(function(){"use strict";try{if(typeof document<"u"){var l=document.createElement("style");l.appendChild(document.createTextNode(':root{--wallet-lib-core_18owxaz0: #D8446E;--wallet-lib-core_18owxaz1: #0050C3;--wallet-lib-core_18owxaz2: #00409C;--wallet-lib-core_18owxaz3: #003889;--wallet-lib-core_18owxaz4: #002861;--wallet-lib-core_18owxaz5: #000814;--wallet-lib-core_18owxaz6: #F2F6FC;--wallet-lib-core_18owxaz7: #FFFFFF;--wallet-lib-core_18owxaz8: #F6F6F6;--wallet-lib-core_18owxaz9: #E7E7E7;--wallet-lib-core_18owxaza: #D1D1D1;--wallet-lib-core_18owxazb: #B0B0B0;--wallet-lib-core_18owxazc: #888888;--wallet-lib-core_18owxazd: #777777;--wallet-lib-core_18owxaze: #5D5D5D;--wallet-lib-core_18owxazf: #343537;--wallet-lib-core_18owxazg: #0A0A0A;--wallet-lib-core_18owxazh: #6D6D6D;--wallet-lib-core_18owxazi: #C80003;--wallet-lib-core_18owxazj: #FEDEDE;--wallet-lib-core_18owxazk: #530001;--wallet-lib-core_18owxazl: #00C87B;--wallet-lib-core_18owxazm: #FFFFFF;--wallet-lib-core_18owxazn: currentcolor;--wallet-lib-core_18owxazo: color-mix(in srgb, currentcolor 10%, transparent);--wallet-lib-core_18owxazp: color-mix(in srgb, currentcolor 50%, transparent);--wallet-lib-core_18owxazq: rgba(48, 49, 48, .42);--wallet-lib-core_18owxazr: 16px;--wallet-lib-core_18owxazs: 12px;--wallet-lib-core_18owxazt: 16px;--wallet-lib-core_18owxazu: 14px;--wallet-lib-core_18owxazv: 10px;--wallet-lib-core_18owxazw: 12px;--wallet-lib-core_18owxazx: 4px;--wallet-lib-core_18owxazy: 6px;--wallet-lib-core_18owxazz: 8px;--wallet-lib-core_18owxaz10: 12px;--wallet-lib-core_18owxaz11: 16px;--wallet-lib-core_18owxaz12: 18px;--wallet-lib-core_18owxaz13: 24px;--wallet-lib-core_18owxaz14: 32px;--wallet-lib-core_18owxaz15: unset;--wallet-lib-core_18owxaz16: -apple-system, system-ui, BlinkMacSystemFont, "Segoe UI", Roboto, sans-serif !important;--wallet-lib-core_18owxaz17: 400;--wallet-lib-core_18owxaz18: 500;--wallet-lib-core_18owxaz19: 700;--wallet-lib-core_18owxaz1a: 600;--wallet-lib-core_18owxaz1b: 340px;--wallet-lib-core_18owxaz1c: 190px}.wallet-lib-core_18owxaz1d{font-size:var(--wallet-lib-core_18owxazs);line-height:var(--wallet-lib-core_18owxazt)}.wallet-lib-core_18owxaz1e{color:var(--wallet-lib-core_18owxaze)}.wallet-lib-core_19vhn320{display:flex;flex-direction:column}.wallet-lib-core_19vhn321{display:flex;flex-direction:row}.wallet-lib-core_19vhn322{display:flex;flex-direction:row;width:100%}.wallet-lib-core_19vhn323{gap:var(--wallet-lib-core_18owxazy)}.wallet-lib-core_1q2fgur0{padding:var(--wallet-lib-core_18owxazx)}.wallet-lib-core_1q2fgur1{padding:var(--wallet-lib-core_18owxazy)}.wallet-lib-core_1q2fgur2{padding:var(--wallet-lib-core_18owxaz12)}.wallet-lib-core_1q2fgur3{padding:var(--wallet-lib-core_18owxazz)}.wallet-lib-core_1q2fgur4{padding:var(--wallet-lib-core_18owxaz10)}.wallet-lib-core_1q2fgur5{padding:var(--wallet-lib-core_18owxaz11)}.wallet-lib-core_1q2fgur6{padding:var(--wallet-lib-core_18owxaz13)}.wallet-lib-core_1q2fgur7{padding:var(--wallet-lib-core_18owxaz14)}.wallet-lib-core_1q2fgur8{padding-top:var(--wallet-lib-core_18owxazx)}.wallet-lib-core_1q2fgur9{padding-top:var(--wallet-lib-core_18owxazy)}.wallet-lib-core_1q2fgura{padding-top:var(--wallet-lib-core_18owxaz12)}.wallet-lib-core_1q2fgurb{padding-top:var(--wallet-lib-core_18owxazz)}.wallet-lib-core_1q2fgurc{padding-top:var(--wallet-lib-core_18owxaz10)}.wallet-lib-core_1q2fgurd{padding-top:var(--wallet-lib-core_18owxaz11)}.wallet-lib-core_1q2fgure{padding-top:var(--wallet-lib-core_18owxaz13)}.wallet-lib-core_1q2fgurf{padding-top:var(--wallet-lib-core_18owxaz14)}.wallet-lib-core_1q2fgurg{padding-right:var(--wallet-lib-core_18owxazx)}.wallet-lib-core_1q2fgurh{padding-right:var(--wallet-lib-core_18owxazy)}.wallet-lib-core_1q2fguri{padding-right:var(--wallet-lib-core_18owxaz12)}.wallet-lib-core_1q2fgurj{padding-right:var(--wallet-lib-core_18owxazz)}.wallet-lib-core_1q2fgurk{padding-right:var(--wallet-lib-core_18owxaz10)}.wallet-lib-core_1q2fgurl{padding-right:var(--wallet-lib-core_18owxaz11)}.wallet-lib-core_1q2fgurm{padding-right:var(--wallet-lib-core_18owxaz13)}.wallet-lib-core_1q2fgurn{padding-right:var(--wallet-lib-core_18owxaz14)}.wallet-lib-core_1q2fguro{padding-top:var(--wallet-lib-core_18owxazx);padding-bottom:var(--wallet-lib-core_18owxazx)}.wallet-lib-core_1q2fgurp{padding-top:var(--wallet-lib-core_18owxazy);padding-bottom:var(--wallet-lib-core_18owxazy)}.wallet-lib-core_1q2fgurq{padding-top:var(--wallet-lib-core_18owxaz12);padding-bottom:var(--wallet-lib-core_18owxaz12)}.wallet-lib-core_1q2fgurr{padding-top:var(--wallet-lib-core_18owxazz);padding-bottom:var(--wallet-lib-core_18owxazz)}.wallet-lib-core_1q2fgurs{padding-top:var(--wallet-lib-core_18owxaz10);padding-bottom:var(--wallet-lib-core_18owxaz10)}.wallet-lib-core_1q2fgurt{padding-top:var(--wallet-lib-core_18owxaz11);padding-bottom:var(--wallet-lib-core_18owxaz11)}.wallet-lib-core_1q2fguru{padding-top:var(--wallet-lib-core_18owxaz13);padding-bottom:var(--wallet-lib-core_18owxaz13)}.wallet-lib-core_1q2fgurv{padding-top:var(--wallet-lib-core_18owxaz14);padding-bottom:var(--wallet-lib-core_18owxaz14)}.wallet-lib-core_1q2fgurw{padding-left:var(--wallet-lib-core_18owxazx);padding-right:var(--wallet-lib-core_18owxazx)}.wallet-lib-core_1q2fgurx{padding-left:var(--wallet-lib-core_18owxazy);padding-right:var(--wallet-lib-core_18owxazy)}.wallet-lib-core_1q2fgury{padding-left:var(--wallet-lib-core_18owxaz12);padding-right:var(--wallet-lib-core_18owxaz12)}.wallet-lib-core_1q2fgurz{padding-left:var(--wallet-lib-core_18owxazz);padding-right:var(--wallet-lib-core_18owxazz)}.wallet-lib-core_1q2fgur10{padding-left:var(--wallet-lib-core_18owxaz10);padding-right:var(--wallet-lib-core_18owxaz10)}.wallet-lib-core_1q2fgur11{padding-left:var(--wallet-lib-core_18owxaz11);padding-right:var(--wallet-lib-core_18owxaz11)}.wallet-lib-core_1q2fgur12{padding-left:var(--wallet-lib-core_18owxaz13);padding-right:var(--wallet-lib-core_18owxaz13)}.wallet-lib-core_1q2fgur13{padding-left:var(--wallet-lib-core_18owxaz14);padding-right:var(--wallet-lib-core_18owxaz14)}.wallet-lib-core_1q2fgur14{padding-bottom:var(--wallet-lib-core_18owxazx)}.wallet-lib-core_1q2fgur15{padding-bottom:var(--wallet-lib-core_18owxazy)}.wallet-lib-core_1q2fgur16{padding-bottom:var(--wallet-lib-core_18owxaz12)}.wallet-lib-core_1q2fgur17{padding-bottom:var(--wallet-lib-core_18owxazz)}.wallet-lib-core_1q2fgur18{padding-bottom:var(--wallet-lib-core_18owxaz10)}.wallet-lib-core_1q2fgur19{padding-bottom:var(--wallet-lib-core_18owxaz11)}.wallet-lib-core_1q2fgur1a{padding-bottom:var(--wallet-lib-core_18owxaz13)}.wallet-lib-core_1q2fgur1b{padding-bottom:var(--wallet-lib-core_18owxaz14)}.wallet-lib-core_t8w95s1{color:var(--wallet-lib-core_t8w95s0)}.wallet-lib-core_t8w95s2{display:flex;justify-content:flex-start;align-items:flex-end;gap:2px}.wallet-lib-core_9s6q6o0{font-family:var(--wallet-lib-core_18owxaz15)}.wallet-lib-core_9s6q6o1{font-family:var(--wallet-lib-core_18owxaz16)}.wallet-lib-core_9s6q6o2{font-size:var(--wallet-lib-core_18owxazu);font-weight:700;color:var(--wallet-lib-core_18owxazg)}.wallet-lib-core_9s6q6o3{font-size:var(--wallet-lib-core_18owxazr);font-weight:700}.wallet-lib-core_9s6q6o4{font-size:var(--wallet-lib-core_18owxazu);font-weight:500;color:var(--wallet-lib-core_18owxazf)}.wallet-lib-core_9s6q6o5{font-size:var(--wallet-lib-core_18owxazu);font-weight:500;color:var(--wallet-lib-core_18owxaz5)}.wallet-lib-core_9s6q6o6{font-size:var(--wallet-lib-core_18owxazs);line-height:var(--wallet-lib-core_18owxazt);font-weight:500;color:var(--wallet-lib-core_18owxazf)}.wallet-lib-core_9s6q6o7{color:var(--wallet-lib-core_18owxaz5);font-size:var(--wallet-lib-core_18owxazs);line-height:var(--wallet-lib-core_18owxazt)}.wallet-lib-core_9s6q6o8{font-size:var(--wallet-lib-core_18owxazs);line-height:var(--wallet-lib-core_18owxazt)}.wallet-lib-core_9s6q6o9{color:var(--wallet-lib-core_18owxazn)}.wallet-lib-core_9s6q6oa{font-weight:700;color:var(--wallet-lib-core_18owxazg)}.wallet-lib-core_9s6q6ob{font-size:var(--wallet-lib-core_18owxazs);line-height:var(--wallet-lib-core_18owxazt);color:var(--wallet-lib-core_18owxazf);opacity:.72}.wallet-lib-core_9s6q6oc{font-size:var(--wallet-lib-core_18owxazs);line-height:var(--wallet-lib-core_18owxazt);color:var(--wallet-lib-core_18owxaz1);font-weight:700}.wallet-lib-core_9s6q6od{font-size:var(--wallet-lib-core_18owxazu);color:var(--wallet-lib-core_18owxaz1)}.wallet-lib-core_9s6q6oe{font-size:var(--wallet-lib-core_18owxazs);line-height:var(--wallet-lib-core_18owxazt);color:var(--wallet-lib-core_18owxaze)}.wallet-lib-core_9s6q6of{width:100%}.wallet-lib-core_9s6q6og{font-weight:var(--wallet-lib-core_18owxaz17)}.wallet-lib-core_9s6q6oh{font-weight:var(--wallet-lib-core_18owxaz18)}.wallet-lib-core_9s6q6oi{font-weight:var(--wallet-lib-core_18owxaz19)}.wallet-lib-core_9s6q6oj{font-weight:var(--wallet-lib-core_18owxaz1a)}.wallet-lib-core_9s6q6ok{font-size:var(--wallet-lib-core_18owxazs);line-height:var(--wallet-lib-core_18owxazt)}.wallet-lib-core_9s6q6ol{font-size:var(--wallet-lib-core_18owxazu)}.wallet-lib-core_9s6q6om{font-size:var(--wallet-lib-core_18owxazv);line-height:var(--wallet-lib-core_18owxazw)}.wallet-lib-core_9s6q6on{font-size:var(--wallet-lib-core_18owxazr)}.wallet-lib-core_9s6q6oo{text-overflow:ellipsis;overflow:hidden}.wallet-lib-core_9s6q6op{text-decoration:underline}.wallet-lib-core_9s6q6oq{text-align:center}.wallet-lib-core_p0efj50{border-top:.25px solid var(--wallet-lib-core_18owxaza);width:100%}.wallet-lib-core_p0efj51{border-top:1px solid var(--wallet-lib-core_18owxazo);width:100%}.wallet-lib-core_dkrzo20{width:auto}.wallet-lib-core_dkrzo21{fill:#fff}.wallet-lib-core_dkrzo22{fill:var(--wallet-lib-core_18owxaz1)}.wallet-lib-core_dkrzo23{min-width:unset}.wallet-lib-core_dkrzo24{min-width:20px}.wallet-lib-core_dkrzo25{min-width:unset}.wallet-lib-core_dkrzo26{max-width:unset}.wallet-lib-core_dkrzo27{max-width:36px}.wallet-lib-core_dkrzo28{max-width:unset}@keyframes wallet-lib-core_y8sstu0{0%{transform:rotate(0)}to{transform:rotate(360deg)}}.wallet-lib-core_y8sstu1{position:absolute;display:inline-block;width:16px;height:16px;border:3px solid var(--wallet-lib-core_18owxaz7);border-bottom-color:transparent;border-radius:50%;box-sizing:border-box;animation:wallet-lib-core_y8sstu0 1s linear infinite}.wallet-lib-core_1hgah2t0{display:flex;position:relative;justify-content:center;align-items:center;cursor:pointer;transition:background .35s cubic-bezier(.19,1,.22,1)}.wallet-lib-core_1hgah2t0:hover,.wallet-lib-core_1hgah2t0:focus{filter:brightness(90%)}.wallet-lib-core_1hgah2t0:active{filter:brightness(85%)}.wallet-lib-core_1hgah2t1{background:none;padding:5px 0;font-weight:400;min-height:auto;text-decoration:underline;text-transform:none}.wallet-lib-core_1hgah2t2{font-family:var(--wallet-lib-core_18owxaz16);font-size:14px;color:var(--wallet-lib-core_18owxaz7)!important;background-color:var(--wallet-lib-core_18owxaz1)!important}.wallet-lib-core_1hgah2t2:hover,.wallet-lib-core_1hgah2t2:focus{background-color:var(--wallet-lib-core_18owxaz2)!important;border-color:var(--wallet-lib-core_18owxaz2)!important;background-image:none!important}.wallet-lib-core_1hgah2t2:active{background-color:var(--wallet-lib-core_18owxaz3)!important;border-color:var(--wallet-lib-core_18owxaz3)!important;background-image:none!important}.wallet-lib-core_1hgah2t3{padding:8px 24px;border-radius:6px}.wallet-lib-core_1hgah2t4{font-weight:400!important;border-color:var(--wallet-lib-core_18owxaz1)!important;box-shadow:none!important;letter-spacing:normal!important;height:43px;background-image:none!important}.wallet-lib-core_1hgah2t6{padding:8px 16px;border:1px solid var(--wallet-lib-core_18owxazb);background:#fff;border-radius:8px}.wallet-lib-core_1hgah2t7{padding:20px;margin:-20px}.wallet-lib-core_1hgah2t8{cursor:pointer}.wallet-lib-core_1hgah2t9{padding:var(--wallet-lib-core_18owxaz12)}.wallet-lib-core_1hgah2ta{opacity:0}.wallet-lib-core_1hgah2tb{color:var(--wallet-lib-core_18owxaz1)}.wallet-lib-core_1hgah2tc{color:var(--wallet-lib-core_18owxaz1);text-decoration:none}.wallet-lib-core_1hgah2td{color:var(--wallet-lib-core_18owxazc);font-size:12px}.wallet-lib-core_1hgah2te{padding:0;background:none;border:none;color:inherit;margin:0;display:inline;cursor:pointer}.wallet-lib-core_1hgah2t4 span{text-transform:none!important;font-size:14px}.wallet-lib-core_1hgah2t4 .spinner-elem{background-color:var(--wallet-lib-core_18owxazn)!important}.wallet-lib-core_1hgah2tf,.wallet-lib-core_1hgah2tg{width:100%}.wallet-lib-core_1hgah2th{border-radius:8px}.wallet-lib-core_1hgah2ti{opacity:.7;cursor:not-allowed}@media screen and (min-width: 768px){.wallet-lib-core_1hgah2tg{width:fit-content}}.wallet-lib-core_18daksv0{background:var(--wallet-lib-core_18owxazm);color:var(--wallet-lib-core_18owxazg);font-family:var(--wallet-lib-core_18owxaz16)}[data-rsbs-overlay]{border-top-right-radius:var(--wallet-lib-core_18owxaz11);border-top-left-radius:var(--wallet-lib-core_18owxaz11)}.wallet-lib-core_18daksv0 [data-rsbs-header]:before{display:none}[data-rsbs-header]{padding:0!important}[data-rsbs-overlay],[data-rsbs-backdrop],[data-rsbs-root]:after{z-index:9999!important}[data-rsbs-backdrop]{background-color:var(--wallet-lib-core_18owxazq)!important}.wallet-lib-core_1oeujdp0{display:flex!important;justify-content:center;padding:0;opacity:1;height:100vh!important}.wallet-lib-core_1oeujdp1{margin-top:var(--wallet-lib-core_18owxazz)}.wallet-lib-core_1oeujdp2{display:flex;flex-wrap:nowrap;justify-content:center;margin:0 auto;max-width:350px;gap:6px}#successPageOtpInput .wallet-lib-core_1oeujdp2{max-width:315px}.wallet-lib-core_1oeujdp3{border-radius:5px;margin:14px auto 0;max-width:350px}.wallet-lib-core_1oeujdp4{background:var(--wallet-lib-core_18owxazi);color:var(--wallet-lib-core_18owxazm);border-radius:5px;padding:7px 0;font-size:var(--wallet-lib-core_18owxazs);line-height:var(--wallet-lib-core_18owxazt);display:inline-flex;justify-content:center;width:100%}.wallet-lib-core_1oeujdp5{height:40px!important;width:40px!important}.wallet-lib-core_1oeujdp6{color:var(--wallet-lib-core_18owxazf)!important;margin-top:8px;font-size:var(--wallet-lib-core_18owxazr);font-weight:500}.wallet-lib-core_1oeujdp7{font-size:var(--wallet-lib-core_18owxazs);line-height:var(--wallet-lib-core_18owxazt);color:var(--wallet-lib-core_18owxazn);letter-spacing:-.1px}.wallet-lib-core_1oeujdp8{line-height:14px}.wallet-lib-core_1oeujdp9{display:inline-block;margin:0;color:var(--wallet-lib-core_18owxazn);text-decoration-color:var(--wallet-lib-core_18owxazn);text-decoration:underline;cursor:pointer;background:none;border:none;padding:0;font-size:var(--wallet-lib-core_18owxazs);line-height:var(--wallet-lib-core_18owxazt)}#modalAppWallet .wallet-lib-core_1oeujdp9,#bottomSheetAppWallet .wallet-lib-core_1oeujdp9{text-decoration:none;color:var(--wallet-lib-core_18owxaz1)}#successPageOtpInput .wallet-lib-core_1oeujdp9{margin-left:0}.wallet-lib-core_1oeujdpa{color:var(--wallet-lib-core_18owxaze)!important}.wallet-lib-core_1oeujdpb{color:var(--wallet-lib-core_18owxaz1)!important}.wallet-lib-core_1oeujdpc{font-size:var(--wallet-lib-core_18owxazs);line-height:var(--wallet-lib-core_18owxazt);color:var(--wallet-lib-core_18owxazn)!important}.wallet-lib-core_1oeujdpd{display:flex!important}.wallet-lib-core_1oeujdpe{display:flex;flex-grow:1;align-items:center;margin:0;font-size:var(--wallet-lib-core_18owxazs);line-height:1.5}.wallet-lib-core_1oeujdpf{width:calc(96% - 44px);font-weight:400}.wallet-lib-core_1oeujdpg{width:calc(96% - 60px);font-weight:400}.wallet-lib-core_1oeujdph{overflow:hidden;text-overflow:ellipsis}.wallet-lib-core_1oeujdpi{font-weight:500;color:var(--wallet-lib-core_18owxazf)}.wallet-lib-core_1oeujdpj{min-height:20px;width:100%}.wallet-lib-core_1oeujdpk{width:100%;display:flex;flex-wrap:nowrap;align-items:center;justify-content:center}#successPageOtpInput .wallet-lib-core_1oeujdpk{justify-content:flex-start}.wallet-lib-core_1oeujdpl{display:flex;justify-content:center;min-height:20px;gap:5px;align-items:center;white-space:nowrap;background:none;border:none}.wallet-lib-core_1oeujdpm{display:block;font-size:var(--wallet-lib-core_18owxazs);line-height:var(--wallet-lib-core_18owxazt);color:var(--wallet-lib-core_18owxazn)!important;text-align:center;min-height:20px;width:100%}#successPageOtpInput .wallet-lib-core_1oeujdpm{text-align:left}.wallet-lib-core_1oeujdpn{align-items:flex-start;margin-right:10px;width:24px;height:24px;border:.25px solid var(--wallet-lib-core_18owxazb);background-color:var(--wallet-lib-core_18owxaz8);fill:var(--wallet-lib-core_18owxazf);color:var(--wallet-lib-core_18owxaz7);display:flex;place-items:center;border-radius:50%;flex-grow:0;font-size:18px;font-weight:700;padding:5px;gap:8px;text-transform:uppercase}.wallet-lib-core_1oeujdpo{position:relative;display:flex;justify-content:space-between;align-items:center;fill:var(--wallet-lib-core_18owxaze);color:var(--wallet-lib-core_18owxaze);font-size:11px}.wallet-lib-core_1oeujdpo .wallet-logo{height:13px;width:auto}.wallet-lib-core_1oeujdpp{display:block;margin-top:25px;font-family:Open Sans,sans-serif!important;font-size:10px;opacity:.5;color:var(--wallet-lib-core_18owxazf)}.wallet-lib-core_1oeujdpq{width:100%}.wallet-lib-core_1oeujdpr{display:none;flex-direction:column;justify-content:center;width:100%}.wallet-lib-core_1oeujdps{font-size:var(--wallet-lib-core_18owxazs);line-height:var(--wallet-lib-core_18owxazt);width:100%;color:var(--wallet-lib-core_18owxaz1);font-weight:var(--wallet-lib-core_18owxaz18);padding-top:var(--wallet-lib-core_18owxaz11);align-items:center;justify-content:center}.wallet-lib-core_1oeujdpp>a{text-decoration:underline;color:var(--wallet-lib-core_18owxazf)}.wallet-lib-core_1oeujdpt{color:var(--wallet-lib-core_18owxaze);letter-spacing:-.1px;font-size:var(--wallet-lib-core_18owxazs);line-height:14px;font-weight:400;margin-bottom:0}@media screen and (min-width: 768px){#successPageOtpInput .wallet-lib-core_1oeujdp2{max-width:unset;gap:4px}}@media screen and (max-width: 576px){.wallet-lib-core_1oeujdp9{width:auto}}.wallet-lib-core_j0outm0{border-radius:6px;border-color:var(--wallet-lib-core_18owxaz9)}.wallet-lib-core_j0outm0:focus{border-color:var(--wallet-lib-core_18owxaz1)}.wallet-lib-core_j0outm1{text-align:center;font-weight:700;font-size:16px;border:1px solid var(--wallet-lib-core_18owxaza);border-radius:8px;outline:none}.wallet-lib-core_j0outm2{display:flex;width:100%;height:100%;justify-content:space-evenly;position:absolute;top:50%;left:50%;transform:translate(-50%,-50%);background-color:#fff!important}.wallet-lib-core_rf6xsr1{margin-top:var(--wallet-lib-core_rf6xsr0)}@media screen and (max-width: 576px){.wallet-lib-core_rf6xsr2{margin-top:var(--wallet-lib-core_rf6xsr0)}}.wallet-lib-core_mttnyu0{display:flex;justify-content:center;align-items:center;height:100%;padding:4px;background:var(--wallet-lib-core_18owxaz8);border-radius:100%}.wallet-lib-core_mttnyu1{padding:var(--wallet-lib-core_18owxazx)}.wallet-lib-core_mttnyu2{padding:var(--wallet-lib-core_18owxazz)}.wallet-lib-core_mttnyu3{border:1px solid var(--wallet-lib-core_18owxaz9)}@keyframes wallet-lib-core_9ciqhz0{0%{opacity:0}to{opacity:1}}@keyframes wallet-lib-core_9ciqhz1{0%{transform:translate(0) scaleX(0)}40%{transform:translate(0) scaleX(.5)}to{transform:translate(100%) scaleX(.5)}}@keyframes wallet-lib-core_9ciqhz2{0%{transform:translateY(-100%);opacity:0}to{transform:translateY(0);opacity:1}}@keyframes wallet-lib-core_9ciqhz3{0%{transform:translateY(0);opacity:1}to{transform:translateY(-100%);opacity:0}}.wallet-lib-core_9ciqhz4{animation:wallet-lib-core_9ciqhz0 .5s}.wallet-lib-core_9ciqhz5{animation:wallet-lib-core_9ciqhz0 .3s}.wallet-lib-core_9ciqhz6{animation:wallet-lib-core_9ciqhz1 1.5s infinite linear}.wallet-lib-core_9ciqhz7{animation:wallet-lib-core_9ciqhz2 .5s ease-in-out}.wallet-lib-core_9ciqhz8{animation:wallet-lib-core_9ciqhz3 .5s ease-in-out}.wallet-lib-core_1l8sk3p0{background-color:var(--wallet-lib-core_18owxazq);height:100%;position:fixed;width:100%;z-index:22;top:0;left:0}.wallet-lib-core_1l8sk3p1{height:100%}.wallet-lib-core_1l8sk3p2{height:190px}.wallet-lib-core_1l8sk3p3{background:linear-gradient(#0003,90%,#0000)}.wallet-lib-core_17qc9kw0{bottom:0;left:0;overflow-x:hidden;overflow-y:auto;position:fixed;right:0;top:0;z-index:9999}.wallet-lib-core_17qc9kw1{display:flex;justify-content:center;align-items:center;height:100%;width:100%;padding:0;font-family:var(--wallet-lib-core_18owxaz16)}.wallet-lib-core_17qc9kw2{width:100%;height:100%}.wallet-lib-core_17qc9kw2:focus{outline:none!important}.wallet-lib-core_17qc9kw2:focus-within{outline:none!important}.wallet-lib-core_17qc9kw3{width:var(--wallet-lib-core_18owxaz1b);max-height:var(--wallet-lib-core_18owxaz1c);padding:12px}.wallet-lib-core_17qc9kw4{width:var(--wallet-lib-core_18owxaz1b);padding:12px}.wallet-lib-core_17qc9kw5{background-color:var(--wallet-lib-core_18owxazm)!important;color:var(--wallet-lib-core_18owxazg);border-radius:5px;box-shadow:0 9px 9px #0000001a;position:relative;z-index:999}.wallet-lib-core_17qc9kw5 a{color:var(--wallet-lib-core_18owxaz1)}.wallet-lib-core_17qc9kw5 *{font-family:var(--wallet-lib-core_18owxaz16);text-transform:none}[data-rsbs-overlay]{border-top-left-radius:16px;border-top-left-radius:var(--rsbs-overlay-rounded,16px);border-top-right-radius:16px;border-top-right-radius:var(--rsbs-overlay-rounded,16px);display:flex;background:#fff;background:var(--rsbs-bg,#fff);flex-direction:column;height:0px;height:var(--rsbs-overlay-h,0px);transform:translateZ(0);transform:translate3d(0,var(--rsbs-overlay-translate-y,0px),0);will-change:height}[data-rsbs-overlay]:focus{outline:none}[data-rsbs-is-blocking=false] [data-rsbs-overlay]{box-shadow:0 -5px 60px #2659731c,0 -1px #2659730d}[data-rsbs-overlay],[data-rsbs-root]:after{max-width:auto;max-width:var(--rsbs-max-w,auto);margin-left:env(safe-area-inset-left);margin-left:var(--rsbs-ml,env(safe-area-inset-left));margin-right:env(safe-area-inset-right);margin-right:var(--rsbs-mr,env(safe-area-inset-right))}[data-rsbs-overlay],[data-rsbs-backdrop],[data-rsbs-root]:after{z-index:3;-ms-scroll-chaining:none;overscroll-behavior:none;touch-action:none;position:fixed;right:0;bottom:0;left:0;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;-webkit-tap-highlight-color:transparent;-webkit-touch-callout:none}[data-rsbs-backdrop]{top:-60px;bottom:-60px;background-color:#0009;background-color:var(--rsbs-backdrop-bg,rgba(0, 0, 0, .6));will-change:opacity;cursor:pointer;opacity:1}[data-rsbs-is-dismissable=false] [data-rsbs-backdrop]{cursor:ns-resize}[data-rsbs-root]:after{content:"";pointer-events:none;background:#fff;background:var(--rsbs-bg,#fff);height:1px;transform-origin:bottom;transform:scale3d(1,0,1);transform:scale3d(1,var(--rsbs-antigap-scale-y,0),1);will-change:transform}[data-rsbs-footer],[data-rsbs-header]{flex-shrink:0;cursor:ns-resize;padding:16px}[data-rsbs-header]{text-align:center;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;box-shadow:0 1px #2e3b4220;box-shadow:0 1px rgba(46,59,66,calc(var(--rsbs-content-opacity,1) * .125));z-index:1;padding-top:calc(20px + env(safe-area-inset-top));padding-bottom:8px}[data-rsbs-header]:before{position:absolute;content:"";display:block;width:36px;height:4px;top:calc(8px + env(safe-area-inset-top));left:50%;transform:translate(-50%);border-radius:2px;background-color:#00000024;background-color:var(--rsbs-handle-bg,hsla(0, 0%, 0%, .14))}@media (-webkit-min-device-pixel-ratio: 2),(min-resolution: 2dppx){[data-rsbs-header]:before{transform:translate(-50%) scaleY(.75)}}[data-rsbs-has-header=false] [data-rsbs-header]{box-shadow:none;padding-top:calc(12px + env(safe-area-inset-top))}[data-rsbs-scroll]{flex-shrink:1;flex-grow:1;-webkit-tap-highlight-color:revert;-webkit-touch-callout:revert;-webkit-user-select:auto;-ms-user-select:auto;-moz-user-select:auto;user-select:auto;overflow:auto;-ms-scroll-chaining:none;overscroll-behavior:contain;-webkit-overflow-scrolling:touch}[data-rsbs-scroll]:focus{outline:none}[data-rsbs-has-footer=false] [data-rsbs-content]{padding-bottom:env(safe-area-inset-bottom)}[data-rsbs-content]{overflow:hidden}[data-rsbs-footer]{box-shadow:0 -1px #2e3b4220,0 2px #fff;box-shadow:0 -1px rgba(46,59,66,calc(var(--rsbs-content-opacity,1) * .125)),0 2px 0 var(--rsbs-bg,#fff);overflow:hidden;z-index:1;padding-bottom:calc(16px + env(safe-area-inset-bottom))}[data-rsbs-is-dismissable=true] [data-rsbs-header]>*,[data-rsbs-is-dismissable=true] [data-rsbs-scroll]>*,[data-rsbs-is-dismissable=true] [data-rsbs-footer]>*,[data-rsbs-is-dismissable=false][data-rsbs-state=opening] [data-rsbs-header]>*,[data-rsbs-is-dismissable=false][data-rsbs-state=closing] [data-rsbs-header]>*,[data-rsbs-is-dismissable=false][data-rsbs-state=opening] [data-rsbs-scroll]>*,[data-rsbs-is-dismissable=false][data-rsbs-state=closing] [data-rsbs-scroll]>*,[data-rsbs-is-dismissable=false][data-rsbs-state=opening] [data-rsbs-footer]>*,[data-rsbs-is-dismissable=false][data-rsbs-state=closing] [data-rsbs-footer]>*{opacity:1;opacity:var(--rsbs-content-opacity,1)}[data-rsbs-is-dismissable=true] [data-rsbs-backdrop],[data-rsbs-is-dismissable=false][data-rsbs-state=opening] [data-rsbs-backdrop],[data-rsbs-is-dismissable=false][data-rsbs-state=closing] [data-rsbs-backdrop]{opacity:1;opacity:var(--rsbs-backdrop-opacity,1)}[data-rsbs-state=closed],[data-rsbs-state=closing]{pointer-events:none}')),document.head.appendChild(l)}}catch(e){console.error("vite-plugin-css-injected-by-js",e)}})();
var ZP = Object.defineProperty;
var XP = (mo, fe, Fn) => fe in mo ? ZP(mo, fe, { enumerable: !0, configurable: !0, writable: !0, value: Fn }) : mo[fe] = Fn;
var PE = (mo, fe, Fn) => (XP(mo, typeof fe != "symbol" ? fe + "" : fe, Fn), Fn);
var JP = {};
(function(mo) {
  const fe = (t) => typeof t == "string", Fn = () => {
    let t, e;
    const n = new Promise((i, s) => {
      t = i, e = s;
    });
    return n.resolve = t, n.reject = e, n;
  }, Im = (t) => t == null ? "" : "" + t, UE = (t, e, n) => {
    t.forEach((i) => {
      e[i] && (n[i] = e[i]);
    });
  }, $E = /###/g, Nm = (t) => t && t.indexOf("###") > -1 ? t.replace($E, ".") : t, Dm = (t) => !t || fe(t), xs = (t, e, n) => {
    const i = fe(e) ? e.split(".") : e;
    let s = 0;
    for (; s < i.length - 1; ) {
      if (Dm(t))
        return {};
      const a = Nm(i[s]);
      !t[a] && n && (t[a] = new n()), Object.prototype.hasOwnProperty.call(t, a) ? t = t[a] : t = {}, ++s;
    }
    return Dm(t) ? {} : {
      obj: t,
      k: Nm(i[s])
    };
  }, jm = (t, e, n) => {
    const {
      obj: i,
      k: s
    } = xs(t, e, Object);
    if (i !== void 0 || e.length === 1) {
      i[s] = n;
      return;
    }
    let a = e[e.length - 1], u = e.slice(0, e.length - 1), d = xs(t, u, Object);
    for (; d.obj === void 0 && u.length; )
      a = `${u[u.length - 1]}.${a}`, u = u.slice(0, u.length - 1), d = xs(t, u, Object), d != null && d.obj && typeof d.obj[`${d.k}.${a}`] < "u" && (d.obj = void 0);
    d.obj[`${d.k}.${a}`] = n;
  }, zE = (t, e, n, i) => {
    const {
      obj: s,
      k: a
    } = xs(t, e, Object);
    s[a] = s[a] || [], s[a].push(n);
  }, Qa = (t, e) => {
    const {
      obj: n,
      k: i
    } = xs(t, e);
    if (n && Object.prototype.hasOwnProperty.call(n, i))
      return n[i];
  }, VE = (t, e, n) => {
    const i = Qa(t, n);
    return i !== void 0 ? i : Qa(e, n);
  }, Mm = (t, e, n) => {
    for (const i in e)
      i !== "__proto__" && i !== "constructor" && (i in t ? fe(t[i]) || t[i] instanceof String || fe(e[i]) || e[i] instanceof String ? n && (t[i] = e[i]) : Mm(t[i], e[i], n) : t[i] = e[i]);
    return t;
  }, go = (t) => t.replace(/[\-\[\]\/\{\}\(\)\*\+\?\.\\\^\$\|]/g, "\\$&");
  var WE = {
    "&": "&amp;",
    "<": "&lt;",
    ">": "&gt;",
    '"': "&quot;",
    "'": "&#39;",
    "/": "&#x2F;"
  };
  const GE = (t) => fe(t) ? t.replace(/[&<>"'\/]/g, (e) => WE[e]) : t;
  class qE {
    constructor(e) {
      this.capacity = e, this.regExpMap = /* @__PURE__ */ new Map(), this.regExpQueue = [];
    }
    getRegExp(e) {
      const n = this.regExpMap.get(e);
      if (n !== void 0)
        return n;
      const i = new RegExp(e);
      return this.regExpQueue.length === this.capacity && this.regExpMap.delete(this.regExpQueue.shift()), this.regExpMap.set(e, i), this.regExpQueue.push(e), i;
    }
  }
  const YE = [" ", ",", "?", "!", ";"], KE = new qE(20), ZE = (t, e, n) => {
    e = e || "", n = n || "";
    const i = YE.filter((u) => e.indexOf(u) < 0 && n.indexOf(u) < 0);
    if (i.length === 0)
      return !0;
    const s = KE.getRegExp(`(${i.map((u) => u === "?" ? "\\?" : u).join("|")})`);
    let a = !s.test(t);
    if (!a) {
      const u = t.indexOf(n);
      u > 0 && !s.test(t.substring(0, u)) && (a = !0);
    }
    return a;
  }, ld = function(t, e) {
    let n = arguments.length > 2 && arguments[2] !== void 0 ? arguments[2] : ".";
    if (!t)
      return;
    if (t[e])
      return Object.prototype.hasOwnProperty.call(t, e) ? t[e] : void 0;
    const i = e.split(n);
    let s = t;
    for (let a = 0; a < i.length; ) {
      if (!s || typeof s != "object")
        return;
      let u, d = "";
      for (let f = a; f < i.length; ++f)
        if (f !== a && (d += n), d += i[f], u = s[d], u !== void 0) {
          if (["string", "number", "boolean"].indexOf(typeof u) > -1 && f < i.length - 1)
            continue;
          a += f - a + 1;
          break;
        }
      s = u;
    }
    return s;
  }, el = (t) => t == null ? void 0 : t.replace("_", "-"), XE = {
    type: "logger",
    log(t) {
      this.output("log", t);
    },
    warn(t) {
      this.output("warn", t);
    },
    error(t) {
      this.output("error", t);
    },
    output(t, e) {
      var n, i;
      (i = (n = console == null ? void 0 : console[t]) == null ? void 0 : n.apply) == null || i.call(n, console, e);
    }
  };
  class tl {
    constructor(e) {
      let n = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {};
      this.init(e, n);
    }
    init(e) {
      let n = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {};
      this.prefix = n.prefix || "i18next:", this.logger = e || XE, this.options = n, this.debug = n.debug;
    }
    log() {
      for (var e = arguments.length, n = new Array(e), i = 0; i < e; i++)
        n[i] = arguments[i];
      return this.forward(n, "log", "", !0);
    }
    warn() {
      for (var e = arguments.length, n = new Array(e), i = 0; i < e; i++)
        n[i] = arguments[i];
      return this.forward(n, "warn", "", !0);
    }
    error() {
      for (var e = arguments.length, n = new Array(e), i = 0; i < e; i++)
        n[i] = arguments[i];
      return this.forward(n, "error", "");
    }
    deprecate() {
      for (var e = arguments.length, n = new Array(e), i = 0; i < e; i++)
        n[i] = arguments[i];
      return this.forward(n, "warn", "WARNING DEPRECATED: ", !0);
    }
    forward(e, n, i, s) {
      return s && !this.debug ? null : (fe(e[0]) && (e[0] = `${i}${this.prefix} ${e[0]}`), this.logger[n](e));
    }
    create(e) {
      return new tl(this.logger, {
        prefix: `${this.prefix}:${e}:`,
        ...this.options
      });
    }
    clone(e) {
      return e = e || this.options, e.prefix = e.prefix || this.prefix, new tl(this.logger, e);
    }
  }
  var ir = new tl();
  class nl {
    constructor() {
      this.observers = {};
    }
    on(e, n) {
      return e.split(" ").forEach((i) => {
        this.observers[i] || (this.observers[i] = /* @__PURE__ */ new Map());
        const s = this.observers[i].get(n) || 0;
        this.observers[i].set(n, s + 1);
      }), this;
    }
    off(e, n) {
      if (this.observers[e]) {
        if (!n) {
          delete this.observers[e];
          return;
        }
        this.observers[e].delete(n);
      }
    }
    emit(e) {
      for (var n = arguments.length, i = new Array(n > 1 ? n - 1 : 0), s = 1; s < n; s++)
        i[s - 1] = arguments[s];
      this.observers[e] && Array.from(this.observers[e].entries()).forEach((u) => {
        let [d, f] = u;
        for (let p = 0; p < f; p++)
          d(...i);
      }), this.observers["*"] && Array.from(this.observers["*"].entries()).forEach((u) => {
        let [d, f] = u;
        for (let p = 0; p < f; p++)
          d.apply(d, [e, ...i]);
      });
    }
  }
  class Fm extends nl {
    constructor(e) {
      let n = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {
        ns: ["translation"],
        defaultNS: "translation"
      };
      super(), this.data = e || {}, this.options = n, this.options.keySeparator === void 0 && (this.options.keySeparator = "."), this.options.ignoreJSONStructure === void 0 && (this.options.ignoreJSONStructure = !0);
    }
    addNamespaces(e) {
      this.options.ns.indexOf(e) < 0 && this.options.ns.push(e);
    }
    removeNamespaces(e) {
      const n = this.options.ns.indexOf(e);
      n > -1 && this.options.ns.splice(n, 1);
    }
    getResource(e, n, i) {
      var p, m;
      let s = arguments.length > 3 && arguments[3] !== void 0 ? arguments[3] : {};
      const a = s.keySeparator !== void 0 ? s.keySeparator : this.options.keySeparator, u = s.ignoreJSONStructure !== void 0 ? s.ignoreJSONStructure : this.options.ignoreJSONStructure;
      let d;
      e.indexOf(".") > -1 ? d = e.split(".") : (d = [e, n], i && (Array.isArray(i) ? d.push(...i) : fe(i) && a ? d.push(...i.split(a)) : d.push(i)));
      const f = Qa(this.data, d);
      return !f && !n && !i && e.indexOf(".") > -1 && (e = d[0], n = d[1], i = d.slice(2).join(".")), f || !u || !fe(i) ? f : ld((m = (p = this.data) == null ? void 0 : p[e]) == null ? void 0 : m[n], i, a);
    }
    addResource(e, n, i, s) {
      let a = arguments.length > 4 && arguments[4] !== void 0 ? arguments[4] : {
        silent: !1
      };
      const u = a.keySeparator !== void 0 ? a.keySeparator : this.options.keySeparator;
      let d = [e, n];
      i && (d = d.concat(u ? i.split(u) : i)), e.indexOf(".") > -1 && (d = e.split("."), s = n, n = d[1]), this.addNamespaces(n), jm(this.data, d, s), a.silent || this.emit("added", e, n, i, s);
    }
    addResources(e, n, i) {
      let s = arguments.length > 3 && arguments[3] !== void 0 ? arguments[3] : {
        silent: !1
      };
      for (const a in i)
        (fe(i[a]) || Array.isArray(i[a])) && this.addResource(e, n, a, i[a], {
          silent: !0
        });
      s.silent || this.emit("added", e, n, i);
    }
    addResourceBundle(e, n, i, s, a) {
      let u = arguments.length > 5 && arguments[5] !== void 0 ? arguments[5] : {
        silent: !1,
        skipCopy: !1
      }, d = [e, n];
      e.indexOf(".") > -1 && (d = e.split("."), s = i, i = n, n = d[1]), this.addNamespaces(n);
      let f = Qa(this.data, d) || {};
      u.skipCopy || (i = JSON.parse(JSON.stringify(i))), s ? Mm(f, i, a) : f = {
        ...f,
        ...i
      }, jm(this.data, d, f), u.silent || this.emit("added", e, n, i);
    }
    removeResourceBundle(e, n) {
      this.hasResourceBundle(e, n) && delete this.data[e][n], this.removeNamespaces(n), this.emit("removed", e, n);
    }
    hasResourceBundle(e, n) {
      return this.getResource(e, n) !== void 0;
    }
    getResourceBundle(e, n) {
      return n || (n = this.options.defaultNS), this.getResource(e, n);
    }
    getDataByLanguage(e) {
      return this.data[e];
    }
    hasLanguageSomeTranslations(e) {
      const n = this.getDataByLanguage(e);
      return !!(n && Object.keys(n) || []).find((s) => n[s] && Object.keys(n[s]).length > 0);
    }
    toJSON() {
      return this.data;
    }
  }
  var Hm = {
    processors: {},
    addPostProcessor(t) {
      this.processors[t.name] = t;
    },
    handle(t, e, n, i, s) {
      return t.forEach((a) => {
        var u;
        e = ((u = this.processors[a]) == null ? void 0 : u.process(e, n, i, s)) ?? e;
      }), e;
    }
  };
  const Bm = {}, Um = (t) => !fe(t) && typeof t != "boolean" && typeof t != "number";
  class rl extends nl {
    constructor(e) {
      let n = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {};
      super(), UE(["resourceStore", "languageUtils", "pluralResolver", "interpolator", "backendConnector", "i18nFormat", "utils"], e, this), this.options = n, this.options.keySeparator === void 0 && (this.options.keySeparator = "."), this.logger = ir.create("translator");
    }
    changeLanguage(e) {
      e && (this.language = e);
    }
    exists(e) {
      let n = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {
        interpolation: {}
      };
      if (e == null)
        return !1;
      const i = this.resolve(e, n);
      return (i == null ? void 0 : i.res) !== void 0;
    }
    extractFromKey(e, n) {
      let i = n.nsSeparator !== void 0 ? n.nsSeparator : this.options.nsSeparator;
      i === void 0 && (i = ":");
      const s = n.keySeparator !== void 0 ? n.keySeparator : this.options.keySeparator;
      let a = n.ns || this.options.defaultNS || [];
      const u = i && e.indexOf(i) > -1, d = !this.options.userDefinedKeySeparator && !n.keySeparator && !this.options.userDefinedNsSeparator && !n.nsSeparator && !ZE(e, i, s);
      if (u && !d) {
        const f = e.match(this.interpolator.nestingRegexp);
        if (f && f.length > 0)
          return {
            key: e,
            namespaces: fe(a) ? [a] : a
          };
        const p = e.split(i);
        (i !== s || i === s && this.options.ns.indexOf(p[0]) > -1) && (a = p.shift()), e = p.join(s);
      }
      return {
        key: e,
        namespaces: fe(a) ? [a] : a
      };
    }
    translate(e, n, i) {
      if (typeof n != "object" && this.options.overloadTranslationOptionHandler && (n = this.options.overloadTranslationOptionHandler(arguments)), typeof n == "object" && (n = {
        ...n
      }), n || (n = {}), e == null)
        return "";
      Array.isArray(e) || (e = [String(e)]);
      const s = n.returnDetails !== void 0 ? n.returnDetails : this.options.returnDetails, a = n.keySeparator !== void 0 ? n.keySeparator : this.options.keySeparator, {
        key: u,
        namespaces: d
      } = this.extractFromKey(e[e.length - 1], n), f = d[d.length - 1], p = n.lng || this.language, m = n.appendNamespaceToCIMode || this.options.appendNamespaceToCIMode;
      if ((p == null ? void 0 : p.toLowerCase()) === "cimode") {
        if (m) {
          const W = n.nsSeparator || this.options.nsSeparator;
          return s ? {
            res: `${f}${W}${u}`,
            usedKey: u,
            exactUsedKey: u,
            usedLng: p,
            usedNS: f,
            usedParams: this.getUsedParamsDetails(n)
          } : `${f}${W}${u}`;
        }
        return s ? {
          res: u,
          usedKey: u,
          exactUsedKey: u,
          usedLng: p,
          usedNS: f,
          usedParams: this.getUsedParamsDetails(n)
        } : u;
      }
      const v = this.resolve(e, n);
      let y = v == null ? void 0 : v.res;
      const E = (v == null ? void 0 : v.usedKey) || u, S = (v == null ? void 0 : v.exactUsedKey) || u, x = ["[object Number]", "[object Function]", "[object RegExp]"], C = n.joinArrays !== void 0 ? n.joinArrays : this.options.joinArrays, L = !this.i18nFormat || this.i18nFormat.handleAsObject, k = n.count !== void 0 && !fe(n.count), I = rl.hasDefaultValue(n), B = k ? this.pluralResolver.getSuffix(p, n.count, n) : "", V = n.ordinal && k ? this.pluralResolver.getSuffix(p, n.count, {
        ordinal: !1
      }) : "", P = k && !n.ordinal && n.count === 0, R = P && n[`defaultValue${this.options.pluralSeparator}zero`] || n[`defaultValue${B}`] || n[`defaultValue${V}`] || n.defaultValue;
      let j = y;
      L && !y && I && (j = R);
      const G = Um(j), ee = Object.prototype.toString.apply(j);
      if (L && j && G && x.indexOf(ee) < 0 && !(fe(C) && Array.isArray(j))) {
        if (!n.returnObjects && !this.options.returnObjects) {
          this.options.returnedObjectHandler || this.logger.warn("accessing an object - but returnObjects options is not enabled!");
          const W = this.options.returnedObjectHandler ? this.options.returnedObjectHandler(E, j, {
            ...n,
            ns: d
          }) : `key '${u} (${this.language})' returned an object instead of string.`;
          return s ? (v.res = W, v.usedParams = this.getUsedParamsDetails(n), v) : W;
        }
        if (a) {
          const W = Array.isArray(j), re = W ? [] : {}, we = W ? S : E;
          for (const ye in j)
            if (Object.prototype.hasOwnProperty.call(j, ye)) {
              const be = `${we}${a}${ye}`;
              I && !y ? re[ye] = this.translate(be, {
                ...n,
                defaultValue: Um(R) ? R[ye] : void 0,
                joinArrays: !1,
                ns: d
              }) : re[ye] = this.translate(be, {
                ...n,
                joinArrays: !1,
                ns: d
              }), re[ye] === be && (re[ye] = j[ye]);
            }
          y = re;
        }
      } else if (L && fe(C) && Array.isArray(y))
        y = y.join(C), y && (y = this.extendTranslation(y, e, n, i));
      else {
        let W = !1, re = !1;
        !this.isValidLookup(y) && I && (W = !0, y = R), this.isValidLookup(y) || (re = !0, y = u);
        const ye = (n.missingKeyNoValueFallbackToKey || this.options.missingKeyNoValueFallbackToKey) && re ? void 0 : y, be = I && R !== y && this.options.updateMissing;
        if (re || W || be) {
          if (this.logger.log(be ? "updateKey" : "missingKey", p, f, u, be ? R : y), a) {
            const Q = this.resolve(u, {
              ...n,
              keySeparator: !1
            });
            Q && Q.res && this.logger.warn("Seems the loaded translations were in flat JSON format instead of nested. Either set keySeparator: false on init or make sure your translations are published in nested format.");
          }
          let Be = [];
          const ge = this.languageUtils.getFallbackCodes(this.options.fallbackLng, n.lng || this.language);
          if (this.options.saveMissingTo === "fallback" && ge && ge[0])
            for (let Q = 0; Q < ge.length; Q++)
              Be.push(ge[Q]);
          else
            this.options.saveMissingTo === "all" ? Be = this.languageUtils.toResolveHierarchy(n.lng || this.language) : Be.push(n.lng || this.language);
          const q = (Q, T, U) => {
            var Se;
            const X = I && U !== y ? U : ye;
            this.options.missingKeyHandler ? this.options.missingKeyHandler(Q, f, T, X, be, n) : (Se = this.backendConnector) != null && Se.saveMissing && this.backendConnector.saveMissing(Q, f, T, X, be, n), this.emit("missingKey", Q, f, T, y);
          };
          this.options.saveMissing && (this.options.saveMissingPlurals && k ? Be.forEach((Q) => {
            const T = this.pluralResolver.getSuffixes(Q, n);
            P && n[`defaultValue${this.options.pluralSeparator}zero`] && T.indexOf(`${this.options.pluralSeparator}zero`) < 0 && T.push(`${this.options.pluralSeparator}zero`), T.forEach((U) => {
              q([Q], u + U, n[`defaultValue${U}`] || R);
            });
          }) : q(Be, u, R));
        }
        y = this.extendTranslation(y, e, n, v, i), re && y === u && this.options.appendNamespaceToMissingKey && (y = `${f}:${u}`), (re || W) && this.options.parseMissingKeyHandler && (y = this.options.parseMissingKeyHandler(this.options.appendNamespaceToMissingKey ? `${f}:${u}` : u, W ? y : void 0));
      }
      return s ? (v.res = y, v.usedParams = this.getUsedParamsDetails(n), v) : y;
    }
    extendTranslation(e, n, i, s, a) {
      var p, m;
      var u = this;
      if ((p = this.i18nFormat) != null && p.parse)
        e = this.i18nFormat.parse(e, {
          ...this.options.interpolation.defaultVariables,
          ...i
        }, i.lng || this.language || s.usedLng, s.usedNS, s.usedKey, {
          resolved: s
        });
      else if (!i.skipInterpolation) {
        i.interpolation && this.interpolator.init({
          ...i,
          interpolation: {
            ...this.options.interpolation,
            ...i.interpolation
          }
        });
        const v = fe(e) && (((m = i == null ? void 0 : i.interpolation) == null ? void 0 : m.skipOnVariables) !== void 0 ? i.interpolation.skipOnVariables : this.options.interpolation.skipOnVariables);
        let y;
        if (v) {
          const S = e.match(this.interpolator.nestingRegexp);
          y = S && S.length;
        }
        let E = i.replace && !fe(i.replace) ? i.replace : i;
        if (this.options.interpolation.defaultVariables && (E = {
          ...this.options.interpolation.defaultVariables,
          ...E
        }), e = this.interpolator.interpolate(e, E, i.lng || this.language || s.usedLng, i), v) {
          const S = e.match(this.interpolator.nestingRegexp), x = S && S.length;
          y < x && (i.nest = !1);
        }
        !i.lng && s && s.res && (i.lng = this.language || s.usedLng), i.nest !== !1 && (e = this.interpolator.nest(e, function() {
          for (var S = arguments.length, x = new Array(S), C = 0; C < S; C++)
            x[C] = arguments[C];
          return (a == null ? void 0 : a[0]) === x[0] && !i.context ? (u.logger.warn(`It seems you are nesting recursively key: ${x[0]} in key: ${n[0]}`), null) : u.translate(...x, n);
        }, i)), i.interpolation && this.interpolator.reset();
      }
      const d = i.postProcess || this.options.postProcess, f = fe(d) ? [d] : d;
      return e != null && (f != null && f.length) && i.applyPostProcessor !== !1 && (e = Hm.handle(f, e, n, this.options && this.options.postProcessPassResolved ? {
        i18nResolved: {
          ...s,
          usedParams: this.getUsedParamsDetails(i)
        },
        ...i
      } : i, this)), e;
    }
    resolve(e) {
      let n = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {}, i, s, a, u, d;
      return fe(e) && (e = [e]), e.forEach((f) => {
        if (this.isValidLookup(i))
          return;
        const p = this.extractFromKey(f, n), m = p.key;
        s = m;
        let v = p.namespaces;
        this.options.fallbackNS && (v = v.concat(this.options.fallbackNS));
        const y = n.count !== void 0 && !fe(n.count), E = y && !n.ordinal && n.count === 0, S = n.context !== void 0 && (fe(n.context) || typeof n.context == "number") && n.context !== "", x = n.lngs ? n.lngs : this.languageUtils.toResolveHierarchy(n.lng || this.language, n.fallbackLng);
        v.forEach((C) => {
          var L, k;
          this.isValidLookup(i) || (d = C, !Bm[`${x[0]}-${C}`] && ((L = this.utils) != null && L.hasLoadedNamespace) && !((k = this.utils) != null && k.hasLoadedNamespace(d)) && (Bm[`${x[0]}-${C}`] = !0, this.logger.warn(`key "${s}" for languages "${x.join(", ")}" won't get resolved as namespace "${d}" was not yet loaded`, "This means something IS WRONG in your setup. You access the t function before i18next.init / i18next.loadNamespace / i18next.changeLanguage was done. Wait for the callback or Promise to resolve before accessing it!!!")), x.forEach((I) => {
            var P;
            if (this.isValidLookup(i))
              return;
            u = I;
            const B = [m];
            if ((P = this.i18nFormat) != null && P.addLookupKeys)
              this.i18nFormat.addLookupKeys(B, m, I, C, n);
            else {
              let R;
              y && (R = this.pluralResolver.getSuffix(I, n.count, n));
              const j = `${this.options.pluralSeparator}zero`, G = `${this.options.pluralSeparator}ordinal${this.options.pluralSeparator}`;
              if (y && (B.push(m + R), n.ordinal && R.indexOf(G) === 0 && B.push(m + R.replace(G, this.options.pluralSeparator)), E && B.push(m + j)), S) {
                const ee = `${m}${this.options.contextSeparator}${n.context}`;
                B.push(ee), y && (B.push(ee + R), n.ordinal && R.indexOf(G) === 0 && B.push(ee + R.replace(G, this.options.pluralSeparator)), E && B.push(ee + j));
              }
            }
            let V;
            for (; V = B.pop(); )
              this.isValidLookup(i) || (a = V, i = this.getResource(I, C, V, n));
          }));
        });
      }), {
        res: i,
        usedKey: s,
        exactUsedKey: a,
        usedLng: u,
        usedNS: d
      };
    }
    isValidLookup(e) {
      return e !== void 0 && !(!this.options.returnNull && e === null) && !(!this.options.returnEmptyString && e === "");
    }
    getResource(e, n, i) {
      var a;
      let s = arguments.length > 3 && arguments[3] !== void 0 ? arguments[3] : {};
      return (a = this.i18nFormat) != null && a.getResource ? this.i18nFormat.getResource(e, n, i, s) : this.resourceStore.getResource(e, n, i, s);
    }
    getUsedParamsDetails() {
      let e = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {};
      const n = ["defaultValue", "ordinal", "context", "replace", "lng", "lngs", "fallbackLng", "ns", "keySeparator", "nsSeparator", "returnObjects", "returnDetails", "joinArrays", "postProcess", "interpolation"], i = e.replace && !fe(e.replace);
      let s = i ? e.replace : e;
      if (i && typeof e.count < "u" && (s.count = e.count), this.options.interpolation.defaultVariables && (s = {
        ...this.options.interpolation.defaultVariables,
        ...s
      }), !i) {
        s = {
          ...s
        };
        for (const a of n)
          delete s[a];
      }
      return s;
    }
    static hasDefaultValue(e) {
      const n = "defaultValue";
      for (const i in e)
        if (Object.prototype.hasOwnProperty.call(e, i) && n === i.substring(0, n.length) && e[i] !== void 0)
          return !0;
      return !1;
    }
  }
  class $m {
    constructor(e) {
      this.options = e, this.supportedLngs = this.options.supportedLngs || !1, this.logger = ir.create("languageUtils");
    }
    getScriptPartFromCode(e) {
      if (e = el(e), !e || e.indexOf("-") < 0)
        return null;
      const n = e.split("-");
      return n.length === 2 || (n.pop(), n[n.length - 1].toLowerCase() === "x") ? null : this.formatLanguageCode(n.join("-"));
    }
    getLanguagePartFromCode(e) {
      if (e = el(e), !e || e.indexOf("-") < 0)
        return e;
      const n = e.split("-");
      return this.formatLanguageCode(n[0]);
    }
    formatLanguageCode(e) {
      if (fe(e) && e.indexOf("-") > -1) {
        let n;
        try {
          n = Intl.getCanonicalLocales(e)[0];
        } catch {
        }
        return n && this.options.lowerCaseLng && (n = n.toLowerCase()), n || (this.options.lowerCaseLng ? e.toLowerCase() : e);
      }
      return this.options.cleanCode || this.options.lowerCaseLng ? e.toLowerCase() : e;
    }
    isSupportedCode(e) {
      return (this.options.load === "languageOnly" || this.options.nonExplicitSupportedLngs) && (e = this.getLanguagePartFromCode(e)), !this.supportedLngs || !this.supportedLngs.length || this.supportedLngs.indexOf(e) > -1;
    }
    getBestMatchFromCodes(e) {
      if (!e)
        return null;
      let n;
      return e.forEach((i) => {
        if (n)
          return;
        const s = this.formatLanguageCode(i);
        (!this.options.supportedLngs || this.isSupportedCode(s)) && (n = s);
      }), !n && this.options.supportedLngs && e.forEach((i) => {
        if (n)
          return;
        const s = this.getLanguagePartFromCode(i);
        if (this.isSupportedCode(s))
          return n = s;
        n = this.options.supportedLngs.find((a) => {
          if (a === s)
            return a;
          if (!(a.indexOf("-") < 0 && s.indexOf("-") < 0) && (a.indexOf("-") > 0 && s.indexOf("-") < 0 && a.substring(0, a.indexOf("-")) === s || a.indexOf(s) === 0 && s.length > 1))
            return a;
        });
      }), n || (n = this.getFallbackCodes(this.options.fallbackLng)[0]), n;
    }
    getFallbackCodes(e, n) {
      if (!e)
        return [];
      if (typeof e == "function" && (e = e(n)), fe(e) && (e = [e]), Array.isArray(e))
        return e;
      if (!n)
        return e.default || [];
      let i = e[n];
      return i || (i = e[this.getScriptPartFromCode(n)]), i || (i = e[this.formatLanguageCode(n)]), i || (i = e[this.getLanguagePartFromCode(n)]), i || (i = e.default), i || [];
    }
    toResolveHierarchy(e, n) {
      const i = this.getFallbackCodes(n || this.options.fallbackLng || [], e), s = [], a = (u) => {
        u && (this.isSupportedCode(u) ? s.push(u) : this.logger.warn(`rejecting language code not found in supportedLngs: ${u}`));
      };
      return fe(e) && (e.indexOf("-") > -1 || e.indexOf("_") > -1) ? (this.options.load !== "languageOnly" && a(this.formatLanguageCode(e)), this.options.load !== "languageOnly" && this.options.load !== "currentOnly" && a(this.getScriptPartFromCode(e)), this.options.load !== "currentOnly" && a(this.getLanguagePartFromCode(e))) : fe(e) && a(this.formatLanguageCode(e)), i.forEach((u) => {
        s.indexOf(u) < 0 && a(this.formatLanguageCode(u));
      }), s;
    }
  }
  const zm = {
    zero: 0,
    one: 1,
    two: 2,
    few: 3,
    many: 4,
    other: 5
  }, Vm = {
    select: (t) => t === 1 ? "one" : "other",
    resolvedOptions: () => ({
      pluralCategories: ["one", "other"]
    })
  };
  class JE {
    constructor(e) {
      let n = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {};
      this.languageUtils = e, this.options = n, this.logger = ir.create("pluralResolver"), this.pluralRulesCache = {};
    }
    addRule(e, n) {
      this.rules[e] = n;
    }
    clearCache() {
      this.pluralRulesCache = {};
    }
    getRule(e) {
      let n = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {};
      const i = el(e === "dev" ? "en" : e), s = n.ordinal ? "ordinal" : "cardinal", a = JSON.stringify({
        cleanedCode: i,
        type: s
      });
      if (a in this.pluralRulesCache)
        return this.pluralRulesCache[a];
      let u;
      try {
        u = new Intl.PluralRules(i, {
          type: s
        });
      } catch {
        if (!Intl)
          return this.logger.error("No Intl support, please use an Intl polyfill!"), Vm;
        if (!e.match(/-|_/))
          return Vm;
        const f = this.languageUtils.getLanguagePartFromCode(e);
        u = this.getRule(f, n);
      }
      return this.pluralRulesCache[a] = u, u;
    }
    needsPlural(e) {
      let n = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {}, i = this.getRule(e, n);
      return i || (i = this.getRule("dev", n)), (i == null ? void 0 : i.resolvedOptions().pluralCategories.length) > 1;
    }
    getPluralFormsOfKey(e, n) {
      let i = arguments.length > 2 && arguments[2] !== void 0 ? arguments[2] : {};
      return this.getSuffixes(e, i).map((s) => `${n}${s}`);
    }
    getSuffixes(e) {
      let n = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {}, i = this.getRule(e, n);
      return i || (i = this.getRule("dev", n)), i ? i.resolvedOptions().pluralCategories.sort((s, a) => zm[s] - zm[a]).map((s) => `${this.options.prepend}${n.ordinal ? `ordinal${this.options.prepend}` : ""}${s}`) : [];
    }
    getSuffix(e, n) {
      let i = arguments.length > 2 && arguments[2] !== void 0 ? arguments[2] : {};
      const s = this.getRule(e, i);
      return s ? `${this.options.prepend}${i.ordinal ? `ordinal${this.options.prepend}` : ""}${s.select(n)}` : (this.logger.warn(`no plural rule found for: ${e}`), this.getSuffix("dev", n, i));
    }
  }
  const Wm = function(t, e, n) {
    let i = arguments.length > 3 && arguments[3] !== void 0 ? arguments[3] : ".", s = arguments.length > 4 && arguments[4] !== void 0 ? arguments[4] : !0, a = VE(t, e, n);
    return !a && s && fe(n) && (a = ld(t, n, i), a === void 0 && (a = ld(e, n, i))), a;
  }, ud = (t) => t.replace(/\$/g, "$$$$");
  class QE {
    constructor() {
      var n;
      let e = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {};
      this.logger = ir.create("interpolator"), this.options = e, this.format = ((n = e == null ? void 0 : e.interpolation) == null ? void 0 : n.format) || ((i) => i), this.init(e);
    }
    init() {
      let e = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {};
      e.interpolation || (e.interpolation = {
        escapeValue: !0
      });
      const {
        escape: n,
        escapeValue: i,
        useRawValueToEscape: s,
        prefix: a,
        prefixEscaped: u,
        suffix: d,
        suffixEscaped: f,
        formatSeparator: p,
        unescapeSuffix: m,
        unescapePrefix: v,
        nestingPrefix: y,
        nestingPrefixEscaped: E,
        nestingSuffix: S,
        nestingSuffixEscaped: x,
        nestingOptionsSeparator: C,
        maxReplaces: L,
        alwaysFormat: k
      } = e.interpolation;
      this.escape = n !== void 0 ? n : GE, this.escapeValue = i !== void 0 ? i : !0, this.useRawValueToEscape = s !== void 0 ? s : !1, this.prefix = a ? go(a) : u || "{{", this.suffix = d ? go(d) : f || "}}", this.formatSeparator = p || ",", this.unescapePrefix = m ? "" : v || "-", this.unescapeSuffix = this.unescapePrefix ? "" : m || "", this.nestingPrefix = y ? go(y) : E || go("$t("), this.nestingSuffix = S ? go(S) : x || go(")"), this.nestingOptionsSeparator = C || ",", this.maxReplaces = L || 1e3, this.alwaysFormat = k !== void 0 ? k : !1, this.resetRegExp();
    }
    reset() {
      this.options && this.init(this.options);
    }
    resetRegExp() {
      const e = (n, i) => (n == null ? void 0 : n.source) === i ? (n.lastIndex = 0, n) : new RegExp(i, "g");
      this.regexp = e(this.regexp, `${this.prefix}(.+?)${this.suffix}`), this.regexpUnescape = e(this.regexpUnescape, `${this.prefix}${this.unescapePrefix}(.+?)${this.unescapeSuffix}${this.suffix}`), this.nestingRegexp = e(this.nestingRegexp, `${this.nestingPrefix}(.+?)${this.nestingSuffix}`);
    }
    interpolate(e, n, i, s) {
      var E;
      let a, u, d;
      const f = this.options && this.options.interpolation && this.options.interpolation.defaultVariables || {}, p = (S) => {
        if (S.indexOf(this.formatSeparator) < 0) {
          const k = Wm(n, f, S, this.options.keySeparator, this.options.ignoreJSONStructure);
          return this.alwaysFormat ? this.format(k, void 0, i, {
            ...s,
            ...n,
            interpolationkey: S
          }) : k;
        }
        const x = S.split(this.formatSeparator), C = x.shift().trim(), L = x.join(this.formatSeparator).trim();
        return this.format(Wm(n, f, C, this.options.keySeparator, this.options.ignoreJSONStructure), L, i, {
          ...s,
          ...n,
          interpolationkey: C
        });
      };
      this.resetRegExp();
      const m = (s == null ? void 0 : s.missingInterpolationHandler) || this.options.missingInterpolationHandler, v = ((E = s == null ? void 0 : s.interpolation) == null ? void 0 : E.skipOnVariables) !== void 0 ? s.interpolation.skipOnVariables : this.options.interpolation.skipOnVariables;
      return [{
        regex: this.regexpUnescape,
        safeValue: (S) => ud(S)
      }, {
        regex: this.regexp,
        safeValue: (S) => this.escapeValue ? ud(this.escape(S)) : ud(S)
      }].forEach((S) => {
        for (d = 0; a = S.regex.exec(e); ) {
          const x = a[1].trim();
          if (u = p(x), u === void 0)
            if (typeof m == "function") {
              const L = m(e, a, s);
              u = fe(L) ? L : "";
            } else if (s && Object.prototype.hasOwnProperty.call(s, x))
              u = "";
            else if (v) {
              u = a[0];
              continue;
            } else
              this.logger.warn(`missed to pass in variable ${x} for interpolating ${e}`), u = "";
          else
            !fe(u) && !this.useRawValueToEscape && (u = Im(u));
          const C = S.safeValue(u);
          if (e = e.replace(a[0], C), v ? (S.regex.lastIndex += u.length, S.regex.lastIndex -= a[0].length) : S.regex.lastIndex = 0, d++, d >= this.maxReplaces)
            break;
        }
      }), e;
    }
    nest(e, n) {
      let i = arguments.length > 2 && arguments[2] !== void 0 ? arguments[2] : {}, s, a, u;
      const d = (f, p) => {
        const m = this.nestingOptionsSeparator;
        if (f.indexOf(m) < 0)
          return f;
        const v = f.split(new RegExp(`${m}[ ]*{`));
        let y = `{${v[1]}`;
        f = v[0], y = this.interpolate(y, u);
        const E = y.match(/'/g), S = y.match(/"/g);
        (((E == null ? void 0 : E.length) ?? 0) % 2 === 0 && !S || S.length % 2 !== 0) && (y = y.replace(/'/g, '"'));
        try {
          u = JSON.parse(y), p && (u = {
            ...p,
            ...u
          });
        } catch (x) {
          return this.logger.warn(`failed parsing options string in nesting for key ${f}`, x), `${f}${m}${y}`;
        }
        return u.defaultValue && u.defaultValue.indexOf(this.prefix) > -1 && delete u.defaultValue, f;
      };
      for (; s = this.nestingRegexp.exec(e); ) {
        let f = [];
        u = {
          ...i
        }, u = u.replace && !fe(u.replace) ? u.replace : u, u.applyPostProcessor = !1, delete u.defaultValue;
        let p = !1;
        if (s[0].indexOf(this.formatSeparator) !== -1 && !/{.*}/.test(s[1])) {
          const m = s[1].split(this.formatSeparator).map((v) => v.trim());
          s[1] = m.shift(), f = m, p = !0;
        }
        if (a = n(d.call(this, s[1].trim(), u), u), a && s[0] === e && !fe(a))
          return a;
        fe(a) || (a = Im(a)), a || (this.logger.warn(`missed to resolve ${s[1]} for nesting ${e}`), a = ""), p && (a = f.reduce((m, v) => this.format(m, v, i.lng, {
          ...i,
          interpolationkey: s[1].trim()
        }), a.trim())), e = e.replace(s[0], a), this.regexp.lastIndex = 0;
      }
      return e;
    }
  }
  const ex = (t) => {
    let e = t.toLowerCase().trim();
    const n = {};
    if (t.indexOf("(") > -1) {
      const i = t.split("(");
      e = i[0].toLowerCase().trim();
      const s = i[1].substring(0, i[1].length - 1);
      e === "currency" && s.indexOf(":") < 0 ? n.currency || (n.currency = s.trim()) : e === "relativetime" && s.indexOf(":") < 0 ? n.range || (n.range = s.trim()) : s.split(";").forEach((u) => {
        if (u) {
          const [d, ...f] = u.split(":"), p = f.join(":").trim().replace(/^'+|'+$/g, ""), m = d.trim();
          n[m] || (n[m] = p), p === "false" && (n[m] = !1), p === "true" && (n[m] = !0), isNaN(p) || (n[m] = parseInt(p, 10));
        }
      });
    }
    return {
      formatName: e,
      formatOptions: n
    };
  }, vo = (t) => {
    const e = {};
    return (n, i, s) => {
      let a = s;
      s && s.interpolationkey && s.formatParams && s.formatParams[s.interpolationkey] && s[s.interpolationkey] && (a = {
        ...a,
        [s.interpolationkey]: void 0
      });
      const u = i + JSON.stringify(a);
      let d = e[u];
      return d || (d = t(el(i), s), e[u] = d), d(n);
    };
  };
  class tx {
    constructor() {
      let e = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {};
      this.logger = ir.create("formatter"), this.options = e, this.formats = {
        number: vo((n, i) => {
          const s = new Intl.NumberFormat(n, {
            ...i
          });
          return (a) => s.format(a);
        }),
        currency: vo((n, i) => {
          const s = new Intl.NumberFormat(n, {
            ...i,
            style: "currency"
          });
          return (a) => s.format(a);
        }),
        datetime: vo((n, i) => {
          const s = new Intl.DateTimeFormat(n, {
            ...i
          });
          return (a) => s.format(a);
        }),
        relativetime: vo((n, i) => {
          const s = new Intl.RelativeTimeFormat(n, {
            ...i
          });
          return (a) => s.format(a, i.range || "day");
        }),
        list: vo((n, i) => {
          const s = new Intl.ListFormat(n, {
            ...i
          });
          return (a) => s.format(a);
        })
      }, this.init(e);
    }
    init(e) {
      let n = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {
        interpolation: {}
      };
      this.formatSeparator = n.interpolation.formatSeparator || ",";
    }
    add(e, n) {
      this.formats[e.toLowerCase().trim()] = n;
    }
    addCached(e, n) {
      this.formats[e.toLowerCase().trim()] = vo(n);
    }
    format(e, n, i) {
      let s = arguments.length > 3 && arguments[3] !== void 0 ? arguments[3] : {};
      const a = n.split(this.formatSeparator);
      if (a.length > 1 && a[0].indexOf("(") > 1 && a[0].indexOf(")") < 0 && a.find((d) => d.indexOf(")") > -1)) {
        const d = a.findIndex((f) => f.indexOf(")") > -1);
        a[0] = [a[0], ...a.splice(1, d)].join(this.formatSeparator);
      }
      return a.reduce((d, f) => {
        var v;
        const {
          formatName: p,
          formatOptions: m
        } = ex(f);
        if (this.formats[p]) {
          let y = d;
          try {
            const E = ((v = s == null ? void 0 : s.formatParams) == null ? void 0 : v[s.interpolationkey]) || {}, S = E.locale || E.lng || s.locale || s.lng || i;
            y = this.formats[p](d, S, {
              ...m,
              ...s,
              ...E
            });
          } catch (E) {
            this.logger.warn(E);
          }
          return y;
        } else
          this.logger.warn(`there was no format function for ${p}`);
        return d;
      }, e);
    }
  }
  const nx = (t, e) => {
    t.pending[e] !== void 0 && (delete t.pending[e], t.pendingCount--);
  };
  class rx extends nl {
    constructor(e, n, i) {
      var a, u;
      let s = arguments.length > 3 && arguments[3] !== void 0 ? arguments[3] : {};
      super(), this.backend = e, this.store = n, this.services = i, this.languageUtils = i.languageUtils, this.options = s, this.logger = ir.create("backendConnector"), this.waitingReads = [], this.maxParallelReads = s.maxParallelReads || 10, this.readingCalls = 0, this.maxRetries = s.maxRetries >= 0 ? s.maxRetries : 5, this.retryTimeout = s.retryTimeout >= 1 ? s.retryTimeout : 350, this.state = {}, this.queue = [], (u = (a = this.backend) == null ? void 0 : a.init) == null || u.call(a, i, s.backend, s);
    }
    queueLoad(e, n, i, s) {
      const a = {}, u = {}, d = {}, f = {};
      return e.forEach((p) => {
        let m = !0;
        n.forEach((v) => {
          const y = `${p}|${v}`;
          !i.reload && this.store.hasResourceBundle(p, v) ? this.state[y] = 2 : this.state[y] < 0 || (this.state[y] === 1 ? u[y] === void 0 && (u[y] = !0) : (this.state[y] = 1, m = !1, u[y] === void 0 && (u[y] = !0), a[y] === void 0 && (a[y] = !0), f[v] === void 0 && (f[v] = !0)));
        }), m || (d[p] = !0);
      }), (Object.keys(a).length || Object.keys(u).length) && this.queue.push({
        pending: u,
        pendingCount: Object.keys(u).length,
        loaded: {},
        errors: [],
        callback: s
      }), {
        toLoad: Object.keys(a),
        pending: Object.keys(u),
        toLoadLanguages: Object.keys(d),
        toLoadNamespaces: Object.keys(f)
      };
    }
    loaded(e, n, i) {
      const s = e.split("|"), a = s[0], u = s[1];
      n && this.emit("failedLoading", a, u, n), !n && i && this.store.addResourceBundle(a, u, i, void 0, void 0, {
        skipCopy: !0
      }), this.state[e] = n ? -1 : 2, n && i && (this.state[e] = 0);
      const d = {};
      this.queue.forEach((f) => {
        zE(f.loaded, [a], u), nx(f, e), n && f.errors.push(n), f.pendingCount === 0 && !f.done && (Object.keys(f.loaded).forEach((p) => {
          d[p] || (d[p] = {});
          const m = f.loaded[p];
          m.length && m.forEach((v) => {
            d[p][v] === void 0 && (d[p][v] = !0);
          });
        }), f.done = !0, f.errors.length ? f.callback(f.errors) : f.callback());
      }), this.emit("loaded", d), this.queue = this.queue.filter((f) => !f.done);
    }
    read(e, n, i) {
      let s = arguments.length > 3 && arguments[3] !== void 0 ? arguments[3] : 0, a = arguments.length > 4 && arguments[4] !== void 0 ? arguments[4] : this.retryTimeout, u = arguments.length > 5 ? arguments[5] : void 0;
      if (!e.length)
        return u(null, {});
      if (this.readingCalls >= this.maxParallelReads) {
        this.waitingReads.push({
          lng: e,
          ns: n,
          fcName: i,
          tried: s,
          wait: a,
          callback: u
        });
        return;
      }
      this.readingCalls++;
      const d = (p, m) => {
        if (this.readingCalls--, this.waitingReads.length > 0) {
          const v = this.waitingReads.shift();
          this.read(v.lng, v.ns, v.fcName, v.tried, v.wait, v.callback);
        }
        if (p && m && s < this.maxRetries) {
          setTimeout(() => {
            this.read.call(this, e, n, i, s + 1, a * 2, u);
          }, a);
          return;
        }
        u(p, m);
      }, f = this.backend[i].bind(this.backend);
      if (f.length === 2) {
        try {
          const p = f(e, n);
          p && typeof p.then == "function" ? p.then((m) => d(null, m)).catch(d) : d(null, p);
        } catch (p) {
          d(p);
        }
        return;
      }
      return f(e, n, d);
    }
    prepareLoading(e, n) {
      let i = arguments.length > 2 && arguments[2] !== void 0 ? arguments[2] : {}, s = arguments.length > 3 ? arguments[3] : void 0;
      if (!this.backend)
        return this.logger.warn("No backend was added via i18next.use. Will not load resources."), s && s();
      fe(e) && (e = this.languageUtils.toResolveHierarchy(e)), fe(n) && (n = [n]);
      const a = this.queueLoad(e, n, i, s);
      if (!a.toLoad.length)
        return a.pending.length || s(), null;
      a.toLoad.forEach((u) => {
        this.loadOne(u);
      });
    }
    load(e, n, i) {
      this.prepareLoading(e, n, {}, i);
    }
    reload(e, n, i) {
      this.prepareLoading(e, n, {
        reload: !0
      }, i);
    }
    loadOne(e) {
      let n = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : "";
      const i = e.split("|"), s = i[0], a = i[1];
      this.read(s, a, "read", void 0, void 0, (u, d) => {
        u && this.logger.warn(`${n}loading namespace ${a} for language ${s} failed`, u), !u && d && this.logger.log(`${n}loaded namespace ${a} for language ${s}`, d), this.loaded(e, u, d);
      });
    }
    saveMissing(e, n, i, s, a) {
      var f, p, m, v, y;
      let u = arguments.length > 5 && arguments[5] !== void 0 ? arguments[5] : {}, d = arguments.length > 6 && arguments[6] !== void 0 ? arguments[6] : () => {
      };
      if ((p = (f = this.services) == null ? void 0 : f.utils) != null && p.hasLoadedNamespace && !((v = (m = this.services) == null ? void 0 : m.utils) != null && v.hasLoadedNamespace(n))) {
        this.logger.warn(`did not save key "${i}" as the namespace "${n}" was not yet loaded`, "This means something IS WRONG in your setup. You access the t function before i18next.init / i18next.loadNamespace / i18next.changeLanguage was done. Wait for the callback or Promise to resolve before accessing it!!!");
        return;
      }
      if (!(i == null || i === "")) {
        if ((y = this.backend) != null && y.create) {
          const E = {
            ...u,
            isUpdate: a
          }, S = this.backend.create.bind(this.backend);
          if (S.length < 6)
            try {
              let x;
              S.length === 5 ? x = S(e, n, i, s, E) : x = S(e, n, i, s), x && typeof x.then == "function" ? x.then((C) => d(null, C)).catch(d) : d(null, x);
            } catch (x) {
              d(x);
            }
          else
            S(e, n, i, s, d, E);
        }
        !e || !e[0] || this.store.addResource(e[0], n, i, s);
      }
    }
  }
  const Gm = () => ({
    debug: !1,
    initAsync: !0,
    ns: ["translation"],
    defaultNS: ["translation"],
    fallbackLng: ["dev"],
    fallbackNS: !1,
    supportedLngs: !1,
    nonExplicitSupportedLngs: !1,
    load: "all",
    preload: !1,
    simplifyPluralSuffix: !0,
    keySeparator: ".",
    nsSeparator: ":",
    pluralSeparator: "_",
    contextSeparator: "_",
    partialBundledLanguages: !1,
    saveMissing: !1,
    updateMissing: !1,
    saveMissingTo: "fallback",
    saveMissingPlurals: !0,
    missingKeyHandler: !1,
    missingInterpolationHandler: !1,
    postProcess: !1,
    postProcessPassResolved: !1,
    returnNull: !1,
    returnEmptyString: !0,
    returnObjects: !1,
    joinArrays: !1,
    returnedObjectHandler: !1,
    parseMissingKeyHandler: !1,
    appendNamespaceToMissingKey: !1,
    appendNamespaceToCIMode: !1,
    overloadTranslationOptionHandler: (t) => {
      let e = {};
      if (typeof t[1] == "object" && (e = t[1]), fe(t[1]) && (e.defaultValue = t[1]), fe(t[2]) && (e.tDescription = t[2]), typeof t[2] == "object" || typeof t[3] == "object") {
        const n = t[3] || t[2];
        Object.keys(n).forEach((i) => {
          e[i] = n[i];
        });
      }
      return e;
    },
    interpolation: {
      escapeValue: !0,
      format: (t) => t,
      prefix: "{{",
      suffix: "}}",
      formatSeparator: ",",
      unescapePrefix: "-",
      nestingPrefix: "$t(",
      nestingSuffix: ")",
      nestingOptionsSeparator: ",",
      maxReplaces: 1e3,
      skipOnVariables: !0
    }
  }), qm = (t) => {
    var e, n;
    return fe(t.ns) && (t.ns = [t.ns]), fe(t.fallbackLng) && (t.fallbackLng = [t.fallbackLng]), fe(t.fallbackNS) && (t.fallbackNS = [t.fallbackNS]), ((n = (e = t.supportedLngs) == null ? void 0 : e.indexOf) == null ? void 0 : n.call(e, "cimode")) < 0 && (t.supportedLngs = t.supportedLngs.concat(["cimode"])), typeof t.initImmediate == "boolean" && (t.initAsync = t.initImmediate), t;
  }, il = () => {
  }, ix = (t) => {
    Object.getOwnPropertyNames(Object.getPrototypeOf(t)).forEach((n) => {
      typeof t[n] == "function" && (t[n] = t[n].bind(t));
    });
  };
  class bs extends nl {
    constructor() {
      let e = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {}, n = arguments.length > 1 ? arguments[1] : void 0;
      if (super(), this.options = qm(e), this.services = {}, this.logger = ir, this.modules = {
        external: []
      }, ix(this), n && !this.isInitialized && !e.isClone) {
        if (!this.options.initAsync)
          return this.init(e, n), this;
        setTimeout(() => {
          this.init(e, n);
        }, 0);
      }
    }
    init() {
      var e = this;
      let n = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {}, i = arguments.length > 1 ? arguments[1] : void 0;
      this.isInitializing = !0, typeof n == "function" && (i = n, n = {}), n.defaultNS == null && n.ns && (fe(n.ns) ? n.defaultNS = n.ns : n.ns.indexOf("translation") < 0 && (n.defaultNS = n.ns[0]));
      const s = Gm();
      this.options = {
        ...s,
        ...this.options,
        ...qm(n)
      }, this.options.interpolation = {
        ...s.interpolation,
        ...this.options.interpolation
      }, n.keySeparator !== void 0 && (this.options.userDefinedKeySeparator = n.keySeparator), n.nsSeparator !== void 0 && (this.options.userDefinedNsSeparator = n.nsSeparator);
      const a = (m) => m ? typeof m == "function" ? new m() : m : null;
      if (!this.options.isClone) {
        this.modules.logger ? ir.init(a(this.modules.logger), this.options) : ir.init(null, this.options);
        let m;
        this.modules.formatter ? m = this.modules.formatter : m = tx;
        const v = new $m(this.options);
        this.store = new Fm(this.options.resources, this.options);
        const y = this.services;
        y.logger = ir, y.resourceStore = this.store, y.languageUtils = v, y.pluralResolver = new JE(v, {
          prepend: this.options.pluralSeparator,
          simplifyPluralSuffix: this.options.simplifyPluralSuffix
        }), m && (!this.options.interpolation.format || this.options.interpolation.format === s.interpolation.format) && (y.formatter = a(m), y.formatter.init(y, this.options), this.options.interpolation.format = y.formatter.format.bind(y.formatter)), y.interpolator = new QE(this.options), y.utils = {
          hasLoadedNamespace: this.hasLoadedNamespace.bind(this)
        }, y.backendConnector = new rx(a(this.modules.backend), y.resourceStore, y, this.options), y.backendConnector.on("*", function(E) {
          for (var S = arguments.length, x = new Array(S > 1 ? S - 1 : 0), C = 1; C < S; C++)
            x[C - 1] = arguments[C];
          e.emit(E, ...x);
        }), this.modules.languageDetector && (y.languageDetector = a(this.modules.languageDetector), y.languageDetector.init && y.languageDetector.init(y, this.options.detection, this.options)), this.modules.i18nFormat && (y.i18nFormat = a(this.modules.i18nFormat), y.i18nFormat.init && y.i18nFormat.init(this)), this.translator = new rl(this.services, this.options), this.translator.on("*", function(E) {
          for (var S = arguments.length, x = new Array(S > 1 ? S - 1 : 0), C = 1; C < S; C++)
            x[C - 1] = arguments[C];
          e.emit(E, ...x);
        }), this.modules.external.forEach((E) => {
          E.init && E.init(this);
        });
      }
      if (this.format = this.options.interpolation.format, i || (i = il), this.options.fallbackLng && !this.services.languageDetector && !this.options.lng) {
        const m = this.services.languageUtils.getFallbackCodes(this.options.fallbackLng);
        m.length > 0 && m[0] !== "dev" && (this.options.lng = m[0]);
      }
      !this.services.languageDetector && !this.options.lng && this.logger.warn("init: no languageDetector is used and no lng is defined"), ["getResource", "hasResourceBundle", "getResourceBundle", "getDataByLanguage"].forEach((m) => {
        this[m] = function() {
          return e.store[m](...arguments);
        };
      }), ["addResource", "addResources", "addResourceBundle", "removeResourceBundle"].forEach((m) => {
        this[m] = function() {
          return e.store[m](...arguments), e;
        };
      });
      const f = Fn(), p = () => {
        const m = (v, y) => {
          this.isInitializing = !1, this.isInitialized && !this.initializedStoreOnce && this.logger.warn("init: i18next is already initialized. You should call init just once!"), this.isInitialized = !0, this.options.isClone || this.logger.log("initialized", this.options), this.emit("initialized", this.options), f.resolve(y), i(v, y);
        };
        if (this.languages && !this.isInitialized)
          return m(null, this.t.bind(this));
        this.changeLanguage(this.options.lng, m);
      };
      return this.options.resources || !this.options.initAsync ? p() : setTimeout(p, 0), f;
    }
    loadResources(e) {
      var a, u;
      let i = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : il;
      const s = fe(e) ? e : this.language;
      if (typeof e == "function" && (i = e), !this.options.resources || this.options.partialBundledLanguages) {
        if ((s == null ? void 0 : s.toLowerCase()) === "cimode" && (!this.options.preload || this.options.preload.length === 0))
          return i();
        const d = [], f = (p) => {
          if (!p || p === "cimode")
            return;
          this.services.languageUtils.toResolveHierarchy(p).forEach((v) => {
            v !== "cimode" && d.indexOf(v) < 0 && d.push(v);
          });
        };
        s ? f(s) : this.services.languageUtils.getFallbackCodes(this.options.fallbackLng).forEach((m) => f(m)), (u = (a = this.options.preload) == null ? void 0 : a.forEach) == null || u.call(a, (p) => f(p)), this.services.backendConnector.load(d, this.options.ns, (p) => {
          !p && !this.resolvedLanguage && this.language && this.setResolvedLanguage(this.language), i(p);
        });
      } else
        i(null);
    }
    reloadResources(e, n, i) {
      const s = Fn();
      return typeof e == "function" && (i = e, e = void 0), typeof n == "function" && (i = n, n = void 0), e || (e = this.languages), n || (n = this.options.ns), i || (i = il), this.services.backendConnector.reload(e, n, (a) => {
        s.resolve(), i(a);
      }), s;
    }
    use(e) {
      if (!e)
        throw new Error("You are passing an undefined module! Please check the object you are passing to i18next.use()");
      if (!e.type)
        throw new Error("You are passing a wrong module! Please check the object you are passing to i18next.use()");
      return e.type === "backend" && (this.modules.backend = e), (e.type === "logger" || e.log && e.warn && e.error) && (this.modules.logger = e), e.type === "languageDetector" && (this.modules.languageDetector = e), e.type === "i18nFormat" && (this.modules.i18nFormat = e), e.type === "postProcessor" && Hm.addPostProcessor(e), e.type === "formatter" && (this.modules.formatter = e), e.type === "3rdParty" && this.modules.external.push(e), this;
    }
    setResolvedLanguage(e) {
      if (!(!e || !this.languages) && !(["cimode", "dev"].indexOf(e) > -1))
        for (let n = 0; n < this.languages.length; n++) {
          const i = this.languages[n];
          if (!(["cimode", "dev"].indexOf(i) > -1) && this.store.hasLanguageSomeTranslations(i)) {
            this.resolvedLanguage = i;
            break;
          }
        }
    }
    changeLanguage(e, n) {
      var i = this;
      this.isLanguageChangingTo = e;
      const s = Fn();
      this.emit("languageChanging", e);
      const a = (f) => {
        this.language = f, this.languages = this.services.languageUtils.toResolveHierarchy(f), this.resolvedLanguage = void 0, this.setResolvedLanguage(f);
      }, u = (f, p) => {
        p ? (a(p), this.translator.changeLanguage(p), this.isLanguageChangingTo = void 0, this.emit("languageChanged", p), this.logger.log("languageChanged", p)) : this.isLanguageChangingTo = void 0, s.resolve(function() {
          return i.t(...arguments);
        }), n && n(f, function() {
          return i.t(...arguments);
        });
      }, d = (f) => {
        var m, v;
        !e && !f && this.services.languageDetector && (f = []);
        const p = fe(f) ? f : this.services.languageUtils.getBestMatchFromCodes(f);
        p && (this.language || a(p), this.translator.language || this.translator.changeLanguage(p), (v = (m = this.services.languageDetector) == null ? void 0 : m.cacheUserLanguage) == null || v.call(m, p)), this.loadResources(p, (y) => {
          u(y, p);
        });
      };
      return !e && this.services.languageDetector && !this.services.languageDetector.async ? d(this.services.languageDetector.detect()) : !e && this.services.languageDetector && this.services.languageDetector.async ? this.services.languageDetector.detect.length === 0 ? this.services.languageDetector.detect().then(d) : this.services.languageDetector.detect(d) : d(e), s;
    }
    getFixedT(e, n, i) {
      var s = this;
      const a = function(u, d) {
        let f;
        if (typeof d != "object") {
          for (var p = arguments.length, m = new Array(p > 2 ? p - 2 : 0), v = 2; v < p; v++)
            m[v - 2] = arguments[v];
          f = s.options.overloadTranslationOptionHandler([u, d].concat(m));
        } else
          f = {
            ...d
          };
        f.lng = f.lng || a.lng, f.lngs = f.lngs || a.lngs, f.ns = f.ns || a.ns, f.keyPrefix !== "" && (f.keyPrefix = f.keyPrefix || i || a.keyPrefix);
        const y = s.options.keySeparator || ".";
        let E;
        return f.keyPrefix && Array.isArray(u) ? E = u.map((S) => `${f.keyPrefix}${y}${S}`) : E = f.keyPrefix ? `${f.keyPrefix}${y}${u}` : u, s.t(E, f);
      };
      return fe(e) ? a.lng = e : a.lngs = e, a.ns = n, a.keyPrefix = i, a;
    }
    t() {
      var s;
      for (var e = arguments.length, n = new Array(e), i = 0; i < e; i++)
        n[i] = arguments[i];
      return (s = this.translator) == null ? void 0 : s.translate(...n);
    }
    exists() {
      var s;
      for (var e = arguments.length, n = new Array(e), i = 0; i < e; i++)
        n[i] = arguments[i];
      return (s = this.translator) == null ? void 0 : s.exists(...n);
    }
    setDefaultNamespace(e) {
      this.options.defaultNS = e;
    }
    hasLoadedNamespace(e) {
      let n = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {};
      if (!this.isInitialized)
        return this.logger.warn("hasLoadedNamespace: i18next was not initialized", this.languages), !1;
      if (!this.languages || !this.languages.length)
        return this.logger.warn("hasLoadedNamespace: i18n.languages were undefined or empty", this.languages), !1;
      const i = n.lng || this.resolvedLanguage || this.languages[0], s = this.options ? this.options.fallbackLng : !1, a = this.languages[this.languages.length - 1];
      if (i.toLowerCase() === "cimode")
        return !0;
      const u = (d, f) => {
        const p = this.services.backendConnector.state[`${d}|${f}`];
        return p === -1 || p === 0 || p === 2;
      };
      if (n.precheck) {
        const d = n.precheck(this, u);
        if (d !== void 0)
          return d;
      }
      return !!(this.hasResourceBundle(i, e) || !this.services.backendConnector.backend || this.options.resources && !this.options.partialBundledLanguages || u(i, e) && (!s || u(a, e)));
    }
    loadNamespaces(e, n) {
      const i = Fn();
      return this.options.ns ? (fe(e) && (e = [e]), e.forEach((s) => {
        this.options.ns.indexOf(s) < 0 && this.options.ns.push(s);
      }), this.loadResources((s) => {
        i.resolve(), n && n(s);
      }), i) : (n && n(), Promise.resolve());
    }
    loadLanguages(e, n) {
      const i = Fn();
      fe(e) && (e = [e]);
      const s = this.options.preload || [], a = e.filter((u) => s.indexOf(u) < 0 && this.services.languageUtils.isSupportedCode(u));
      return a.length ? (this.options.preload = s.concat(a), this.loadResources((u) => {
        i.resolve(), n && n(u);
      }), i) : (n && n(), Promise.resolve());
    }
    dir(e) {
      var s, a;
      if (e || (e = this.resolvedLanguage || (((s = this.languages) == null ? void 0 : s.length) > 0 ? this.languages[0] : this.language)), !e)
        return "rtl";
      const n = ["ar", "shu", "sqr", "ssh", "xaa", "yhd", "yud", "aao", "abh", "abv", "acm", "acq", "acw", "acx", "acy", "adf", "ads", "aeb", "aec", "afb", "ajp", "apc", "apd", "arb", "arq", "ars", "ary", "arz", "auz", "avl", "ayh", "ayl", "ayn", "ayp", "bbz", "pga", "he", "iw", "ps", "pbt", "pbu", "pst", "prp", "prd", "ug", "ur", "ydd", "yds", "yih", "ji", "yi", "hbo", "men", "xmn", "fa", "jpr", "peo", "pes", "prs", "dv", "sam", "ckb"], i = ((a = this.services) == null ? void 0 : a.languageUtils) || new $m(Gm());
      return n.indexOf(i.getLanguagePartFromCode(e)) > -1 || e.toLowerCase().indexOf("-arab") > 1 ? "rtl" : "ltr";
    }
    static createInstance() {
      let e = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {}, n = arguments.length > 1 ? arguments[1] : void 0;
      return new bs(e, n);
    }
    cloneInstance() {
      let e = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {}, n = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : il;
      const i = e.forkResourceStore;
      i && delete e.forkResourceStore;
      const s = {
        ...this.options,
        ...e,
        isClone: !0
      }, a = new bs(s);
      if ((e.debug !== void 0 || e.prefix !== void 0) && (a.logger = a.logger.clone(e)), ["store", "services", "language"].forEach((d) => {
        a[d] = this[d];
      }), a.services = {
        ...this.services
      }, a.services.utils = {
        hasLoadedNamespace: a.hasLoadedNamespace.bind(a)
      }, i) {
        const d = Object.keys(this.store.data).reduce((f, p) => (f[p] = {
          ...this.store.data[p]
        }, Object.keys(f[p]).reduce((m, v) => (m[v] = {
          ...f[p][v]
        }, m), {})), {});
        a.store = new Fm(d, s), a.services.resourceStore = a.store;
      }
      return a.translator = new rl(a.services, s), a.translator.on("*", function(d) {
        for (var f = arguments.length, p = new Array(f > 1 ? f - 1 : 0), m = 1; m < f; m++)
          p[m - 1] = arguments[m];
        a.emit(d, ...p);
      }), a.init(s, n), a.translator.options = s, a.translator.backendConnector.services.utils = {
        hasLoadedNamespace: a.hasLoadedNamespace.bind(a)
      }, a;
    }
    toJSON() {
      return {
        options: this.options,
        store: this.store,
        language: this.language,
        languages: this.languages,
        resolvedLanguage: this.resolvedLanguage
      };
    }
  }
  const kt = bs.createInstance();
  kt.createInstance = bs.createInstance, kt.createInstance, kt.dir, kt.init, kt.loadResources, kt.reloadResources, kt.use, kt.changeLanguage, kt.getFixedT;
  const ox = kt.t;
  kt.exists, kt.setDefaultNamespace, kt.hasLoadedNamespace, kt.loadNamespaces, kt.loadLanguages;
  function Ym(t) {
    return t && t.__esModule && Object.prototype.hasOwnProperty.call(t, "default") ? t.default : t;
  }
  var Km = { exports: {} }, Ne = {};
  /**
   * @license React
   * react.production.min.js
   *
   * Copyright (c) Facebook, Inc. and its affiliates.
   *
   * This source code is licensed under the MIT license found in the
   * LICENSE file in the root directory of this source tree.
   */
  var Zm;
  function sx() {
    if (Zm)
      return Ne;
    Zm = 1;
    var t = Symbol.for("react.element"), e = Symbol.for("react.portal"), n = Symbol.for("react.fragment"), i = Symbol.for("react.strict_mode"), s = Symbol.for("react.profiler"), a = Symbol.for("react.provider"), u = Symbol.for("react.context"), d = Symbol.for("react.forward_ref"), f = Symbol.for("react.suspense"), p = Symbol.for("react.memo"), m = Symbol.for("react.lazy"), v = Symbol.iterator;
    function y(T) {
      return T === null || typeof T != "object" ? null : (T = v && T[v] || T["@@iterator"], typeof T == "function" ? T : null);
    }
    var E = { isMounted: function() {
      return !1;
    }, enqueueForceUpdate: function() {
    }, enqueueReplaceState: function() {
    }, enqueueSetState: function() {
    } }, S = Object.assign, x = {};
    function C(T, U, X) {
      this.props = T, this.context = U, this.refs = x, this.updater = X || E;
    }
    C.prototype.isReactComponent = {}, C.prototype.setState = function(T, U) {
      if (typeof T != "object" && typeof T != "function" && T != null)
        throw Error("setState(...): takes an object of state variables to update or a function which returns an object of state variables.");
      this.updater.enqueueSetState(this, T, U, "setState");
    }, C.prototype.forceUpdate = function(T) {
      this.updater.enqueueForceUpdate(this, T, "forceUpdate");
    };
    function L() {
    }
    L.prototype = C.prototype;
    function k(T, U, X) {
      this.props = T, this.context = U, this.refs = x, this.updater = X || E;
    }
    var I = k.prototype = new L();
    I.constructor = k, S(I, C.prototype), I.isPureReactComponent = !0;
    var B = Array.isArray, V = Object.prototype.hasOwnProperty, P = { current: null }, R = { key: !0, ref: !0, __self: !0, __source: !0 };
    function j(T, U, X) {
      var Se, de = {}, Oe = null, _e = null;
      if (U != null)
        for (Se in U.ref !== void 0 && (_e = U.ref), U.key !== void 0 && (Oe = "" + U.key), U)
          V.call(U, Se) && !R.hasOwnProperty(Se) && (de[Se] = U[Se]);
      var Pe = arguments.length - 2;
      if (Pe === 1)
        de.children = X;
      else if (1 < Pe) {
        for (var Ae = Array(Pe), st = 0; st < Pe; st++)
          Ae[st] = arguments[st + 2];
        de.children = Ae;
      }
      if (T && T.defaultProps)
        for (Se in Pe = T.defaultProps, Pe)
          de[Se] === void 0 && (de[Se] = Pe[Se]);
      return { $$typeof: t, type: T, key: Oe, ref: _e, props: de, _owner: P.current };
    }
    function G(T, U) {
      return { $$typeof: t, type: T.type, key: U, ref: T.ref, props: T.props, _owner: T._owner };
    }
    function ee(T) {
      return typeof T == "object" && T !== null && T.$$typeof === t;
    }
    function W(T) {
      var U = { "=": "=0", ":": "=2" };
      return "$" + T.replace(/[=:]/g, function(X) {
        return U[X];
      });
    }
    var re = /\/+/g;
    function we(T, U) {
      return typeof T == "object" && T !== null && T.key != null ? W("" + T.key) : U.toString(36);
    }
    function ye(T, U, X, Se, de) {
      var Oe = typeof T;
      (Oe === "undefined" || Oe === "boolean") && (T = null);
      var _e = !1;
      if (T === null)
        _e = !0;
      else
        switch (Oe) {
          case "string":
          case "number":
            _e = !0;
            break;
          case "object":
            switch (T.$$typeof) {
              case t:
              case e:
                _e = !0;
            }
        }
      if (_e)
        return _e = T, de = de(_e), T = Se === "" ? "." + we(_e, 0) : Se, B(de) ? (X = "", T != null && (X = T.replace(re, "$&/") + "/"), ye(de, U, X, "", function(st) {
          return st;
        })) : de != null && (ee(de) && (de = G(de, X + (!de.key || _e && _e.key === de.key ? "" : ("" + de.key).replace(re, "$&/") + "/") + T)), U.push(de)), 1;
      if (_e = 0, Se = Se === "" ? "." : Se + ":", B(T))
        for (var Pe = 0; Pe < T.length; Pe++) {
          Oe = T[Pe];
          var Ae = Se + we(Oe, Pe);
          _e += ye(Oe, U, X, Ae, de);
        }
      else if (Ae = y(T), typeof Ae == "function")
        for (T = Ae.call(T), Pe = 0; !(Oe = T.next()).done; )
          Oe = Oe.value, Ae = Se + we(Oe, Pe++), _e += ye(Oe, U, X, Ae, de);
      else if (Oe === "object")
        throw U = String(T), Error("Objects are not valid as a React child (found: " + (U === "[object Object]" ? "object with keys {" + Object.keys(T).join(", ") + "}" : U) + "). If you meant to render a collection of children, use an array instead.");
      return _e;
    }
    function be(T, U, X) {
      if (T == null)
        return T;
      var Se = [], de = 0;
      return ye(T, Se, "", "", function(Oe) {
        return U.call(X, Oe, de++);
      }), Se;
    }
    function Be(T) {
      if (T._status === -1) {
        var U = T._result;
        U = U(), U.then(function(X) {
          (T._status === 0 || T._status === -1) && (T._status = 1, T._result = X);
        }, function(X) {
          (T._status === 0 || T._status === -1) && (T._status = 2, T._result = X);
        }), T._status === -1 && (T._status = 0, T._result = U);
      }
      if (T._status === 1)
        return T._result.default;
      throw T._result;
    }
    var ge = { current: null }, q = { transition: null }, Q = { ReactCurrentDispatcher: ge, ReactCurrentBatchConfig: q, ReactCurrentOwner: P };
    return Ne.Children = { map: be, forEach: function(T, U, X) {
      be(T, function() {
        U.apply(this, arguments);
      }, X);
    }, count: function(T) {
      var U = 0;
      return be(T, function() {
        U++;
      }), U;
    }, toArray: function(T) {
      return be(T, function(U) {
        return U;
      }) || [];
    }, only: function(T) {
      if (!ee(T))
        throw Error("React.Children.only expected to receive a single React element child.");
      return T;
    } }, Ne.Component = C, Ne.Fragment = n, Ne.Profiler = s, Ne.PureComponent = k, Ne.StrictMode = i, Ne.Suspense = f, Ne.__SECRET_INTERNALS_DO_NOT_USE_OR_YOU_WILL_BE_FIRED = Q, Ne.cloneElement = function(T, U, X) {
      if (T == null)
        throw Error("React.cloneElement(...): The argument must be a React element, but you passed " + T + ".");
      var Se = S({}, T.props), de = T.key, Oe = T.ref, _e = T._owner;
      if (U != null) {
        if (U.ref !== void 0 && (Oe = U.ref, _e = P.current), U.key !== void 0 && (de = "" + U.key), T.type && T.type.defaultProps)
          var Pe = T.type.defaultProps;
        for (Ae in U)
          V.call(U, Ae) && !R.hasOwnProperty(Ae) && (Se[Ae] = U[Ae] === void 0 && Pe !== void 0 ? Pe[Ae] : U[Ae]);
      }
      var Ae = arguments.length - 2;
      if (Ae === 1)
        Se.children = X;
      else if (1 < Ae) {
        Pe = Array(Ae);
        for (var st = 0; st < Ae; st++)
          Pe[st] = arguments[st + 2];
        Se.children = Pe;
      }
      return { $$typeof: t, type: T.type, key: de, ref: Oe, props: Se, _owner: _e };
    }, Ne.createContext = function(T) {
      return T = { $$typeof: u, _currentValue: T, _currentValue2: T, _threadCount: 0, Provider: null, Consumer: null, _defaultValue: null, _globalName: null }, T.Provider = { $$typeof: a, _context: T }, T.Consumer = T;
    }, Ne.createElement = j, Ne.createFactory = function(T) {
      var U = j.bind(null, T);
      return U.type = T, U;
    }, Ne.createRef = function() {
      return { current: null };
    }, Ne.forwardRef = function(T) {
      return { $$typeof: d, render: T };
    }, Ne.isValidElement = ee, Ne.lazy = function(T) {
      return { $$typeof: m, _payload: { _status: -1, _result: T }, _init: Be };
    }, Ne.memo = function(T, U) {
      return { $$typeof: p, type: T, compare: U === void 0 ? null : U };
    }, Ne.startTransition = function(T) {
      var U = q.transition;
      q.transition = {};
      try {
        T();
      } finally {
        q.transition = U;
      }
    }, Ne.unstable_act = function() {
      throw Error("act(...) is not supported in production builds of React.");
    }, Ne.useCallback = function(T, U) {
      return ge.current.useCallback(T, U);
    }, Ne.useContext = function(T) {
      return ge.current.useContext(T);
    }, Ne.useDebugValue = function() {
    }, Ne.useDeferredValue = function(T) {
      return ge.current.useDeferredValue(T);
    }, Ne.useEffect = function(T, U) {
      return ge.current.useEffect(T, U);
    }, Ne.useId = function() {
      return ge.current.useId();
    }, Ne.useImperativeHandle = function(T, U, X) {
      return ge.current.useImperativeHandle(T, U, X);
    }, Ne.useInsertionEffect = function(T, U) {
      return ge.current.useInsertionEffect(T, U);
    }, Ne.useLayoutEffect = function(T, U) {
      return ge.current.useLayoutEffect(T, U);
    }, Ne.useMemo = function(T, U) {
      return ge.current.useMemo(T, U);
    }, Ne.useReducer = function(T, U, X) {
      return ge.current.useReducer(T, U, X);
    }, Ne.useRef = function(T) {
      return ge.current.useRef(T);
    }, Ne.useState = function(T) {
      return ge.current.useState(T);
    }, Ne.useSyncExternalStore = function(T, U, X) {
      return ge.current.useSyncExternalStore(T, U, X);
    }, Ne.useTransition = function() {
      return ge.current.useTransition();
    }, Ne.version = "18.2.0", Ne;
  }
  Km.exports = sx();
  var N = Km.exports;
  const gt = /* @__PURE__ */ Ym(N), ax = (t, e, n, i) => {
    var a, u, d, f;
    const s = [n, {
      code: e,
      ...i || {}
    }];
    if ((u = (a = t == null ? void 0 : t.services) == null ? void 0 : a.logger) != null && u.forward)
      return t.services.logger.forward(s, "warn", "react-i18next::", !0);
    Li(s[0]) && (s[0] = `react-i18next:: ${s[0]}`), (f = (d = t == null ? void 0 : t.services) == null ? void 0 : d.logger) != null && f.warn ? t.services.logger.warn(...s) : console != null && console.warn && console.warn(...s);
  }, Xm = {}, cd = (t, e, n, i) => {
    Li(n) && Xm[n] || (Li(n) && (Xm[n] = /* @__PURE__ */ new Date()), ax(t, e, n, i));
  }, Jm = (t, e) => () => {
    if (t.isInitialized)
      e();
    else {
      const n = () => {
        setTimeout(() => {
          t.off("initialized", n);
        }, 0), e();
      };
      t.on("initialized", n);
    }
  }, dd = (t, e, n) => {
    t.loadNamespaces(e, Jm(t, n));
  }, Qm = (t, e, n, i) => {
    if (Li(n) && (n = [n]), t.options.preload && t.options.preload.indexOf(e) > -1)
      return dd(t, n, i);
    n.forEach((s) => {
      t.options.ns.indexOf(s) < 0 && t.options.ns.push(s);
    }), t.loadLanguages(e, Jm(t, i));
  }, lx = (t, e, n = {}) => !e.languages || !e.languages.length ? (cd(e, "NO_LANGUAGES", "i18n.languages were undefined or empty", {
    languages: e.languages
  }), !0) : e.hasLoadedNamespace(t, {
    lng: n.lng,
    precheck: (i, s) => {
      var a;
      if (((a = n.bindI18n) == null ? void 0 : a.indexOf("languageChanging")) > -1 && i.services.backendConnector.backend && i.isLanguageChangingTo && !s(i.isLanguageChangingTo, t))
        return !1;
    }
  }), Li = (t) => typeof t == "string", ux = (t) => typeof t == "object" && t !== null, cx = /&(?:amp|#38|lt|#60|gt|#62|apos|#39|quot|#34|nbsp|#160|copy|#169|reg|#174|hellip|#8230|#x2F|#47);/g, dx = {
    "&amp;": "&",
    "&#38;": "&",
    "&lt;": "<",
    "&#60;": "<",
    "&gt;": ">",
    "&#62;": ">",
    "&apos;": "'",
    "&#39;": "'",
    "&quot;": '"',
    "&#34;": '"',
    "&nbsp;": " ",
    "&#160;": " ",
    "&copy;": "©",
    "&#169;": "©",
    "&reg;": "®",
    "&#174;": "®",
    "&hellip;": "…",
    "&#8230;": "…",
    "&#x2F;": "/",
    "&#47;": "/"
  }, fx = (t) => dx[t];
  let fd = {
    bindI18n: "languageChanged",
    bindI18nStore: "",
    transEmptyNodeValue: "",
    transSupportBasicHtmlNodes: !0,
    transWrapTextNodes: "",
    transKeepBasicHtmlNodesFor: ["br", "strong", "i", "p"],
    useSuspense: !0,
    unescape: (t) => t.replace(cx, fx)
  };
  const hx = (t = {}) => {
    fd = {
      ...fd,
      ...t
    };
  }, px = () => fd;
  let eg;
  const mx = (t) => {
    eg = t;
  }, gx = () => eg, tg = {
    type: "3rdParty",
    init(t) {
      hx(t.options.react), mx(t);
    }
  }, vx = N.createContext();
  class yx {
    constructor() {
      this.usedNamespaces = {};
    }
    addUsedNamespaces(e) {
      e.forEach((n) => {
        this.usedNamespaces[n] || (this.usedNamespaces[n] = !0);
      });
    }
    getUsedNamespaces() {
      return Object.keys(this.usedNamespaces);
    }
  }
  const wx = (t, e) => {
    const n = N.useRef();
    return N.useEffect(() => {
      n.current = e ? n.current : t;
    }, [t, e]), n.current;
  }, ng = (t, e, n, i) => t.getFixedT(e, n, i), Sx = (t, e, n, i) => N.useCallback(ng(t, e, n, i), [t, e, n, i]), or = (t, e = {}) => {
    var B, V, P, R;
    const {
      i18n: n
    } = e, {
      i18n: i,
      defaultNS: s
    } = N.useContext(vx) || {}, a = n || i || gx();
    if (a && !a.reportNamespaces && (a.reportNamespaces = new yx()), !a) {
      cd(a, "NO_I18NEXT_INSTANCE", "useTranslation: You will need to pass in an i18next instance by using initReactI18next");
      const j = (ee, W) => Li(W) ? W : ux(W) && Li(W.defaultValue) ? W.defaultValue : Array.isArray(ee) ? ee[ee.length - 1] : ee, G = [j, {}, !1];
      return G.t = j, G.i18n = {}, G.ready = !1, G;
    }
    (B = a.options.react) != null && B.wait && cd(a, "DEPRECATED_OPTION", "useTranslation: It seems you are still using the old wait option, you may migrate to the new useSuspense behaviour.");
    const u = {
      ...px(),
      ...a.options.react,
      ...e
    }, {
      useSuspense: d,
      keyPrefix: f
    } = u;
    let p = t || s || ((V = a.options) == null ? void 0 : V.defaultNS);
    p = Li(p) ? [p] : p || ["translation"], (R = (P = a.reportNamespaces).addUsedNamespaces) == null || R.call(P, p);
    const m = (a.isInitialized || a.initializedStoreOnce) && p.every((j) => lx(j, a, u)), v = Sx(a, e.lng || null, u.nsMode === "fallback" ? p : p[0], f), y = () => v, E = () => ng(a, e.lng || null, u.nsMode === "fallback" ? p : p[0], f), [S, x] = N.useState(y);
    let C = p.join();
    e.lng && (C = `${e.lng}${C}`);
    const L = wx(C), k = N.useRef(!0);
    N.useEffect(() => {
      const {
        bindI18n: j,
        bindI18nStore: G
      } = u;
      k.current = !0, !m && !d && (e.lng ? Qm(a, e.lng, p, () => {
        k.current && x(E);
      }) : dd(a, p, () => {
        k.current && x(E);
      })), m && L && L !== C && k.current && x(E);
      const ee = () => {
        k.current && x(E);
      };
      return j && (a == null || a.on(j, ee)), G && (a == null || a.store.on(G, ee)), () => {
        k.current = !1, a && (j == null || j.split(" ").forEach((W) => a.off(W, ee))), G && a && G.split(" ").forEach((W) => a.store.off(W, ee));
      };
    }, [a, C]), N.useEffect(() => {
      k.current && m && x(y);
    }, [a, f, m]);
    const I = [S, a, m];
    if (I.t = S, I.i18n = a, I.ready = m, m || !m && !d)
      return I;
    throw new Promise((j) => {
      e.lng ? Qm(a, e.lng, p, () => j()) : dd(a, p, () => j());
    });
  };
  var rg = { exports: {} }, Cs = {};
  /**
   * @license React
   * react-jsx-runtime.production.min.js
   *
   * Copyright (c) Facebook, Inc. and its affiliates.
   *
   * This source code is licensed under the MIT license found in the
   * LICENSE file in the root directory of this source tree.
   */
  var ig;
  function Ex() {
    if (ig)
      return Cs;
    ig = 1;
    var t = N, e = Symbol.for("react.element"), n = Symbol.for("react.fragment"), i = Object.prototype.hasOwnProperty, s = t.__SECRET_INTERNALS_DO_NOT_USE_OR_YOU_WILL_BE_FIRED.ReactCurrentOwner, a = { key: !0, ref: !0, __self: !0, __source: !0 };
    function u(d, f, p) {
      var m, v = {}, y = null, E = null;
      p !== void 0 && (y = "" + p), f.key !== void 0 && (y = "" + f.key), f.ref !== void 0 && (E = f.ref);
      for (m in f)
        i.call(f, m) && !a.hasOwnProperty(m) && (v[m] = f[m]);
      if (d && d.defaultProps)
        for (m in f = d.defaultProps, f)
          v[m] === void 0 && (v[m] = f[m]);
      return { $$typeof: e, type: d, key: y, ref: E, props: v, _owner: s.current };
    }
    return Cs.Fragment = n, Cs.jsx = u, Cs.jsxs = u, Cs;
  }
  rg.exports = Ex();
  var O = rg.exports;
  function og(t, e) {
    return function() {
      return t.apply(e, arguments);
    };
  }
  const { toString: xx } = Object.prototype, { getPrototypeOf: hd } = Object, ol = /* @__PURE__ */ ((t) => (e) => {
    const n = xx.call(e);
    return t[n] || (t[n] = n.slice(8, -1).toLowerCase());
  })(/* @__PURE__ */ Object.create(null)), Hn = (t) => (t = t.toLowerCase(), (e) => ol(e) === t), sl = (t) => (e) => typeof e === t, { isArray: yo } = Array, Ts = sl("undefined");
  function bx(t) {
    return t !== null && !Ts(t) && t.constructor !== null && !Ts(t.constructor) && vn(t.constructor.isBuffer) && t.constructor.isBuffer(t);
  }
  const sg = Hn("ArrayBuffer");
  function Cx(t) {
    let e;
    return typeof ArrayBuffer < "u" && ArrayBuffer.isView ? e = ArrayBuffer.isView(t) : e = t && t.buffer && sg(t.buffer), e;
  }
  const Tx = sl("string"), vn = sl("function"), ag = sl("number"), al = (t) => t !== null && typeof t == "object", Ox = (t) => t === !0 || t === !1, ll = (t) => {
    if (ol(t) !== "object")
      return !1;
    const e = hd(t);
    return (e === null || e === Object.prototype || Object.getPrototypeOf(e) === null) && !(Symbol.toStringTag in t) && !(Symbol.iterator in t);
  }, _x = Hn("Date"), Rx = Hn("File"), Lx = Hn("Blob"), Ax = Hn("FileList"), kx = (t) => al(t) && vn(t.pipe), Px = (t) => {
    let e;
    return t && (typeof FormData == "function" && t instanceof FormData || vn(t.append) && ((e = ol(t)) === "formdata" || // detect form-data instance
    e === "object" && vn(t.toString) && t.toString() === "[object FormData]"));
  }, Ix = Hn("URLSearchParams"), [Nx, Dx, jx, Mx] = ["ReadableStream", "Request", "Response", "Headers"].map(Hn), Fx = (t) => t.trim ? t.trim() : t.replace(/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g, "");
  function Os(t, e, { allOwnKeys: n = !1 } = {}) {
    if (t === null || typeof t > "u")
      return;
    let i, s;
    if (typeof t != "object" && (t = [t]), yo(t))
      for (i = 0, s = t.length; i < s; i++)
        e.call(null, t[i], i, t);
    else {
      const a = n ? Object.getOwnPropertyNames(t) : Object.keys(t), u = a.length;
      let d;
      for (i = 0; i < u; i++)
        d = a[i], e.call(null, t[d], d, t);
    }
  }
  function lg(t, e) {
    e = e.toLowerCase();
    const n = Object.keys(t);
    let i = n.length, s;
    for (; i-- > 0; )
      if (s = n[i], e === s.toLowerCase())
        return s;
    return null;
  }
  const Ai = typeof globalThis < "u" ? globalThis : typeof self < "u" ? self : typeof window < "u" ? window : global, ug = (t) => !Ts(t) && t !== Ai;
  function pd() {
    const { caseless: t } = ug(this) && this || {}, e = {}, n = (i, s) => {
      const a = t && lg(e, s) || s;
      ll(e[a]) && ll(i) ? e[a] = pd(e[a], i) : ll(i) ? e[a] = pd({}, i) : yo(i) ? e[a] = i.slice() : e[a] = i;
    };
    for (let i = 0, s = arguments.length; i < s; i++)
      arguments[i] && Os(arguments[i], n);
    return e;
  }
  const Hx = (t, e, n, { allOwnKeys: i } = {}) => (Os(e, (s, a) => {
    n && vn(s) ? t[a] = og(s, n) : t[a] = s;
  }, { allOwnKeys: i }), t), Bx = (t) => (t.charCodeAt(0) === 65279 && (t = t.slice(1)), t), Ux = (t, e, n, i) => {
    t.prototype = Object.create(e.prototype, i), t.prototype.constructor = t, Object.defineProperty(t, "super", {
      value: e.prototype
    }), n && Object.assign(t.prototype, n);
  }, $x = (t, e, n, i) => {
    let s, a, u;
    const d = {};
    if (e = e || {}, t == null)
      return e;
    do {
      for (s = Object.getOwnPropertyNames(t), a = s.length; a-- > 0; )
        u = s[a], (!i || i(u, t, e)) && !d[u] && (e[u] = t[u], d[u] = !0);
      t = n !== !1 && hd(t);
    } while (t && (!n || n(t, e)) && t !== Object.prototype);
    return e;
  }, zx = (t, e, n) => {
    t = String(t), (n === void 0 || n > t.length) && (n = t.length), n -= e.length;
    const i = t.indexOf(e, n);
    return i !== -1 && i === n;
  }, Vx = (t) => {
    if (!t)
      return null;
    if (yo(t))
      return t;
    let e = t.length;
    if (!ag(e))
      return null;
    const n = new Array(e);
    for (; e-- > 0; )
      n[e] = t[e];
    return n;
  }, Wx = /* @__PURE__ */ ((t) => (e) => t && e instanceof t)(typeof Uint8Array < "u" && hd(Uint8Array)), Gx = (t, e) => {
    const i = (t && t[Symbol.iterator]).call(t);
    let s;
    for (; (s = i.next()) && !s.done; ) {
      const a = s.value;
      e.call(t, a[0], a[1]);
    }
  }, qx = (t, e) => {
    let n;
    const i = [];
    for (; (n = t.exec(e)) !== null; )
      i.push(n);
    return i;
  }, Yx = Hn("HTMLFormElement"), Kx = (t) => t.toLowerCase().replace(
    /[-_\s]([a-z\d])(\w*)/g,
    function(n, i, s) {
      return i.toUpperCase() + s;
    }
  ), cg = (({ hasOwnProperty: t }) => (e, n) => t.call(e, n))(Object.prototype), Zx = Hn("RegExp"), dg = (t, e) => {
    const n = Object.getOwnPropertyDescriptors(t), i = {};
    Os(n, (s, a) => {
      let u;
      (u = e(s, a, t)) !== !1 && (i[a] = u || s);
    }), Object.defineProperties(t, i);
  }, Xx = (t) => {
    dg(t, (e, n) => {
      if (vn(t) && ["arguments", "caller", "callee"].indexOf(n) !== -1)
        return !1;
      const i = t[n];
      if (vn(i)) {
        if (e.enumerable = !1, "writable" in e) {
          e.writable = !1;
          return;
        }
        e.set || (e.set = () => {
          throw Error("Can not rewrite read-only method '" + n + "'");
        });
      }
    });
  }, Jx = (t, e) => {
    const n = {}, i = (s) => {
      s.forEach((a) => {
        n[a] = !0;
      });
    };
    return yo(t) ? i(t) : i(String(t).split(e)), n;
  }, Qx = () => {
  }, eb = (t, e) => t != null && Number.isFinite(t = +t) ? t : e;
  function tb(t) {
    return !!(t && vn(t.append) && t[Symbol.toStringTag] === "FormData" && t[Symbol.iterator]);
  }
  const nb = (t) => {
    const e = new Array(10), n = (i, s) => {
      if (al(i)) {
        if (e.indexOf(i) >= 0)
          return;
        if (!("toJSON" in i)) {
          e[s] = i;
          const a = yo(i) ? [] : {};
          return Os(i, (u, d) => {
            const f = n(u, s + 1);
            !Ts(f) && (a[d] = f);
          }), e[s] = void 0, a;
        }
      }
      return i;
    };
    return n(t, 0);
  }, rb = Hn("AsyncFunction"), ib = (t) => t && (al(t) || vn(t)) && vn(t.then) && vn(t.catch), fg = ((t, e) => t ? setImmediate : e ? ((n, i) => (Ai.addEventListener("message", ({ source: s, data: a }) => {
    s === Ai && a === n && i.length && i.shift()();
  }, !1), (s) => {
    i.push(s), Ai.postMessage(n, "*");
  }))(`axios@${Math.random()}`, []) : (n) => setTimeout(n))(
    typeof setImmediate == "function",
    vn(Ai.postMessage)
  ), ob = typeof queueMicrotask < "u" ? queueMicrotask.bind(Ai) : typeof process < "u" && process.nextTick || fg, z = {
    isArray: yo,
    isArrayBuffer: sg,
    isBuffer: bx,
    isFormData: Px,
    isArrayBufferView: Cx,
    isString: Tx,
    isNumber: ag,
    isBoolean: Ox,
    isObject: al,
    isPlainObject: ll,
    isReadableStream: Nx,
    isRequest: Dx,
    isResponse: jx,
    isHeaders: Mx,
    isUndefined: Ts,
    isDate: _x,
    isFile: Rx,
    isBlob: Lx,
    isRegExp: Zx,
    isFunction: vn,
    isStream: kx,
    isURLSearchParams: Ix,
    isTypedArray: Wx,
    isFileList: Ax,
    forEach: Os,
    merge: pd,
    extend: Hx,
    trim: Fx,
    stripBOM: Bx,
    inherits: Ux,
    toFlatObject: $x,
    kindOf: ol,
    kindOfTest: Hn,
    endsWith: zx,
    toArray: Vx,
    forEachEntry: Gx,
    matchAll: qx,
    isHTMLForm: Yx,
    hasOwnProperty: cg,
    hasOwnProp: cg,
    // an alias to avoid ESLint no-prototype-builtins detection
    reduceDescriptors: dg,
    freezeMethods: Xx,
    toObjectSet: Jx,
    toCamelCase: Kx,
    noop: Qx,
    toFiniteNumber: eb,
    findKey: lg,
    global: Ai,
    isContextDefined: ug,
    isSpecCompliantForm: tb,
    toJSONObject: nb,
    isAsyncFn: rb,
    isThenable: ib,
    setImmediate: fg,
    asap: ob
  };
  function Te(t, e, n, i, s) {
    Error.call(this), Error.captureStackTrace ? Error.captureStackTrace(this, this.constructor) : this.stack = new Error().stack, this.message = t, this.name = "AxiosError", e && (this.code = e), n && (this.config = n), i && (this.request = i), s && (this.response = s, this.status = s.status ? s.status : null);
  }
  z.inherits(Te, Error, {
    toJSON: function() {
      return {
        // Standard
        message: this.message,
        name: this.name,
        // Microsoft
        description: this.description,
        number: this.number,
        // Mozilla
        fileName: this.fileName,
        lineNumber: this.lineNumber,
        columnNumber: this.columnNumber,
        stack: this.stack,
        // Axios
        config: z.toJSONObject(this.config),
        code: this.code,
        status: this.status
      };
    }
  });
  const hg = Te.prototype, pg = {};
  [
    "ERR_BAD_OPTION_VALUE",
    "ERR_BAD_OPTION",
    "ECONNABORTED",
    "ETIMEDOUT",
    "ERR_NETWORK",
    "ERR_FR_TOO_MANY_REDIRECTS",
    "ERR_DEPRECATED",
    "ERR_BAD_RESPONSE",
    "ERR_BAD_REQUEST",
    "ERR_CANCELED",
    "ERR_NOT_SUPPORT",
    "ERR_INVALID_URL"
    // eslint-disable-next-line func-names
  ].forEach((t) => {
    pg[t] = { value: t };
  }), Object.defineProperties(Te, pg), Object.defineProperty(hg, "isAxiosError", { value: !0 }), Te.from = (t, e, n, i, s, a) => {
    const u = Object.create(hg);
    return z.toFlatObject(t, u, function(f) {
      return f !== Error.prototype;
    }, (d) => d !== "isAxiosError"), Te.call(u, t.message, e, n, i, s), u.cause = t, u.name = t.name, a && Object.assign(u, a), u;
  };
  const sb = null;
  function md(t) {
    return z.isPlainObject(t) || z.isArray(t);
  }
  function mg(t) {
    return z.endsWith(t, "[]") ? t.slice(0, -2) : t;
  }
  function gg(t, e, n) {
    return t ? t.concat(e).map(function(s, a) {
      return s = mg(s), !n && a ? "[" + s + "]" : s;
    }).join(n ? "." : "") : e;
  }
  function ab(t) {
    return z.isArray(t) && !t.some(md);
  }
  const lb = z.toFlatObject(z, {}, null, function(e) {
    return /^is[A-Z]/.test(e);
  });
  function ul(t, e, n) {
    if (!z.isObject(t))
      throw new TypeError("target must be an object");
    e = e || new FormData(), n = z.toFlatObject(n, {
      metaTokens: !0,
      dots: !1,
      indexes: !1
    }, !1, function(x, C) {
      return !z.isUndefined(C[x]);
    });
    const i = n.metaTokens, s = n.visitor || m, a = n.dots, u = n.indexes, f = (n.Blob || typeof Blob < "u" && Blob) && z.isSpecCompliantForm(e);
    if (!z.isFunction(s))
      throw new TypeError("visitor must be a function");
    function p(S) {
      if (S === null)
        return "";
      if (z.isDate(S))
        return S.toISOString();
      if (!f && z.isBlob(S))
        throw new Te("Blob is not supported. Use a Buffer instead.");
      return z.isArrayBuffer(S) || z.isTypedArray(S) ? f && typeof Blob == "function" ? new Blob([S]) : Buffer.from(S) : S;
    }
    function m(S, x, C) {
      let L = S;
      if (S && !C && typeof S == "object") {
        if (z.endsWith(x, "{}"))
          x = i ? x : x.slice(0, -2), S = JSON.stringify(S);
        else if (z.isArray(S) && ab(S) || (z.isFileList(S) || z.endsWith(x, "[]")) && (L = z.toArray(S)))
          return x = mg(x), L.forEach(function(I, B) {
            !(z.isUndefined(I) || I === null) && e.append(
              // eslint-disable-next-line no-nested-ternary
              u === !0 ? gg([x], B, a) : u === null ? x : x + "[]",
              p(I)
            );
          }), !1;
      }
      return md(S) ? !0 : (e.append(gg(C, x, a), p(S)), !1);
    }
    const v = [], y = Object.assign(lb, {
      defaultVisitor: m,
      convertValue: p,
      isVisitable: md
    });
    function E(S, x) {
      if (!z.isUndefined(S)) {
        if (v.indexOf(S) !== -1)
          throw Error("Circular reference detected in " + x.join("."));
        v.push(S), z.forEach(S, function(L, k) {
          (!(z.isUndefined(L) || L === null) && s.call(
            e,
            L,
            z.isString(k) ? k.trim() : k,
            x,
            y
          )) === !0 && E(L, x ? x.concat(k) : [k]);
        }), v.pop();
      }
    }
    if (!z.isObject(t))
      throw new TypeError("data must be an object");
    return E(t), e;
  }
  function vg(t) {
    const e = {
      "!": "%21",
      "'": "%27",
      "(": "%28",
      ")": "%29",
      "~": "%7E",
      "%20": "+",
      "%00": "\0"
    };
    return encodeURIComponent(t).replace(/[!'()~]|%20|%00/g, function(i) {
      return e[i];
    });
  }
  function gd(t, e) {
    this._pairs = [], t && ul(t, this, e);
  }
  const yg = gd.prototype;
  yg.append = function(e, n) {
    this._pairs.push([e, n]);
  }, yg.toString = function(e) {
    const n = e ? function(i) {
      return e.call(this, i, vg);
    } : vg;
    return this._pairs.map(function(s) {
      return n(s[0]) + "=" + n(s[1]);
    }, "").join("&");
  };
  function ub(t) {
    return encodeURIComponent(t).replace(/%3A/gi, ":").replace(/%24/g, "$").replace(/%2C/gi, ",").replace(/%20/g, "+").replace(/%5B/gi, "[").replace(/%5D/gi, "]");
  }
  function wg(t, e, n) {
    if (!e)
      return t;
    const i = n && n.encode || ub;
    z.isFunction(n) && (n = {
      serialize: n
    });
    const s = n && n.serialize;
    let a;
    if (s ? a = s(e, n) : a = z.isURLSearchParams(e) ? e.toString() : new gd(e, n).toString(i), a) {
      const u = t.indexOf("#");
      u !== -1 && (t = t.slice(0, u)), t += (t.indexOf("?") === -1 ? "?" : "&") + a;
    }
    return t;
  }
  class Sg {
    constructor() {
      this.handlers = [];
    }
    /**
     * Add a new interceptor to the stack
     *
     * @param {Function} fulfilled The function to handle `then` for a `Promise`
     * @param {Function} rejected The function to handle `reject` for a `Promise`
     *
     * @return {Number} An ID used to remove interceptor later
     */
    use(e, n, i) {
      return this.handlers.push({
        fulfilled: e,
        rejected: n,
        synchronous: i ? i.synchronous : !1,
        runWhen: i ? i.runWhen : null
      }), this.handlers.length - 1;
    }
    /**
     * Remove an interceptor from the stack
     *
     * @param {Number} id The ID that was returned by `use`
     *
     * @returns {Boolean} `true` if the interceptor was removed, `false` otherwise
     */
    eject(e) {
      this.handlers[e] && (this.handlers[e] = null);
    }
    /**
     * Clear all interceptors from the stack
     *
     * @returns {void}
     */
    clear() {
      this.handlers && (this.handlers = []);
    }
    /**
     * Iterate over all the registered interceptors
     *
     * This method is particularly useful for skipping over any
     * interceptors that may have become `null` calling `eject`.
     *
     * @param {Function} fn The function to call for each interceptor
     *
     * @returns {void}
     */
    forEach(e) {
      z.forEach(this.handlers, function(i) {
        i !== null && e(i);
      });
    }
  }
  const Eg = {
    silentJSONParsing: !0,
    forcedJSONParsing: !0,
    clarifyTimeoutError: !1
  }, cb = {
    isBrowser: !0,
    classes: {
      URLSearchParams: typeof URLSearchParams < "u" ? URLSearchParams : gd,
      FormData: typeof FormData < "u" ? FormData : null,
      Blob: typeof Blob < "u" ? Blob : null
    },
    protocols: ["http", "https", "file", "blob", "url", "data"]
  }, vd = typeof window < "u" && typeof document < "u", yd = typeof navigator == "object" && navigator || void 0, db = vd && (!yd || ["ReactNative", "NativeScript", "NS"].indexOf(yd.product) < 0), fb = typeof WorkerGlobalScope < "u" && // eslint-disable-next-line no-undef
  self instanceof WorkerGlobalScope && typeof self.importScripts == "function", hb = vd && window.location.href || "http://localhost", Gt = {
    .../* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
      __proto__: null,
      hasBrowserEnv: vd,
      hasStandardBrowserEnv: db,
      hasStandardBrowserWebWorkerEnv: fb,
      navigator: yd,
      origin: hb
    }, Symbol.toStringTag, { value: "Module" })),
    ...cb
  };
  function pb(t, e) {
    return ul(t, new Gt.classes.URLSearchParams(), Object.assign({
      visitor: function(n, i, s, a) {
        return Gt.isNode && z.isBuffer(n) ? (this.append(i, n.toString("base64")), !1) : a.defaultVisitor.apply(this, arguments);
      }
    }, e));
  }
  function mb(t) {
    return z.matchAll(/\w+|\[(\w*)]/g, t).map((e) => e[0] === "[]" ? "" : e[1] || e[0]);
  }
  function gb(t) {
    const e = {}, n = Object.keys(t);
    let i;
    const s = n.length;
    let a;
    for (i = 0; i < s; i++)
      a = n[i], e[a] = t[a];
    return e;
  }
  function xg(t) {
    function e(n, i, s, a) {
      let u = n[a++];
      if (u === "__proto__")
        return !0;
      const d = Number.isFinite(+u), f = a >= n.length;
      return u = !u && z.isArray(s) ? s.length : u, f ? (z.hasOwnProp(s, u) ? s[u] = [s[u], i] : s[u] = i, !d) : ((!s[u] || !z.isObject(s[u])) && (s[u] = []), e(n, i, s[u], a) && z.isArray(s[u]) && (s[u] = gb(s[u])), !d);
    }
    if (z.isFormData(t) && z.isFunction(t.entries)) {
      const n = {};
      return z.forEachEntry(t, (i, s) => {
        e(mb(i), s, n, 0);
      }), n;
    }
    return null;
  }
  function vb(t, e, n) {
    if (z.isString(t))
      try {
        return (e || JSON.parse)(t), z.trim(t);
      } catch (i) {
        if (i.name !== "SyntaxError")
          throw i;
      }
    return (n || JSON.stringify)(t);
  }
  const wd = {
    transitional: Eg,
    adapter: ["xhr", "http", "fetch"],
    transformRequest: [function(e, n) {
      const i = n.getContentType() || "", s = i.indexOf("application/json") > -1, a = z.isObject(e);
      if (a && z.isHTMLForm(e) && (e = new FormData(e)), z.isFormData(e))
        return s ? JSON.stringify(xg(e)) : e;
      if (z.isArrayBuffer(e) || z.isBuffer(e) || z.isStream(e) || z.isFile(e) || z.isBlob(e) || z.isReadableStream(e))
        return e;
      if (z.isArrayBufferView(e))
        return e.buffer;
      if (z.isURLSearchParams(e))
        return n.setContentType("application/x-www-form-urlencoded;charset=utf-8", !1), e.toString();
      let d;
      if (a) {
        if (i.indexOf("application/x-www-form-urlencoded") > -1)
          return pb(e, this.formSerializer).toString();
        if ((d = z.isFileList(e)) || i.indexOf("multipart/form-data") > -1) {
          const f = this.env && this.env.FormData;
          return ul(
            d ? { "files[]": e } : e,
            f && new f(),
            this.formSerializer
          );
        }
      }
      return a || s ? (n.setContentType("application/json", !1), vb(e)) : e;
    }],
    transformResponse: [function(e) {
      const n = this.transitional || wd.transitional, i = n && n.forcedJSONParsing, s = this.responseType === "json";
      if (z.isResponse(e) || z.isReadableStream(e))
        return e;
      if (e && z.isString(e) && (i && !this.responseType || s)) {
        const u = !(n && n.silentJSONParsing) && s;
        try {
          return JSON.parse(e);
        } catch (d) {
          if (u)
            throw d.name === "SyntaxError" ? Te.from(d, Te.ERR_BAD_RESPONSE, this, null, this.response) : d;
        }
      }
      return e;
    }],
    /**
     * A timeout in milliseconds to abort a request. If set to 0 (default) a
     * timeout is not created.
     */
    timeout: 0,
    xsrfCookieName: "XSRF-TOKEN",
    xsrfHeaderName: "X-XSRF-TOKEN",
    maxContentLength: -1,
    maxBodyLength: -1,
    env: {
      FormData: Gt.classes.FormData,
      Blob: Gt.classes.Blob
    },
    validateStatus: function(e) {
      return e >= 200 && e < 300;
    },
    headers: {
      common: {
        Accept: "application/json, text/plain, */*",
        "Content-Type": void 0
      }
    }
  };
  z.forEach(["delete", "get", "head", "post", "put", "patch"], (t) => {
    wd.headers[t] = {};
  });
  const Sd = wd, yb = z.toObjectSet([
    "age",
    "authorization",
    "content-length",
    "content-type",
    "etag",
    "expires",
    "from",
    "host",
    "if-modified-since",
    "if-unmodified-since",
    "last-modified",
    "location",
    "max-forwards",
    "proxy-authorization",
    "referer",
    "retry-after",
    "user-agent"
  ]), wb = (t) => {
    const e = {};
    let n, i, s;
    return t && t.split(`
`).forEach(function(u) {
      s = u.indexOf(":"), n = u.substring(0, s).trim().toLowerCase(), i = u.substring(s + 1).trim(), !(!n || e[n] && yb[n]) && (n === "set-cookie" ? e[n] ? e[n].push(i) : e[n] = [i] : e[n] = e[n] ? e[n] + ", " + i : i);
    }), e;
  }, bg = Symbol("internals");
  function _s(t) {
    return t && String(t).trim().toLowerCase();
  }
  function cl(t) {
    return t === !1 || t == null ? t : z.isArray(t) ? t.map(cl) : String(t);
  }
  function Sb(t) {
    const e = /* @__PURE__ */ Object.create(null), n = /([^\s,;=]+)\s*(?:=\s*([^,;]+))?/g;
    let i;
    for (; i = n.exec(t); )
      e[i[1]] = i[2];
    return e;
  }
  const Eb = (t) => /^[-_a-zA-Z0-9^`|~,!#$%&'*+.]+$/.test(t.trim());
  function Ed(t, e, n, i, s) {
    if (z.isFunction(i))
      return i.call(this, e, n);
    if (s && (e = n), !!z.isString(e)) {
      if (z.isString(i))
        return e.indexOf(i) !== -1;
      if (z.isRegExp(i))
        return i.test(e);
    }
  }
  function xb(t) {
    return t.trim().toLowerCase().replace(/([a-z\d])(\w*)/g, (e, n, i) => n.toUpperCase() + i);
  }
  function bb(t, e) {
    const n = z.toCamelCase(" " + e);
    ["get", "set", "has"].forEach((i) => {
      Object.defineProperty(t, i + n, {
        value: function(s, a, u) {
          return this[i].call(this, e, s, a, u);
        },
        configurable: !0
      });
    });
  }
  let dl = class {
    constructor(e) {
      e && this.set(e);
    }
    set(e, n, i) {
      const s = this;
      function a(d, f, p) {
        const m = _s(f);
        if (!m)
          throw new Error("header name must be a non-empty string");
        const v = z.findKey(s, m);
        (!v || s[v] === void 0 || p === !0 || p === void 0 && s[v] !== !1) && (s[v || f] = cl(d));
      }
      const u = (d, f) => z.forEach(d, (p, m) => a(p, m, f));
      if (z.isPlainObject(e) || e instanceof this.constructor)
        u(e, n);
      else if (z.isString(e) && (e = e.trim()) && !Eb(e))
        u(wb(e), n);
      else if (z.isHeaders(e))
        for (const [d, f] of e.entries())
          a(f, d, i);
      else
        e != null && a(n, e, i);
      return this;
    }
    get(e, n) {
      if (e = _s(e), e) {
        const i = z.findKey(this, e);
        if (i) {
          const s = this[i];
          if (!n)
            return s;
          if (n === !0)
            return Sb(s);
          if (z.isFunction(n))
            return n.call(this, s, i);
          if (z.isRegExp(n))
            return n.exec(s);
          throw new TypeError("parser must be boolean|regexp|function");
        }
      }
    }
    has(e, n) {
      if (e = _s(e), e) {
        const i = z.findKey(this, e);
        return !!(i && this[i] !== void 0 && (!n || Ed(this, this[i], i, n)));
      }
      return !1;
    }
    delete(e, n) {
      const i = this;
      let s = !1;
      function a(u) {
        if (u = _s(u), u) {
          const d = z.findKey(i, u);
          d && (!n || Ed(i, i[d], d, n)) && (delete i[d], s = !0);
        }
      }
      return z.isArray(e) ? e.forEach(a) : a(e), s;
    }
    clear(e) {
      const n = Object.keys(this);
      let i = n.length, s = !1;
      for (; i--; ) {
        const a = n[i];
        (!e || Ed(this, this[a], a, e, !0)) && (delete this[a], s = !0);
      }
      return s;
    }
    normalize(e) {
      const n = this, i = {};
      return z.forEach(this, (s, a) => {
        const u = z.findKey(i, a);
        if (u) {
          n[u] = cl(s), delete n[a];
          return;
        }
        const d = e ? xb(a) : String(a).trim();
        d !== a && delete n[a], n[d] = cl(s), i[d] = !0;
      }), this;
    }
    concat(...e) {
      return this.constructor.concat(this, ...e);
    }
    toJSON(e) {
      const n = /* @__PURE__ */ Object.create(null);
      return z.forEach(this, (i, s) => {
        i != null && i !== !1 && (n[s] = e && z.isArray(i) ? i.join(", ") : i);
      }), n;
    }
    [Symbol.iterator]() {
      return Object.entries(this.toJSON())[Symbol.iterator]();
    }
    toString() {
      return Object.entries(this.toJSON()).map(([e, n]) => e + ": " + n).join(`
`);
    }
    get [Symbol.toStringTag]() {
      return "AxiosHeaders";
    }
    static from(e) {
      return e instanceof this ? e : new this(e);
    }
    static concat(e, ...n) {
      const i = new this(e);
      return n.forEach((s) => i.set(s)), i;
    }
    static accessor(e) {
      const i = (this[bg] = this[bg] = {
        accessors: {}
      }).accessors, s = this.prototype;
      function a(u) {
        const d = _s(u);
        i[d] || (bb(s, u), i[d] = !0);
      }
      return z.isArray(e) ? e.forEach(a) : a(e), this;
    }
  };
  dl.accessor(["Content-Type", "Content-Length", "Accept", "Accept-Encoding", "User-Agent", "Authorization"]), z.reduceDescriptors(dl.prototype, ({ value: t }, e) => {
    let n = e[0].toUpperCase() + e.slice(1);
    return {
      get: () => t,
      set(i) {
        this[n] = i;
      }
    };
  }), z.freezeMethods(dl);
  const Bn = dl;
  function xd(t, e) {
    const n = this || Sd, i = e || n, s = Bn.from(i.headers);
    let a = i.data;
    return z.forEach(t, function(d) {
      a = d.call(n, a, s.normalize(), e ? e.status : void 0);
    }), s.normalize(), a;
  }
  function Cg(t) {
    return !!(t && t.__CANCEL__);
  }
  function wo(t, e, n) {
    Te.call(this, t ?? "canceled", Te.ERR_CANCELED, e, n), this.name = "CanceledError";
  }
  z.inherits(wo, Te, {
    __CANCEL__: !0
  });
  function Tg(t, e, n) {
    const i = n.config.validateStatus;
    !n.status || !i || i(n.status) ? t(n) : e(new Te(
      "Request failed with status code " + n.status,
      [Te.ERR_BAD_REQUEST, Te.ERR_BAD_RESPONSE][Math.floor(n.status / 100) - 4],
      n.config,
      n.request,
      n
    ));
  }
  function Cb(t) {
    const e = /^([-+\w]{1,25})(:?\/\/|:)/.exec(t);
    return e && e[1] || "";
  }
  function Tb(t, e) {
    t = t || 10;
    const n = new Array(t), i = new Array(t);
    let s = 0, a = 0, u;
    return e = e !== void 0 ? e : 1e3, function(f) {
      const p = Date.now(), m = i[a];
      u || (u = p), n[s] = f, i[s] = p;
      let v = a, y = 0;
      for (; v !== s; )
        y += n[v++], v = v % t;
      if (s = (s + 1) % t, s === a && (a = (a + 1) % t), p - u < e)
        return;
      const E = m && p - m;
      return E ? Math.round(y * 1e3 / E) : void 0;
    };
  }
  function Ob(t, e) {
    let n = 0, i = 1e3 / e, s, a;
    const u = (p, m = Date.now()) => {
      n = m, s = null, a && (clearTimeout(a), a = null), t.apply(null, p);
    };
    return [(...p) => {
      const m = Date.now(), v = m - n;
      v >= i ? u(p, m) : (s = p, a || (a = setTimeout(() => {
        a = null, u(s);
      }, i - v)));
    }, () => s && u(s)];
  }
  const fl = (t, e, n = 3) => {
    let i = 0;
    const s = Tb(50, 250);
    return Ob((a) => {
      const u = a.loaded, d = a.lengthComputable ? a.total : void 0, f = u - i, p = s(f), m = u <= d;
      i = u;
      const v = {
        loaded: u,
        total: d,
        progress: d ? u / d : void 0,
        bytes: f,
        rate: p || void 0,
        estimated: p && d && m ? (d - u) / p : void 0,
        event: a,
        lengthComputable: d != null,
        [e ? "download" : "upload"]: !0
      };
      t(v);
    }, n);
  }, Og = (t, e) => {
    const n = t != null;
    return [(i) => e[0]({
      lengthComputable: n,
      total: t,
      loaded: i
    }), e[1]];
  }, _g = (t) => (...e) => z.asap(() => t(...e)), _b = Gt.hasStandardBrowserEnv ? /* @__PURE__ */ ((t, e) => (n) => (n = new URL(n, Gt.origin), t.protocol === n.protocol && t.host === n.host && (e || t.port === n.port)))(
    new URL(Gt.origin),
    Gt.navigator && /(msie|trident)/i.test(Gt.navigator.userAgent)
  ) : () => !0, Rb = Gt.hasStandardBrowserEnv ? (
    // Standard browser envs support document.cookie
    {
      write(t, e, n, i, s, a) {
        const u = [t + "=" + encodeURIComponent(e)];
        z.isNumber(n) && u.push("expires=" + new Date(n).toGMTString()), z.isString(i) && u.push("path=" + i), z.isString(s) && u.push("domain=" + s), a === !0 && u.push("secure"), document.cookie = u.join("; ");
      },
      read(t) {
        const e = document.cookie.match(new RegExp("(^|;\\s*)(" + t + ")=([^;]*)"));
        return e ? decodeURIComponent(e[3]) : null;
      },
      remove(t) {
        this.write(t, "", Date.now() - 864e5);
      }
    }
  ) : (
    // Non-standard browser env (web workers, react-native) lack needed support.
    {
      write() {
      },
      read() {
        return null;
      },
      remove() {
      }
    }
  );
  function Lb(t) {
    return /^([a-z][a-z\d+\-.]*:)?\/\//i.test(t);
  }
  function Ab(t, e) {
    return e ? t.replace(/\/?\/$/, "") + "/" + e.replace(/^\/+/, "") : t;
  }
  function Rg(t, e, n) {
    let i = !Lb(e);
    return t && i || n == !1 ? Ab(t, e) : e;
  }
  const Lg = (t) => t instanceof Bn ? { ...t } : t;
  function ki(t, e) {
    e = e || {};
    const n = {};
    function i(p, m, v, y) {
      return z.isPlainObject(p) && z.isPlainObject(m) ? z.merge.call({ caseless: y }, p, m) : z.isPlainObject(m) ? z.merge({}, m) : z.isArray(m) ? m.slice() : m;
    }
    function s(p, m, v, y) {
      if (z.isUndefined(m)) {
        if (!z.isUndefined(p))
          return i(void 0, p, v, y);
      } else
        return i(p, m, v, y);
    }
    function a(p, m) {
      if (!z.isUndefined(m))
        return i(void 0, m);
    }
    function u(p, m) {
      if (z.isUndefined(m)) {
        if (!z.isUndefined(p))
          return i(void 0, p);
      } else
        return i(void 0, m);
    }
    function d(p, m, v) {
      if (v in e)
        return i(p, m);
      if (v in t)
        return i(void 0, p);
    }
    const f = {
      url: a,
      method: a,
      data: a,
      baseURL: u,
      transformRequest: u,
      transformResponse: u,
      paramsSerializer: u,
      timeout: u,
      timeoutMessage: u,
      withCredentials: u,
      withXSRFToken: u,
      adapter: u,
      responseType: u,
      xsrfCookieName: u,
      xsrfHeaderName: u,
      onUploadProgress: u,
      onDownloadProgress: u,
      decompress: u,
      maxContentLength: u,
      maxBodyLength: u,
      beforeRedirect: u,
      transport: u,
      httpAgent: u,
      httpsAgent: u,
      cancelToken: u,
      socketPath: u,
      responseEncoding: u,
      validateStatus: d,
      headers: (p, m, v) => s(Lg(p), Lg(m), v, !0)
    };
    return z.forEach(Object.keys(Object.assign({}, t, e)), function(m) {
      const v = f[m] || s, y = v(t[m], e[m], m);
      z.isUndefined(y) && v !== d || (n[m] = y);
    }), n;
  }
  const Ag = (t) => {
    const e = ki({}, t);
    let { data: n, withXSRFToken: i, xsrfHeaderName: s, xsrfCookieName: a, headers: u, auth: d } = e;
    e.headers = u = Bn.from(u), e.url = wg(Rg(e.baseURL, e.url), t.params, t.paramsSerializer), d && u.set(
      "Authorization",
      "Basic " + btoa((d.username || "") + ":" + (d.password ? unescape(encodeURIComponent(d.password)) : ""))
    );
    let f;
    if (z.isFormData(n)) {
      if (Gt.hasStandardBrowserEnv || Gt.hasStandardBrowserWebWorkerEnv)
        u.setContentType(void 0);
      else if ((f = u.getContentType()) !== !1) {
        const [p, ...m] = f ? f.split(";").map((v) => v.trim()).filter(Boolean) : [];
        u.setContentType([p || "multipart/form-data", ...m].join("; "));
      }
    }
    if (Gt.hasStandardBrowserEnv && (i && z.isFunction(i) && (i = i(e)), i || i !== !1 && _b(e.url))) {
      const p = s && a && Rb.read(a);
      p && u.set(s, p);
    }
    return e;
  }, kb = typeof XMLHttpRequest < "u" && function(t) {
    return new Promise(function(n, i) {
      const s = Ag(t);
      let a = s.data;
      const u = Bn.from(s.headers).normalize();
      let { responseType: d, onUploadProgress: f, onDownloadProgress: p } = s, m, v, y, E, S;
      function x() {
        E && E(), S && S(), s.cancelToken && s.cancelToken.unsubscribe(m), s.signal && s.signal.removeEventListener("abort", m);
      }
      let C = new XMLHttpRequest();
      C.open(s.method.toUpperCase(), s.url, !0), C.timeout = s.timeout;
      function L() {
        if (!C)
          return;
        const I = Bn.from(
          "getAllResponseHeaders" in C && C.getAllResponseHeaders()
        ), V = {
          data: !d || d === "text" || d === "json" ? C.responseText : C.response,
          status: C.status,
          statusText: C.statusText,
          headers: I,
          config: t,
          request: C
        };
        Tg(function(R) {
          n(R), x();
        }, function(R) {
          i(R), x();
        }, V), C = null;
      }
      "onloadend" in C ? C.onloadend = L : C.onreadystatechange = function() {
        !C || C.readyState !== 4 || C.status === 0 && !(C.responseURL && C.responseURL.indexOf("file:") === 0) || setTimeout(L);
      }, C.onabort = function() {
        C && (i(new Te("Request aborted", Te.ECONNABORTED, t, C)), C = null);
      }, C.onerror = function() {
        i(new Te("Network Error", Te.ERR_NETWORK, t, C)), C = null;
      }, C.ontimeout = function() {
        let B = s.timeout ? "timeout of " + s.timeout + "ms exceeded" : "timeout exceeded";
        const V = s.transitional || Eg;
        s.timeoutErrorMessage && (B = s.timeoutErrorMessage), i(new Te(
          B,
          V.clarifyTimeoutError ? Te.ETIMEDOUT : Te.ECONNABORTED,
          t,
          C
        )), C = null;
      }, a === void 0 && u.setContentType(null), "setRequestHeader" in C && z.forEach(u.toJSON(), function(B, V) {
        C.setRequestHeader(V, B);
      }), z.isUndefined(s.withCredentials) || (C.withCredentials = !!s.withCredentials), d && d !== "json" && (C.responseType = s.responseType), p && ([y, S] = fl(p, !0), C.addEventListener("progress", y)), f && C.upload && ([v, E] = fl(f), C.upload.addEventListener("progress", v), C.upload.addEventListener("loadend", E)), (s.cancelToken || s.signal) && (m = (I) => {
        C && (i(!I || I.type ? new wo(null, t, C) : I), C.abort(), C = null);
      }, s.cancelToken && s.cancelToken.subscribe(m), s.signal && (s.signal.aborted ? m() : s.signal.addEventListener("abort", m)));
      const k = Cb(s.url);
      if (k && Gt.protocols.indexOf(k) === -1) {
        i(new Te("Unsupported protocol " + k + ":", Te.ERR_BAD_REQUEST, t));
        return;
      }
      C.send(a || null);
    });
  }, Pb = (t, e) => {
    const { length: n } = t = t ? t.filter(Boolean) : [];
    if (e || n) {
      let i = new AbortController(), s;
      const a = function(p) {
        if (!s) {
          s = !0, d();
          const m = p instanceof Error ? p : this.reason;
          i.abort(m instanceof Te ? m : new wo(m instanceof Error ? m.message : m));
        }
      };
      let u = e && setTimeout(() => {
        u = null, a(new Te(`timeout ${e} of ms exceeded`, Te.ETIMEDOUT));
      }, e);
      const d = () => {
        t && (u && clearTimeout(u), u = null, t.forEach((p) => {
          p.unsubscribe ? p.unsubscribe(a) : p.removeEventListener("abort", a);
        }), t = null);
      };
      t.forEach((p) => p.addEventListener("abort", a));
      const { signal: f } = i;
      return f.unsubscribe = () => z.asap(d), f;
    }
  }, Ib = function* (t, e) {
    let n = t.byteLength;
    if (!e || n < e) {
      yield t;
      return;
    }
    let i = 0, s;
    for (; i < n; )
      s = i + e, yield t.slice(i, s), i = s;
  }, Nb = async function* (t, e) {
    for await (const n of Db(t))
      yield* Ib(n, e);
  }, Db = async function* (t) {
    if (t[Symbol.asyncIterator]) {
      yield* t;
      return;
    }
    const e = t.getReader();
    try {
      for (; ; ) {
        const { done: n, value: i } = await e.read();
        if (n)
          break;
        yield i;
      }
    } finally {
      await e.cancel();
    }
  }, kg = (t, e, n, i) => {
    const s = Nb(t, e);
    let a = 0, u, d = (f) => {
      u || (u = !0, i && i(f));
    };
    return new ReadableStream({
      async pull(f) {
        try {
          const { done: p, value: m } = await s.next();
          if (p) {
            d(), f.close();
            return;
          }
          let v = m.byteLength;
          if (n) {
            let y = a += v;
            n(y);
          }
          f.enqueue(new Uint8Array(m));
        } catch (p) {
          throw d(p), p;
        }
      },
      cancel(f) {
        return d(f), s.return();
      }
    }, {
      highWaterMark: 2
    });
  }, hl = typeof fetch == "function" && typeof Request == "function" && typeof Response == "function", Pg = hl && typeof ReadableStream == "function", jb = hl && (typeof TextEncoder == "function" ? /* @__PURE__ */ ((t) => (e) => t.encode(e))(new TextEncoder()) : async (t) => new Uint8Array(await new Response(t).arrayBuffer())), Ig = (t, ...e) => {
    try {
      return !!t(...e);
    } catch {
      return !1;
    }
  }, Mb = Pg && Ig(() => {
    let t = !1;
    const e = new Request(Gt.origin, {
      body: new ReadableStream(),
      method: "POST",
      get duplex() {
        return t = !0, "half";
      }
    }).headers.has("Content-Type");
    return t && !e;
  }), Ng = 64 * 1024, bd = Pg && Ig(() => z.isReadableStream(new Response("").body)), pl = {
    stream: bd && ((t) => t.body)
  };
  hl && ((t) => {
    ["text", "arrayBuffer", "blob", "formData", "stream"].forEach((e) => {
      !pl[e] && (pl[e] = z.isFunction(t[e]) ? (n) => n[e]() : (n, i) => {
        throw new Te(`Response type '${e}' is not supported`, Te.ERR_NOT_SUPPORT, i);
      });
    });
  })(new Response());
  const Fb = async (t) => {
    if (t == null)
      return 0;
    if (z.isBlob(t))
      return t.size;
    if (z.isSpecCompliantForm(t))
      return (await new Request(Gt.origin, {
        method: "POST",
        body: t
      }).arrayBuffer()).byteLength;
    if (z.isArrayBufferView(t) || z.isArrayBuffer(t))
      return t.byteLength;
    if (z.isURLSearchParams(t) && (t = t + ""), z.isString(t))
      return (await jb(t)).byteLength;
  }, Hb = async (t, e) => {
    const n = z.toFiniteNumber(t.getContentLength());
    return n ?? Fb(e);
  }, Cd = {
    http: sb,
    xhr: kb,
    fetch: hl && (async (t) => {
      let {
        url: e,
        method: n,
        data: i,
        signal: s,
        cancelToken: a,
        timeout: u,
        onDownloadProgress: d,
        onUploadProgress: f,
        responseType: p,
        headers: m,
        withCredentials: v = "same-origin",
        fetchOptions: y
      } = Ag(t);
      p = p ? (p + "").toLowerCase() : "text";
      let E = Pb([s, a && a.toAbortSignal()], u), S;
      const x = E && E.unsubscribe && (() => {
        E.unsubscribe();
      });
      let C;
      try {
        if (f && Mb && n !== "get" && n !== "head" && (C = await Hb(m, i)) !== 0) {
          let V = new Request(e, {
            method: "POST",
            body: i,
            duplex: "half"
          }), P;
          if (z.isFormData(i) && (P = V.headers.get("content-type")) && m.setContentType(P), V.body) {
            const [R, j] = Og(
              C,
              fl(_g(f))
            );
            i = kg(V.body, Ng, R, j);
          }
        }
        z.isString(v) || (v = v ? "include" : "omit");
        const L = "credentials" in Request.prototype;
        S = new Request(e, {
          ...y,
          signal: E,
          method: n.toUpperCase(),
          headers: m.normalize().toJSON(),
          body: i,
          duplex: "half",
          credentials: L ? v : void 0
        });
        let k = await fetch(S);
        const I = bd && (p === "stream" || p === "response");
        if (bd && (d || I && x)) {
          const V = {};
          ["status", "statusText", "headers"].forEach((G) => {
            V[G] = k[G];
          });
          const P = z.toFiniteNumber(k.headers.get("content-length")), [R, j] = d && Og(
            P,
            fl(_g(d), !0)
          ) || [];
          k = new Response(
            kg(k.body, Ng, R, () => {
              j && j(), x && x();
            }),
            V
          );
        }
        p = p || "text";
        let B = await pl[z.findKey(pl, p) || "text"](k, t);
        return !I && x && x(), await new Promise((V, P) => {
          Tg(V, P, {
            data: B,
            headers: Bn.from(k.headers),
            status: k.status,
            statusText: k.statusText,
            config: t,
            request: S
          });
        });
      } catch (L) {
        throw x && x(), L && L.name === "TypeError" && /fetch/i.test(L.message) ? Object.assign(
          new Te("Network Error", Te.ERR_NETWORK, t, S),
          {
            cause: L.cause || L
          }
        ) : Te.from(L, L && L.code, t, S);
      }
    })
  };
  z.forEach(Cd, (t, e) => {
    if (t) {
      try {
        Object.defineProperty(t, "name", { value: e });
      } catch {
      }
      Object.defineProperty(t, "adapterName", { value: e });
    }
  });
  const Dg = (t) => `- ${t}`, Bb = (t) => z.isFunction(t) || t === null || t === !1, jg = {
    getAdapter: (t) => {
      t = z.isArray(t) ? t : [t];
      const { length: e } = t;
      let n, i;
      const s = {};
      for (let a = 0; a < e; a++) {
        n = t[a];
        let u;
        if (i = n, !Bb(n) && (i = Cd[(u = String(n)).toLowerCase()], i === void 0))
          throw new Te(`Unknown adapter '${u}'`);
        if (i)
          break;
        s[u || "#" + a] = i;
      }
      if (!i) {
        const a = Object.entries(s).map(
          ([d, f]) => `adapter ${d} ` + (f === !1 ? "is not supported by the environment" : "is not available in the build")
        );
        let u = e ? a.length > 1 ? `since :
` + a.map(Dg).join(`
`) : " " + Dg(a[0]) : "as no adapter specified";
        throw new Te(
          "There is no suitable adapter to dispatch the request " + u,
          "ERR_NOT_SUPPORT"
        );
      }
      return i;
    },
    adapters: Cd
  };
  function Td(t) {
    if (t.cancelToken && t.cancelToken.throwIfRequested(), t.signal && t.signal.aborted)
      throw new wo(null, t);
  }
  function Mg(t) {
    return Td(t), t.headers = Bn.from(t.headers), t.data = xd.call(
      t,
      t.transformRequest
    ), ["post", "put", "patch"].indexOf(t.method) !== -1 && t.headers.setContentType("application/x-www-form-urlencoded", !1), jg.getAdapter(t.adapter || Sd.adapter)(t).then(function(i) {
      return Td(t), i.data = xd.call(
        t,
        t.transformResponse,
        i
      ), i.headers = Bn.from(i.headers), i;
    }, function(i) {
      return Cg(i) || (Td(t), i && i.response && (i.response.data = xd.call(
        t,
        t.transformResponse,
        i.response
      ), i.response.headers = Bn.from(i.response.headers))), Promise.reject(i);
    });
  }
  const Fg = "1.8.2", ml = {};
  ["object", "boolean", "number", "function", "string", "symbol"].forEach((t, e) => {
    ml[t] = function(i) {
      return typeof i === t || "a" + (e < 1 ? "n " : " ") + t;
    };
  });
  const Hg = {};
  ml.transitional = function(e, n, i) {
    function s(a, u) {
      return "[Axios v" + Fg + "] Transitional option '" + a + "'" + u + (i ? ". " + i : "");
    }
    return (a, u, d) => {
      if (e === !1)
        throw new Te(
          s(u, " has been removed" + (n ? " in " + n : "")),
          Te.ERR_DEPRECATED
        );
      return n && !Hg[u] && (Hg[u] = !0, console.warn(
        s(
          u,
          " has been deprecated since v" + n + " and will be removed in the near future"
        )
      )), e ? e(a, u, d) : !0;
    };
  }, ml.spelling = function(e) {
    return (n, i) => (console.warn(`${i} is likely a misspelling of ${e}`), !0);
  };
  function Ub(t, e, n) {
    if (typeof t != "object")
      throw new Te("options must be an object", Te.ERR_BAD_OPTION_VALUE);
    const i = Object.keys(t);
    let s = i.length;
    for (; s-- > 0; ) {
      const a = i[s], u = e[a];
      if (u) {
        const d = t[a], f = d === void 0 || u(d, a, t);
        if (f !== !0)
          throw new Te("option " + a + " must be " + f, Te.ERR_BAD_OPTION_VALUE);
        continue;
      }
      if (n !== !0)
        throw new Te("Unknown option " + a, Te.ERR_BAD_OPTION);
    }
  }
  const gl = {
    assertOptions: Ub,
    validators: ml
  }, sr = gl.validators;
  let vl = class {
    constructor(e) {
      this.defaults = e, this.interceptors = {
        request: new Sg(),
        response: new Sg()
      };
    }
    /**
     * Dispatch a request
     *
     * @param {String|Object} configOrUrl The config specific for this request (merged with this.defaults)
     * @param {?Object} config
     *
     * @returns {Promise} The Promise to be fulfilled
     */
    async request(e, n) {
      try {
        return await this._request(e, n);
      } catch (i) {
        if (i instanceof Error) {
          let s = {};
          Error.captureStackTrace ? Error.captureStackTrace(s) : s = new Error();
          const a = s.stack ? s.stack.replace(/^.+\n/, "") : "";
          try {
            i.stack ? a && !String(i.stack).endsWith(a.replace(/^.+\n.+\n/, "")) && (i.stack += `
` + a) : i.stack = a;
          } catch {
          }
        }
        throw i;
      }
    }
    _request(e, n) {
      typeof e == "string" ? (n = n || {}, n.url = e) : n = e || {}, n = ki(this.defaults, n);
      const { transitional: i, paramsSerializer: s, headers: a } = n;
      i !== void 0 && gl.assertOptions(i, {
        silentJSONParsing: sr.transitional(sr.boolean),
        forcedJSONParsing: sr.transitional(sr.boolean),
        clarifyTimeoutError: sr.transitional(sr.boolean)
      }, !1), s != null && (z.isFunction(s) ? n.paramsSerializer = {
        serialize: s
      } : gl.assertOptions(s, {
        encode: sr.function,
        serialize: sr.function
      }, !0)), n.allowAbsoluteUrls !== void 0 || (this.defaults.allowAbsoluteUrls !== void 0 ? n.allowAbsoluteUrls = this.defaults.allowAbsoluteUrls : n.allowAbsoluteUrls = !0), gl.assertOptions(n, {
        baseUrl: sr.spelling("baseURL"),
        withXsrfToken: sr.spelling("withXSRFToken")
      }, !0), n.method = (n.method || this.defaults.method || "get").toLowerCase();
      let u = a && z.merge(
        a.common,
        a[n.method]
      );
      a && z.forEach(
        ["delete", "get", "head", "post", "put", "patch", "common"],
        (S) => {
          delete a[S];
        }
      ), n.headers = Bn.concat(u, a);
      const d = [];
      let f = !0;
      this.interceptors.request.forEach(function(x) {
        typeof x.runWhen == "function" && x.runWhen(n) === !1 || (f = f && x.synchronous, d.unshift(x.fulfilled, x.rejected));
      });
      const p = [];
      this.interceptors.response.forEach(function(x) {
        p.push(x.fulfilled, x.rejected);
      });
      let m, v = 0, y;
      if (!f) {
        const S = [Mg.bind(this), void 0];
        for (S.unshift.apply(S, d), S.push.apply(S, p), y = S.length, m = Promise.resolve(n); v < y; )
          m = m.then(S[v++], S[v++]);
        return m;
      }
      y = d.length;
      let E = n;
      for (v = 0; v < y; ) {
        const S = d[v++], x = d[v++];
        try {
          E = S(E);
        } catch (C) {
          x.call(this, C);
          break;
        }
      }
      try {
        m = Mg.call(this, E);
      } catch (S) {
        return Promise.reject(S);
      }
      for (v = 0, y = p.length; v < y; )
        m = m.then(p[v++], p[v++]);
      return m;
    }
    getUri(e) {
      e = ki(this.defaults, e);
      const n = Rg(e.baseURL, e.url, e.allowAbsoluteUrls);
      return wg(n, e.params, e.paramsSerializer);
    }
  };
  z.forEach(["delete", "get", "head", "options"], function(e) {
    vl.prototype[e] = function(n, i) {
      return this.request(ki(i || {}, {
        method: e,
        url: n,
        data: (i || {}).data
      }));
    };
  }), z.forEach(["post", "put", "patch"], function(e) {
    function n(i) {
      return function(a, u, d) {
        return this.request(ki(d || {}, {
          method: e,
          headers: i ? {
            "Content-Type": "multipart/form-data"
          } : {},
          url: a,
          data: u
        }));
      };
    }
    vl.prototype[e] = n(), vl.prototype[e + "Form"] = n(!0);
  });
  const yl = vl, $b = class IE {
    constructor(e) {
      if (typeof e != "function")
        throw new TypeError("executor must be a function.");
      let n;
      this.promise = new Promise(function(a) {
        n = a;
      });
      const i = this;
      this.promise.then((s) => {
        if (!i._listeners)
          return;
        let a = i._listeners.length;
        for (; a-- > 0; )
          i._listeners[a](s);
        i._listeners = null;
      }), this.promise.then = (s) => {
        let a;
        const u = new Promise((d) => {
          i.subscribe(d), a = d;
        }).then(s);
        return u.cancel = function() {
          i.unsubscribe(a);
        }, u;
      }, e(function(a, u, d) {
        i.reason || (i.reason = new wo(a, u, d), n(i.reason));
      });
    }
    /**
     * Throws a `CanceledError` if cancellation has been requested.
     */
    throwIfRequested() {
      if (this.reason)
        throw this.reason;
    }
    /**
     * Subscribe to the cancel signal
     */
    subscribe(e) {
      if (this.reason) {
        e(this.reason);
        return;
      }
      this._listeners ? this._listeners.push(e) : this._listeners = [e];
    }
    /**
     * Unsubscribe from the cancel signal
     */
    unsubscribe(e) {
      if (!this._listeners)
        return;
      const n = this._listeners.indexOf(e);
      n !== -1 && this._listeners.splice(n, 1);
    }
    toAbortSignal() {
      const e = new AbortController(), n = (i) => {
        e.abort(i);
      };
      return this.subscribe(n), e.signal.unsubscribe = () => this.unsubscribe(n), e.signal;
    }
    /**
     * Returns an object that contains a new `CancelToken` and a function that, when called,
     * cancels the `CancelToken`.
     */
    static source() {
      let e;
      return {
        token: new IE(function(s) {
          e = s;
        }),
        cancel: e
      };
    }
  };
  function zb(t) {
    return function(n) {
      return t.apply(null, n);
    };
  }
  function Vb(t) {
    return z.isObject(t) && t.isAxiosError === !0;
  }
  const Od = {
    Continue: 100,
    SwitchingProtocols: 101,
    Processing: 102,
    EarlyHints: 103,
    Ok: 200,
    Created: 201,
    Accepted: 202,
    NonAuthoritativeInformation: 203,
    NoContent: 204,
    ResetContent: 205,
    PartialContent: 206,
    MultiStatus: 207,
    AlreadyReported: 208,
    ImUsed: 226,
    MultipleChoices: 300,
    MovedPermanently: 301,
    Found: 302,
    SeeOther: 303,
    NotModified: 304,
    UseProxy: 305,
    Unused: 306,
    TemporaryRedirect: 307,
    PermanentRedirect: 308,
    BadRequest: 400,
    Unauthorized: 401,
    PaymentRequired: 402,
    Forbidden: 403,
    NotFound: 404,
    MethodNotAllowed: 405,
    NotAcceptable: 406,
    ProxyAuthenticationRequired: 407,
    RequestTimeout: 408,
    Conflict: 409,
    Gone: 410,
    LengthRequired: 411,
    PreconditionFailed: 412,
    PayloadTooLarge: 413,
    UriTooLong: 414,
    UnsupportedMediaType: 415,
    RangeNotSatisfiable: 416,
    ExpectationFailed: 417,
    ImATeapot: 418,
    MisdirectedRequest: 421,
    UnprocessableEntity: 422,
    Locked: 423,
    FailedDependency: 424,
    TooEarly: 425,
    UpgradeRequired: 426,
    PreconditionRequired: 428,
    TooManyRequests: 429,
    RequestHeaderFieldsTooLarge: 431,
    UnavailableForLegalReasons: 451,
    InternalServerError: 500,
    NotImplemented: 501,
    BadGateway: 502,
    ServiceUnavailable: 503,
    GatewayTimeout: 504,
    HttpVersionNotSupported: 505,
    VariantAlsoNegotiates: 506,
    InsufficientStorage: 507,
    LoopDetected: 508,
    NotExtended: 510,
    NetworkAuthenticationRequired: 511
  };
  Object.entries(Od).forEach(([t, e]) => {
    Od[e] = t;
  });
  const Wb = Od;
  function Bg(t) {
    const e = new yl(t), n = og(yl.prototype.request, e);
    return z.extend(n, yl.prototype, e, { allOwnKeys: !0 }), z.extend(n, e, null, { allOwnKeys: !0 }), n.create = function(s) {
      return Bg(ki(t, s));
    }, n;
  }
  const Et = Bg(Sd);
  Et.Axios = yl, Et.CanceledError = wo, Et.CancelToken = $b, Et.isCancel = Cg, Et.VERSION = Fg, Et.toFormData = ul, Et.AxiosError = Te, Et.Cancel = Et.CanceledError, Et.all = function(e) {
    return Promise.all(e);
  }, Et.spread = zb, Et.isAxiosError = Vb, Et.mergeConfig = ki, Et.AxiosHeaders = Bn, Et.formToJSON = (t) => xg(z.isHTMLForm(t) ? new FormData(t) : t), Et.getAdapter = jg.getAdapter, Et.HttpStatusCode = Wb, Et.default = Et;
  const {
    Axios: l5,
    AxiosError: Gb,
    CanceledError: u5,
    isCancel: c5,
    CancelToken: d5,
    VERSION: f5,
    all: h5,
    Cancel: p5,
    isAxiosError: m5,
    spread: g5,
    toFormData: v5,
    AxiosHeaders: y5,
    HttpStatusCode: w5,
    formToJSON: S5,
    getAdapter: E5,
    mergeConfig: x5
  } = Et;
  var Ug = { exports: {} }, dn = {}, _d = { exports: {} }, Rd = {};
  /**
   * @license React
   * scheduler.production.min.js
   *
   * Copyright (c) Facebook, Inc. and its affiliates.
   *
   * This source code is licensed under the MIT license found in the
   * LICENSE file in the root directory of this source tree.
   */
  var $g;
  function qb() {
    return $g || ($g = 1, function(t) {
      function e(q, Q) {
        var T = q.length;
        q.push(Q);
        e:
          for (; 0 < T; ) {
            var U = T - 1 >>> 1, X = q[U];
            if (0 < s(X, Q))
              q[U] = Q, q[T] = X, T = U;
            else
              break e;
          }
      }
      function n(q) {
        return q.length === 0 ? null : q[0];
      }
      function i(q) {
        if (q.length === 0)
          return null;
        var Q = q[0], T = q.pop();
        if (T !== Q) {
          q[0] = T;
          e:
            for (var U = 0, X = q.length, Se = X >>> 1; U < Se; ) {
              var de = 2 * (U + 1) - 1, Oe = q[de], _e = de + 1, Pe = q[_e];
              if (0 > s(Oe, T))
                _e < X && 0 > s(Pe, Oe) ? (q[U] = Pe, q[_e] = T, U = _e) : (q[U] = Oe, q[de] = T, U = de);
              else if (_e < X && 0 > s(Pe, T))
                q[U] = Pe, q[_e] = T, U = _e;
              else
                break e;
            }
        }
        return Q;
      }
      function s(q, Q) {
        var T = q.sortIndex - Q.sortIndex;
        return T !== 0 ? T : q.id - Q.id;
      }
      if (typeof performance == "object" && typeof performance.now == "function") {
        var a = performance;
        t.unstable_now = function() {
          return a.now();
        };
      } else {
        var u = Date, d = u.now();
        t.unstable_now = function() {
          return u.now() - d;
        };
      }
      var f = [], p = [], m = 1, v = null, y = 3, E = !1, S = !1, x = !1, C = typeof setTimeout == "function" ? setTimeout : null, L = typeof clearTimeout == "function" ? clearTimeout : null, k = typeof setImmediate < "u" ? setImmediate : null;
      typeof navigator < "u" && navigator.scheduling !== void 0 && navigator.scheduling.isInputPending !== void 0 && navigator.scheduling.isInputPending.bind(navigator.scheduling);
      function I(q) {
        for (var Q = n(p); Q !== null; ) {
          if (Q.callback === null)
            i(p);
          else if (Q.startTime <= q)
            i(p), Q.sortIndex = Q.expirationTime, e(f, Q);
          else
            break;
          Q = n(p);
        }
      }
      function B(q) {
        if (x = !1, I(q), !S)
          if (n(f) !== null)
            S = !0, Be(V);
          else {
            var Q = n(p);
            Q !== null && ge(B, Q.startTime - q);
          }
      }
      function V(q, Q) {
        S = !1, x && (x = !1, L(j), j = -1), E = !0;
        var T = y;
        try {
          for (I(Q), v = n(f); v !== null && (!(v.expirationTime > Q) || q && !W()); ) {
            var U = v.callback;
            if (typeof U == "function") {
              v.callback = null, y = v.priorityLevel;
              var X = U(v.expirationTime <= Q);
              Q = t.unstable_now(), typeof X == "function" ? v.callback = X : v === n(f) && i(f), I(Q);
            } else
              i(f);
            v = n(f);
          }
          if (v !== null)
            var Se = !0;
          else {
            var de = n(p);
            de !== null && ge(B, de.startTime - Q), Se = !1;
          }
          return Se;
        } finally {
          v = null, y = T, E = !1;
        }
      }
      var P = !1, R = null, j = -1, G = 5, ee = -1;
      function W() {
        return !(t.unstable_now() - ee < G);
      }
      function re() {
        if (R !== null) {
          var q = t.unstable_now();
          ee = q;
          var Q = !0;
          try {
            Q = R(!0, q);
          } finally {
            Q ? we() : (P = !1, R = null);
          }
        } else
          P = !1;
      }
      var we;
      if (typeof k == "function")
        we = function() {
          k(re);
        };
      else if (typeof MessageChannel < "u") {
        var ye = new MessageChannel(), be = ye.port2;
        ye.port1.onmessage = re, we = function() {
          be.postMessage(null);
        };
      } else
        we = function() {
          C(re, 0);
        };
      function Be(q) {
        R = q, P || (P = !0, we());
      }
      function ge(q, Q) {
        j = C(function() {
          q(t.unstable_now());
        }, Q);
      }
      t.unstable_IdlePriority = 5, t.unstable_ImmediatePriority = 1, t.unstable_LowPriority = 4, t.unstable_NormalPriority = 3, t.unstable_Profiling = null, t.unstable_UserBlockingPriority = 2, t.unstable_cancelCallback = function(q) {
        q.callback = null;
      }, t.unstable_continueExecution = function() {
        S || E || (S = !0, Be(V));
      }, t.unstable_forceFrameRate = function(q) {
        0 > q || 125 < q ? console.error("forceFrameRate takes a positive int between 0 and 125, forcing frame rates higher than 125 fps is not supported") : G = 0 < q ? Math.floor(1e3 / q) : 5;
      }, t.unstable_getCurrentPriorityLevel = function() {
        return y;
      }, t.unstable_getFirstCallbackNode = function() {
        return n(f);
      }, t.unstable_next = function(q) {
        switch (y) {
          case 1:
          case 2:
          case 3:
            var Q = 3;
            break;
          default:
            Q = y;
        }
        var T = y;
        y = Q;
        try {
          return q();
        } finally {
          y = T;
        }
      }, t.unstable_pauseExecution = function() {
      }, t.unstable_requestPaint = function() {
      }, t.unstable_runWithPriority = function(q, Q) {
        switch (q) {
          case 1:
          case 2:
          case 3:
          case 4:
          case 5:
            break;
          default:
            q = 3;
        }
        var T = y;
        y = q;
        try {
          return Q();
        } finally {
          y = T;
        }
      }, t.unstable_scheduleCallback = function(q, Q, T) {
        var U = t.unstable_now();
        switch (typeof T == "object" && T !== null ? (T = T.delay, T = typeof T == "number" && 0 < T ? U + T : U) : T = U, q) {
          case 1:
            var X = -1;
            break;
          case 2:
            X = 250;
            break;
          case 5:
            X = 1073741823;
            break;
          case 4:
            X = 1e4;
            break;
          default:
            X = 5e3;
        }
        return X = T + X, q = { id: m++, callback: Q, priorityLevel: q, startTime: T, expirationTime: X, sortIndex: -1 }, T > U ? (q.sortIndex = T, e(p, q), n(f) === null && q === n(p) && (x ? (L(j), j = -1) : x = !0, ge(B, T - U))) : (q.sortIndex = X, e(f, q), S || E || (S = !0, Be(V))), q;
      }, t.unstable_shouldYield = W, t.unstable_wrapCallback = function(q) {
        var Q = y;
        return function() {
          var T = y;
          y = Q;
          try {
            return q.apply(this, arguments);
          } finally {
            y = T;
          }
        };
      };
    }(Rd)), Rd;
  }
  var zg;
  function Yb() {
    return zg || (zg = 1, _d.exports = qb()), _d.exports;
  }
  /**
   * @license React
   * react-dom.production.min.js
   *
   * Copyright (c) Facebook, Inc. and its affiliates.
   *
   * This source code is licensed under the MIT license found in the
   * LICENSE file in the root directory of this source tree.
   */
  var Vg;
  function Kb() {
    if (Vg)
      return dn;
    Vg = 1;
    var t = N, e = Yb();
    function n(r) {
      for (var o = "https://reactjs.org/docs/error-decoder.html?invariant=" + r, l = 1; l < arguments.length; l++)
        o += "&args[]=" + encodeURIComponent(arguments[l]);
      return "Minified React error #" + r + "; visit " + o + " for the full message or use the non-minified dev environment for full errors and additional helpful warnings.";
    }
    var i = /* @__PURE__ */ new Set(), s = {};
    function a(r, o) {
      u(r, o), u(r + "Capture", o);
    }
    function u(r, o) {
      for (s[r] = o, r = 0; r < o.length; r++)
        i.add(o[r]);
    }
    var d = !(typeof window > "u" || typeof window.document > "u" || typeof window.document.createElement > "u"), f = Object.prototype.hasOwnProperty, p = /^[:A-Z_a-z\u00C0-\u00D6\u00D8-\u00F6\u00F8-\u02FF\u0370-\u037D\u037F-\u1FFF\u200C-\u200D\u2070-\u218F\u2C00-\u2FEF\u3001-\uD7FF\uF900-\uFDCF\uFDF0-\uFFFD][:A-Z_a-z\u00C0-\u00D6\u00D8-\u00F6\u00F8-\u02FF\u0370-\u037D\u037F-\u1FFF\u200C-\u200D\u2070-\u218F\u2C00-\u2FEF\u3001-\uD7FF\uF900-\uFDCF\uFDF0-\uFFFD\-.0-9\u00B7\u0300-\u036F\u203F-\u2040]*$/, m = {}, v = {};
    function y(r) {
      return f.call(v, r) ? !0 : f.call(m, r) ? !1 : p.test(r) ? v[r] = !0 : (m[r] = !0, !1);
    }
    function E(r, o, l, c) {
      if (l !== null && l.type === 0)
        return !1;
      switch (typeof o) {
        case "function":
        case "symbol":
          return !0;
        case "boolean":
          return c ? !1 : l !== null ? !l.acceptsBooleans : (r = r.toLowerCase().slice(0, 5), r !== "data-" && r !== "aria-");
        default:
          return !1;
      }
    }
    function S(r, o, l, c) {
      if (o === null || typeof o > "u" || E(r, o, l, c))
        return !0;
      if (c)
        return !1;
      if (l !== null)
        switch (l.type) {
          case 3:
            return !o;
          case 4:
            return o === !1;
          case 5:
            return isNaN(o);
          case 6:
            return isNaN(o) || 1 > o;
        }
      return !1;
    }
    function x(r, o, l, c, h, g, w) {
      this.acceptsBooleans = o === 2 || o === 3 || o === 4, this.attributeName = c, this.attributeNamespace = h, this.mustUseProperty = l, this.propertyName = r, this.type = o, this.sanitizeURL = g, this.removeEmptyString = w;
    }
    var C = {};
    "children dangerouslySetInnerHTML defaultValue defaultChecked innerHTML suppressContentEditableWarning suppressHydrationWarning style".split(" ").forEach(function(r) {
      C[r] = new x(r, 0, !1, r, null, !1, !1);
    }), [["acceptCharset", "accept-charset"], ["className", "class"], ["htmlFor", "for"], ["httpEquiv", "http-equiv"]].forEach(function(r) {
      var o = r[0];
      C[o] = new x(o, 1, !1, r[1], null, !1, !1);
    }), ["contentEditable", "draggable", "spellCheck", "value"].forEach(function(r) {
      C[r] = new x(r, 2, !1, r.toLowerCase(), null, !1, !1);
    }), ["autoReverse", "externalResourcesRequired", "focusable", "preserveAlpha"].forEach(function(r) {
      C[r] = new x(r, 2, !1, r, null, !1, !1);
    }), "allowFullScreen async autoFocus autoPlay controls default defer disabled disablePictureInPicture disableRemotePlayback formNoValidate hidden loop noModule noValidate open playsInline readOnly required reversed scoped seamless itemScope".split(" ").forEach(function(r) {
      C[r] = new x(r, 3, !1, r.toLowerCase(), null, !1, !1);
    }), ["checked", "multiple", "muted", "selected"].forEach(function(r) {
      C[r] = new x(r, 3, !0, r, null, !1, !1);
    }), ["capture", "download"].forEach(function(r) {
      C[r] = new x(r, 4, !1, r, null, !1, !1);
    }), ["cols", "rows", "size", "span"].forEach(function(r) {
      C[r] = new x(r, 6, !1, r, null, !1, !1);
    }), ["rowSpan", "start"].forEach(function(r) {
      C[r] = new x(r, 5, !1, r.toLowerCase(), null, !1, !1);
    });
    var L = /[\-:]([a-z])/g;
    function k(r) {
      return r[1].toUpperCase();
    }
    "accent-height alignment-baseline arabic-form baseline-shift cap-height clip-path clip-rule color-interpolation color-interpolation-filters color-profile color-rendering dominant-baseline enable-background fill-opacity fill-rule flood-color flood-opacity font-family font-size font-size-adjust font-stretch font-style font-variant font-weight glyph-name glyph-orientation-horizontal glyph-orientation-vertical horiz-adv-x horiz-origin-x image-rendering letter-spacing lighting-color marker-end marker-mid marker-start overline-position overline-thickness paint-order panose-1 pointer-events rendering-intent shape-rendering stop-color stop-opacity strikethrough-position strikethrough-thickness stroke-dasharray stroke-dashoffset stroke-linecap stroke-linejoin stroke-miterlimit stroke-opacity stroke-width text-anchor text-decoration text-rendering underline-position underline-thickness unicode-bidi unicode-range units-per-em v-alphabetic v-hanging v-ideographic v-mathematical vector-effect vert-adv-y vert-origin-x vert-origin-y word-spacing writing-mode xmlns:xlink x-height".split(" ").forEach(function(r) {
      var o = r.replace(
        L,
        k
      );
      C[o] = new x(o, 1, !1, r, null, !1, !1);
    }), "xlink:actuate xlink:arcrole xlink:role xlink:show xlink:title xlink:type".split(" ").forEach(function(r) {
      var o = r.replace(L, k);
      C[o] = new x(o, 1, !1, r, "http://www.w3.org/1999/xlink", !1, !1);
    }), ["xml:base", "xml:lang", "xml:space"].forEach(function(r) {
      var o = r.replace(L, k);
      C[o] = new x(o, 1, !1, r, "http://www.w3.org/XML/1998/namespace", !1, !1);
    }), ["tabIndex", "crossOrigin"].forEach(function(r) {
      C[r] = new x(r, 1, !1, r.toLowerCase(), null, !1, !1);
    }), C.xlinkHref = new x("xlinkHref", 1, !1, "xlink:href", "http://www.w3.org/1999/xlink", !0, !1), ["src", "href", "action", "formAction"].forEach(function(r) {
      C[r] = new x(r, 1, !1, r.toLowerCase(), null, !0, !0);
    });
    function I(r, o, l, c) {
      var h = C.hasOwnProperty(o) ? C[o] : null;
      (h !== null ? h.type !== 0 : c || !(2 < o.length) || o[0] !== "o" && o[0] !== "O" || o[1] !== "n" && o[1] !== "N") && (S(o, l, h, c) && (l = null), c || h === null ? y(o) && (l === null ? r.removeAttribute(o) : r.setAttribute(o, "" + l)) : h.mustUseProperty ? r[h.propertyName] = l === null ? h.type === 3 ? !1 : "" : l : (o = h.attributeName, c = h.attributeNamespace, l === null ? r.removeAttribute(o) : (h = h.type, l = h === 3 || h === 4 && l === !0 ? "" : "" + l, c ? r.setAttributeNS(c, o, l) : r.setAttribute(o, l))));
    }
    var B = t.__SECRET_INTERNALS_DO_NOT_USE_OR_YOU_WILL_BE_FIRED, V = Symbol.for("react.element"), P = Symbol.for("react.portal"), R = Symbol.for("react.fragment"), j = Symbol.for("react.strict_mode"), G = Symbol.for("react.profiler"), ee = Symbol.for("react.provider"), W = Symbol.for("react.context"), re = Symbol.for("react.forward_ref"), we = Symbol.for("react.suspense"), ye = Symbol.for("react.suspense_list"), be = Symbol.for("react.memo"), Be = Symbol.for("react.lazy"), ge = Symbol.for("react.offscreen"), q = Symbol.iterator;
    function Q(r) {
      return r === null || typeof r != "object" ? null : (r = q && r[q] || r["@@iterator"], typeof r == "function" ? r : null);
    }
    var T = Object.assign, U;
    function X(r) {
      if (U === void 0)
        try {
          throw Error();
        } catch (l) {
          var o = l.stack.trim().match(/\n( *(at )?)/);
          U = o && o[1] || "";
        }
      return `
` + U + r;
    }
    var Se = !1;
    function de(r, o) {
      if (!r || Se)
        return "";
      Se = !0;
      var l = Error.prepareStackTrace;
      Error.prepareStackTrace = void 0;
      try {
        if (o)
          if (o = function() {
            throw Error();
          }, Object.defineProperty(o.prototype, "props", { set: function() {
            throw Error();
          } }), typeof Reflect == "object" && Reflect.construct) {
            try {
              Reflect.construct(o, []);
            } catch (H) {
              var c = H;
            }
            Reflect.construct(r, [], o);
          } else {
            try {
              o.call();
            } catch (H) {
              c = H;
            }
            r.call(o.prototype);
          }
        else {
          try {
            throw Error();
          } catch (H) {
            c = H;
          }
          r();
        }
      } catch (H) {
        if (H && c && typeof H.stack == "string") {
          for (var h = H.stack.split(`
`), g = c.stack.split(`
`), w = h.length - 1, b = g.length - 1; 1 <= w && 0 <= b && h[w] !== g[b]; )
            b--;
          for (; 1 <= w && 0 <= b; w--, b--)
            if (h[w] !== g[b]) {
              if (w !== 1 || b !== 1)
                do
                  if (w--, b--, 0 > b || h[w] !== g[b]) {
                    var _ = `
` + h[w].replace(" at new ", " at ");
                    return r.displayName && _.includes("<anonymous>") && (_ = _.replace("<anonymous>", r.displayName)), _;
                  }
                while (1 <= w && 0 <= b);
              break;
            }
        }
      } finally {
        Se = !1, Error.prepareStackTrace = l;
      }
      return (r = r ? r.displayName || r.name : "") ? X(r) : "";
    }
    function Oe(r) {
      switch (r.tag) {
        case 5:
          return X(r.type);
        case 16:
          return X("Lazy");
        case 13:
          return X("Suspense");
        case 19:
          return X("SuspenseList");
        case 0:
        case 2:
        case 15:
          return r = de(r.type, !1), r;
        case 11:
          return r = de(r.type.render, !1), r;
        case 1:
          return r = de(r.type, !0), r;
        default:
          return "";
      }
    }
    function _e(r) {
      if (r == null)
        return null;
      if (typeof r == "function")
        return r.displayName || r.name || null;
      if (typeof r == "string")
        return r;
      switch (r) {
        case R:
          return "Fragment";
        case P:
          return "Portal";
        case G:
          return "Profiler";
        case j:
          return "StrictMode";
        case we:
          return "Suspense";
        case ye:
          return "SuspenseList";
      }
      if (typeof r == "object")
        switch (r.$$typeof) {
          case W:
            return (r.displayName || "Context") + ".Consumer";
          case ee:
            return (r._context.displayName || "Context") + ".Provider";
          case re:
            var o = r.render;
            return r = r.displayName, r || (r = o.displayName || o.name || "", r = r !== "" ? "ForwardRef(" + r + ")" : "ForwardRef"), r;
          case be:
            return o = r.displayName || null, o !== null ? o : _e(r.type) || "Memo";
          case Be:
            o = r._payload, r = r._init;
            try {
              return _e(r(o));
            } catch {
            }
        }
      return null;
    }
    function Pe(r) {
      var o = r.type;
      switch (r.tag) {
        case 24:
          return "Cache";
        case 9:
          return (o.displayName || "Context") + ".Consumer";
        case 10:
          return (o._context.displayName || "Context") + ".Provider";
        case 18:
          return "DehydratedFragment";
        case 11:
          return r = o.render, r = r.displayName || r.name || "", o.displayName || (r !== "" ? "ForwardRef(" + r + ")" : "ForwardRef");
        case 7:
          return "Fragment";
        case 5:
          return o;
        case 4:
          return "Portal";
        case 3:
          return "Root";
        case 6:
          return "Text";
        case 16:
          return _e(o);
        case 8:
          return o === j ? "StrictMode" : "Mode";
        case 22:
          return "Offscreen";
        case 12:
          return "Profiler";
        case 21:
          return "Scope";
        case 13:
          return "Suspense";
        case 19:
          return "SuspenseList";
        case 25:
          return "TracingMarker";
        case 1:
        case 0:
        case 17:
        case 2:
        case 14:
        case 15:
          if (typeof o == "function")
            return o.displayName || o.name || null;
          if (typeof o == "string")
            return o;
      }
      return null;
    }
    function Ae(r) {
      switch (typeof r) {
        case "boolean":
        case "number":
        case "string":
        case "undefined":
          return r;
        case "object":
          return r;
        default:
          return "";
      }
    }
    function st(r) {
      var o = r.type;
      return (r = r.nodeName) && r.toLowerCase() === "input" && (o === "checkbox" || o === "radio");
    }
    function ti(r) {
      var o = st(r) ? "checked" : "value", l = Object.getOwnPropertyDescriptor(r.constructor.prototype, o), c = "" + r[o];
      if (!r.hasOwnProperty(o) && typeof l < "u" && typeof l.get == "function" && typeof l.set == "function") {
        var h = l.get, g = l.set;
        return Object.defineProperty(r, o, { configurable: !0, get: function() {
          return h.call(this);
        }, set: function(w) {
          c = "" + w, g.call(this, w);
        } }), Object.defineProperty(r, o, { enumerable: l.enumerable }), { getValue: function() {
          return c;
        }, setValue: function(w) {
          c = "" + w;
        }, stopTracking: function() {
          r._valueTracker = null, delete r[o];
        } };
      }
    }
    function Rn(r) {
      r._valueTracker || (r._valueTracker = ti(r));
    }
    function xt(r) {
      if (!r)
        return !1;
      var o = r._valueTracker;
      if (!o)
        return !0;
      var l = o.getValue(), c = "";
      return r && (c = st(r) ? r.checked ? "true" : "false" : r.value), r = c, r !== l ? (o.setValue(r), !0) : !1;
    }
    function qn(r) {
      if (r = r || (typeof document < "u" ? document : void 0), typeof r > "u")
        return null;
      try {
        return r.activeElement || r.body;
      } catch {
        return r.body;
      }
    }
    function Zi(r, o) {
      var l = o.checked;
      return T({}, o, { defaultChecked: void 0, defaultValue: void 0, value: void 0, checked: l ?? r._wrapperState.initialChecked });
    }
    function Yn(r, o) {
      var l = o.defaultValue == null ? "" : o.defaultValue, c = o.checked != null ? o.checked : o.defaultChecked;
      l = Ae(o.value != null ? o.value : l), r._wrapperState = { initialChecked: c, initialValue: l, controlled: o.type === "checkbox" || o.type === "radio" ? o.checked != null : o.value != null };
    }
    function Lr(r, o) {
      o = o.checked, o != null && I(r, "checked", o, !1);
    }
    function dr(r, o) {
      Lr(r, o);
      var l = Ae(o.value), c = o.type;
      if (l != null)
        c === "number" ? (l === 0 && r.value === "" || r.value != l) && (r.value = "" + l) : r.value !== "" + l && (r.value = "" + l);
      else if (c === "submit" || c === "reset") {
        r.removeAttribute("value");
        return;
      }
      o.hasOwnProperty("value") ? ni(r, o.type, l) : o.hasOwnProperty("defaultValue") && ni(r, o.type, Ae(o.defaultValue)), o.checked == null && o.defaultChecked != null && (r.defaultChecked = !!o.defaultChecked);
    }
    function Ar(r, o, l) {
      if (o.hasOwnProperty("value") || o.hasOwnProperty("defaultValue")) {
        var c = o.type;
        if (!(c !== "submit" && c !== "reset" || o.value !== void 0 && o.value !== null))
          return;
        o = "" + r._wrapperState.initialValue, l || o === r.value || (r.value = o), r.defaultValue = o;
      }
      l = r.name, l !== "" && (r.name = ""), r.defaultChecked = !!r._wrapperState.initialChecked, l !== "" && (r.name = l);
    }
    function ni(r, o, l) {
      (o !== "number" || qn(r.ownerDocument) !== r) && (l == null ? r.defaultValue = "" + r._wrapperState.initialValue : r.defaultValue !== "" + l && (r.defaultValue = "" + l));
    }
    var Kn = Array.isArray;
    function Ln(r, o, l, c) {
      if (r = r.options, o) {
        o = {};
        for (var h = 0; h < l.length; h++)
          o["$" + l[h]] = !0;
        for (l = 0; l < r.length; l++)
          h = o.hasOwnProperty("$" + r[l].value), r[l].selected !== h && (r[l].selected = h), h && c && (r[l].defaultSelected = !0);
      } else {
        for (l = "" + Ae(l), o = null, h = 0; h < r.length; h++) {
          if (r[h].value === l) {
            r[h].selected = !0, c && (r[h].defaultSelected = !0);
            return;
          }
          o !== null || r[h].disabled || (o = r[h]);
        }
        o !== null && (o.selected = !0);
      }
    }
    function kr(r, o) {
      if (o.dangerouslySetInnerHTML != null)
        throw Error(n(91));
      return T({}, o, { value: void 0, defaultValue: void 0, children: "" + r._wrapperState.initialValue });
    }
    function Xi(r, o) {
      var l = o.value;
      if (l == null) {
        if (l = o.children, o = o.defaultValue, l != null) {
          if (o != null)
            throw Error(n(92));
          if (Kn(l)) {
            if (1 < l.length)
              throw Error(n(93));
            l = l[0];
          }
          o = l;
        }
        o == null && (o = ""), l = o;
      }
      r._wrapperState = { initialValue: Ae(l) };
    }
    function An(r, o) {
      var l = Ae(o.value), c = Ae(o.defaultValue);
      l != null && (l = "" + l, l !== r.value && (r.value = l), o.defaultValue == null && r.defaultValue !== l && (r.defaultValue = l)), c != null && (r.defaultValue = "" + c);
    }
    function on(r) {
      var o = r.textContent;
      o === r._wrapperState.initialValue && o !== "" && o !== null && (r.value = o);
    }
    function ht(r) {
      switch (r) {
        case "svg":
          return "http://www.w3.org/2000/svg";
        case "math":
          return "http://www.w3.org/1998/Math/MathML";
        default:
          return "http://www.w3.org/1999/xhtml";
      }
    }
    function ri(r, o) {
      return r == null || r === "http://www.w3.org/1999/xhtml" ? ht(o) : r === "http://www.w3.org/2000/svg" && o === "foreignObject" ? "http://www.w3.org/1999/xhtml" : r;
    }
    var sn, Ft = function(r) {
      return typeof MSApp < "u" && MSApp.execUnsafeLocalFunction ? function(o, l, c, h) {
        MSApp.execUnsafeLocalFunction(function() {
          return r(o, l, c, h);
        });
      } : r;
    }(function(r, o) {
      if (r.namespaceURI !== "http://www.w3.org/2000/svg" || "innerHTML" in r)
        r.innerHTML = o;
      else {
        for (sn = sn || document.createElement("div"), sn.innerHTML = "<svg>" + o.valueOf().toString() + "</svg>", o = sn.firstChild; r.firstChild; )
          r.removeChild(r.firstChild);
        for (; o.firstChild; )
          r.appendChild(o.firstChild);
      }
    });
    function ii(r, o) {
      if (o) {
        var l = r.firstChild;
        if (l && l === r.lastChild && l.nodeType === 3) {
          l.nodeValue = o;
          return;
        }
      }
      r.textContent = o;
    }
    var Ji = {
      animationIterationCount: !0,
      aspectRatio: !0,
      borderImageOutset: !0,
      borderImageSlice: !0,
      borderImageWidth: !0,
      boxFlex: !0,
      boxFlexGroup: !0,
      boxOrdinalGroup: !0,
      columnCount: !0,
      columns: !0,
      flex: !0,
      flexGrow: !0,
      flexPositive: !0,
      flexShrink: !0,
      flexNegative: !0,
      flexOrder: !0,
      gridArea: !0,
      gridRow: !0,
      gridRowEnd: !0,
      gridRowSpan: !0,
      gridRowStart: !0,
      gridColumn: !0,
      gridColumnEnd: !0,
      gridColumnSpan: !0,
      gridColumnStart: !0,
      fontWeight: !0,
      lineClamp: !0,
      lineHeight: !0,
      opacity: !0,
      order: !0,
      orphans: !0,
      tabSize: !0,
      widows: !0,
      zIndex: !0,
      zoom: !0,
      fillOpacity: !0,
      floodOpacity: !0,
      stopOpacity: !0,
      strokeDasharray: !0,
      strokeDashoffset: !0,
      strokeMiterlimit: !0,
      strokeOpacity: !0,
      strokeWidth: !0
    }, fr = ["Webkit", "ms", "Moz", "O"];
    Object.keys(Ji).forEach(function(r) {
      fr.forEach(function(o) {
        o = o + r.charAt(0).toUpperCase() + r.substring(1), Ji[o] = Ji[r];
      });
    });
    function Qi(r, o, l) {
      return o == null || typeof o == "boolean" || o === "" ? "" : l || typeof o != "number" || o === 0 || Ji.hasOwnProperty(r) && Ji[r] ? ("" + o).trim() : o + "px";
    }
    function Yu(r, o) {
      r = r.style;
      for (var l in o)
        if (o.hasOwnProperty(l)) {
          var c = l.indexOf("--") === 0, h = Qi(l, o[l], c);
          l === "float" && (l = "cssFloat"), c ? r.setProperty(l, h) : r[l] = h;
        }
    }
    var Z = T({ menuitem: !0 }, { area: !0, base: !0, br: !0, col: !0, embed: !0, hr: !0, img: !0, input: !0, keygen: !0, link: !0, meta: !0, param: !0, source: !0, track: !0, wbr: !0 });
    function ve(r, o) {
      if (o) {
        if (Z[r] && (o.children != null || o.dangerouslySetInnerHTML != null))
          throw Error(n(137, r));
        if (o.dangerouslySetInnerHTML != null) {
          if (o.children != null)
            throw Error(n(60));
          if (typeof o.dangerouslySetInnerHTML != "object" || !("__html" in o.dangerouslySetInnerHTML))
            throw Error(n(61));
        }
        if (o.style != null && typeof o.style != "object")
          throw Error(n(62));
      }
    }
    function ae(r, o) {
      if (r.indexOf("-") === -1)
        return typeof o.is == "string";
      switch (r) {
        case "annotation-xml":
        case "color-profile":
        case "font-face":
        case "font-face-src":
        case "font-face-uri":
        case "font-face-format":
        case "font-face-name":
        case "missing-glyph":
          return !1;
        default:
          return !0;
      }
    }
    var Ie = null;
    function Qe(r) {
      return r = r.target || r.srcElement || window, r.correspondingUseElement && (r = r.correspondingUseElement), r.nodeType === 3 ? r.parentNode : r;
    }
    var Fe = null, Ue = null, We = null;
    function nt(r) {
      if (r = Da(r)) {
        if (typeof Fe != "function")
          throw Error(n(280));
        var o = r.stateNode;
        o && (o = Ec(o), Fe(r.stateNode, r.type, o));
      }
    }
    function Re(r) {
      Ue ? We ? We.push(r) : We = [r] : Ue = r;
    }
    function $e() {
      if (Ue) {
        var r = Ue, o = We;
        if (We = Ue = null, nt(r), o)
          for (r = 0; r < o.length; r++)
            nt(o[r]);
      }
    }
    function an(r, o) {
      return r(o);
    }
    function Pr() {
    }
    var ln = !1;
    function Lt(r, o, l) {
      if (ln)
        return r(o, l);
      ln = !0;
      try {
        return an(r, o, l);
      } finally {
        ln = !1, (Ue !== null || We !== null) && (Pr(), $e());
      }
    }
    function zt(r, o) {
      var l = r.stateNode;
      if (l === null)
        return null;
      var c = Ec(l);
      if (c === null)
        return null;
      l = c[o];
      e:
        switch (o) {
          case "onClick":
          case "onClickCapture":
          case "onDoubleClick":
          case "onDoubleClickCapture":
          case "onMouseDown":
          case "onMouseDownCapture":
          case "onMouseMove":
          case "onMouseMoveCapture":
          case "onMouseUp":
          case "onMouseUpCapture":
          case "onMouseEnter":
            (c = !c.disabled) || (r = r.type, c = !(r === "button" || r === "input" || r === "select" || r === "textarea")), r = !c;
            break e;
          default:
            r = !1;
        }
      if (r)
        return null;
      if (l && typeof l != "function")
        throw Error(n(231, o, typeof l));
      return l;
    }
    var wn = !1;
    if (d)
      try {
        var bt = {};
        Object.defineProperty(bt, "passive", { get: function() {
          wn = !0;
        } }), window.addEventListener("test", bt, bt), window.removeEventListener("test", bt, bt);
      } catch {
        wn = !1;
      }
    function Ir(r, o, l, c, h, g, w, b, _) {
      var H = Array.prototype.slice.call(arguments, 3);
      try {
        o.apply(l, H);
      } catch (K) {
        this.onError(K);
      }
    }
    var kn = !1, Zt = null, hr = !1, oi = null, Ku = { onError: function(r) {
      kn = !0, Zt = r;
    } };
    function Zu(r, o, l, c, h, g, w, b, _) {
      kn = !1, Zt = null, Ir.apply(Ku, arguments);
    }
    function ha(r, o, l, c, h, g, w, b, _) {
      if (Zu.apply(this, arguments), kn) {
        if (kn) {
          var H = Zt;
          kn = !1, Zt = null;
        } else
          throw Error(n(198));
        hr || (hr = !0, oi = H);
      }
    }
    function pr(r) {
      var o = r, l = r;
      if (r.alternate)
        for (; o.return; )
          o = o.return;
      else {
        r = o;
        do
          o = r, o.flags & 4098 && (l = o.return), r = o.return;
        while (r);
      }
      return o.tag === 3 ? l : null;
    }
    function Qo(r) {
      if (r.tag === 13) {
        var o = r.memoizedState;
        if (o === null && (r = r.alternate, r !== null && (o = r.memoizedState)), o !== null)
          return o.dehydrated;
      }
      return null;
    }
    function pa(r) {
      if (pr(r) !== r)
        throw Error(n(188));
    }
    function Xu(r) {
      var o = r.alternate;
      if (!o) {
        if (o = pr(r), o === null)
          throw Error(n(188));
        return o !== r ? null : r;
      }
      for (var l = r, c = o; ; ) {
        var h = l.return;
        if (h === null)
          break;
        var g = h.alternate;
        if (g === null) {
          if (c = h.return, c !== null) {
            l = c;
            continue;
          }
          break;
        }
        if (h.child === g.child) {
          for (g = h.child; g; ) {
            if (g === l)
              return pa(h), r;
            if (g === c)
              return pa(h), o;
            g = g.sibling;
          }
          throw Error(n(188));
        }
        if (l.return !== c.return)
          l = h, c = g;
        else {
          for (var w = !1, b = h.child; b; ) {
            if (b === l) {
              w = !0, l = h, c = g;
              break;
            }
            if (b === c) {
              w = !0, c = h, l = g;
              break;
            }
            b = b.sibling;
          }
          if (!w) {
            for (b = g.child; b; ) {
              if (b === l) {
                w = !0, l = g, c = h;
                break;
              }
              if (b === c) {
                w = !0, c = g, l = h;
                break;
              }
              b = b.sibling;
            }
            if (!w)
              throw Error(n(189));
          }
        }
        if (l.alternate !== c)
          throw Error(n(190));
      }
      if (l.tag !== 3)
        throw Error(n(188));
      return l.stateNode.current === l ? r : o;
    }
    function si(r) {
      return r = Xu(r), r !== null ? ma(r) : null;
    }
    function ma(r) {
      if (r.tag === 5 || r.tag === 6)
        return r;
      for (r = r.child; r !== null; ) {
        var o = ma(r);
        if (o !== null)
          return o;
        r = r.sibling;
      }
      return null;
    }
    var eo = e.unstable_scheduleCallback, to = e.unstable_cancelCallback, Ju = e.unstable_shouldYield, Qu = e.unstable_requestPaint, at = e.unstable_now, ec = e.unstable_getCurrentPriorityLevel, ai = e.unstable_ImmediatePriority, ga = e.unstable_UserBlockingPriority, tc = e.unstable_NormalPriority, ck = e.unstable_LowPriority, aw = e.unstable_IdlePriority, nc = null, mr = null;
    function dk(r) {
      if (mr && typeof mr.onCommitFiberRoot == "function")
        try {
          mr.onCommitFiberRoot(nc, r, void 0, (r.current.flags & 128) === 128);
        } catch {
        }
    }
    var Zn = Math.clz32 ? Math.clz32 : pk, fk = Math.log, hk = Math.LN2;
    function pk(r) {
      return r >>>= 0, r === 0 ? 32 : 31 - (fk(r) / hk | 0) | 0;
    }
    var rc = 64, ic = 4194304;
    function va(r) {
      switch (r & -r) {
        case 1:
          return 1;
        case 2:
          return 2;
        case 4:
          return 4;
        case 8:
          return 8;
        case 16:
          return 16;
        case 32:
          return 32;
        case 64:
        case 128:
        case 256:
        case 512:
        case 1024:
        case 2048:
        case 4096:
        case 8192:
        case 16384:
        case 32768:
        case 65536:
        case 131072:
        case 262144:
        case 524288:
        case 1048576:
        case 2097152:
          return r & 4194240;
        case 4194304:
        case 8388608:
        case 16777216:
        case 33554432:
        case 67108864:
          return r & 130023424;
        case 134217728:
          return 134217728;
        case 268435456:
          return 268435456;
        case 536870912:
          return 536870912;
        case 1073741824:
          return 1073741824;
        default:
          return r;
      }
    }
    function oc(r, o) {
      var l = r.pendingLanes;
      if (l === 0)
        return 0;
      var c = 0, h = r.suspendedLanes, g = r.pingedLanes, w = l & 268435455;
      if (w !== 0) {
        var b = w & ~h;
        b !== 0 ? c = va(b) : (g &= w, g !== 0 && (c = va(g)));
      } else
        w = l & ~h, w !== 0 ? c = va(w) : g !== 0 && (c = va(g));
      if (c === 0)
        return 0;
      if (o !== 0 && o !== c && !(o & h) && (h = c & -c, g = o & -o, h >= g || h === 16 && (g & 4194240) !== 0))
        return o;
      if (c & 4 && (c |= l & 16), o = r.entangledLanes, o !== 0)
        for (r = r.entanglements, o &= c; 0 < o; )
          l = 31 - Zn(o), h = 1 << l, c |= r[l], o &= ~h;
      return c;
    }
    function mk(r, o) {
      switch (r) {
        case 1:
        case 2:
        case 4:
          return o + 250;
        case 8:
        case 16:
        case 32:
        case 64:
        case 128:
        case 256:
        case 512:
        case 1024:
        case 2048:
        case 4096:
        case 8192:
        case 16384:
        case 32768:
        case 65536:
        case 131072:
        case 262144:
        case 524288:
        case 1048576:
        case 2097152:
          return o + 5e3;
        case 4194304:
        case 8388608:
        case 16777216:
        case 33554432:
        case 67108864:
          return -1;
        case 134217728:
        case 268435456:
        case 536870912:
        case 1073741824:
          return -1;
        default:
          return -1;
      }
    }
    function gk(r, o) {
      for (var l = r.suspendedLanes, c = r.pingedLanes, h = r.expirationTimes, g = r.pendingLanes; 0 < g; ) {
        var w = 31 - Zn(g), b = 1 << w, _ = h[w];
        _ === -1 ? (!(b & l) || b & c) && (h[w] = mk(b, o)) : _ <= o && (r.expiredLanes |= b), g &= ~b;
      }
    }
    function Qh(r) {
      return r = r.pendingLanes & -1073741825, r !== 0 ? r : r & 1073741824 ? 1073741824 : 0;
    }
    function lw() {
      var r = rc;
      return rc <<= 1, !(rc & 4194240) && (rc = 64), r;
    }
    function ep(r) {
      for (var o = [], l = 0; 31 > l; l++)
        o.push(r);
      return o;
    }
    function ya(r, o, l) {
      r.pendingLanes |= o, o !== 536870912 && (r.suspendedLanes = 0, r.pingedLanes = 0), r = r.eventTimes, o = 31 - Zn(o), r[o] = l;
    }
    function vk(r, o) {
      var l = r.pendingLanes & ~o;
      r.pendingLanes = o, r.suspendedLanes = 0, r.pingedLanes = 0, r.expiredLanes &= o, r.mutableReadLanes &= o, r.entangledLanes &= o, o = r.entanglements;
      var c = r.eventTimes;
      for (r = r.expirationTimes; 0 < l; ) {
        var h = 31 - Zn(l), g = 1 << h;
        o[h] = 0, c[h] = -1, r[h] = -1, l &= ~g;
      }
    }
    function tp(r, o) {
      var l = r.entangledLanes |= o;
      for (r = r.entanglements; l; ) {
        var c = 31 - Zn(l), h = 1 << c;
        h & o | r[c] & o && (r[c] |= o), l &= ~h;
      }
    }
    var Xe = 0;
    function uw(r) {
      return r &= -r, 1 < r ? 4 < r ? r & 268435455 ? 16 : 536870912 : 4 : 1;
    }
    var cw, np, dw, fw, hw, rp = !1, sc = [], li = null, ui = null, ci = null, wa = /* @__PURE__ */ new Map(), Sa = /* @__PURE__ */ new Map(), di = [], yk = "mousedown mouseup touchcancel touchend touchstart auxclick dblclick pointercancel pointerdown pointerup dragend dragstart drop compositionend compositionstart keydown keypress keyup input textInput copy cut paste click change contextmenu reset submit".split(" ");
    function pw(r, o) {
      switch (r) {
        case "focusin":
        case "focusout":
          li = null;
          break;
        case "dragenter":
        case "dragleave":
          ui = null;
          break;
        case "mouseover":
        case "mouseout":
          ci = null;
          break;
        case "pointerover":
        case "pointerout":
          wa.delete(o.pointerId);
          break;
        case "gotpointercapture":
        case "lostpointercapture":
          Sa.delete(o.pointerId);
      }
    }
    function Ea(r, o, l, c, h, g) {
      return r === null || r.nativeEvent !== g ? (r = { blockedOn: o, domEventName: l, eventSystemFlags: c, nativeEvent: g, targetContainers: [h] }, o !== null && (o = Da(o), o !== null && np(o)), r) : (r.eventSystemFlags |= c, o = r.targetContainers, h !== null && o.indexOf(h) === -1 && o.push(h), r);
    }
    function wk(r, o, l, c, h) {
      switch (o) {
        case "focusin":
          return li = Ea(li, r, o, l, c, h), !0;
        case "dragenter":
          return ui = Ea(ui, r, o, l, c, h), !0;
        case "mouseover":
          return ci = Ea(ci, r, o, l, c, h), !0;
        case "pointerover":
          var g = h.pointerId;
          return wa.set(g, Ea(wa.get(g) || null, r, o, l, c, h)), !0;
        case "gotpointercapture":
          return g = h.pointerId, Sa.set(g, Ea(Sa.get(g) || null, r, o, l, c, h)), !0;
      }
      return !1;
    }
    function mw(r) {
      var o = no(r.target);
      if (o !== null) {
        var l = pr(o);
        if (l !== null) {
          if (o = l.tag, o === 13) {
            if (o = Qo(l), o !== null) {
              r.blockedOn = o, hw(r.priority, function() {
                dw(l);
              });
              return;
            }
          } else if (o === 3 && l.stateNode.current.memoizedState.isDehydrated) {
            r.blockedOn = l.tag === 3 ? l.stateNode.containerInfo : null;
            return;
          }
        }
      }
      r.blockedOn = null;
    }
    function ac(r) {
      if (r.blockedOn !== null)
        return !1;
      for (var o = r.targetContainers; 0 < o.length; ) {
        var l = op(r.domEventName, r.eventSystemFlags, o[0], r.nativeEvent);
        if (l === null) {
          l = r.nativeEvent;
          var c = new l.constructor(l.type, l);
          Ie = c, l.target.dispatchEvent(c), Ie = null;
        } else
          return o = Da(l), o !== null && np(o), r.blockedOn = l, !1;
        o.shift();
      }
      return !0;
    }
    function gw(r, o, l) {
      ac(r) && l.delete(o);
    }
    function Sk() {
      rp = !1, li !== null && ac(li) && (li = null), ui !== null && ac(ui) && (ui = null), ci !== null && ac(ci) && (ci = null), wa.forEach(gw), Sa.forEach(gw);
    }
    function xa(r, o) {
      r.blockedOn === o && (r.blockedOn = null, rp || (rp = !0, e.unstable_scheduleCallback(e.unstable_NormalPriority, Sk)));
    }
    function ba(r) {
      function o(h) {
        return xa(h, r);
      }
      if (0 < sc.length) {
        xa(sc[0], r);
        for (var l = 1; l < sc.length; l++) {
          var c = sc[l];
          c.blockedOn === r && (c.blockedOn = null);
        }
      }
      for (li !== null && xa(li, r), ui !== null && xa(ui, r), ci !== null && xa(ci, r), wa.forEach(o), Sa.forEach(o), l = 0; l < di.length; l++)
        c = di[l], c.blockedOn === r && (c.blockedOn = null);
      for (; 0 < di.length && (l = di[0], l.blockedOn === null); )
        mw(l), l.blockedOn === null && di.shift();
    }
    var es = B.ReactCurrentBatchConfig, lc = !0;
    function Ek(r, o, l, c) {
      var h = Xe, g = es.transition;
      es.transition = null;
      try {
        Xe = 1, ip(r, o, l, c);
      } finally {
        Xe = h, es.transition = g;
      }
    }
    function xk(r, o, l, c) {
      var h = Xe, g = es.transition;
      es.transition = null;
      try {
        Xe = 4, ip(r, o, l, c);
      } finally {
        Xe = h, es.transition = g;
      }
    }
    function ip(r, o, l, c) {
      if (lc) {
        var h = op(r, o, l, c);
        if (h === null)
          xp(r, o, c, uc, l), pw(r, c);
        else if (wk(h, r, o, l, c))
          c.stopPropagation();
        else if (pw(r, c), o & 4 && -1 < yk.indexOf(r)) {
          for (; h !== null; ) {
            var g = Da(h);
            if (g !== null && cw(g), g = op(r, o, l, c), g === null && xp(r, o, c, uc, l), g === h)
              break;
            h = g;
          }
          h !== null && c.stopPropagation();
        } else
          xp(r, o, c, null, l);
      }
    }
    var uc = null;
    function op(r, o, l, c) {
      if (uc = null, r = Qe(c), r = no(r), r !== null)
        if (o = pr(r), o === null)
          r = null;
        else if (l = o.tag, l === 13) {
          if (r = Qo(o), r !== null)
            return r;
          r = null;
        } else if (l === 3) {
          if (o.stateNode.current.memoizedState.isDehydrated)
            return o.tag === 3 ? o.stateNode.containerInfo : null;
          r = null;
        } else
          o !== r && (r = null);
      return uc = r, null;
    }
    function vw(r) {
      switch (r) {
        case "cancel":
        case "click":
        case "close":
        case "contextmenu":
        case "copy":
        case "cut":
        case "auxclick":
        case "dblclick":
        case "dragend":
        case "dragstart":
        case "drop":
        case "focusin":
        case "focusout":
        case "input":
        case "invalid":
        case "keydown":
        case "keypress":
        case "keyup":
        case "mousedown":
        case "mouseup":
        case "paste":
        case "pause":
        case "play":
        case "pointercancel":
        case "pointerdown":
        case "pointerup":
        case "ratechange":
        case "reset":
        case "resize":
        case "seeked":
        case "submit":
        case "touchcancel":
        case "touchend":
        case "touchstart":
        case "volumechange":
        case "change":
        case "selectionchange":
        case "textInput":
        case "compositionstart":
        case "compositionend":
        case "compositionupdate":
        case "beforeblur":
        case "afterblur":
        case "beforeinput":
        case "blur":
        case "fullscreenchange":
        case "focus":
        case "hashchange":
        case "popstate":
        case "select":
        case "selectstart":
          return 1;
        case "drag":
        case "dragenter":
        case "dragexit":
        case "dragleave":
        case "dragover":
        case "mousemove":
        case "mouseout":
        case "mouseover":
        case "pointermove":
        case "pointerout":
        case "pointerover":
        case "scroll":
        case "toggle":
        case "touchmove":
        case "wheel":
        case "mouseenter":
        case "mouseleave":
        case "pointerenter":
        case "pointerleave":
          return 4;
        case "message":
          switch (ec()) {
            case ai:
              return 1;
            case ga:
              return 4;
            case tc:
            case ck:
              return 16;
            case aw:
              return 536870912;
            default:
              return 16;
          }
        default:
          return 16;
      }
    }
    var fi = null, sp = null, cc = null;
    function yw() {
      if (cc)
        return cc;
      var r, o = sp, l = o.length, c, h = "value" in fi ? fi.value : fi.textContent, g = h.length;
      for (r = 0; r < l && o[r] === h[r]; r++)
        ;
      var w = l - r;
      for (c = 1; c <= w && o[l - c] === h[g - c]; c++)
        ;
      return cc = h.slice(r, 1 < c ? 1 - c : void 0);
    }
    function dc(r) {
      var o = r.keyCode;
      return "charCode" in r ? (r = r.charCode, r === 0 && o === 13 && (r = 13)) : r = o, r === 10 && (r = 13), 32 <= r || r === 13 ? r : 0;
    }
    function fc() {
      return !0;
    }
    function ww() {
      return !1;
    }
    function Sn(r) {
      function o(l, c, h, g, w) {
        this._reactName = l, this._targetInst = h, this.type = c, this.nativeEvent = g, this.target = w, this.currentTarget = null;
        for (var b in r)
          r.hasOwnProperty(b) && (l = r[b], this[b] = l ? l(g) : g[b]);
        return this.isDefaultPrevented = (g.defaultPrevented != null ? g.defaultPrevented : g.returnValue === !1) ? fc : ww, this.isPropagationStopped = ww, this;
      }
      return T(o.prototype, { preventDefault: function() {
        this.defaultPrevented = !0;
        var l = this.nativeEvent;
        l && (l.preventDefault ? l.preventDefault() : typeof l.returnValue != "unknown" && (l.returnValue = !1), this.isDefaultPrevented = fc);
      }, stopPropagation: function() {
        var l = this.nativeEvent;
        l && (l.stopPropagation ? l.stopPropagation() : typeof l.cancelBubble != "unknown" && (l.cancelBubble = !0), this.isPropagationStopped = fc);
      }, persist: function() {
      }, isPersistent: fc }), o;
    }
    var ts = { eventPhase: 0, bubbles: 0, cancelable: 0, timeStamp: function(r) {
      return r.timeStamp || Date.now();
    }, defaultPrevented: 0, isTrusted: 0 }, ap = Sn(ts), Ca = T({}, ts, { view: 0, detail: 0 }), bk = Sn(Ca), lp, up, Ta, hc = T({}, Ca, { screenX: 0, screenY: 0, clientX: 0, clientY: 0, pageX: 0, pageY: 0, ctrlKey: 0, shiftKey: 0, altKey: 0, metaKey: 0, getModifierState: dp, button: 0, buttons: 0, relatedTarget: function(r) {
      return r.relatedTarget === void 0 ? r.fromElement === r.srcElement ? r.toElement : r.fromElement : r.relatedTarget;
    }, movementX: function(r) {
      return "movementX" in r ? r.movementX : (r !== Ta && (Ta && r.type === "mousemove" ? (lp = r.screenX - Ta.screenX, up = r.screenY - Ta.screenY) : up = lp = 0, Ta = r), lp);
    }, movementY: function(r) {
      return "movementY" in r ? r.movementY : up;
    } }), Sw = Sn(hc), Ck = T({}, hc, { dataTransfer: 0 }), Tk = Sn(Ck), Ok = T({}, Ca, { relatedTarget: 0 }), cp = Sn(Ok), _k = T({}, ts, { animationName: 0, elapsedTime: 0, pseudoElement: 0 }), Rk = Sn(_k), Lk = T({}, ts, { clipboardData: function(r) {
      return "clipboardData" in r ? r.clipboardData : window.clipboardData;
    } }), Ak = Sn(Lk), kk = T({}, ts, { data: 0 }), Ew = Sn(kk), Pk = {
      Esc: "Escape",
      Spacebar: " ",
      Left: "ArrowLeft",
      Up: "ArrowUp",
      Right: "ArrowRight",
      Down: "ArrowDown",
      Del: "Delete",
      Win: "OS",
      Menu: "ContextMenu",
      Apps: "ContextMenu",
      Scroll: "ScrollLock",
      MozPrintableKey: "Unidentified"
    }, Ik = {
      8: "Backspace",
      9: "Tab",
      12: "Clear",
      13: "Enter",
      16: "Shift",
      17: "Control",
      18: "Alt",
      19: "Pause",
      20: "CapsLock",
      27: "Escape",
      32: " ",
      33: "PageUp",
      34: "PageDown",
      35: "End",
      36: "Home",
      37: "ArrowLeft",
      38: "ArrowUp",
      39: "ArrowRight",
      40: "ArrowDown",
      45: "Insert",
      46: "Delete",
      112: "F1",
      113: "F2",
      114: "F3",
      115: "F4",
      116: "F5",
      117: "F6",
      118: "F7",
      119: "F8",
      120: "F9",
      121: "F10",
      122: "F11",
      123: "F12",
      144: "NumLock",
      145: "ScrollLock",
      224: "Meta"
    }, Nk = { Alt: "altKey", Control: "ctrlKey", Meta: "metaKey", Shift: "shiftKey" };
    function Dk(r) {
      var o = this.nativeEvent;
      return o.getModifierState ? o.getModifierState(r) : (r = Nk[r]) ? !!o[r] : !1;
    }
    function dp() {
      return Dk;
    }
    var jk = T({}, Ca, { key: function(r) {
      if (r.key) {
        var o = Pk[r.key] || r.key;
        if (o !== "Unidentified")
          return o;
      }
      return r.type === "keypress" ? (r = dc(r), r === 13 ? "Enter" : String.fromCharCode(r)) : r.type === "keydown" || r.type === "keyup" ? Ik[r.keyCode] || "Unidentified" : "";
    }, code: 0, location: 0, ctrlKey: 0, shiftKey: 0, altKey: 0, metaKey: 0, repeat: 0, locale: 0, getModifierState: dp, charCode: function(r) {
      return r.type === "keypress" ? dc(r) : 0;
    }, keyCode: function(r) {
      return r.type === "keydown" || r.type === "keyup" ? r.keyCode : 0;
    }, which: function(r) {
      return r.type === "keypress" ? dc(r) : r.type === "keydown" || r.type === "keyup" ? r.keyCode : 0;
    } }), Mk = Sn(jk), Fk = T({}, hc, { pointerId: 0, width: 0, height: 0, pressure: 0, tangentialPressure: 0, tiltX: 0, tiltY: 0, twist: 0, pointerType: 0, isPrimary: 0 }), xw = Sn(Fk), Hk = T({}, Ca, { touches: 0, targetTouches: 0, changedTouches: 0, altKey: 0, metaKey: 0, ctrlKey: 0, shiftKey: 0, getModifierState: dp }), Bk = Sn(Hk), Uk = T({}, ts, { propertyName: 0, elapsedTime: 0, pseudoElement: 0 }), $k = Sn(Uk), zk = T({}, hc, {
      deltaX: function(r) {
        return "deltaX" in r ? r.deltaX : "wheelDeltaX" in r ? -r.wheelDeltaX : 0;
      },
      deltaY: function(r) {
        return "deltaY" in r ? r.deltaY : "wheelDeltaY" in r ? -r.wheelDeltaY : "wheelDelta" in r ? -r.wheelDelta : 0;
      },
      deltaZ: 0,
      deltaMode: 0
    }), Vk = Sn(zk), Wk = [9, 13, 27, 32], fp = d && "CompositionEvent" in window, Oa = null;
    d && "documentMode" in document && (Oa = document.documentMode);
    var Gk = d && "TextEvent" in window && !Oa, bw = d && (!fp || Oa && 8 < Oa && 11 >= Oa), Cw = " ", Tw = !1;
    function Ow(r, o) {
      switch (r) {
        case "keyup":
          return Wk.indexOf(o.keyCode) !== -1;
        case "keydown":
          return o.keyCode !== 229;
        case "keypress":
        case "mousedown":
        case "focusout":
          return !0;
        default:
          return !1;
      }
    }
    function _w(r) {
      return r = r.detail, typeof r == "object" && "data" in r ? r.data : null;
    }
    var ns = !1;
    function qk(r, o) {
      switch (r) {
        case "compositionend":
          return _w(o);
        case "keypress":
          return o.which !== 32 ? null : (Tw = !0, Cw);
        case "textInput":
          return r = o.data, r === Cw && Tw ? null : r;
        default:
          return null;
      }
    }
    function Yk(r, o) {
      if (ns)
        return r === "compositionend" || !fp && Ow(r, o) ? (r = yw(), cc = sp = fi = null, ns = !1, r) : null;
      switch (r) {
        case "paste":
          return null;
        case "keypress":
          if (!(o.ctrlKey || o.altKey || o.metaKey) || o.ctrlKey && o.altKey) {
            if (o.char && 1 < o.char.length)
              return o.char;
            if (o.which)
              return String.fromCharCode(o.which);
          }
          return null;
        case "compositionend":
          return bw && o.locale !== "ko" ? null : o.data;
        default:
          return null;
      }
    }
    var Kk = { color: !0, date: !0, datetime: !0, "datetime-local": !0, email: !0, month: !0, number: !0, password: !0, range: !0, search: !0, tel: !0, text: !0, time: !0, url: !0, week: !0 };
    function Rw(r) {
      var o = r && r.nodeName && r.nodeName.toLowerCase();
      return o === "input" ? !!Kk[r.type] : o === "textarea";
    }
    function Lw(r, o, l, c) {
      Re(c), o = yc(o, "onChange"), 0 < o.length && (l = new ap("onChange", "change", null, l, c), r.push({ event: l, listeners: o }));
    }
    var _a = null, Ra = null;
    function Zk(r) {
      qw(r, 0);
    }
    function pc(r) {
      var o = as(r);
      if (xt(o))
        return r;
    }
    function Xk(r, o) {
      if (r === "change")
        return o;
    }
    var Aw = !1;
    if (d) {
      var hp;
      if (d) {
        var pp = "oninput" in document;
        if (!pp) {
          var kw = document.createElement("div");
          kw.setAttribute("oninput", "return;"), pp = typeof kw.oninput == "function";
        }
        hp = pp;
      } else
        hp = !1;
      Aw = hp && (!document.documentMode || 9 < document.documentMode);
    }
    function Pw() {
      _a && (_a.detachEvent("onpropertychange", Iw), Ra = _a = null);
    }
    function Iw(r) {
      if (r.propertyName === "value" && pc(Ra)) {
        var o = [];
        Lw(o, Ra, r, Qe(r)), Lt(Zk, o);
      }
    }
    function Jk(r, o, l) {
      r === "focusin" ? (Pw(), _a = o, Ra = l, _a.attachEvent("onpropertychange", Iw)) : r === "focusout" && Pw();
    }
    function Qk(r) {
      if (r === "selectionchange" || r === "keyup" || r === "keydown")
        return pc(Ra);
    }
    function eP(r, o) {
      if (r === "click")
        return pc(o);
    }
    function tP(r, o) {
      if (r === "input" || r === "change")
        return pc(o);
    }
    function nP(r, o) {
      return r === o && (r !== 0 || 1 / r === 1 / o) || r !== r && o !== o;
    }
    var Xn = typeof Object.is == "function" ? Object.is : nP;
    function La(r, o) {
      if (Xn(r, o))
        return !0;
      if (typeof r != "object" || r === null || typeof o != "object" || o === null)
        return !1;
      var l = Object.keys(r), c = Object.keys(o);
      if (l.length !== c.length)
        return !1;
      for (c = 0; c < l.length; c++) {
        var h = l[c];
        if (!f.call(o, h) || !Xn(r[h], o[h]))
          return !1;
      }
      return !0;
    }
    function Nw(r) {
      for (; r && r.firstChild; )
        r = r.firstChild;
      return r;
    }
    function Dw(r, o) {
      var l = Nw(r);
      r = 0;
      for (var c; l; ) {
        if (l.nodeType === 3) {
          if (c = r + l.textContent.length, r <= o && c >= o)
            return { node: l, offset: o - r };
          r = c;
        }
        e: {
          for (; l; ) {
            if (l.nextSibling) {
              l = l.nextSibling;
              break e;
            }
            l = l.parentNode;
          }
          l = void 0;
        }
        l = Nw(l);
      }
    }
    function jw(r, o) {
      return r && o ? r === o ? !0 : r && r.nodeType === 3 ? !1 : o && o.nodeType === 3 ? jw(r, o.parentNode) : "contains" in r ? r.contains(o) : r.compareDocumentPosition ? !!(r.compareDocumentPosition(o) & 16) : !1 : !1;
    }
    function Mw() {
      for (var r = window, o = qn(); o instanceof r.HTMLIFrameElement; ) {
        try {
          var l = typeof o.contentWindow.location.href == "string";
        } catch {
          l = !1;
        }
        if (l)
          r = o.contentWindow;
        else
          break;
        o = qn(r.document);
      }
      return o;
    }
    function mp(r) {
      var o = r && r.nodeName && r.nodeName.toLowerCase();
      return o && (o === "input" && (r.type === "text" || r.type === "search" || r.type === "tel" || r.type === "url" || r.type === "password") || o === "textarea" || r.contentEditable === "true");
    }
    function rP(r) {
      var o = Mw(), l = r.focusedElem, c = r.selectionRange;
      if (o !== l && l && l.ownerDocument && jw(l.ownerDocument.documentElement, l)) {
        if (c !== null && mp(l)) {
          if (o = c.start, r = c.end, r === void 0 && (r = o), "selectionStart" in l)
            l.selectionStart = o, l.selectionEnd = Math.min(r, l.value.length);
          else if (r = (o = l.ownerDocument || document) && o.defaultView || window, r.getSelection) {
            r = r.getSelection();
            var h = l.textContent.length, g = Math.min(c.start, h);
            c = c.end === void 0 ? g : Math.min(c.end, h), !r.extend && g > c && (h = c, c = g, g = h), h = Dw(l, g);
            var w = Dw(
              l,
              c
            );
            h && w && (r.rangeCount !== 1 || r.anchorNode !== h.node || r.anchorOffset !== h.offset || r.focusNode !== w.node || r.focusOffset !== w.offset) && (o = o.createRange(), o.setStart(h.node, h.offset), r.removeAllRanges(), g > c ? (r.addRange(o), r.extend(w.node, w.offset)) : (o.setEnd(w.node, w.offset), r.addRange(o)));
          }
        }
        for (o = [], r = l; r = r.parentNode; )
          r.nodeType === 1 && o.push({ element: r, left: r.scrollLeft, top: r.scrollTop });
        for (typeof l.focus == "function" && l.focus(), l = 0; l < o.length; l++)
          r = o[l], r.element.scrollLeft = r.left, r.element.scrollTop = r.top;
      }
    }
    var iP = d && "documentMode" in document && 11 >= document.documentMode, rs = null, gp = null, Aa = null, vp = !1;
    function Fw(r, o, l) {
      var c = l.window === l ? l.document : l.nodeType === 9 ? l : l.ownerDocument;
      vp || rs == null || rs !== qn(c) || (c = rs, "selectionStart" in c && mp(c) ? c = { start: c.selectionStart, end: c.selectionEnd } : (c = (c.ownerDocument && c.ownerDocument.defaultView || window).getSelection(), c = { anchorNode: c.anchorNode, anchorOffset: c.anchorOffset, focusNode: c.focusNode, focusOffset: c.focusOffset }), Aa && La(Aa, c) || (Aa = c, c = yc(gp, "onSelect"), 0 < c.length && (o = new ap("onSelect", "select", null, o, l), r.push({ event: o, listeners: c }), o.target = rs)));
    }
    function mc(r, o) {
      var l = {};
      return l[r.toLowerCase()] = o.toLowerCase(), l["Webkit" + r] = "webkit" + o, l["Moz" + r] = "moz" + o, l;
    }
    var is = { animationend: mc("Animation", "AnimationEnd"), animationiteration: mc("Animation", "AnimationIteration"), animationstart: mc("Animation", "AnimationStart"), transitionend: mc("Transition", "TransitionEnd") }, yp = {}, Hw = {};
    d && (Hw = document.createElement("div").style, "AnimationEvent" in window || (delete is.animationend.animation, delete is.animationiteration.animation, delete is.animationstart.animation), "TransitionEvent" in window || delete is.transitionend.transition);
    function gc(r) {
      if (yp[r])
        return yp[r];
      if (!is[r])
        return r;
      var o = is[r], l;
      for (l in o)
        if (o.hasOwnProperty(l) && l in Hw)
          return yp[r] = o[l];
      return r;
    }
    var Bw = gc("animationend"), Uw = gc("animationiteration"), $w = gc("animationstart"), zw = gc("transitionend"), Vw = /* @__PURE__ */ new Map(), Ww = "abort auxClick cancel canPlay canPlayThrough click close contextMenu copy cut drag dragEnd dragEnter dragExit dragLeave dragOver dragStart drop durationChange emptied encrypted ended error gotPointerCapture input invalid keyDown keyPress keyUp load loadedData loadedMetadata loadStart lostPointerCapture mouseDown mouseMove mouseOut mouseOver mouseUp paste pause play playing pointerCancel pointerDown pointerMove pointerOut pointerOver pointerUp progress rateChange reset resize seeked seeking stalled submit suspend timeUpdate touchCancel touchEnd touchStart volumeChange scroll toggle touchMove waiting wheel".split(" ");
    function hi(r, o) {
      Vw.set(r, o), a(o, [r]);
    }
    for (var wp = 0; wp < Ww.length; wp++) {
      var Sp = Ww[wp], oP = Sp.toLowerCase(), sP = Sp[0].toUpperCase() + Sp.slice(1);
      hi(oP, "on" + sP);
    }
    hi(Bw, "onAnimationEnd"), hi(Uw, "onAnimationIteration"), hi($w, "onAnimationStart"), hi("dblclick", "onDoubleClick"), hi("focusin", "onFocus"), hi("focusout", "onBlur"), hi(zw, "onTransitionEnd"), u("onMouseEnter", ["mouseout", "mouseover"]), u("onMouseLeave", ["mouseout", "mouseover"]), u("onPointerEnter", ["pointerout", "pointerover"]), u("onPointerLeave", ["pointerout", "pointerover"]), a("onChange", "change click focusin focusout input keydown keyup selectionchange".split(" ")), a("onSelect", "focusout contextmenu dragend focusin keydown keyup mousedown mouseup selectionchange".split(" ")), a("onBeforeInput", ["compositionend", "keypress", "textInput", "paste"]), a("onCompositionEnd", "compositionend focusout keydown keypress keyup mousedown".split(" ")), a("onCompositionStart", "compositionstart focusout keydown keypress keyup mousedown".split(" ")), a("onCompositionUpdate", "compositionupdate focusout keydown keypress keyup mousedown".split(" "));
    var ka = "abort canplay canplaythrough durationchange emptied encrypted ended error loadeddata loadedmetadata loadstart pause play playing progress ratechange resize seeked seeking stalled suspend timeupdate volumechange waiting".split(" "), aP = new Set("cancel close invalid load scroll toggle".split(" ").concat(ka));
    function Gw(r, o, l) {
      var c = r.type || "unknown-event";
      r.currentTarget = l, ha(c, o, void 0, r), r.currentTarget = null;
    }
    function qw(r, o) {
      o = (o & 4) !== 0;
      for (var l = 0; l < r.length; l++) {
        var c = r[l], h = c.event;
        c = c.listeners;
        e: {
          var g = void 0;
          if (o)
            for (var w = c.length - 1; 0 <= w; w--) {
              var b = c[w], _ = b.instance, H = b.currentTarget;
              if (b = b.listener, _ !== g && h.isPropagationStopped())
                break e;
              Gw(h, b, H), g = _;
            }
          else
            for (w = 0; w < c.length; w++) {
              if (b = c[w], _ = b.instance, H = b.currentTarget, b = b.listener, _ !== g && h.isPropagationStopped())
                break e;
              Gw(h, b, H), g = _;
            }
        }
      }
      if (hr)
        throw r = oi, hr = !1, oi = null, r;
    }
    function lt(r, o) {
      var l = o[Rp];
      l === void 0 && (l = o[Rp] = /* @__PURE__ */ new Set());
      var c = r + "__bubble";
      l.has(c) || (Yw(o, r, 2, !1), l.add(c));
    }
    function Ep(r, o, l) {
      var c = 0;
      o && (c |= 4), Yw(l, r, c, o);
    }
    var vc = "_reactListening" + Math.random().toString(36).slice(2);
    function Pa(r) {
      if (!r[vc]) {
        r[vc] = !0, i.forEach(function(l) {
          l !== "selectionchange" && (aP.has(l) || Ep(l, !1, r), Ep(l, !0, r));
        });
        var o = r.nodeType === 9 ? r : r.ownerDocument;
        o === null || o[vc] || (o[vc] = !0, Ep("selectionchange", !1, o));
      }
    }
    function Yw(r, o, l, c) {
      switch (vw(o)) {
        case 1:
          var h = Ek;
          break;
        case 4:
          h = xk;
          break;
        default:
          h = ip;
      }
      l = h.bind(null, o, l, r), h = void 0, !wn || o !== "touchstart" && o !== "touchmove" && o !== "wheel" || (h = !0), c ? h !== void 0 ? r.addEventListener(o, l, { capture: !0, passive: h }) : r.addEventListener(o, l, !0) : h !== void 0 ? r.addEventListener(o, l, { passive: h }) : r.addEventListener(o, l, !1);
    }
    function xp(r, o, l, c, h) {
      var g = c;
      if (!(o & 1) && !(o & 2) && c !== null)
        e:
          for (; ; ) {
            if (c === null)
              return;
            var w = c.tag;
            if (w === 3 || w === 4) {
              var b = c.stateNode.containerInfo;
              if (b === h || b.nodeType === 8 && b.parentNode === h)
                break;
              if (w === 4)
                for (w = c.return; w !== null; ) {
                  var _ = w.tag;
                  if ((_ === 3 || _ === 4) && (_ = w.stateNode.containerInfo, _ === h || _.nodeType === 8 && _.parentNode === h))
                    return;
                  w = w.return;
                }
              for (; b !== null; ) {
                if (w = no(b), w === null)
                  return;
                if (_ = w.tag, _ === 5 || _ === 6) {
                  c = g = w;
                  continue e;
                }
                b = b.parentNode;
              }
            }
            c = c.return;
          }
      Lt(function() {
        var H = g, K = Qe(l), J = [];
        e: {
          var Y = Vw.get(r);
          if (Y !== void 0) {
            var oe = ap, le = r;
            switch (r) {
              case "keypress":
                if (dc(l) === 0)
                  break e;
              case "keydown":
              case "keyup":
                oe = Mk;
                break;
              case "focusin":
                le = "focus", oe = cp;
                break;
              case "focusout":
                le = "blur", oe = cp;
                break;
              case "beforeblur":
              case "afterblur":
                oe = cp;
                break;
              case "click":
                if (l.button === 2)
                  break e;
              case "auxclick":
              case "dblclick":
              case "mousedown":
              case "mousemove":
              case "mouseup":
              case "mouseout":
              case "mouseover":
              case "contextmenu":
                oe = Sw;
                break;
              case "drag":
              case "dragend":
              case "dragenter":
              case "dragexit":
              case "dragleave":
              case "dragover":
              case "dragstart":
              case "drop":
                oe = Tk;
                break;
              case "touchcancel":
              case "touchend":
              case "touchmove":
              case "touchstart":
                oe = Bk;
                break;
              case Bw:
              case Uw:
              case $w:
                oe = Rk;
                break;
              case zw:
                oe = $k;
                break;
              case "scroll":
                oe = bk;
                break;
              case "wheel":
                oe = Vk;
                break;
              case "copy":
              case "cut":
              case "paste":
                oe = Ak;
                break;
              case "gotpointercapture":
              case "lostpointercapture":
              case "pointercancel":
              case "pointerdown":
              case "pointermove":
              case "pointerout":
              case "pointerover":
              case "pointerup":
                oe = xw;
            }
            var ue = (o & 4) !== 0, Ct = !ue && r === "scroll", D = ue ? Y !== null ? Y + "Capture" : null : Y;
            ue = [];
            for (var A = H, F; A !== null; ) {
              F = A;
              var te = F.stateNode;
              if (F.tag === 5 && te !== null && (F = te, D !== null && (te = zt(A, D), te != null && ue.push(Ia(A, te, F)))), Ct)
                break;
              A = A.return;
            }
            0 < ue.length && (Y = new oe(Y, le, null, l, K), J.push({ event: Y, listeners: ue }));
          }
        }
        if (!(o & 7)) {
          e: {
            if (Y = r === "mouseover" || r === "pointerover", oe = r === "mouseout" || r === "pointerout", Y && l !== Ie && (le = l.relatedTarget || l.fromElement) && (no(le) || le[Nr]))
              break e;
            if ((oe || Y) && (Y = K.window === K ? K : (Y = K.ownerDocument) ? Y.defaultView || Y.parentWindow : window, oe ? (le = l.relatedTarget || l.toElement, oe = H, le = le ? no(le) : null, le !== null && (Ct = pr(le), le !== Ct || le.tag !== 5 && le.tag !== 6) && (le = null)) : (oe = null, le = H), oe !== le)) {
              if (ue = Sw, te = "onMouseLeave", D = "onMouseEnter", A = "mouse", (r === "pointerout" || r === "pointerover") && (ue = xw, te = "onPointerLeave", D = "onPointerEnter", A = "pointer"), Ct = oe == null ? Y : as(oe), F = le == null ? Y : as(le), Y = new ue(te, A + "leave", oe, l, K), Y.target = Ct, Y.relatedTarget = F, te = null, no(K) === H && (ue = new ue(D, A + "enter", le, l, K), ue.target = F, ue.relatedTarget = Ct, te = ue), Ct = te, oe && le)
                t: {
                  for (ue = oe, D = le, A = 0, F = ue; F; F = os(F))
                    A++;
                  for (F = 0, te = D; te; te = os(te))
                    F++;
                  for (; 0 < A - F; )
                    ue = os(ue), A--;
                  for (; 0 < F - A; )
                    D = os(D), F--;
                  for (; A--; ) {
                    if (ue === D || D !== null && ue === D.alternate)
                      break t;
                    ue = os(ue), D = os(D);
                  }
                  ue = null;
                }
              else
                ue = null;
              oe !== null && Kw(J, Y, oe, ue, !1), le !== null && Ct !== null && Kw(J, Ct, le, ue, !0);
            }
          }
          e: {
            if (Y = H ? as(H) : window, oe = Y.nodeName && Y.nodeName.toLowerCase(), oe === "select" || oe === "input" && Y.type === "file")
              var ce = Xk;
            else if (Rw(Y))
              if (Aw)
                ce = tP;
              else {
                ce = Qk;
                var pe = Jk;
              }
            else
              (oe = Y.nodeName) && oe.toLowerCase() === "input" && (Y.type === "checkbox" || Y.type === "radio") && (ce = eP);
            if (ce && (ce = ce(r, H))) {
              Lw(J, ce, l, K);
              break e;
            }
            pe && pe(r, Y, H), r === "focusout" && (pe = Y._wrapperState) && pe.controlled && Y.type === "number" && ni(Y, "number", Y.value);
          }
          switch (pe = H ? as(H) : window, r) {
            case "focusin":
              (Rw(pe) || pe.contentEditable === "true") && (rs = pe, gp = H, Aa = null);
              break;
            case "focusout":
              Aa = gp = rs = null;
              break;
            case "mousedown":
              vp = !0;
              break;
            case "contextmenu":
            case "mouseup":
            case "dragend":
              vp = !1, Fw(J, l, K);
              break;
            case "selectionchange":
              if (iP)
                break;
            case "keydown":
            case "keyup":
              Fw(J, l, K);
          }
          var me;
          if (fp)
            e: {
              switch (r) {
                case "compositionstart":
                  var xe = "onCompositionStart";
                  break e;
                case "compositionend":
                  xe = "onCompositionEnd";
                  break e;
                case "compositionupdate":
                  xe = "onCompositionUpdate";
                  break e;
              }
              xe = void 0;
            }
          else
            ns ? Ow(r, l) && (xe = "onCompositionEnd") : r === "keydown" && l.keyCode === 229 && (xe = "onCompositionStart");
          xe && (bw && l.locale !== "ko" && (ns || xe !== "onCompositionStart" ? xe === "onCompositionEnd" && ns && (me = yw()) : (fi = K, sp = "value" in fi ? fi.value : fi.textContent, ns = !0)), pe = yc(H, xe), 0 < pe.length && (xe = new Ew(xe, r, null, l, K), J.push({ event: xe, listeners: pe }), me ? xe.data = me : (me = _w(l), me !== null && (xe.data = me)))), (me = Gk ? qk(r, l) : Yk(r, l)) && (H = yc(H, "onBeforeInput"), 0 < H.length && (K = new Ew("onBeforeInput", "beforeinput", null, l, K), J.push({ event: K, listeners: H }), K.data = me));
        }
        qw(J, o);
      });
    }
    function Ia(r, o, l) {
      return { instance: r, listener: o, currentTarget: l };
    }
    function yc(r, o) {
      for (var l = o + "Capture", c = []; r !== null; ) {
        var h = r, g = h.stateNode;
        h.tag === 5 && g !== null && (h = g, g = zt(r, l), g != null && c.unshift(Ia(r, g, h)), g = zt(r, o), g != null && c.push(Ia(r, g, h))), r = r.return;
      }
      return c;
    }
    function os(r) {
      if (r === null)
        return null;
      do
        r = r.return;
      while (r && r.tag !== 5);
      return r || null;
    }
    function Kw(r, o, l, c, h) {
      for (var g = o._reactName, w = []; l !== null && l !== c; ) {
        var b = l, _ = b.alternate, H = b.stateNode;
        if (_ !== null && _ === c)
          break;
        b.tag === 5 && H !== null && (b = H, h ? (_ = zt(l, g), _ != null && w.unshift(Ia(l, _, b))) : h || (_ = zt(l, g), _ != null && w.push(Ia(l, _, b)))), l = l.return;
      }
      w.length !== 0 && r.push({ event: o, listeners: w });
    }
    var lP = /\r\n?/g, uP = /\u0000|\uFFFD/g;
    function Zw(r) {
      return (typeof r == "string" ? r : "" + r).replace(lP, `
`).replace(uP, "");
    }
    function wc(r, o, l) {
      if (o = Zw(o), Zw(r) !== o && l)
        throw Error(n(425));
    }
    function Sc() {
    }
    var bp = null, Cp = null;
    function Tp(r, o) {
      return r === "textarea" || r === "noscript" || typeof o.children == "string" || typeof o.children == "number" || typeof o.dangerouslySetInnerHTML == "object" && o.dangerouslySetInnerHTML !== null && o.dangerouslySetInnerHTML.__html != null;
    }
    var Op = typeof setTimeout == "function" ? setTimeout : void 0, cP = typeof clearTimeout == "function" ? clearTimeout : void 0, Xw = typeof Promise == "function" ? Promise : void 0, dP = typeof queueMicrotask == "function" ? queueMicrotask : typeof Xw < "u" ? function(r) {
      return Xw.resolve(null).then(r).catch(fP);
    } : Op;
    function fP(r) {
      setTimeout(function() {
        throw r;
      });
    }
    function _p(r, o) {
      var l = o, c = 0;
      do {
        var h = l.nextSibling;
        if (r.removeChild(l), h && h.nodeType === 8)
          if (l = h.data, l === "/$") {
            if (c === 0) {
              r.removeChild(h), ba(o);
              return;
            }
            c--;
          } else
            l !== "$" && l !== "$?" && l !== "$!" || c++;
        l = h;
      } while (l);
      ba(o);
    }
    function pi(r) {
      for (; r != null; r = r.nextSibling) {
        var o = r.nodeType;
        if (o === 1 || o === 3)
          break;
        if (o === 8) {
          if (o = r.data, o === "$" || o === "$!" || o === "$?")
            break;
          if (o === "/$")
            return null;
        }
      }
      return r;
    }
    function Jw(r) {
      r = r.previousSibling;
      for (var o = 0; r; ) {
        if (r.nodeType === 8) {
          var l = r.data;
          if (l === "$" || l === "$!" || l === "$?") {
            if (o === 0)
              return r;
            o--;
          } else
            l === "/$" && o++;
        }
        r = r.previousSibling;
      }
      return null;
    }
    var ss = Math.random().toString(36).slice(2), gr = "__reactFiber$" + ss, Na = "__reactProps$" + ss, Nr = "__reactContainer$" + ss, Rp = "__reactEvents$" + ss, hP = "__reactListeners$" + ss, pP = "__reactHandles$" + ss;
    function no(r) {
      var o = r[gr];
      if (o)
        return o;
      for (var l = r.parentNode; l; ) {
        if (o = l[Nr] || l[gr]) {
          if (l = o.alternate, o.child !== null || l !== null && l.child !== null)
            for (r = Jw(r); r !== null; ) {
              if (l = r[gr])
                return l;
              r = Jw(r);
            }
          return o;
        }
        r = l, l = r.parentNode;
      }
      return null;
    }
    function Da(r) {
      return r = r[gr] || r[Nr], !r || r.tag !== 5 && r.tag !== 6 && r.tag !== 13 && r.tag !== 3 ? null : r;
    }
    function as(r) {
      if (r.tag === 5 || r.tag === 6)
        return r.stateNode;
      throw Error(n(33));
    }
    function Ec(r) {
      return r[Na] || null;
    }
    var Lp = [], ls = -1;
    function mi(r) {
      return { current: r };
    }
    function ut(r) {
      0 > ls || (r.current = Lp[ls], Lp[ls] = null, ls--);
    }
    function rt(r, o) {
      ls++, Lp[ls] = r.current, r.current = o;
    }
    var gi = {}, Xt = mi(gi), fn = mi(!1), ro = gi;
    function us(r, o) {
      var l = r.type.contextTypes;
      if (!l)
        return gi;
      var c = r.stateNode;
      if (c && c.__reactInternalMemoizedUnmaskedChildContext === o)
        return c.__reactInternalMemoizedMaskedChildContext;
      var h = {}, g;
      for (g in l)
        h[g] = o[g];
      return c && (r = r.stateNode, r.__reactInternalMemoizedUnmaskedChildContext = o, r.__reactInternalMemoizedMaskedChildContext = h), h;
    }
    function hn(r) {
      return r = r.childContextTypes, r != null;
    }
    function xc() {
      ut(fn), ut(Xt);
    }
    function Qw(r, o, l) {
      if (Xt.current !== gi)
        throw Error(n(168));
      rt(Xt, o), rt(fn, l);
    }
    function eS(r, o, l) {
      var c = r.stateNode;
      if (o = o.childContextTypes, typeof c.getChildContext != "function")
        return l;
      c = c.getChildContext();
      for (var h in c)
        if (!(h in o))
          throw Error(n(108, Pe(r) || "Unknown", h));
      return T({}, l, c);
    }
    function bc(r) {
      return r = (r = r.stateNode) && r.__reactInternalMemoizedMergedChildContext || gi, ro = Xt.current, rt(Xt, r), rt(fn, fn.current), !0;
    }
    function tS(r, o, l) {
      var c = r.stateNode;
      if (!c)
        throw Error(n(169));
      l ? (r = eS(r, o, ro), c.__reactInternalMemoizedMergedChildContext = r, ut(fn), ut(Xt), rt(Xt, r)) : ut(fn), rt(fn, l);
    }
    var Dr = null, Cc = !1, Ap = !1;
    function nS(r) {
      Dr === null ? Dr = [r] : Dr.push(r);
    }
    function mP(r) {
      Cc = !0, nS(r);
    }
    function vi() {
      if (!Ap && Dr !== null) {
        Ap = !0;
        var r = 0, o = Xe;
        try {
          var l = Dr;
          for (Xe = 1; r < l.length; r++) {
            var c = l[r];
            do
              c = c(!0);
            while (c !== null);
          }
          Dr = null, Cc = !1;
        } catch (h) {
          throw Dr !== null && (Dr = Dr.slice(r + 1)), eo(ai, vi), h;
        } finally {
          Xe = o, Ap = !1;
        }
      }
      return null;
    }
    var cs = [], ds = 0, Tc = null, Oc = 0, Pn = [], In = 0, io = null, jr = 1, Mr = "";
    function oo(r, o) {
      cs[ds++] = Oc, cs[ds++] = Tc, Tc = r, Oc = o;
    }
    function rS(r, o, l) {
      Pn[In++] = jr, Pn[In++] = Mr, Pn[In++] = io, io = r;
      var c = jr;
      r = Mr;
      var h = 32 - Zn(c) - 1;
      c &= ~(1 << h), l += 1;
      var g = 32 - Zn(o) + h;
      if (30 < g) {
        var w = h - h % 5;
        g = (c & (1 << w) - 1).toString(32), c >>= w, h -= w, jr = 1 << 32 - Zn(o) + h | l << h | c, Mr = g + r;
      } else
        jr = 1 << g | l << h | c, Mr = r;
    }
    function kp(r) {
      r.return !== null && (oo(r, 1), rS(r, 1, 0));
    }
    function Pp(r) {
      for (; r === Tc; )
        Tc = cs[--ds], cs[ds] = null, Oc = cs[--ds], cs[ds] = null;
      for (; r === io; )
        io = Pn[--In], Pn[In] = null, Mr = Pn[--In], Pn[In] = null, jr = Pn[--In], Pn[In] = null;
    }
    var En = null, xn = null, dt = !1, Jn = null;
    function iS(r, o) {
      var l = Mn(5, null, null, 0);
      l.elementType = "DELETED", l.stateNode = o, l.return = r, o = r.deletions, o === null ? (r.deletions = [l], r.flags |= 16) : o.push(l);
    }
    function oS(r, o) {
      switch (r.tag) {
        case 5:
          var l = r.type;
          return o = o.nodeType !== 1 || l.toLowerCase() !== o.nodeName.toLowerCase() ? null : o, o !== null ? (r.stateNode = o, En = r, xn = pi(o.firstChild), !0) : !1;
        case 6:
          return o = r.pendingProps === "" || o.nodeType !== 3 ? null : o, o !== null ? (r.stateNode = o, En = r, xn = null, !0) : !1;
        case 13:
          return o = o.nodeType !== 8 ? null : o, o !== null ? (l = io !== null ? { id: jr, overflow: Mr } : null, r.memoizedState = { dehydrated: o, treeContext: l, retryLane: 1073741824 }, l = Mn(18, null, null, 0), l.stateNode = o, l.return = r, r.child = l, En = r, xn = null, !0) : !1;
        default:
          return !1;
      }
    }
    function Ip(r) {
      return (r.mode & 1) !== 0 && (r.flags & 128) === 0;
    }
    function Np(r) {
      if (dt) {
        var o = xn;
        if (o) {
          var l = o;
          if (!oS(r, o)) {
            if (Ip(r))
              throw Error(n(418));
            o = pi(l.nextSibling);
            var c = En;
            o && oS(r, o) ? iS(c, l) : (r.flags = r.flags & -4097 | 2, dt = !1, En = r);
          }
        } else {
          if (Ip(r))
            throw Error(n(418));
          r.flags = r.flags & -4097 | 2, dt = !1, En = r;
        }
      }
    }
    function sS(r) {
      for (r = r.return; r !== null && r.tag !== 5 && r.tag !== 3 && r.tag !== 13; )
        r = r.return;
      En = r;
    }
    function _c(r) {
      if (r !== En)
        return !1;
      if (!dt)
        return sS(r), dt = !0, !1;
      var o;
      if ((o = r.tag !== 3) && !(o = r.tag !== 5) && (o = r.type, o = o !== "head" && o !== "body" && !Tp(r.type, r.memoizedProps)), o && (o = xn)) {
        if (Ip(r))
          throw aS(), Error(n(418));
        for (; o; )
          iS(r, o), o = pi(o.nextSibling);
      }
      if (sS(r), r.tag === 13) {
        if (r = r.memoizedState, r = r !== null ? r.dehydrated : null, !r)
          throw Error(n(317));
        e: {
          for (r = r.nextSibling, o = 0; r; ) {
            if (r.nodeType === 8) {
              var l = r.data;
              if (l === "/$") {
                if (o === 0) {
                  xn = pi(r.nextSibling);
                  break e;
                }
                o--;
              } else
                l !== "$" && l !== "$!" && l !== "$?" || o++;
            }
            r = r.nextSibling;
          }
          xn = null;
        }
      } else
        xn = En ? pi(r.stateNode.nextSibling) : null;
      return !0;
    }
    function aS() {
      for (var r = xn; r; )
        r = pi(r.nextSibling);
    }
    function fs() {
      xn = En = null, dt = !1;
    }
    function Dp(r) {
      Jn === null ? Jn = [r] : Jn.push(r);
    }
    var gP = B.ReactCurrentBatchConfig;
    function Qn(r, o) {
      if (r && r.defaultProps) {
        o = T({}, o), r = r.defaultProps;
        for (var l in r)
          o[l] === void 0 && (o[l] = r[l]);
        return o;
      }
      return o;
    }
    var Rc = mi(null), Lc = null, hs = null, jp = null;
    function Mp() {
      jp = hs = Lc = null;
    }
    function Fp(r) {
      var o = Rc.current;
      ut(Rc), r._currentValue = o;
    }
    function Hp(r, o, l) {
      for (; r !== null; ) {
        var c = r.alternate;
        if ((r.childLanes & o) !== o ? (r.childLanes |= o, c !== null && (c.childLanes |= o)) : c !== null && (c.childLanes & o) !== o && (c.childLanes |= o), r === l)
          break;
        r = r.return;
      }
    }
    function ps(r, o) {
      Lc = r, jp = hs = null, r = r.dependencies, r !== null && r.firstContext !== null && (r.lanes & o && (pn = !0), r.firstContext = null);
    }
    function Nn(r) {
      var o = r._currentValue;
      if (jp !== r)
        if (r = { context: r, memoizedValue: o, next: null }, hs === null) {
          if (Lc === null)
            throw Error(n(308));
          hs = r, Lc.dependencies = { lanes: 0, firstContext: r };
        } else
          hs = hs.next = r;
      return o;
    }
    var so = null;
    function Bp(r) {
      so === null ? so = [r] : so.push(r);
    }
    function lS(r, o, l, c) {
      var h = o.interleaved;
      return h === null ? (l.next = l, Bp(o)) : (l.next = h.next, h.next = l), o.interleaved = l, Fr(r, c);
    }
    function Fr(r, o) {
      r.lanes |= o;
      var l = r.alternate;
      for (l !== null && (l.lanes |= o), l = r, r = r.return; r !== null; )
        r.childLanes |= o, l = r.alternate, l !== null && (l.childLanes |= o), l = r, r = r.return;
      return l.tag === 3 ? l.stateNode : null;
    }
    var yi = !1;
    function Up(r) {
      r.updateQueue = { baseState: r.memoizedState, firstBaseUpdate: null, lastBaseUpdate: null, shared: { pending: null, interleaved: null, lanes: 0 }, effects: null };
    }
    function uS(r, o) {
      r = r.updateQueue, o.updateQueue === r && (o.updateQueue = { baseState: r.baseState, firstBaseUpdate: r.firstBaseUpdate, lastBaseUpdate: r.lastBaseUpdate, shared: r.shared, effects: r.effects });
    }
    function Hr(r, o) {
      return { eventTime: r, lane: o, tag: 0, payload: null, callback: null, next: null };
    }
    function wi(r, o, l) {
      var c = r.updateQueue;
      if (c === null)
        return null;
      if (c = c.shared, ze & 2) {
        var h = c.pending;
        return h === null ? o.next = o : (o.next = h.next, h.next = o), c.pending = o, Fr(r, l);
      }
      return h = c.interleaved, h === null ? (o.next = o, Bp(c)) : (o.next = h.next, h.next = o), c.interleaved = o, Fr(r, l);
    }
    function Ac(r, o, l) {
      if (o = o.updateQueue, o !== null && (o = o.shared, (l & 4194240) !== 0)) {
        var c = o.lanes;
        c &= r.pendingLanes, l |= c, o.lanes = l, tp(r, l);
      }
    }
    function cS(r, o) {
      var l = r.updateQueue, c = r.alternate;
      if (c !== null && (c = c.updateQueue, l === c)) {
        var h = null, g = null;
        if (l = l.firstBaseUpdate, l !== null) {
          do {
            var w = { eventTime: l.eventTime, lane: l.lane, tag: l.tag, payload: l.payload, callback: l.callback, next: null };
            g === null ? h = g = w : g = g.next = w, l = l.next;
          } while (l !== null);
          g === null ? h = g = o : g = g.next = o;
        } else
          h = g = o;
        l = { baseState: c.baseState, firstBaseUpdate: h, lastBaseUpdate: g, shared: c.shared, effects: c.effects }, r.updateQueue = l;
        return;
      }
      r = l.lastBaseUpdate, r === null ? l.firstBaseUpdate = o : r.next = o, l.lastBaseUpdate = o;
    }
    function kc(r, o, l, c) {
      var h = r.updateQueue;
      yi = !1;
      var g = h.firstBaseUpdate, w = h.lastBaseUpdate, b = h.shared.pending;
      if (b !== null) {
        h.shared.pending = null;
        var _ = b, H = _.next;
        _.next = null, w === null ? g = H : w.next = H, w = _;
        var K = r.alternate;
        K !== null && (K = K.updateQueue, b = K.lastBaseUpdate, b !== w && (b === null ? K.firstBaseUpdate = H : b.next = H, K.lastBaseUpdate = _));
      }
      if (g !== null) {
        var J = h.baseState;
        w = 0, K = H = _ = null, b = g;
        do {
          var Y = b.lane, oe = b.eventTime;
          if ((c & Y) === Y) {
            K !== null && (K = K.next = {
              eventTime: oe,
              lane: 0,
              tag: b.tag,
              payload: b.payload,
              callback: b.callback,
              next: null
            });
            e: {
              var le = r, ue = b;
              switch (Y = o, oe = l, ue.tag) {
                case 1:
                  if (le = ue.payload, typeof le == "function") {
                    J = le.call(oe, J, Y);
                    break e;
                  }
                  J = le;
                  break e;
                case 3:
                  le.flags = le.flags & -65537 | 128;
                case 0:
                  if (le = ue.payload, Y = typeof le == "function" ? le.call(oe, J, Y) : le, Y == null)
                    break e;
                  J = T({}, J, Y);
                  break e;
                case 2:
                  yi = !0;
              }
            }
            b.callback !== null && b.lane !== 0 && (r.flags |= 64, Y = h.effects, Y === null ? h.effects = [b] : Y.push(b));
          } else
            oe = { eventTime: oe, lane: Y, tag: b.tag, payload: b.payload, callback: b.callback, next: null }, K === null ? (H = K = oe, _ = J) : K = K.next = oe, w |= Y;
          if (b = b.next, b === null) {
            if (b = h.shared.pending, b === null)
              break;
            Y = b, b = Y.next, Y.next = null, h.lastBaseUpdate = Y, h.shared.pending = null;
          }
        } while (!0);
        if (K === null && (_ = J), h.baseState = _, h.firstBaseUpdate = H, h.lastBaseUpdate = K, o = h.shared.interleaved, o !== null) {
          h = o;
          do
            w |= h.lane, h = h.next;
          while (h !== o);
        } else
          g === null && (h.shared.lanes = 0);
        uo |= w, r.lanes = w, r.memoizedState = J;
      }
    }
    function dS(r, o, l) {
      if (r = o.effects, o.effects = null, r !== null)
        for (o = 0; o < r.length; o++) {
          var c = r[o], h = c.callback;
          if (h !== null) {
            if (c.callback = null, c = l, typeof h != "function")
              throw Error(n(191, h));
            h.call(c);
          }
        }
    }
    var fS = new t.Component().refs;
    function $p(r, o, l, c) {
      o = r.memoizedState, l = l(c, o), l = l == null ? o : T({}, o, l), r.memoizedState = l, r.lanes === 0 && (r.updateQueue.baseState = l);
    }
    var Pc = { isMounted: function(r) {
      return (r = r._reactInternals) ? pr(r) === r : !1;
    }, enqueueSetState: function(r, o, l) {
      r = r._reactInternals;
      var c = cn(), h = bi(r), g = Hr(c, h);
      g.payload = o, l != null && (g.callback = l), o = wi(r, g, h), o !== null && (nr(o, r, h, c), Ac(o, r, h));
    }, enqueueReplaceState: function(r, o, l) {
      r = r._reactInternals;
      var c = cn(), h = bi(r), g = Hr(c, h);
      g.tag = 1, g.payload = o, l != null && (g.callback = l), o = wi(r, g, h), o !== null && (nr(o, r, h, c), Ac(o, r, h));
    }, enqueueForceUpdate: function(r, o) {
      r = r._reactInternals;
      var l = cn(), c = bi(r), h = Hr(l, c);
      h.tag = 2, o != null && (h.callback = o), o = wi(r, h, c), o !== null && (nr(o, r, c, l), Ac(o, r, c));
    } };
    function hS(r, o, l, c, h, g, w) {
      return r = r.stateNode, typeof r.shouldComponentUpdate == "function" ? r.shouldComponentUpdate(c, g, w) : o.prototype && o.prototype.isPureReactComponent ? !La(l, c) || !La(h, g) : !0;
    }
    function pS(r, o, l) {
      var c = !1, h = gi, g = o.contextType;
      return typeof g == "object" && g !== null ? g = Nn(g) : (h = hn(o) ? ro : Xt.current, c = o.contextTypes, g = (c = c != null) ? us(r, h) : gi), o = new o(l, g), r.memoizedState = o.state !== null && o.state !== void 0 ? o.state : null, o.updater = Pc, r.stateNode = o, o._reactInternals = r, c && (r = r.stateNode, r.__reactInternalMemoizedUnmaskedChildContext = h, r.__reactInternalMemoizedMaskedChildContext = g), o;
    }
    function mS(r, o, l, c) {
      r = o.state, typeof o.componentWillReceiveProps == "function" && o.componentWillReceiveProps(l, c), typeof o.UNSAFE_componentWillReceiveProps == "function" && o.UNSAFE_componentWillReceiveProps(l, c), o.state !== r && Pc.enqueueReplaceState(o, o.state, null);
    }
    function zp(r, o, l, c) {
      var h = r.stateNode;
      h.props = l, h.state = r.memoizedState, h.refs = fS, Up(r);
      var g = o.contextType;
      typeof g == "object" && g !== null ? h.context = Nn(g) : (g = hn(o) ? ro : Xt.current, h.context = us(r, g)), h.state = r.memoizedState, g = o.getDerivedStateFromProps, typeof g == "function" && ($p(r, o, g, l), h.state = r.memoizedState), typeof o.getDerivedStateFromProps == "function" || typeof h.getSnapshotBeforeUpdate == "function" || typeof h.UNSAFE_componentWillMount != "function" && typeof h.componentWillMount != "function" || (o = h.state, typeof h.componentWillMount == "function" && h.componentWillMount(), typeof h.UNSAFE_componentWillMount == "function" && h.UNSAFE_componentWillMount(), o !== h.state && Pc.enqueueReplaceState(h, h.state, null), kc(r, l, h, c), h.state = r.memoizedState), typeof h.componentDidMount == "function" && (r.flags |= 4194308);
    }
    function ja(r, o, l) {
      if (r = l.ref, r !== null && typeof r != "function" && typeof r != "object") {
        if (l._owner) {
          if (l = l._owner, l) {
            if (l.tag !== 1)
              throw Error(n(309));
            var c = l.stateNode;
          }
          if (!c)
            throw Error(n(147, r));
          var h = c, g = "" + r;
          return o !== null && o.ref !== null && typeof o.ref == "function" && o.ref._stringRef === g ? o.ref : (o = function(w) {
            var b = h.refs;
            b === fS && (b = h.refs = {}), w === null ? delete b[g] : b[g] = w;
          }, o._stringRef = g, o);
        }
        if (typeof r != "string")
          throw Error(n(284));
        if (!l._owner)
          throw Error(n(290, r));
      }
      return r;
    }
    function Ic(r, o) {
      throw r = Object.prototype.toString.call(o), Error(n(31, r === "[object Object]" ? "object with keys {" + Object.keys(o).join(", ") + "}" : r));
    }
    function gS(r) {
      var o = r._init;
      return o(r._payload);
    }
    function vS(r) {
      function o(D, A) {
        if (r) {
          var F = D.deletions;
          F === null ? (D.deletions = [A], D.flags |= 16) : F.push(A);
        }
      }
      function l(D, A) {
        if (!r)
          return null;
        for (; A !== null; )
          o(D, A), A = A.sibling;
        return null;
      }
      function c(D, A) {
        for (D = /* @__PURE__ */ new Map(); A !== null; )
          A.key !== null ? D.set(A.key, A) : D.set(A.index, A), A = A.sibling;
        return D;
      }
      function h(D, A) {
        return D = Ti(D, A), D.index = 0, D.sibling = null, D;
      }
      function g(D, A, F) {
        return D.index = F, r ? (F = D.alternate, F !== null ? (F = F.index, F < A ? (D.flags |= 2, A) : F) : (D.flags |= 2, A)) : (D.flags |= 1048576, A);
      }
      function w(D) {
        return r && D.alternate === null && (D.flags |= 2), D;
      }
      function b(D, A, F, te) {
        return A === null || A.tag !== 6 ? (A = Om(F, D.mode, te), A.return = D, A) : (A = h(A, F), A.return = D, A);
      }
      function _(D, A, F, te) {
        var ce = F.type;
        return ce === R ? K(D, A, F.props.children, te, F.key) : A !== null && (A.elementType === ce || typeof ce == "object" && ce !== null && ce.$$typeof === Be && gS(ce) === A.type) ? (te = h(A, F.props), te.ref = ja(D, A, F), te.return = D, te) : (te = Jc(F.type, F.key, F.props, null, D.mode, te), te.ref = ja(D, A, F), te.return = D, te);
      }
      function H(D, A, F, te) {
        return A === null || A.tag !== 4 || A.stateNode.containerInfo !== F.containerInfo || A.stateNode.implementation !== F.implementation ? (A = _m(F, D.mode, te), A.return = D, A) : (A = h(A, F.children || []), A.return = D, A);
      }
      function K(D, A, F, te, ce) {
        return A === null || A.tag !== 7 ? (A = po(F, D.mode, te, ce), A.return = D, A) : (A = h(A, F), A.return = D, A);
      }
      function J(D, A, F) {
        if (typeof A == "string" && A !== "" || typeof A == "number")
          return A = Om("" + A, D.mode, F), A.return = D, A;
        if (typeof A == "object" && A !== null) {
          switch (A.$$typeof) {
            case V:
              return F = Jc(A.type, A.key, A.props, null, D.mode, F), F.ref = ja(D, null, A), F.return = D, F;
            case P:
              return A = _m(A, D.mode, F), A.return = D, A;
            case Be:
              var te = A._init;
              return J(D, te(A._payload), F);
          }
          if (Kn(A) || Q(A))
            return A = po(A, D.mode, F, null), A.return = D, A;
          Ic(D, A);
        }
        return null;
      }
      function Y(D, A, F, te) {
        var ce = A !== null ? A.key : null;
        if (typeof F == "string" && F !== "" || typeof F == "number")
          return ce !== null ? null : b(D, A, "" + F, te);
        if (typeof F == "object" && F !== null) {
          switch (F.$$typeof) {
            case V:
              return F.key === ce ? _(D, A, F, te) : null;
            case P:
              return F.key === ce ? H(D, A, F, te) : null;
            case Be:
              return ce = F._init, Y(
                D,
                A,
                ce(F._payload),
                te
              );
          }
          if (Kn(F) || Q(F))
            return ce !== null ? null : K(D, A, F, te, null);
          Ic(D, F);
        }
        return null;
      }
      function oe(D, A, F, te, ce) {
        if (typeof te == "string" && te !== "" || typeof te == "number")
          return D = D.get(F) || null, b(A, D, "" + te, ce);
        if (typeof te == "object" && te !== null) {
          switch (te.$$typeof) {
            case V:
              return D = D.get(te.key === null ? F : te.key) || null, _(A, D, te, ce);
            case P:
              return D = D.get(te.key === null ? F : te.key) || null, H(A, D, te, ce);
            case Be:
              var pe = te._init;
              return oe(D, A, F, pe(te._payload), ce);
          }
          if (Kn(te) || Q(te))
            return D = D.get(F) || null, K(A, D, te, ce, null);
          Ic(A, te);
        }
        return null;
      }
      function le(D, A, F, te) {
        for (var ce = null, pe = null, me = A, xe = A = 0, Ut = null; me !== null && xe < F.length; xe++) {
          me.index > xe ? (Ut = me, me = null) : Ut = me.sibling;
          var Ge = Y(D, me, F[xe], te);
          if (Ge === null) {
            me === null && (me = Ut);
            break;
          }
          r && me && Ge.alternate === null && o(D, me), A = g(Ge, A, xe), pe === null ? ce = Ge : pe.sibling = Ge, pe = Ge, me = Ut;
        }
        if (xe === F.length)
          return l(D, me), dt && oo(D, xe), ce;
        if (me === null) {
          for (; xe < F.length; xe++)
            me = J(D, F[xe], te), me !== null && (A = g(me, A, xe), pe === null ? ce = me : pe.sibling = me, pe = me);
          return dt && oo(D, xe), ce;
        }
        for (me = c(D, me); xe < F.length; xe++)
          Ut = oe(me, D, xe, F[xe], te), Ut !== null && (r && Ut.alternate !== null && me.delete(Ut.key === null ? xe : Ut.key), A = g(Ut, A, xe), pe === null ? ce = Ut : pe.sibling = Ut, pe = Ut);
        return r && me.forEach(function(Oi) {
          return o(D, Oi);
        }), dt && oo(D, xe), ce;
      }
      function ue(D, A, F, te) {
        var ce = Q(F);
        if (typeof ce != "function")
          throw Error(n(150));
        if (F = ce.call(F), F == null)
          throw Error(n(151));
        for (var pe = ce = null, me = A, xe = A = 0, Ut = null, Ge = F.next(); me !== null && !Ge.done; xe++, Ge = F.next()) {
          me.index > xe ? (Ut = me, me = null) : Ut = me.sibling;
          var Oi = Y(D, me, Ge.value, te);
          if (Oi === null) {
            me === null && (me = Ut);
            break;
          }
          r && me && Oi.alternate === null && o(D, me), A = g(Oi, A, xe), pe === null ? ce = Oi : pe.sibling = Oi, pe = Oi, me = Ut;
        }
        if (Ge.done)
          return l(
            D,
            me
          ), dt && oo(D, xe), ce;
        if (me === null) {
          for (; !Ge.done; xe++, Ge = F.next())
            Ge = J(D, Ge.value, te), Ge !== null && (A = g(Ge, A, xe), pe === null ? ce = Ge : pe.sibling = Ge, pe = Ge);
          return dt && oo(D, xe), ce;
        }
        for (me = c(D, me); !Ge.done; xe++, Ge = F.next())
          Ge = oe(me, D, xe, Ge.value, te), Ge !== null && (r && Ge.alternate !== null && me.delete(Ge.key === null ? xe : Ge.key), A = g(Ge, A, xe), pe === null ? ce = Ge : pe.sibling = Ge, pe = Ge);
        return r && me.forEach(function(KP) {
          return o(D, KP);
        }), dt && oo(D, xe), ce;
      }
      function Ct(D, A, F, te) {
        if (typeof F == "object" && F !== null && F.type === R && F.key === null && (F = F.props.children), typeof F == "object" && F !== null) {
          switch (F.$$typeof) {
            case V:
              e: {
                for (var ce = F.key, pe = A; pe !== null; ) {
                  if (pe.key === ce) {
                    if (ce = F.type, ce === R) {
                      if (pe.tag === 7) {
                        l(D, pe.sibling), A = h(pe, F.props.children), A.return = D, D = A;
                        break e;
                      }
                    } else if (pe.elementType === ce || typeof ce == "object" && ce !== null && ce.$$typeof === Be && gS(ce) === pe.type) {
                      l(D, pe.sibling), A = h(pe, F.props), A.ref = ja(D, pe, F), A.return = D, D = A;
                      break e;
                    }
                    l(D, pe);
                    break;
                  } else
                    o(D, pe);
                  pe = pe.sibling;
                }
                F.type === R ? (A = po(F.props.children, D.mode, te, F.key), A.return = D, D = A) : (te = Jc(F.type, F.key, F.props, null, D.mode, te), te.ref = ja(D, A, F), te.return = D, D = te);
              }
              return w(D);
            case P:
              e: {
                for (pe = F.key; A !== null; ) {
                  if (A.key === pe)
                    if (A.tag === 4 && A.stateNode.containerInfo === F.containerInfo && A.stateNode.implementation === F.implementation) {
                      l(D, A.sibling), A = h(A, F.children || []), A.return = D, D = A;
                      break e;
                    } else {
                      l(D, A);
                      break;
                    }
                  else
                    o(D, A);
                  A = A.sibling;
                }
                A = _m(F, D.mode, te), A.return = D, D = A;
              }
              return w(D);
            case Be:
              return pe = F._init, Ct(D, A, pe(F._payload), te);
          }
          if (Kn(F))
            return le(D, A, F, te);
          if (Q(F))
            return ue(D, A, F, te);
          Ic(D, F);
        }
        return typeof F == "string" && F !== "" || typeof F == "number" ? (F = "" + F, A !== null && A.tag === 6 ? (l(D, A.sibling), A = h(A, F), A.return = D, D = A) : (l(D, A), A = Om(F, D.mode, te), A.return = D, D = A), w(D)) : l(D, A);
      }
      return Ct;
    }
    var ms = vS(!0), yS = vS(!1), Ma = {}, vr = mi(Ma), Fa = mi(Ma), Ha = mi(Ma);
    function ao(r) {
      if (r === Ma)
        throw Error(n(174));
      return r;
    }
    function Vp(r, o) {
      switch (rt(Ha, o), rt(Fa, r), rt(vr, Ma), r = o.nodeType, r) {
        case 9:
        case 11:
          o = (o = o.documentElement) ? o.namespaceURI : ri(null, "");
          break;
        default:
          r = r === 8 ? o.parentNode : o, o = r.namespaceURI || null, r = r.tagName, o = ri(o, r);
      }
      ut(vr), rt(vr, o);
    }
    function gs() {
      ut(vr), ut(Fa), ut(Ha);
    }
    function wS(r) {
      ao(Ha.current);
      var o = ao(vr.current), l = ri(o, r.type);
      o !== l && (rt(Fa, r), rt(vr, l));
    }
    function Wp(r) {
      Fa.current === r && (ut(vr), ut(Fa));
    }
    var pt = mi(0);
    function Nc(r) {
      for (var o = r; o !== null; ) {
        if (o.tag === 13) {
          var l = o.memoizedState;
          if (l !== null && (l = l.dehydrated, l === null || l.data === "$?" || l.data === "$!"))
            return o;
        } else if (o.tag === 19 && o.memoizedProps.revealOrder !== void 0) {
          if (o.flags & 128)
            return o;
        } else if (o.child !== null) {
          o.child.return = o, o = o.child;
          continue;
        }
        if (o === r)
          break;
        for (; o.sibling === null; ) {
          if (o.return === null || o.return === r)
            return null;
          o = o.return;
        }
        o.sibling.return = o.return, o = o.sibling;
      }
      return null;
    }
    var Gp = [];
    function qp() {
      for (var r = 0; r < Gp.length; r++)
        Gp[r]._workInProgressVersionPrimary = null;
      Gp.length = 0;
    }
    var Dc = B.ReactCurrentDispatcher, Yp = B.ReactCurrentBatchConfig, lo = 0, mt = null, It = null, Ht = null, jc = !1, Ba = !1, Ua = 0, vP = 0;
    function Jt() {
      throw Error(n(321));
    }
    function Kp(r, o) {
      if (o === null)
        return !1;
      for (var l = 0; l < o.length && l < r.length; l++)
        if (!Xn(r[l], o[l]))
          return !1;
      return !0;
    }
    function Zp(r, o, l, c, h, g) {
      if (lo = g, mt = o, o.memoizedState = null, o.updateQueue = null, o.lanes = 0, Dc.current = r === null || r.memoizedState === null ? EP : xP, r = l(c, h), Ba) {
        g = 0;
        do {
          if (Ba = !1, Ua = 0, 25 <= g)
            throw Error(n(301));
          g += 1, Ht = It = null, o.updateQueue = null, Dc.current = bP, r = l(c, h);
        } while (Ba);
      }
      if (Dc.current = Hc, o = It !== null && It.next !== null, lo = 0, Ht = It = mt = null, jc = !1, o)
        throw Error(n(300));
      return r;
    }
    function Xp() {
      var r = Ua !== 0;
      return Ua = 0, r;
    }
    function yr() {
      var r = { memoizedState: null, baseState: null, baseQueue: null, queue: null, next: null };
      return Ht === null ? mt.memoizedState = Ht = r : Ht = Ht.next = r, Ht;
    }
    function Dn() {
      if (It === null) {
        var r = mt.alternate;
        r = r !== null ? r.memoizedState : null;
      } else
        r = It.next;
      var o = Ht === null ? mt.memoizedState : Ht.next;
      if (o !== null)
        Ht = o, It = r;
      else {
        if (r === null)
          throw Error(n(310));
        It = r, r = { memoizedState: It.memoizedState, baseState: It.baseState, baseQueue: It.baseQueue, queue: It.queue, next: null }, Ht === null ? mt.memoizedState = Ht = r : Ht = Ht.next = r;
      }
      return Ht;
    }
    function $a(r, o) {
      return typeof o == "function" ? o(r) : o;
    }
    function Jp(r) {
      var o = Dn(), l = o.queue;
      if (l === null)
        throw Error(n(311));
      l.lastRenderedReducer = r;
      var c = It, h = c.baseQueue, g = l.pending;
      if (g !== null) {
        if (h !== null) {
          var w = h.next;
          h.next = g.next, g.next = w;
        }
        c.baseQueue = h = g, l.pending = null;
      }
      if (h !== null) {
        g = h.next, c = c.baseState;
        var b = w = null, _ = null, H = g;
        do {
          var K = H.lane;
          if ((lo & K) === K)
            _ !== null && (_ = _.next = { lane: 0, action: H.action, hasEagerState: H.hasEagerState, eagerState: H.eagerState, next: null }), c = H.hasEagerState ? H.eagerState : r(c, H.action);
          else {
            var J = {
              lane: K,
              action: H.action,
              hasEagerState: H.hasEagerState,
              eagerState: H.eagerState,
              next: null
            };
            _ === null ? (b = _ = J, w = c) : _ = _.next = J, mt.lanes |= K, uo |= K;
          }
          H = H.next;
        } while (H !== null && H !== g);
        _ === null ? w = c : _.next = b, Xn(c, o.memoizedState) || (pn = !0), o.memoizedState = c, o.baseState = w, o.baseQueue = _, l.lastRenderedState = c;
      }
      if (r = l.interleaved, r !== null) {
        h = r;
        do
          g = h.lane, mt.lanes |= g, uo |= g, h = h.next;
        while (h !== r);
      } else
        h === null && (l.lanes = 0);
      return [o.memoizedState, l.dispatch];
    }
    function Qp(r) {
      var o = Dn(), l = o.queue;
      if (l === null)
        throw Error(n(311));
      l.lastRenderedReducer = r;
      var c = l.dispatch, h = l.pending, g = o.memoizedState;
      if (h !== null) {
        l.pending = null;
        var w = h = h.next;
        do
          g = r(g, w.action), w = w.next;
        while (w !== h);
        Xn(g, o.memoizedState) || (pn = !0), o.memoizedState = g, o.baseQueue === null && (o.baseState = g), l.lastRenderedState = g;
      }
      return [g, c];
    }
    function SS() {
    }
    function ES(r, o) {
      var l = mt, c = Dn(), h = o(), g = !Xn(c.memoizedState, h);
      if (g && (c.memoizedState = h, pn = !0), c = c.queue, em(CS.bind(null, l, c, r), [r]), c.getSnapshot !== o || g || Ht !== null && Ht.memoizedState.tag & 1) {
        if (l.flags |= 2048, za(9, bS.bind(null, l, c, h, o), void 0, null), Bt === null)
          throw Error(n(349));
        lo & 30 || xS(l, o, h);
      }
      return h;
    }
    function xS(r, o, l) {
      r.flags |= 16384, r = { getSnapshot: o, value: l }, o = mt.updateQueue, o === null ? (o = { lastEffect: null, stores: null }, mt.updateQueue = o, o.stores = [r]) : (l = o.stores, l === null ? o.stores = [r] : l.push(r));
    }
    function bS(r, o, l, c) {
      o.value = l, o.getSnapshot = c, TS(o) && OS(r);
    }
    function CS(r, o, l) {
      return l(function() {
        TS(o) && OS(r);
      });
    }
    function TS(r) {
      var o = r.getSnapshot;
      r = r.value;
      try {
        var l = o();
        return !Xn(r, l);
      } catch {
        return !0;
      }
    }
    function OS(r) {
      var o = Fr(r, 1);
      o !== null && nr(o, r, 1, -1);
    }
    function _S(r) {
      var o = yr();
      return typeof r == "function" && (r = r()), o.memoizedState = o.baseState = r, r = { pending: null, interleaved: null, lanes: 0, dispatch: null, lastRenderedReducer: $a, lastRenderedState: r }, o.queue = r, r = r.dispatch = SP.bind(null, mt, r), [o.memoizedState, r];
    }
    function za(r, o, l, c) {
      return r = { tag: r, create: o, destroy: l, deps: c, next: null }, o = mt.updateQueue, o === null ? (o = { lastEffect: null, stores: null }, mt.updateQueue = o, o.lastEffect = r.next = r) : (l = o.lastEffect, l === null ? o.lastEffect = r.next = r : (c = l.next, l.next = r, r.next = c, o.lastEffect = r)), r;
    }
    function RS() {
      return Dn().memoizedState;
    }
    function Mc(r, o, l, c) {
      var h = yr();
      mt.flags |= r, h.memoizedState = za(1 | o, l, void 0, c === void 0 ? null : c);
    }
    function Fc(r, o, l, c) {
      var h = Dn();
      c = c === void 0 ? null : c;
      var g = void 0;
      if (It !== null) {
        var w = It.memoizedState;
        if (g = w.destroy, c !== null && Kp(c, w.deps)) {
          h.memoizedState = za(o, l, g, c);
          return;
        }
      }
      mt.flags |= r, h.memoizedState = za(1 | o, l, g, c);
    }
    function LS(r, o) {
      return Mc(8390656, 8, r, o);
    }
    function em(r, o) {
      return Fc(2048, 8, r, o);
    }
    function AS(r, o) {
      return Fc(4, 2, r, o);
    }
    function kS(r, o) {
      return Fc(4, 4, r, o);
    }
    function PS(r, o) {
      if (typeof o == "function")
        return r = r(), o(r), function() {
          o(null);
        };
      if (o != null)
        return r = r(), o.current = r, function() {
          o.current = null;
        };
    }
    function IS(r, o, l) {
      return l = l != null ? l.concat([r]) : null, Fc(4, 4, PS.bind(null, o, r), l);
    }
    function tm() {
    }
    function NS(r, o) {
      var l = Dn();
      o = o === void 0 ? null : o;
      var c = l.memoizedState;
      return c !== null && o !== null && Kp(o, c[1]) ? c[0] : (l.memoizedState = [r, o], r);
    }
    function DS(r, o) {
      var l = Dn();
      o = o === void 0 ? null : o;
      var c = l.memoizedState;
      return c !== null && o !== null && Kp(o, c[1]) ? c[0] : (r = r(), l.memoizedState = [r, o], r);
    }
    function jS(r, o, l) {
      return lo & 21 ? (Xn(l, o) || (l = lw(), mt.lanes |= l, uo |= l, r.baseState = !0), o) : (r.baseState && (r.baseState = !1, pn = !0), r.memoizedState = l);
    }
    function yP(r, o) {
      var l = Xe;
      Xe = l !== 0 && 4 > l ? l : 4, r(!0);
      var c = Yp.transition;
      Yp.transition = {};
      try {
        r(!1), o();
      } finally {
        Xe = l, Yp.transition = c;
      }
    }
    function MS() {
      return Dn().memoizedState;
    }
    function wP(r, o, l) {
      var c = bi(r);
      if (l = { lane: c, action: l, hasEagerState: !1, eagerState: null, next: null }, FS(r))
        HS(o, l);
      else if (l = lS(r, o, l, c), l !== null) {
        var h = cn();
        nr(l, r, c, h), BS(l, o, c);
      }
    }
    function SP(r, o, l) {
      var c = bi(r), h = { lane: c, action: l, hasEagerState: !1, eagerState: null, next: null };
      if (FS(r))
        HS(o, h);
      else {
        var g = r.alternate;
        if (r.lanes === 0 && (g === null || g.lanes === 0) && (g = o.lastRenderedReducer, g !== null))
          try {
            var w = o.lastRenderedState, b = g(w, l);
            if (h.hasEagerState = !0, h.eagerState = b, Xn(b, w)) {
              var _ = o.interleaved;
              _ === null ? (h.next = h, Bp(o)) : (h.next = _.next, _.next = h), o.interleaved = h;
              return;
            }
          } catch {
          } finally {
          }
        l = lS(r, o, h, c), l !== null && (h = cn(), nr(l, r, c, h), BS(l, o, c));
      }
    }
    function FS(r) {
      var o = r.alternate;
      return r === mt || o !== null && o === mt;
    }
    function HS(r, o) {
      Ba = jc = !0;
      var l = r.pending;
      l === null ? o.next = o : (o.next = l.next, l.next = o), r.pending = o;
    }
    function BS(r, o, l) {
      if (l & 4194240) {
        var c = o.lanes;
        c &= r.pendingLanes, l |= c, o.lanes = l, tp(r, l);
      }
    }
    var Hc = { readContext: Nn, useCallback: Jt, useContext: Jt, useEffect: Jt, useImperativeHandle: Jt, useInsertionEffect: Jt, useLayoutEffect: Jt, useMemo: Jt, useReducer: Jt, useRef: Jt, useState: Jt, useDebugValue: Jt, useDeferredValue: Jt, useTransition: Jt, useMutableSource: Jt, useSyncExternalStore: Jt, useId: Jt, unstable_isNewReconciler: !1 }, EP = { readContext: Nn, useCallback: function(r, o) {
      return yr().memoizedState = [r, o === void 0 ? null : o], r;
    }, useContext: Nn, useEffect: LS, useImperativeHandle: function(r, o, l) {
      return l = l != null ? l.concat([r]) : null, Mc(
        4194308,
        4,
        PS.bind(null, o, r),
        l
      );
    }, useLayoutEffect: function(r, o) {
      return Mc(4194308, 4, r, o);
    }, useInsertionEffect: function(r, o) {
      return Mc(4, 2, r, o);
    }, useMemo: function(r, o) {
      var l = yr();
      return o = o === void 0 ? null : o, r = r(), l.memoizedState = [r, o], r;
    }, useReducer: function(r, o, l) {
      var c = yr();
      return o = l !== void 0 ? l(o) : o, c.memoizedState = c.baseState = o, r = { pending: null, interleaved: null, lanes: 0, dispatch: null, lastRenderedReducer: r, lastRenderedState: o }, c.queue = r, r = r.dispatch = wP.bind(null, mt, r), [c.memoizedState, r];
    }, useRef: function(r) {
      var o = yr();
      return r = { current: r }, o.memoizedState = r;
    }, useState: _S, useDebugValue: tm, useDeferredValue: function(r) {
      return yr().memoizedState = r;
    }, useTransition: function() {
      var r = _S(!1), o = r[0];
      return r = yP.bind(null, r[1]), yr().memoizedState = r, [o, r];
    }, useMutableSource: function() {
    }, useSyncExternalStore: function(r, o, l) {
      var c = mt, h = yr();
      if (dt) {
        if (l === void 0)
          throw Error(n(407));
        l = l();
      } else {
        if (l = o(), Bt === null)
          throw Error(n(349));
        lo & 30 || xS(c, o, l);
      }
      h.memoizedState = l;
      var g = { value: l, getSnapshot: o };
      return h.queue = g, LS(CS.bind(
        null,
        c,
        g,
        r
      ), [r]), c.flags |= 2048, za(9, bS.bind(null, c, g, l, o), void 0, null), l;
    }, useId: function() {
      var r = yr(), o = Bt.identifierPrefix;
      if (dt) {
        var l = Mr, c = jr;
        l = (c & ~(1 << 32 - Zn(c) - 1)).toString(32) + l, o = ":" + o + "R" + l, l = Ua++, 0 < l && (o += "H" + l.toString(32)), o += ":";
      } else
        l = vP++, o = ":" + o + "r" + l.toString(32) + ":";
      return r.memoizedState = o;
    }, unstable_isNewReconciler: !1 }, xP = {
      readContext: Nn,
      useCallback: NS,
      useContext: Nn,
      useEffect: em,
      useImperativeHandle: IS,
      useInsertionEffect: AS,
      useLayoutEffect: kS,
      useMemo: DS,
      useReducer: Jp,
      useRef: RS,
      useState: function() {
        return Jp($a);
      },
      useDebugValue: tm,
      useDeferredValue: function(r) {
        var o = Dn();
        return jS(o, It.memoizedState, r);
      },
      useTransition: function() {
        var r = Jp($a)[0], o = Dn().memoizedState;
        return [r, o];
      },
      useMutableSource: SS,
      useSyncExternalStore: ES,
      useId: MS,
      unstable_isNewReconciler: !1
    }, bP = { readContext: Nn, useCallback: NS, useContext: Nn, useEffect: em, useImperativeHandle: IS, useInsertionEffect: AS, useLayoutEffect: kS, useMemo: DS, useReducer: Qp, useRef: RS, useState: function() {
      return Qp($a);
    }, useDebugValue: tm, useDeferredValue: function(r) {
      var o = Dn();
      return It === null ? o.memoizedState = r : jS(o, It.memoizedState, r);
    }, useTransition: function() {
      var r = Qp($a)[0], o = Dn().memoizedState;
      return [r, o];
    }, useMutableSource: SS, useSyncExternalStore: ES, useId: MS, unstable_isNewReconciler: !1 };
    function vs(r, o) {
      try {
        var l = "", c = o;
        do
          l += Oe(c), c = c.return;
        while (c);
        var h = l;
      } catch (g) {
        h = `
Error generating stack: ` + g.message + `
` + g.stack;
      }
      return { value: r, source: o, stack: h, digest: null };
    }
    function nm(r, o, l) {
      return { value: r, source: null, stack: l ?? null, digest: o ?? null };
    }
    function rm(r, o) {
      try {
        console.error(o.value);
      } catch (l) {
        setTimeout(function() {
          throw l;
        });
      }
    }
    var CP = typeof WeakMap == "function" ? WeakMap : Map;
    function US(r, o, l) {
      l = Hr(-1, l), l.tag = 3, l.payload = { element: null };
      var c = o.value;
      return l.callback = function() {
        Gc || (Gc = !0, ym = c), rm(r, o);
      }, l;
    }
    function $S(r, o, l) {
      l = Hr(-1, l), l.tag = 3;
      var c = r.type.getDerivedStateFromError;
      if (typeof c == "function") {
        var h = o.value;
        l.payload = function() {
          return c(h);
        }, l.callback = function() {
          rm(r, o);
        };
      }
      var g = r.stateNode;
      return g !== null && typeof g.componentDidCatch == "function" && (l.callback = function() {
        rm(r, o), typeof c != "function" && (Ei === null ? Ei = /* @__PURE__ */ new Set([this]) : Ei.add(this));
        var w = o.stack;
        this.componentDidCatch(o.value, { componentStack: w !== null ? w : "" });
      }), l;
    }
    function zS(r, o, l) {
      var c = r.pingCache;
      if (c === null) {
        c = r.pingCache = new CP();
        var h = /* @__PURE__ */ new Set();
        c.set(o, h);
      } else
        h = c.get(o), h === void 0 && (h = /* @__PURE__ */ new Set(), c.set(o, h));
      h.has(l) || (h.add(l), r = FP.bind(null, r, o, l), o.then(r, r));
    }
    function VS(r) {
      do {
        var o;
        if ((o = r.tag === 13) && (o = r.memoizedState, o = o !== null ? o.dehydrated !== null : !0), o)
          return r;
        r = r.return;
      } while (r !== null);
      return null;
    }
    function WS(r, o, l, c, h) {
      return r.mode & 1 ? (r.flags |= 65536, r.lanes = h, r) : (r === o ? r.flags |= 65536 : (r.flags |= 128, l.flags |= 131072, l.flags &= -52805, l.tag === 1 && (l.alternate === null ? l.tag = 17 : (o = Hr(-1, 1), o.tag = 2, wi(l, o, 1))), l.lanes |= 1), r);
    }
    var TP = B.ReactCurrentOwner, pn = !1;
    function un(r, o, l, c) {
      o.child = r === null ? yS(o, null, l, c) : ms(o, r.child, l, c);
    }
    function GS(r, o, l, c, h) {
      l = l.render;
      var g = o.ref;
      return ps(o, h), c = Zp(r, o, l, c, g, h), l = Xp(), r !== null && !pn ? (o.updateQueue = r.updateQueue, o.flags &= -2053, r.lanes &= ~h, Br(r, o, h)) : (dt && l && kp(o), o.flags |= 1, un(r, o, c, h), o.child);
    }
    function qS(r, o, l, c, h) {
      if (r === null) {
        var g = l.type;
        return typeof g == "function" && !Tm(g) && g.defaultProps === void 0 && l.compare === null && l.defaultProps === void 0 ? (o.tag = 15, o.type = g, YS(r, o, g, c, h)) : (r = Jc(l.type, null, c, o, o.mode, h), r.ref = o.ref, r.return = o, o.child = r);
      }
      if (g = r.child, !(r.lanes & h)) {
        var w = g.memoizedProps;
        if (l = l.compare, l = l !== null ? l : La, l(w, c) && r.ref === o.ref)
          return Br(r, o, h);
      }
      return o.flags |= 1, r = Ti(g, c), r.ref = o.ref, r.return = o, o.child = r;
    }
    function YS(r, o, l, c, h) {
      if (r !== null) {
        var g = r.memoizedProps;
        if (La(g, c) && r.ref === o.ref)
          if (pn = !1, o.pendingProps = c = g, (r.lanes & h) !== 0)
            r.flags & 131072 && (pn = !0);
          else
            return o.lanes = r.lanes, Br(r, o, h);
      }
      return im(r, o, l, c, h);
    }
    function KS(r, o, l) {
      var c = o.pendingProps, h = c.children, g = r !== null ? r.memoizedState : null;
      if (c.mode === "hidden")
        if (!(o.mode & 1))
          o.memoizedState = { baseLanes: 0, cachePool: null, transitions: null }, rt(ws, bn), bn |= l;
        else {
          if (!(l & 1073741824))
            return r = g !== null ? g.baseLanes | l : l, o.lanes = o.childLanes = 1073741824, o.memoizedState = { baseLanes: r, cachePool: null, transitions: null }, o.updateQueue = null, rt(ws, bn), bn |= r, null;
          o.memoizedState = { baseLanes: 0, cachePool: null, transitions: null }, c = g !== null ? g.baseLanes : l, rt(ws, bn), bn |= c;
        }
      else
        g !== null ? (c = g.baseLanes | l, o.memoizedState = null) : c = l, rt(ws, bn), bn |= c;
      return un(r, o, h, l), o.child;
    }
    function ZS(r, o) {
      var l = o.ref;
      (r === null && l !== null || r !== null && r.ref !== l) && (o.flags |= 512, o.flags |= 2097152);
    }
    function im(r, o, l, c, h) {
      var g = hn(l) ? ro : Xt.current;
      return g = us(o, g), ps(o, h), l = Zp(r, o, l, c, g, h), c = Xp(), r !== null && !pn ? (o.updateQueue = r.updateQueue, o.flags &= -2053, r.lanes &= ~h, Br(r, o, h)) : (dt && c && kp(o), o.flags |= 1, un(r, o, l, h), o.child);
    }
    function XS(r, o, l, c, h) {
      if (hn(l)) {
        var g = !0;
        bc(o);
      } else
        g = !1;
      if (ps(o, h), o.stateNode === null)
        Uc(r, o), pS(o, l, c), zp(o, l, c, h), c = !0;
      else if (r === null) {
        var w = o.stateNode, b = o.memoizedProps;
        w.props = b;
        var _ = w.context, H = l.contextType;
        typeof H == "object" && H !== null ? H = Nn(H) : (H = hn(l) ? ro : Xt.current, H = us(o, H));
        var K = l.getDerivedStateFromProps, J = typeof K == "function" || typeof w.getSnapshotBeforeUpdate == "function";
        J || typeof w.UNSAFE_componentWillReceiveProps != "function" && typeof w.componentWillReceiveProps != "function" || (b !== c || _ !== H) && mS(o, w, c, H), yi = !1;
        var Y = o.memoizedState;
        w.state = Y, kc(o, c, w, h), _ = o.memoizedState, b !== c || Y !== _ || fn.current || yi ? (typeof K == "function" && ($p(o, l, K, c), _ = o.memoizedState), (b = yi || hS(o, l, b, c, Y, _, H)) ? (J || typeof w.UNSAFE_componentWillMount != "function" && typeof w.componentWillMount != "function" || (typeof w.componentWillMount == "function" && w.componentWillMount(), typeof w.UNSAFE_componentWillMount == "function" && w.UNSAFE_componentWillMount()), typeof w.componentDidMount == "function" && (o.flags |= 4194308)) : (typeof w.componentDidMount == "function" && (o.flags |= 4194308), o.memoizedProps = c, o.memoizedState = _), w.props = c, w.state = _, w.context = H, c = b) : (typeof w.componentDidMount == "function" && (o.flags |= 4194308), c = !1);
      } else {
        w = o.stateNode, uS(r, o), b = o.memoizedProps, H = o.type === o.elementType ? b : Qn(o.type, b), w.props = H, J = o.pendingProps, Y = w.context, _ = l.contextType, typeof _ == "object" && _ !== null ? _ = Nn(_) : (_ = hn(l) ? ro : Xt.current, _ = us(o, _));
        var oe = l.getDerivedStateFromProps;
        (K = typeof oe == "function" || typeof w.getSnapshotBeforeUpdate == "function") || typeof w.UNSAFE_componentWillReceiveProps != "function" && typeof w.componentWillReceiveProps != "function" || (b !== J || Y !== _) && mS(o, w, c, _), yi = !1, Y = o.memoizedState, w.state = Y, kc(o, c, w, h);
        var le = o.memoizedState;
        b !== J || Y !== le || fn.current || yi ? (typeof oe == "function" && ($p(o, l, oe, c), le = o.memoizedState), (H = yi || hS(o, l, H, c, Y, le, _) || !1) ? (K || typeof w.UNSAFE_componentWillUpdate != "function" && typeof w.componentWillUpdate != "function" || (typeof w.componentWillUpdate == "function" && w.componentWillUpdate(c, le, _), typeof w.UNSAFE_componentWillUpdate == "function" && w.UNSAFE_componentWillUpdate(c, le, _)), typeof w.componentDidUpdate == "function" && (o.flags |= 4), typeof w.getSnapshotBeforeUpdate == "function" && (o.flags |= 1024)) : (typeof w.componentDidUpdate != "function" || b === r.memoizedProps && Y === r.memoizedState || (o.flags |= 4), typeof w.getSnapshotBeforeUpdate != "function" || b === r.memoizedProps && Y === r.memoizedState || (o.flags |= 1024), o.memoizedProps = c, o.memoizedState = le), w.props = c, w.state = le, w.context = _, c = H) : (typeof w.componentDidUpdate != "function" || b === r.memoizedProps && Y === r.memoizedState || (o.flags |= 4), typeof w.getSnapshotBeforeUpdate != "function" || b === r.memoizedProps && Y === r.memoizedState || (o.flags |= 1024), c = !1);
      }
      return om(r, o, l, c, g, h);
    }
    function om(r, o, l, c, h, g) {
      ZS(r, o);
      var w = (o.flags & 128) !== 0;
      if (!c && !w)
        return h && tS(o, l, !1), Br(r, o, g);
      c = o.stateNode, TP.current = o;
      var b = w && typeof l.getDerivedStateFromError != "function" ? null : c.render();
      return o.flags |= 1, r !== null && w ? (o.child = ms(o, r.child, null, g), o.child = ms(o, null, b, g)) : un(r, o, b, g), o.memoizedState = c.state, h && tS(o, l, !0), o.child;
    }
    function JS(r) {
      var o = r.stateNode;
      o.pendingContext ? Qw(r, o.pendingContext, o.pendingContext !== o.context) : o.context && Qw(r, o.context, !1), Vp(r, o.containerInfo);
    }
    function QS(r, o, l, c, h) {
      return fs(), Dp(h), o.flags |= 256, un(r, o, l, c), o.child;
    }
    var sm = { dehydrated: null, treeContext: null, retryLane: 0 };
    function am(r) {
      return { baseLanes: r, cachePool: null, transitions: null };
    }
    function eE(r, o, l) {
      var c = o.pendingProps, h = pt.current, g = !1, w = (o.flags & 128) !== 0, b;
      if ((b = w) || (b = r !== null && r.memoizedState === null ? !1 : (h & 2) !== 0), b ? (g = !0, o.flags &= -129) : (r === null || r.memoizedState !== null) && (h |= 1), rt(pt, h & 1), r === null)
        return Np(o), r = o.memoizedState, r !== null && (r = r.dehydrated, r !== null) ? (o.mode & 1 ? r.data === "$!" ? o.lanes = 8 : o.lanes = 1073741824 : o.lanes = 1, null) : (w = c.children, r = c.fallback, g ? (c = o.mode, g = o.child, w = { mode: "hidden", children: w }, !(c & 1) && g !== null ? (g.childLanes = 0, g.pendingProps = w) : g = Qc(w, c, 0, null), r = po(r, c, l, null), g.return = o, r.return = o, g.sibling = r, o.child = g, o.child.memoizedState = am(l), o.memoizedState = sm, r) : lm(o, w));
      if (h = r.memoizedState, h !== null && (b = h.dehydrated, b !== null))
        return OP(r, o, w, c, b, h, l);
      if (g) {
        g = c.fallback, w = o.mode, h = r.child, b = h.sibling;
        var _ = { mode: "hidden", children: c.children };
        return !(w & 1) && o.child !== h ? (c = o.child, c.childLanes = 0, c.pendingProps = _, o.deletions = null) : (c = Ti(h, _), c.subtreeFlags = h.subtreeFlags & 14680064), b !== null ? g = Ti(b, g) : (g = po(g, w, l, null), g.flags |= 2), g.return = o, c.return = o, c.sibling = g, o.child = c, c = g, g = o.child, w = r.child.memoizedState, w = w === null ? am(l) : { baseLanes: w.baseLanes | l, cachePool: null, transitions: w.transitions }, g.memoizedState = w, g.childLanes = r.childLanes & ~l, o.memoizedState = sm, c;
      }
      return g = r.child, r = g.sibling, c = Ti(g, { mode: "visible", children: c.children }), !(o.mode & 1) && (c.lanes = l), c.return = o, c.sibling = null, r !== null && (l = o.deletions, l === null ? (o.deletions = [r], o.flags |= 16) : l.push(r)), o.child = c, o.memoizedState = null, c;
    }
    function lm(r, o) {
      return o = Qc({ mode: "visible", children: o }, r.mode, 0, null), o.return = r, r.child = o;
    }
    function Bc(r, o, l, c) {
      return c !== null && Dp(c), ms(o, r.child, null, l), r = lm(o, o.pendingProps.children), r.flags |= 2, o.memoizedState = null, r;
    }
    function OP(r, o, l, c, h, g, w) {
      if (l)
        return o.flags & 256 ? (o.flags &= -257, c = nm(Error(n(422))), Bc(r, o, w, c)) : o.memoizedState !== null ? (o.child = r.child, o.flags |= 128, null) : (g = c.fallback, h = o.mode, c = Qc({ mode: "visible", children: c.children }, h, 0, null), g = po(g, h, w, null), g.flags |= 2, c.return = o, g.return = o, c.sibling = g, o.child = c, o.mode & 1 && ms(o, r.child, null, w), o.child.memoizedState = am(w), o.memoizedState = sm, g);
      if (!(o.mode & 1))
        return Bc(r, o, w, null);
      if (h.data === "$!") {
        if (c = h.nextSibling && h.nextSibling.dataset, c)
          var b = c.dgst;
        return c = b, g = Error(n(419)), c = nm(g, c, void 0), Bc(r, o, w, c);
      }
      if (b = (w & r.childLanes) !== 0, pn || b) {
        if (c = Bt, c !== null) {
          switch (w & -w) {
            case 4:
              h = 2;
              break;
            case 16:
              h = 8;
              break;
            case 64:
            case 128:
            case 256:
            case 512:
            case 1024:
            case 2048:
            case 4096:
            case 8192:
            case 16384:
            case 32768:
            case 65536:
            case 131072:
            case 262144:
            case 524288:
            case 1048576:
            case 2097152:
            case 4194304:
            case 8388608:
            case 16777216:
            case 33554432:
            case 67108864:
              h = 32;
              break;
            case 536870912:
              h = 268435456;
              break;
            default:
              h = 0;
          }
          h = h & (c.suspendedLanes | w) ? 0 : h, h !== 0 && h !== g.retryLane && (g.retryLane = h, Fr(r, h), nr(c, r, h, -1));
        }
        return Cm(), c = nm(Error(n(421))), Bc(r, o, w, c);
      }
      return h.data === "$?" ? (o.flags |= 128, o.child = r.child, o = HP.bind(null, r), h._reactRetry = o, null) : (r = g.treeContext, xn = pi(h.nextSibling), En = o, dt = !0, Jn = null, r !== null && (Pn[In++] = jr, Pn[In++] = Mr, Pn[In++] = io, jr = r.id, Mr = r.overflow, io = o), o = lm(o, c.children), o.flags |= 4096, o);
    }
    function tE(r, o, l) {
      r.lanes |= o;
      var c = r.alternate;
      c !== null && (c.lanes |= o), Hp(r.return, o, l);
    }
    function um(r, o, l, c, h) {
      var g = r.memoizedState;
      g === null ? r.memoizedState = { isBackwards: o, rendering: null, renderingStartTime: 0, last: c, tail: l, tailMode: h } : (g.isBackwards = o, g.rendering = null, g.renderingStartTime = 0, g.last = c, g.tail = l, g.tailMode = h);
    }
    function nE(r, o, l) {
      var c = o.pendingProps, h = c.revealOrder, g = c.tail;
      if (un(r, o, c.children, l), c = pt.current, c & 2)
        c = c & 1 | 2, o.flags |= 128;
      else {
        if (r !== null && r.flags & 128)
          e:
            for (r = o.child; r !== null; ) {
              if (r.tag === 13)
                r.memoizedState !== null && tE(r, l, o);
              else if (r.tag === 19)
                tE(r, l, o);
              else if (r.child !== null) {
                r.child.return = r, r = r.child;
                continue;
              }
              if (r === o)
                break e;
              for (; r.sibling === null; ) {
                if (r.return === null || r.return === o)
                  break e;
                r = r.return;
              }
              r.sibling.return = r.return, r = r.sibling;
            }
        c &= 1;
      }
      if (rt(pt, c), !(o.mode & 1))
        o.memoizedState = null;
      else
        switch (h) {
          case "forwards":
            for (l = o.child, h = null; l !== null; )
              r = l.alternate, r !== null && Nc(r) === null && (h = l), l = l.sibling;
            l = h, l === null ? (h = o.child, o.child = null) : (h = l.sibling, l.sibling = null), um(o, !1, h, l, g);
            break;
          case "backwards":
            for (l = null, h = o.child, o.child = null; h !== null; ) {
              if (r = h.alternate, r !== null && Nc(r) === null) {
                o.child = h;
                break;
              }
              r = h.sibling, h.sibling = l, l = h, h = r;
            }
            um(o, !0, l, null, g);
            break;
          case "together":
            um(o, !1, null, null, void 0);
            break;
          default:
            o.memoizedState = null;
        }
      return o.child;
    }
    function Uc(r, o) {
      !(o.mode & 1) && r !== null && (r.alternate = null, o.alternate = null, o.flags |= 2);
    }
    function Br(r, o, l) {
      if (r !== null && (o.dependencies = r.dependencies), uo |= o.lanes, !(l & o.childLanes))
        return null;
      if (r !== null && o.child !== r.child)
        throw Error(n(153));
      if (o.child !== null) {
        for (r = o.child, l = Ti(r, r.pendingProps), o.child = l, l.return = o; r.sibling !== null; )
          r = r.sibling, l = l.sibling = Ti(r, r.pendingProps), l.return = o;
        l.sibling = null;
      }
      return o.child;
    }
    function _P(r, o, l) {
      switch (o.tag) {
        case 3:
          JS(o), fs();
          break;
        case 5:
          wS(o);
          break;
        case 1:
          hn(o.type) && bc(o);
          break;
        case 4:
          Vp(o, o.stateNode.containerInfo);
          break;
        case 10:
          var c = o.type._context, h = o.memoizedProps.value;
          rt(Rc, c._currentValue), c._currentValue = h;
          break;
        case 13:
          if (c = o.memoizedState, c !== null)
            return c.dehydrated !== null ? (rt(pt, pt.current & 1), o.flags |= 128, null) : l & o.child.childLanes ? eE(r, o, l) : (rt(pt, pt.current & 1), r = Br(r, o, l), r !== null ? r.sibling : null);
          rt(pt, pt.current & 1);
          break;
        case 19:
          if (c = (l & o.childLanes) !== 0, r.flags & 128) {
            if (c)
              return nE(r, o, l);
            o.flags |= 128;
          }
          if (h = o.memoizedState, h !== null && (h.rendering = null, h.tail = null, h.lastEffect = null), rt(pt, pt.current), c)
            break;
          return null;
        case 22:
        case 23:
          return o.lanes = 0, KS(r, o, l);
      }
      return Br(r, o, l);
    }
    var rE, cm, iE, oE;
    rE = function(r, o) {
      for (var l = o.child; l !== null; ) {
        if (l.tag === 5 || l.tag === 6)
          r.appendChild(l.stateNode);
        else if (l.tag !== 4 && l.child !== null) {
          l.child.return = l, l = l.child;
          continue;
        }
        if (l === o)
          break;
        for (; l.sibling === null; ) {
          if (l.return === null || l.return === o)
            return;
          l = l.return;
        }
        l.sibling.return = l.return, l = l.sibling;
      }
    }, cm = function() {
    }, iE = function(r, o, l, c) {
      var h = r.memoizedProps;
      if (h !== c) {
        r = o.stateNode, ao(vr.current);
        var g = null;
        switch (l) {
          case "input":
            h = Zi(r, h), c = Zi(r, c), g = [];
            break;
          case "select":
            h = T({}, h, { value: void 0 }), c = T({}, c, { value: void 0 }), g = [];
            break;
          case "textarea":
            h = kr(r, h), c = kr(r, c), g = [];
            break;
          default:
            typeof h.onClick != "function" && typeof c.onClick == "function" && (r.onclick = Sc);
        }
        ve(l, c);
        var w;
        l = null;
        for (H in h)
          if (!c.hasOwnProperty(H) && h.hasOwnProperty(H) && h[H] != null)
            if (H === "style") {
              var b = h[H];
              for (w in b)
                b.hasOwnProperty(w) && (l || (l = {}), l[w] = "");
            } else
              H !== "dangerouslySetInnerHTML" && H !== "children" && H !== "suppressContentEditableWarning" && H !== "suppressHydrationWarning" && H !== "autoFocus" && (s.hasOwnProperty(H) ? g || (g = []) : (g = g || []).push(H, null));
        for (H in c) {
          var _ = c[H];
          if (b = h != null ? h[H] : void 0, c.hasOwnProperty(H) && _ !== b && (_ != null || b != null))
            if (H === "style")
              if (b) {
                for (w in b)
                  !b.hasOwnProperty(w) || _ && _.hasOwnProperty(w) || (l || (l = {}), l[w] = "");
                for (w in _)
                  _.hasOwnProperty(w) && b[w] !== _[w] && (l || (l = {}), l[w] = _[w]);
              } else
                l || (g || (g = []), g.push(
                  H,
                  l
                )), l = _;
            else
              H === "dangerouslySetInnerHTML" ? (_ = _ ? _.__html : void 0, b = b ? b.__html : void 0, _ != null && b !== _ && (g = g || []).push(H, _)) : H === "children" ? typeof _ != "string" && typeof _ != "number" || (g = g || []).push(H, "" + _) : H !== "suppressContentEditableWarning" && H !== "suppressHydrationWarning" && (s.hasOwnProperty(H) ? (_ != null && H === "onScroll" && lt("scroll", r), g || b === _ || (g = [])) : (g = g || []).push(H, _));
        }
        l && (g = g || []).push("style", l);
        var H = g;
        (o.updateQueue = H) && (o.flags |= 4);
      }
    }, oE = function(r, o, l, c) {
      l !== c && (o.flags |= 4);
    };
    function Va(r, o) {
      if (!dt)
        switch (r.tailMode) {
          case "hidden":
            o = r.tail;
            for (var l = null; o !== null; )
              o.alternate !== null && (l = o), o = o.sibling;
            l === null ? r.tail = null : l.sibling = null;
            break;
          case "collapsed":
            l = r.tail;
            for (var c = null; l !== null; )
              l.alternate !== null && (c = l), l = l.sibling;
            c === null ? o || r.tail === null ? r.tail = null : r.tail.sibling = null : c.sibling = null;
        }
    }
    function Qt(r) {
      var o = r.alternate !== null && r.alternate.child === r.child, l = 0, c = 0;
      if (o)
        for (var h = r.child; h !== null; )
          l |= h.lanes | h.childLanes, c |= h.subtreeFlags & 14680064, c |= h.flags & 14680064, h.return = r, h = h.sibling;
      else
        for (h = r.child; h !== null; )
          l |= h.lanes | h.childLanes, c |= h.subtreeFlags, c |= h.flags, h.return = r, h = h.sibling;
      return r.subtreeFlags |= c, r.childLanes = l, o;
    }
    function RP(r, o, l) {
      var c = o.pendingProps;
      switch (Pp(o), o.tag) {
        case 2:
        case 16:
        case 15:
        case 0:
        case 11:
        case 7:
        case 8:
        case 12:
        case 9:
        case 14:
          return Qt(o), null;
        case 1:
          return hn(o.type) && xc(), Qt(o), null;
        case 3:
          return c = o.stateNode, gs(), ut(fn), ut(Xt), qp(), c.pendingContext && (c.context = c.pendingContext, c.pendingContext = null), (r === null || r.child === null) && (_c(o) ? o.flags |= 4 : r === null || r.memoizedState.isDehydrated && !(o.flags & 256) || (o.flags |= 1024, Jn !== null && (Em(Jn), Jn = null))), cm(r, o), Qt(o), null;
        case 5:
          Wp(o);
          var h = ao(Ha.current);
          if (l = o.type, r !== null && o.stateNode != null)
            iE(r, o, l, c, h), r.ref !== o.ref && (o.flags |= 512, o.flags |= 2097152);
          else {
            if (!c) {
              if (o.stateNode === null)
                throw Error(n(166));
              return Qt(o), null;
            }
            if (r = ao(vr.current), _c(o)) {
              c = o.stateNode, l = o.type;
              var g = o.memoizedProps;
              switch (c[gr] = o, c[Na] = g, r = (o.mode & 1) !== 0, l) {
                case "dialog":
                  lt("cancel", c), lt("close", c);
                  break;
                case "iframe":
                case "object":
                case "embed":
                  lt("load", c);
                  break;
                case "video":
                case "audio":
                  for (h = 0; h < ka.length; h++)
                    lt(ka[h], c);
                  break;
                case "source":
                  lt("error", c);
                  break;
                case "img":
                case "image":
                case "link":
                  lt(
                    "error",
                    c
                  ), lt("load", c);
                  break;
                case "details":
                  lt("toggle", c);
                  break;
                case "input":
                  Yn(c, g), lt("invalid", c);
                  break;
                case "select":
                  c._wrapperState = { wasMultiple: !!g.multiple }, lt("invalid", c);
                  break;
                case "textarea":
                  Xi(c, g), lt("invalid", c);
              }
              ve(l, g), h = null;
              for (var w in g)
                if (g.hasOwnProperty(w)) {
                  var b = g[w];
                  w === "children" ? typeof b == "string" ? c.textContent !== b && (g.suppressHydrationWarning !== !0 && wc(c.textContent, b, r), h = ["children", b]) : typeof b == "number" && c.textContent !== "" + b && (g.suppressHydrationWarning !== !0 && wc(
                    c.textContent,
                    b,
                    r
                  ), h = ["children", "" + b]) : s.hasOwnProperty(w) && b != null && w === "onScroll" && lt("scroll", c);
                }
              switch (l) {
                case "input":
                  Rn(c), Ar(c, g, !0);
                  break;
                case "textarea":
                  Rn(c), on(c);
                  break;
                case "select":
                case "option":
                  break;
                default:
                  typeof g.onClick == "function" && (c.onclick = Sc);
              }
              c = h, o.updateQueue = c, c !== null && (o.flags |= 4);
            } else {
              w = h.nodeType === 9 ? h : h.ownerDocument, r === "http://www.w3.org/1999/xhtml" && (r = ht(l)), r === "http://www.w3.org/1999/xhtml" ? l === "script" ? (r = w.createElement("div"), r.innerHTML = "<script><\/script>", r = r.removeChild(r.firstChild)) : typeof c.is == "string" ? r = w.createElement(l, { is: c.is }) : (r = w.createElement(l), l === "select" && (w = r, c.multiple ? w.multiple = !0 : c.size && (w.size = c.size))) : r = w.createElementNS(r, l), r[gr] = o, r[Na] = c, rE(r, o, !1, !1), o.stateNode = r;
              e: {
                switch (w = ae(l, c), l) {
                  case "dialog":
                    lt("cancel", r), lt("close", r), h = c;
                    break;
                  case "iframe":
                  case "object":
                  case "embed":
                    lt("load", r), h = c;
                    break;
                  case "video":
                  case "audio":
                    for (h = 0; h < ka.length; h++)
                      lt(ka[h], r);
                    h = c;
                    break;
                  case "source":
                    lt("error", r), h = c;
                    break;
                  case "img":
                  case "image":
                  case "link":
                    lt(
                      "error",
                      r
                    ), lt("load", r), h = c;
                    break;
                  case "details":
                    lt("toggle", r), h = c;
                    break;
                  case "input":
                    Yn(r, c), h = Zi(r, c), lt("invalid", r);
                    break;
                  case "option":
                    h = c;
                    break;
                  case "select":
                    r._wrapperState = { wasMultiple: !!c.multiple }, h = T({}, c, { value: void 0 }), lt("invalid", r);
                    break;
                  case "textarea":
                    Xi(r, c), h = kr(r, c), lt("invalid", r);
                    break;
                  default:
                    h = c;
                }
                ve(l, h), b = h;
                for (g in b)
                  if (b.hasOwnProperty(g)) {
                    var _ = b[g];
                    g === "style" ? Yu(r, _) : g === "dangerouslySetInnerHTML" ? (_ = _ ? _.__html : void 0, _ != null && Ft(r, _)) : g === "children" ? typeof _ == "string" ? (l !== "textarea" || _ !== "") && ii(r, _) : typeof _ == "number" && ii(r, "" + _) : g !== "suppressContentEditableWarning" && g !== "suppressHydrationWarning" && g !== "autoFocus" && (s.hasOwnProperty(g) ? _ != null && g === "onScroll" && lt("scroll", r) : _ != null && I(r, g, _, w));
                  }
                switch (l) {
                  case "input":
                    Rn(r), Ar(r, c, !1);
                    break;
                  case "textarea":
                    Rn(r), on(r);
                    break;
                  case "option":
                    c.value != null && r.setAttribute("value", "" + Ae(c.value));
                    break;
                  case "select":
                    r.multiple = !!c.multiple, g = c.value, g != null ? Ln(r, !!c.multiple, g, !1) : c.defaultValue != null && Ln(
                      r,
                      !!c.multiple,
                      c.defaultValue,
                      !0
                    );
                    break;
                  default:
                    typeof h.onClick == "function" && (r.onclick = Sc);
                }
                switch (l) {
                  case "button":
                  case "input":
                  case "select":
                  case "textarea":
                    c = !!c.autoFocus;
                    break e;
                  case "img":
                    c = !0;
                    break e;
                  default:
                    c = !1;
                }
              }
              c && (o.flags |= 4);
            }
            o.ref !== null && (o.flags |= 512, o.flags |= 2097152);
          }
          return Qt(o), null;
        case 6:
          if (r && o.stateNode != null)
            oE(r, o, r.memoizedProps, c);
          else {
            if (typeof c != "string" && o.stateNode === null)
              throw Error(n(166));
            if (l = ao(Ha.current), ao(vr.current), _c(o)) {
              if (c = o.stateNode, l = o.memoizedProps, c[gr] = o, (g = c.nodeValue !== l) && (r = En, r !== null))
                switch (r.tag) {
                  case 3:
                    wc(c.nodeValue, l, (r.mode & 1) !== 0);
                    break;
                  case 5:
                    r.memoizedProps.suppressHydrationWarning !== !0 && wc(c.nodeValue, l, (r.mode & 1) !== 0);
                }
              g && (o.flags |= 4);
            } else
              c = (l.nodeType === 9 ? l : l.ownerDocument).createTextNode(c), c[gr] = o, o.stateNode = c;
          }
          return Qt(o), null;
        case 13:
          if (ut(pt), c = o.memoizedState, r === null || r.memoizedState !== null && r.memoizedState.dehydrated !== null) {
            if (dt && xn !== null && o.mode & 1 && !(o.flags & 128))
              aS(), fs(), o.flags |= 98560, g = !1;
            else if (g = _c(o), c !== null && c.dehydrated !== null) {
              if (r === null) {
                if (!g)
                  throw Error(n(318));
                if (g = o.memoizedState, g = g !== null ? g.dehydrated : null, !g)
                  throw Error(n(317));
                g[gr] = o;
              } else
                fs(), !(o.flags & 128) && (o.memoizedState = null), o.flags |= 4;
              Qt(o), g = !1;
            } else
              Jn !== null && (Em(Jn), Jn = null), g = !0;
            if (!g)
              return o.flags & 65536 ? o : null;
          }
          return o.flags & 128 ? (o.lanes = l, o) : (c = c !== null, c !== (r !== null && r.memoizedState !== null) && c && (o.child.flags |= 8192, o.mode & 1 && (r === null || pt.current & 1 ? Nt === 0 && (Nt = 3) : Cm())), o.updateQueue !== null && (o.flags |= 4), Qt(o), null);
        case 4:
          return gs(), cm(r, o), r === null && Pa(o.stateNode.containerInfo), Qt(o), null;
        case 10:
          return Fp(o.type._context), Qt(o), null;
        case 17:
          return hn(o.type) && xc(), Qt(o), null;
        case 19:
          if (ut(pt), g = o.memoizedState, g === null)
            return Qt(o), null;
          if (c = (o.flags & 128) !== 0, w = g.rendering, w === null)
            if (c)
              Va(g, !1);
            else {
              if (Nt !== 0 || r !== null && r.flags & 128)
                for (r = o.child; r !== null; ) {
                  if (w = Nc(r), w !== null) {
                    for (o.flags |= 128, Va(g, !1), c = w.updateQueue, c !== null && (o.updateQueue = c, o.flags |= 4), o.subtreeFlags = 0, c = l, l = o.child; l !== null; )
                      g = l, r = c, g.flags &= 14680066, w = g.alternate, w === null ? (g.childLanes = 0, g.lanes = r, g.child = null, g.subtreeFlags = 0, g.memoizedProps = null, g.memoizedState = null, g.updateQueue = null, g.dependencies = null, g.stateNode = null) : (g.childLanes = w.childLanes, g.lanes = w.lanes, g.child = w.child, g.subtreeFlags = 0, g.deletions = null, g.memoizedProps = w.memoizedProps, g.memoizedState = w.memoizedState, g.updateQueue = w.updateQueue, g.type = w.type, r = w.dependencies, g.dependencies = r === null ? null : { lanes: r.lanes, firstContext: r.firstContext }), l = l.sibling;
                    return rt(pt, pt.current & 1 | 2), o.child;
                  }
                  r = r.sibling;
                }
              g.tail !== null && at() > Ss && (o.flags |= 128, c = !0, Va(g, !1), o.lanes = 4194304);
            }
          else {
            if (!c)
              if (r = Nc(w), r !== null) {
                if (o.flags |= 128, c = !0, l = r.updateQueue, l !== null && (o.updateQueue = l, o.flags |= 4), Va(g, !0), g.tail === null && g.tailMode === "hidden" && !w.alternate && !dt)
                  return Qt(o), null;
              } else
                2 * at() - g.renderingStartTime > Ss && l !== 1073741824 && (o.flags |= 128, c = !0, Va(g, !1), o.lanes = 4194304);
            g.isBackwards ? (w.sibling = o.child, o.child = w) : (l = g.last, l !== null ? l.sibling = w : o.child = w, g.last = w);
          }
          return g.tail !== null ? (o = g.tail, g.rendering = o, g.tail = o.sibling, g.renderingStartTime = at(), o.sibling = null, l = pt.current, rt(pt, c ? l & 1 | 2 : l & 1), o) : (Qt(o), null);
        case 22:
        case 23:
          return bm(), c = o.memoizedState !== null, r !== null && r.memoizedState !== null !== c && (o.flags |= 8192), c && o.mode & 1 ? bn & 1073741824 && (Qt(o), o.subtreeFlags & 6 && (o.flags |= 8192)) : Qt(o), null;
        case 24:
          return null;
        case 25:
          return null;
      }
      throw Error(n(156, o.tag));
    }
    function LP(r, o) {
      switch (Pp(o), o.tag) {
        case 1:
          return hn(o.type) && xc(), r = o.flags, r & 65536 ? (o.flags = r & -65537 | 128, o) : null;
        case 3:
          return gs(), ut(fn), ut(Xt), qp(), r = o.flags, r & 65536 && !(r & 128) ? (o.flags = r & -65537 | 128, o) : null;
        case 5:
          return Wp(o), null;
        case 13:
          if (ut(pt), r = o.memoizedState, r !== null && r.dehydrated !== null) {
            if (o.alternate === null)
              throw Error(n(340));
            fs();
          }
          return r = o.flags, r & 65536 ? (o.flags = r & -65537 | 128, o) : null;
        case 19:
          return ut(pt), null;
        case 4:
          return gs(), null;
        case 10:
          return Fp(o.type._context), null;
        case 22:
        case 23:
          return bm(), null;
        case 24:
          return null;
        default:
          return null;
      }
    }
    var $c = !1, en = !1, AP = typeof WeakSet == "function" ? WeakSet : Set, se = null;
    function ys(r, o) {
      var l = r.ref;
      if (l !== null)
        if (typeof l == "function")
          try {
            l(null);
          } catch (c) {
            St(r, o, c);
          }
        else
          l.current = null;
    }
    function dm(r, o, l) {
      try {
        l();
      } catch (c) {
        St(r, o, c);
      }
    }
    var sE = !1;
    function kP(r, o) {
      if (bp = lc, r = Mw(), mp(r)) {
        if ("selectionStart" in r)
          var l = { start: r.selectionStart, end: r.selectionEnd };
        else
          e: {
            l = (l = r.ownerDocument) && l.defaultView || window;
            var c = l.getSelection && l.getSelection();
            if (c && c.rangeCount !== 0) {
              l = c.anchorNode;
              var h = c.anchorOffset, g = c.focusNode;
              c = c.focusOffset;
              try {
                l.nodeType, g.nodeType;
              } catch {
                l = null;
                break e;
              }
              var w = 0, b = -1, _ = -1, H = 0, K = 0, J = r, Y = null;
              t:
                for (; ; ) {
                  for (var oe; J !== l || h !== 0 && J.nodeType !== 3 || (b = w + h), J !== g || c !== 0 && J.nodeType !== 3 || (_ = w + c), J.nodeType === 3 && (w += J.nodeValue.length), (oe = J.firstChild) !== null; )
                    Y = J, J = oe;
                  for (; ; ) {
                    if (J === r)
                      break t;
                    if (Y === l && ++H === h && (b = w), Y === g && ++K === c && (_ = w), (oe = J.nextSibling) !== null)
                      break;
                    J = Y, Y = J.parentNode;
                  }
                  J = oe;
                }
              l = b === -1 || _ === -1 ? null : { start: b, end: _ };
            } else
              l = null;
          }
        l = l || { start: 0, end: 0 };
      } else
        l = null;
      for (Cp = { focusedElem: r, selectionRange: l }, lc = !1, se = o; se !== null; )
        if (o = se, r = o.child, (o.subtreeFlags & 1028) !== 0 && r !== null)
          r.return = o, se = r;
        else
          for (; se !== null; ) {
            o = se;
            try {
              var le = o.alternate;
              if (o.flags & 1024)
                switch (o.tag) {
                  case 0:
                  case 11:
                  case 15:
                    break;
                  case 1:
                    if (le !== null) {
                      var ue = le.memoizedProps, Ct = le.memoizedState, D = o.stateNode, A = D.getSnapshotBeforeUpdate(o.elementType === o.type ? ue : Qn(o.type, ue), Ct);
                      D.__reactInternalSnapshotBeforeUpdate = A;
                    }
                    break;
                  case 3:
                    var F = o.stateNode.containerInfo;
                    F.nodeType === 1 ? F.textContent = "" : F.nodeType === 9 && F.documentElement && F.removeChild(F.documentElement);
                    break;
                  case 5:
                  case 6:
                  case 4:
                  case 17:
                    break;
                  default:
                    throw Error(n(163));
                }
            } catch (te) {
              St(o, o.return, te);
            }
            if (r = o.sibling, r !== null) {
              r.return = o.return, se = r;
              break;
            }
            se = o.return;
          }
      return le = sE, sE = !1, le;
    }
    function Wa(r, o, l) {
      var c = o.updateQueue;
      if (c = c !== null ? c.lastEffect : null, c !== null) {
        var h = c = c.next;
        do {
          if ((h.tag & r) === r) {
            var g = h.destroy;
            h.destroy = void 0, g !== void 0 && dm(o, l, g);
          }
          h = h.next;
        } while (h !== c);
      }
    }
    function zc(r, o) {
      if (o = o.updateQueue, o = o !== null ? o.lastEffect : null, o !== null) {
        var l = o = o.next;
        do {
          if ((l.tag & r) === r) {
            var c = l.create;
            l.destroy = c();
          }
          l = l.next;
        } while (l !== o);
      }
    }
    function fm(r) {
      var o = r.ref;
      if (o !== null) {
        var l = r.stateNode;
        switch (r.tag) {
          case 5:
            r = l;
            break;
          default:
            r = l;
        }
        typeof o == "function" ? o(r) : o.current = r;
      }
    }
    function aE(r) {
      var o = r.alternate;
      o !== null && (r.alternate = null, aE(o)), r.child = null, r.deletions = null, r.sibling = null, r.tag === 5 && (o = r.stateNode, o !== null && (delete o[gr], delete o[Na], delete o[Rp], delete o[hP], delete o[pP])), r.stateNode = null, r.return = null, r.dependencies = null, r.memoizedProps = null, r.memoizedState = null, r.pendingProps = null, r.stateNode = null, r.updateQueue = null;
    }
    function lE(r) {
      return r.tag === 5 || r.tag === 3 || r.tag === 4;
    }
    function uE(r) {
      e:
        for (; ; ) {
          for (; r.sibling === null; ) {
            if (r.return === null || lE(r.return))
              return null;
            r = r.return;
          }
          for (r.sibling.return = r.return, r = r.sibling; r.tag !== 5 && r.tag !== 6 && r.tag !== 18; ) {
            if (r.flags & 2 || r.child === null || r.tag === 4)
              continue e;
            r.child.return = r, r = r.child;
          }
          if (!(r.flags & 2))
            return r.stateNode;
        }
    }
    function hm(r, o, l) {
      var c = r.tag;
      if (c === 5 || c === 6)
        r = r.stateNode, o ? l.nodeType === 8 ? l.parentNode.insertBefore(r, o) : l.insertBefore(r, o) : (l.nodeType === 8 ? (o = l.parentNode, o.insertBefore(r, l)) : (o = l, o.appendChild(r)), l = l._reactRootContainer, l != null || o.onclick !== null || (o.onclick = Sc));
      else if (c !== 4 && (r = r.child, r !== null))
        for (hm(r, o, l), r = r.sibling; r !== null; )
          hm(r, o, l), r = r.sibling;
    }
    function pm(r, o, l) {
      var c = r.tag;
      if (c === 5 || c === 6)
        r = r.stateNode, o ? l.insertBefore(r, o) : l.appendChild(r);
      else if (c !== 4 && (r = r.child, r !== null))
        for (pm(r, o, l), r = r.sibling; r !== null; )
          pm(r, o, l), r = r.sibling;
    }
    var Vt = null, er = !1;
    function Si(r, o, l) {
      for (l = l.child; l !== null; )
        cE(r, o, l), l = l.sibling;
    }
    function cE(r, o, l) {
      if (mr && typeof mr.onCommitFiberUnmount == "function")
        try {
          mr.onCommitFiberUnmount(nc, l);
        } catch {
        }
      switch (l.tag) {
        case 5:
          en || ys(l, o);
        case 6:
          var c = Vt, h = er;
          Vt = null, Si(r, o, l), Vt = c, er = h, Vt !== null && (er ? (r = Vt, l = l.stateNode, r.nodeType === 8 ? r.parentNode.removeChild(l) : r.removeChild(l)) : Vt.removeChild(l.stateNode));
          break;
        case 18:
          Vt !== null && (er ? (r = Vt, l = l.stateNode, r.nodeType === 8 ? _p(r.parentNode, l) : r.nodeType === 1 && _p(r, l), ba(r)) : _p(Vt, l.stateNode));
          break;
        case 4:
          c = Vt, h = er, Vt = l.stateNode.containerInfo, er = !0, Si(r, o, l), Vt = c, er = h;
          break;
        case 0:
        case 11:
        case 14:
        case 15:
          if (!en && (c = l.updateQueue, c !== null && (c = c.lastEffect, c !== null))) {
            h = c = c.next;
            do {
              var g = h, w = g.destroy;
              g = g.tag, w !== void 0 && (g & 2 || g & 4) && dm(l, o, w), h = h.next;
            } while (h !== c);
          }
          Si(r, o, l);
          break;
        case 1:
          if (!en && (ys(l, o), c = l.stateNode, typeof c.componentWillUnmount == "function"))
            try {
              c.props = l.memoizedProps, c.state = l.memoizedState, c.componentWillUnmount();
            } catch (b) {
              St(l, o, b);
            }
          Si(r, o, l);
          break;
        case 21:
          Si(r, o, l);
          break;
        case 22:
          l.mode & 1 ? (en = (c = en) || l.memoizedState !== null, Si(r, o, l), en = c) : Si(r, o, l);
          break;
        default:
          Si(r, o, l);
      }
    }
    function dE(r) {
      var o = r.updateQueue;
      if (o !== null) {
        r.updateQueue = null;
        var l = r.stateNode;
        l === null && (l = r.stateNode = new AP()), o.forEach(function(c) {
          var h = BP.bind(null, r, c);
          l.has(c) || (l.add(c), c.then(h, h));
        });
      }
    }
    function tr(r, o) {
      var l = o.deletions;
      if (l !== null)
        for (var c = 0; c < l.length; c++) {
          var h = l[c];
          try {
            var g = r, w = o, b = w;
            e:
              for (; b !== null; ) {
                switch (b.tag) {
                  case 5:
                    Vt = b.stateNode, er = !1;
                    break e;
                  case 3:
                    Vt = b.stateNode.containerInfo, er = !0;
                    break e;
                  case 4:
                    Vt = b.stateNode.containerInfo, er = !0;
                    break e;
                }
                b = b.return;
              }
            if (Vt === null)
              throw Error(n(160));
            cE(g, w, h), Vt = null, er = !1;
            var _ = h.alternate;
            _ !== null && (_.return = null), h.return = null;
          } catch (H) {
            St(h, o, H);
          }
        }
      if (o.subtreeFlags & 12854)
        for (o = o.child; o !== null; )
          fE(o, r), o = o.sibling;
    }
    function fE(r, o) {
      var l = r.alternate, c = r.flags;
      switch (r.tag) {
        case 0:
        case 11:
        case 14:
        case 15:
          if (tr(o, r), wr(r), c & 4) {
            try {
              Wa(3, r, r.return), zc(3, r);
            } catch (ue) {
              St(r, r.return, ue);
            }
            try {
              Wa(5, r, r.return);
            } catch (ue) {
              St(r, r.return, ue);
            }
          }
          break;
        case 1:
          tr(o, r), wr(r), c & 512 && l !== null && ys(l, l.return);
          break;
        case 5:
          if (tr(o, r), wr(r), c & 512 && l !== null && ys(l, l.return), r.flags & 32) {
            var h = r.stateNode;
            try {
              ii(h, "");
            } catch (ue) {
              St(r, r.return, ue);
            }
          }
          if (c & 4 && (h = r.stateNode, h != null)) {
            var g = r.memoizedProps, w = l !== null ? l.memoizedProps : g, b = r.type, _ = r.updateQueue;
            if (r.updateQueue = null, _ !== null)
              try {
                b === "input" && g.type === "radio" && g.name != null && Lr(h, g), ae(b, w);
                var H = ae(b, g);
                for (w = 0; w < _.length; w += 2) {
                  var K = _[w], J = _[w + 1];
                  K === "style" ? Yu(h, J) : K === "dangerouslySetInnerHTML" ? Ft(h, J) : K === "children" ? ii(h, J) : I(h, K, J, H);
                }
                switch (b) {
                  case "input":
                    dr(h, g);
                    break;
                  case "textarea":
                    An(h, g);
                    break;
                  case "select":
                    var Y = h._wrapperState.wasMultiple;
                    h._wrapperState.wasMultiple = !!g.multiple;
                    var oe = g.value;
                    oe != null ? Ln(h, !!g.multiple, oe, !1) : Y !== !!g.multiple && (g.defaultValue != null ? Ln(
                      h,
                      !!g.multiple,
                      g.defaultValue,
                      !0
                    ) : Ln(h, !!g.multiple, g.multiple ? [] : "", !1));
                }
                h[Na] = g;
              } catch (ue) {
                St(r, r.return, ue);
              }
          }
          break;
        case 6:
          if (tr(o, r), wr(r), c & 4) {
            if (r.stateNode === null)
              throw Error(n(162));
            h = r.stateNode, g = r.memoizedProps;
            try {
              h.nodeValue = g;
            } catch (ue) {
              St(r, r.return, ue);
            }
          }
          break;
        case 3:
          if (tr(o, r), wr(r), c & 4 && l !== null && l.memoizedState.isDehydrated)
            try {
              ba(o.containerInfo);
            } catch (ue) {
              St(r, r.return, ue);
            }
          break;
        case 4:
          tr(o, r), wr(r);
          break;
        case 13:
          tr(o, r), wr(r), h = r.child, h.flags & 8192 && (g = h.memoizedState !== null, h.stateNode.isHidden = g, !g || h.alternate !== null && h.alternate.memoizedState !== null || (vm = at())), c & 4 && dE(r);
          break;
        case 22:
          if (K = l !== null && l.memoizedState !== null, r.mode & 1 ? (en = (H = en) || K, tr(o, r), en = H) : tr(o, r), wr(r), c & 8192) {
            if (H = r.memoizedState !== null, (r.stateNode.isHidden = H) && !K && r.mode & 1)
              for (se = r, K = r.child; K !== null; ) {
                for (J = se = K; se !== null; ) {
                  switch (Y = se, oe = Y.child, Y.tag) {
                    case 0:
                    case 11:
                    case 14:
                    case 15:
                      Wa(4, Y, Y.return);
                      break;
                    case 1:
                      ys(Y, Y.return);
                      var le = Y.stateNode;
                      if (typeof le.componentWillUnmount == "function") {
                        c = Y, l = Y.return;
                        try {
                          o = c, le.props = o.memoizedProps, le.state = o.memoizedState, le.componentWillUnmount();
                        } catch (ue) {
                          St(c, l, ue);
                        }
                      }
                      break;
                    case 5:
                      ys(Y, Y.return);
                      break;
                    case 22:
                      if (Y.memoizedState !== null) {
                        mE(J);
                        continue;
                      }
                  }
                  oe !== null ? (oe.return = Y, se = oe) : mE(J);
                }
                K = K.sibling;
              }
            e:
              for (K = null, J = r; ; ) {
                if (J.tag === 5) {
                  if (K === null) {
                    K = J;
                    try {
                      h = J.stateNode, H ? (g = h.style, typeof g.setProperty == "function" ? g.setProperty("display", "none", "important") : g.display = "none") : (b = J.stateNode, _ = J.memoizedProps.style, w = _ != null && _.hasOwnProperty("display") ? _.display : null, b.style.display = Qi("display", w));
                    } catch (ue) {
                      St(r, r.return, ue);
                    }
                  }
                } else if (J.tag === 6) {
                  if (K === null)
                    try {
                      J.stateNode.nodeValue = H ? "" : J.memoizedProps;
                    } catch (ue) {
                      St(r, r.return, ue);
                    }
                } else if ((J.tag !== 22 && J.tag !== 23 || J.memoizedState === null || J === r) && J.child !== null) {
                  J.child.return = J, J = J.child;
                  continue;
                }
                if (J === r)
                  break e;
                for (; J.sibling === null; ) {
                  if (J.return === null || J.return === r)
                    break e;
                  K === J && (K = null), J = J.return;
                }
                K === J && (K = null), J.sibling.return = J.return, J = J.sibling;
              }
          }
          break;
        case 19:
          tr(o, r), wr(r), c & 4 && dE(r);
          break;
        case 21:
          break;
        default:
          tr(
            o,
            r
          ), wr(r);
      }
    }
    function wr(r) {
      var o = r.flags;
      if (o & 2) {
        try {
          e: {
            for (var l = r.return; l !== null; ) {
              if (lE(l)) {
                var c = l;
                break e;
              }
              l = l.return;
            }
            throw Error(n(160));
          }
          switch (c.tag) {
            case 5:
              var h = c.stateNode;
              c.flags & 32 && (ii(h, ""), c.flags &= -33);
              var g = uE(r);
              pm(r, g, h);
              break;
            case 3:
            case 4:
              var w = c.stateNode.containerInfo, b = uE(r);
              hm(r, b, w);
              break;
            default:
              throw Error(n(161));
          }
        } catch (_) {
          St(r, r.return, _);
        }
        r.flags &= -3;
      }
      o & 4096 && (r.flags &= -4097);
    }
    function PP(r, o, l) {
      se = r, hE(r);
    }
    function hE(r, o, l) {
      for (var c = (r.mode & 1) !== 0; se !== null; ) {
        var h = se, g = h.child;
        if (h.tag === 22 && c) {
          var w = h.memoizedState !== null || $c;
          if (!w) {
            var b = h.alternate, _ = b !== null && b.memoizedState !== null || en;
            b = $c;
            var H = en;
            if ($c = w, (en = _) && !H)
              for (se = h; se !== null; )
                w = se, _ = w.child, w.tag === 22 && w.memoizedState !== null ? gE(h) : _ !== null ? (_.return = w, se = _) : gE(h);
            for (; g !== null; )
              se = g, hE(g), g = g.sibling;
            se = h, $c = b, en = H;
          }
          pE(r);
        } else
          h.subtreeFlags & 8772 && g !== null ? (g.return = h, se = g) : pE(r);
      }
    }
    function pE(r) {
      for (; se !== null; ) {
        var o = se;
        if (o.flags & 8772) {
          var l = o.alternate;
          try {
            if (o.flags & 8772)
              switch (o.tag) {
                case 0:
                case 11:
                case 15:
                  en || zc(5, o);
                  break;
                case 1:
                  var c = o.stateNode;
                  if (o.flags & 4 && !en)
                    if (l === null)
                      c.componentDidMount();
                    else {
                      var h = o.elementType === o.type ? l.memoizedProps : Qn(o.type, l.memoizedProps);
                      c.componentDidUpdate(h, l.memoizedState, c.__reactInternalSnapshotBeforeUpdate);
                    }
                  var g = o.updateQueue;
                  g !== null && dS(o, g, c);
                  break;
                case 3:
                  var w = o.updateQueue;
                  if (w !== null) {
                    if (l = null, o.child !== null)
                      switch (o.child.tag) {
                        case 5:
                          l = o.child.stateNode;
                          break;
                        case 1:
                          l = o.child.stateNode;
                      }
                    dS(o, w, l);
                  }
                  break;
                case 5:
                  var b = o.stateNode;
                  if (l === null && o.flags & 4) {
                    l = b;
                    var _ = o.memoizedProps;
                    switch (o.type) {
                      case "button":
                      case "input":
                      case "select":
                      case "textarea":
                        _.autoFocus && l.focus();
                        break;
                      case "img":
                        _.src && (l.src = _.src);
                    }
                  }
                  break;
                case 6:
                  break;
                case 4:
                  break;
                case 12:
                  break;
                case 13:
                  if (o.memoizedState === null) {
                    var H = o.alternate;
                    if (H !== null) {
                      var K = H.memoizedState;
                      if (K !== null) {
                        var J = K.dehydrated;
                        J !== null && ba(J);
                      }
                    }
                  }
                  break;
                case 19:
                case 17:
                case 21:
                case 22:
                case 23:
                case 25:
                  break;
                default:
                  throw Error(n(163));
              }
            en || o.flags & 512 && fm(o);
          } catch (Y) {
            St(o, o.return, Y);
          }
        }
        if (o === r) {
          se = null;
          break;
        }
        if (l = o.sibling, l !== null) {
          l.return = o.return, se = l;
          break;
        }
        se = o.return;
      }
    }
    function mE(r) {
      for (; se !== null; ) {
        var o = se;
        if (o === r) {
          se = null;
          break;
        }
        var l = o.sibling;
        if (l !== null) {
          l.return = o.return, se = l;
          break;
        }
        se = o.return;
      }
    }
    function gE(r) {
      for (; se !== null; ) {
        var o = se;
        try {
          switch (o.tag) {
            case 0:
            case 11:
            case 15:
              var l = o.return;
              try {
                zc(4, o);
              } catch (_) {
                St(o, l, _);
              }
              break;
            case 1:
              var c = o.stateNode;
              if (typeof c.componentDidMount == "function") {
                var h = o.return;
                try {
                  c.componentDidMount();
                } catch (_) {
                  St(o, h, _);
                }
              }
              var g = o.return;
              try {
                fm(o);
              } catch (_) {
                St(o, g, _);
              }
              break;
            case 5:
              var w = o.return;
              try {
                fm(o);
              } catch (_) {
                St(o, w, _);
              }
          }
        } catch (_) {
          St(o, o.return, _);
        }
        if (o === r) {
          se = null;
          break;
        }
        var b = o.sibling;
        if (b !== null) {
          b.return = o.return, se = b;
          break;
        }
        se = o.return;
      }
    }
    var IP = Math.ceil, Vc = B.ReactCurrentDispatcher, mm = B.ReactCurrentOwner, jn = B.ReactCurrentBatchConfig, ze = 0, Bt = null, At = null, Wt = 0, bn = 0, ws = mi(0), Nt = 0, Ga = null, uo = 0, Wc = 0, gm = 0, qa = null, mn = null, vm = 0, Ss = 1 / 0, Ur = null, Gc = !1, ym = null, Ei = null, qc = !1, xi = null, Yc = 0, Ya = 0, wm = null, Kc = -1, Zc = 0;
    function cn() {
      return ze & 6 ? at() : Kc !== -1 ? Kc : Kc = at();
    }
    function bi(r) {
      return r.mode & 1 ? ze & 2 && Wt !== 0 ? Wt & -Wt : gP.transition !== null ? (Zc === 0 && (Zc = lw()), Zc) : (r = Xe, r !== 0 || (r = window.event, r = r === void 0 ? 16 : vw(r.type)), r) : 1;
    }
    function nr(r, o, l, c) {
      if (50 < Ya)
        throw Ya = 0, wm = null, Error(n(185));
      ya(r, l, c), (!(ze & 2) || r !== Bt) && (r === Bt && (!(ze & 2) && (Wc |= l), Nt === 4 && Ci(r, Wt)), gn(r, c), l === 1 && ze === 0 && !(o.mode & 1) && (Ss = at() + 500, Cc && vi()));
    }
    function gn(r, o) {
      var l = r.callbackNode;
      gk(r, o);
      var c = oc(r, r === Bt ? Wt : 0);
      if (c === 0)
        l !== null && to(l), r.callbackNode = null, r.callbackPriority = 0;
      else if (o = c & -c, r.callbackPriority !== o) {
        if (l != null && to(l), o === 1)
          r.tag === 0 ? mP(yE.bind(null, r)) : nS(yE.bind(null, r)), dP(function() {
            !(ze & 6) && vi();
          }), l = null;
        else {
          switch (uw(c)) {
            case 1:
              l = ai;
              break;
            case 4:
              l = ga;
              break;
            case 16:
              l = tc;
              break;
            case 536870912:
              l = aw;
              break;
            default:
              l = tc;
          }
          l = OE(l, vE.bind(null, r));
        }
        r.callbackPriority = o, r.callbackNode = l;
      }
    }
    function vE(r, o) {
      if (Kc = -1, Zc = 0, ze & 6)
        throw Error(n(327));
      var l = r.callbackNode;
      if (Es() && r.callbackNode !== l)
        return null;
      var c = oc(r, r === Bt ? Wt : 0);
      if (c === 0)
        return null;
      if (c & 30 || c & r.expiredLanes || o)
        o = Xc(r, c);
      else {
        o = c;
        var h = ze;
        ze |= 2;
        var g = SE();
        (Bt !== r || Wt !== o) && (Ur = null, Ss = at() + 500, fo(r, o));
        do
          try {
            jP();
            break;
          } catch (b) {
            wE(r, b);
          }
        while (!0);
        Mp(), Vc.current = g, ze = h, At !== null ? o = 0 : (Bt = null, Wt = 0, o = Nt);
      }
      if (o !== 0) {
        if (o === 2 && (h = Qh(r), h !== 0 && (c = h, o = Sm(r, h))), o === 1)
          throw l = Ga, fo(r, 0), Ci(r, c), gn(r, at()), l;
        if (o === 6)
          Ci(r, c);
        else {
          if (h = r.current.alternate, !(c & 30) && !NP(h) && (o = Xc(r, c), o === 2 && (g = Qh(r), g !== 0 && (c = g, o = Sm(r, g))), o === 1))
            throw l = Ga, fo(r, 0), Ci(r, c), gn(r, at()), l;
          switch (r.finishedWork = h, r.finishedLanes = c, o) {
            case 0:
            case 1:
              throw Error(n(345));
            case 2:
              ho(r, mn, Ur);
              break;
            case 3:
              if (Ci(r, c), (c & 130023424) === c && (o = vm + 500 - at(), 10 < o)) {
                if (oc(r, 0) !== 0)
                  break;
                if (h = r.suspendedLanes, (h & c) !== c) {
                  cn(), r.pingedLanes |= r.suspendedLanes & h;
                  break;
                }
                r.timeoutHandle = Op(ho.bind(null, r, mn, Ur), o);
                break;
              }
              ho(r, mn, Ur);
              break;
            case 4:
              if (Ci(r, c), (c & 4194240) === c)
                break;
              for (o = r.eventTimes, h = -1; 0 < c; ) {
                var w = 31 - Zn(c);
                g = 1 << w, w = o[w], w > h && (h = w), c &= ~g;
              }
              if (c = h, c = at() - c, c = (120 > c ? 120 : 480 > c ? 480 : 1080 > c ? 1080 : 1920 > c ? 1920 : 3e3 > c ? 3e3 : 4320 > c ? 4320 : 1960 * IP(c / 1960)) - c, 10 < c) {
                r.timeoutHandle = Op(ho.bind(null, r, mn, Ur), c);
                break;
              }
              ho(r, mn, Ur);
              break;
            case 5:
              ho(r, mn, Ur);
              break;
            default:
              throw Error(n(329));
          }
        }
      }
      return gn(r, at()), r.callbackNode === l ? vE.bind(null, r) : null;
    }
    function Sm(r, o) {
      var l = qa;
      return r.current.memoizedState.isDehydrated && (fo(r, o).flags |= 256), r = Xc(r, o), r !== 2 && (o = mn, mn = l, o !== null && Em(o)), r;
    }
    function Em(r) {
      mn === null ? mn = r : mn.push.apply(mn, r);
    }
    function NP(r) {
      for (var o = r; ; ) {
        if (o.flags & 16384) {
          var l = o.updateQueue;
          if (l !== null && (l = l.stores, l !== null))
            for (var c = 0; c < l.length; c++) {
              var h = l[c], g = h.getSnapshot;
              h = h.value;
              try {
                if (!Xn(g(), h))
                  return !1;
              } catch {
                return !1;
              }
            }
        }
        if (l = o.child, o.subtreeFlags & 16384 && l !== null)
          l.return = o, o = l;
        else {
          if (o === r)
            break;
          for (; o.sibling === null; ) {
            if (o.return === null || o.return === r)
              return !0;
            o = o.return;
          }
          o.sibling.return = o.return, o = o.sibling;
        }
      }
      return !0;
    }
    function Ci(r, o) {
      for (o &= ~gm, o &= ~Wc, r.suspendedLanes |= o, r.pingedLanes &= ~o, r = r.expirationTimes; 0 < o; ) {
        var l = 31 - Zn(o), c = 1 << l;
        r[l] = -1, o &= ~c;
      }
    }
    function yE(r) {
      if (ze & 6)
        throw Error(n(327));
      Es();
      var o = oc(r, 0);
      if (!(o & 1))
        return gn(r, at()), null;
      var l = Xc(r, o);
      if (r.tag !== 0 && l === 2) {
        var c = Qh(r);
        c !== 0 && (o = c, l = Sm(r, c));
      }
      if (l === 1)
        throw l = Ga, fo(r, 0), Ci(r, o), gn(r, at()), l;
      if (l === 6)
        throw Error(n(345));
      return r.finishedWork = r.current.alternate, r.finishedLanes = o, ho(r, mn, Ur), gn(r, at()), null;
    }
    function xm(r, o) {
      var l = ze;
      ze |= 1;
      try {
        return r(o);
      } finally {
        ze = l, ze === 0 && (Ss = at() + 500, Cc && vi());
      }
    }
    function co(r) {
      xi !== null && xi.tag === 0 && !(ze & 6) && Es();
      var o = ze;
      ze |= 1;
      var l = jn.transition, c = Xe;
      try {
        if (jn.transition = null, Xe = 1, r)
          return r();
      } finally {
        Xe = c, jn.transition = l, ze = o, !(ze & 6) && vi();
      }
    }
    function bm() {
      bn = ws.current, ut(ws);
    }
    function fo(r, o) {
      r.finishedWork = null, r.finishedLanes = 0;
      var l = r.timeoutHandle;
      if (l !== -1 && (r.timeoutHandle = -1, cP(l)), At !== null)
        for (l = At.return; l !== null; ) {
          var c = l;
          switch (Pp(c), c.tag) {
            case 1:
              c = c.type.childContextTypes, c != null && xc();
              break;
            case 3:
              gs(), ut(fn), ut(Xt), qp();
              break;
            case 5:
              Wp(c);
              break;
            case 4:
              gs();
              break;
            case 13:
              ut(pt);
              break;
            case 19:
              ut(pt);
              break;
            case 10:
              Fp(c.type._context);
              break;
            case 22:
            case 23:
              bm();
          }
          l = l.return;
        }
      if (Bt = r, At = r = Ti(r.current, null), Wt = bn = o, Nt = 0, Ga = null, gm = Wc = uo = 0, mn = qa = null, so !== null) {
        for (o = 0; o < so.length; o++)
          if (l = so[o], c = l.interleaved, c !== null) {
            l.interleaved = null;
            var h = c.next, g = l.pending;
            if (g !== null) {
              var w = g.next;
              g.next = h, c.next = w;
            }
            l.pending = c;
          }
        so = null;
      }
      return r;
    }
    function wE(r, o) {
      do {
        var l = At;
        try {
          if (Mp(), Dc.current = Hc, jc) {
            for (var c = mt.memoizedState; c !== null; ) {
              var h = c.queue;
              h !== null && (h.pending = null), c = c.next;
            }
            jc = !1;
          }
          if (lo = 0, Ht = It = mt = null, Ba = !1, Ua = 0, mm.current = null, l === null || l.return === null) {
            Nt = 1, Ga = o, At = null;
            break;
          }
          e: {
            var g = r, w = l.return, b = l, _ = o;
            if (o = Wt, b.flags |= 32768, _ !== null && typeof _ == "object" && typeof _.then == "function") {
              var H = _, K = b, J = K.tag;
              if (!(K.mode & 1) && (J === 0 || J === 11 || J === 15)) {
                var Y = K.alternate;
                Y ? (K.updateQueue = Y.updateQueue, K.memoizedState = Y.memoizedState, K.lanes = Y.lanes) : (K.updateQueue = null, K.memoizedState = null);
              }
              var oe = VS(w);
              if (oe !== null) {
                oe.flags &= -257, WS(oe, w, b, g, o), oe.mode & 1 && zS(g, H, o), o = oe, _ = H;
                var le = o.updateQueue;
                if (le === null) {
                  var ue = /* @__PURE__ */ new Set();
                  ue.add(_), o.updateQueue = ue;
                } else
                  le.add(_);
                break e;
              } else {
                if (!(o & 1)) {
                  zS(g, H, o), Cm();
                  break e;
                }
                _ = Error(n(426));
              }
            } else if (dt && b.mode & 1) {
              var Ct = VS(w);
              if (Ct !== null) {
                !(Ct.flags & 65536) && (Ct.flags |= 256), WS(Ct, w, b, g, o), Dp(vs(_, b));
                break e;
              }
            }
            g = _ = vs(_, b), Nt !== 4 && (Nt = 2), qa === null ? qa = [g] : qa.push(g), g = w;
            do {
              switch (g.tag) {
                case 3:
                  g.flags |= 65536, o &= -o, g.lanes |= o;
                  var D = US(g, _, o);
                  cS(g, D);
                  break e;
                case 1:
                  b = _;
                  var A = g.type, F = g.stateNode;
                  if (!(g.flags & 128) && (typeof A.getDerivedStateFromError == "function" || F !== null && typeof F.componentDidCatch == "function" && (Ei === null || !Ei.has(F)))) {
                    g.flags |= 65536, o &= -o, g.lanes |= o;
                    var te = $S(g, b, o);
                    cS(g, te);
                    break e;
                  }
              }
              g = g.return;
            } while (g !== null);
          }
          xE(l);
        } catch (ce) {
          o = ce, At === l && l !== null && (At = l = l.return);
          continue;
        }
        break;
      } while (!0);
    }
    function SE() {
      var r = Vc.current;
      return Vc.current = Hc, r === null ? Hc : r;
    }
    function Cm() {
      (Nt === 0 || Nt === 3 || Nt === 2) && (Nt = 4), Bt === null || !(uo & 268435455) && !(Wc & 268435455) || Ci(Bt, Wt);
    }
    function Xc(r, o) {
      var l = ze;
      ze |= 2;
      var c = SE();
      (Bt !== r || Wt !== o) && (Ur = null, fo(r, o));
      do
        try {
          DP();
          break;
        } catch (h) {
          wE(r, h);
        }
      while (!0);
      if (Mp(), ze = l, Vc.current = c, At !== null)
        throw Error(n(261));
      return Bt = null, Wt = 0, Nt;
    }
    function DP() {
      for (; At !== null; )
        EE(At);
    }
    function jP() {
      for (; At !== null && !Ju(); )
        EE(At);
    }
    function EE(r) {
      var o = TE(r.alternate, r, bn);
      r.memoizedProps = r.pendingProps, o === null ? xE(r) : At = o, mm.current = null;
    }
    function xE(r) {
      var o = r;
      do {
        var l = o.alternate;
        if (r = o.return, o.flags & 32768) {
          if (l = LP(l, o), l !== null) {
            l.flags &= 32767, At = l;
            return;
          }
          if (r !== null)
            r.flags |= 32768, r.subtreeFlags = 0, r.deletions = null;
          else {
            Nt = 6, At = null;
            return;
          }
        } else if (l = RP(l, o, bn), l !== null) {
          At = l;
          return;
        }
        if (o = o.sibling, o !== null) {
          At = o;
          return;
        }
        At = o = r;
      } while (o !== null);
      Nt === 0 && (Nt = 5);
    }
    function ho(r, o, l) {
      var c = Xe, h = jn.transition;
      try {
        jn.transition = null, Xe = 1, MP(r, o, l, c);
      } finally {
        jn.transition = h, Xe = c;
      }
      return null;
    }
    function MP(r, o, l, c) {
      do
        Es();
      while (xi !== null);
      if (ze & 6)
        throw Error(n(327));
      l = r.finishedWork;
      var h = r.finishedLanes;
      if (l === null)
        return null;
      if (r.finishedWork = null, r.finishedLanes = 0, l === r.current)
        throw Error(n(177));
      r.callbackNode = null, r.callbackPriority = 0;
      var g = l.lanes | l.childLanes;
      if (vk(r, g), r === Bt && (At = Bt = null, Wt = 0), !(l.subtreeFlags & 2064) && !(l.flags & 2064) || qc || (qc = !0, OE(tc, function() {
        return Es(), null;
      })), g = (l.flags & 15990) !== 0, l.subtreeFlags & 15990 || g) {
        g = jn.transition, jn.transition = null;
        var w = Xe;
        Xe = 1;
        var b = ze;
        ze |= 4, mm.current = null, kP(r, l), fE(l, r), rP(Cp), lc = !!bp, Cp = bp = null, r.current = l, PP(l), Qu(), ze = b, Xe = w, jn.transition = g;
      } else
        r.current = l;
      if (qc && (qc = !1, xi = r, Yc = h), g = r.pendingLanes, g === 0 && (Ei = null), dk(l.stateNode), gn(r, at()), o !== null)
        for (c = r.onRecoverableError, l = 0; l < o.length; l++)
          h = o[l], c(h.value, { componentStack: h.stack, digest: h.digest });
      if (Gc)
        throw Gc = !1, r = ym, ym = null, r;
      return Yc & 1 && r.tag !== 0 && Es(), g = r.pendingLanes, g & 1 ? r === wm ? Ya++ : (Ya = 0, wm = r) : Ya = 0, vi(), null;
    }
    function Es() {
      if (xi !== null) {
        var r = uw(Yc), o = jn.transition, l = Xe;
        try {
          if (jn.transition = null, Xe = 16 > r ? 16 : r, xi === null)
            var c = !1;
          else {
            if (r = xi, xi = null, Yc = 0, ze & 6)
              throw Error(n(331));
            var h = ze;
            for (ze |= 4, se = r.current; se !== null; ) {
              var g = se, w = g.child;
              if (se.flags & 16) {
                var b = g.deletions;
                if (b !== null) {
                  for (var _ = 0; _ < b.length; _++) {
                    var H = b[_];
                    for (se = H; se !== null; ) {
                      var K = se;
                      switch (K.tag) {
                        case 0:
                        case 11:
                        case 15:
                          Wa(8, K, g);
                      }
                      var J = K.child;
                      if (J !== null)
                        J.return = K, se = J;
                      else
                        for (; se !== null; ) {
                          K = se;
                          var Y = K.sibling, oe = K.return;
                          if (aE(K), K === H) {
                            se = null;
                            break;
                          }
                          if (Y !== null) {
                            Y.return = oe, se = Y;
                            break;
                          }
                          se = oe;
                        }
                    }
                  }
                  var le = g.alternate;
                  if (le !== null) {
                    var ue = le.child;
                    if (ue !== null) {
                      le.child = null;
                      do {
                        var Ct = ue.sibling;
                        ue.sibling = null, ue = Ct;
                      } while (ue !== null);
                    }
                  }
                  se = g;
                }
              }
              if (g.subtreeFlags & 2064 && w !== null)
                w.return = g, se = w;
              else
                e:
                  for (; se !== null; ) {
                    if (g = se, g.flags & 2048)
                      switch (g.tag) {
                        case 0:
                        case 11:
                        case 15:
                          Wa(9, g, g.return);
                      }
                    var D = g.sibling;
                    if (D !== null) {
                      D.return = g.return, se = D;
                      break e;
                    }
                    se = g.return;
                  }
            }
            var A = r.current;
            for (se = A; se !== null; ) {
              w = se;
              var F = w.child;
              if (w.subtreeFlags & 2064 && F !== null)
                F.return = w, se = F;
              else
                e:
                  for (w = A; se !== null; ) {
                    if (b = se, b.flags & 2048)
                      try {
                        switch (b.tag) {
                          case 0:
                          case 11:
                          case 15:
                            zc(9, b);
                        }
                      } catch (ce) {
                        St(b, b.return, ce);
                      }
                    if (b === w) {
                      se = null;
                      break e;
                    }
                    var te = b.sibling;
                    if (te !== null) {
                      te.return = b.return, se = te;
                      break e;
                    }
                    se = b.return;
                  }
            }
            if (ze = h, vi(), mr && typeof mr.onPostCommitFiberRoot == "function")
              try {
                mr.onPostCommitFiberRoot(nc, r);
              } catch {
              }
            c = !0;
          }
          return c;
        } finally {
          Xe = l, jn.transition = o;
        }
      }
      return !1;
    }
    function bE(r, o, l) {
      o = vs(l, o), o = US(r, o, 1), r = wi(r, o, 1), o = cn(), r !== null && (ya(r, 1, o), gn(r, o));
    }
    function St(r, o, l) {
      if (r.tag === 3)
        bE(r, r, l);
      else
        for (; o !== null; ) {
          if (o.tag === 3) {
            bE(o, r, l);
            break;
          } else if (o.tag === 1) {
            var c = o.stateNode;
            if (typeof o.type.getDerivedStateFromError == "function" || typeof c.componentDidCatch == "function" && (Ei === null || !Ei.has(c))) {
              r = vs(l, r), r = $S(o, r, 1), o = wi(o, r, 1), r = cn(), o !== null && (ya(o, 1, r), gn(o, r));
              break;
            }
          }
          o = o.return;
        }
    }
    function FP(r, o, l) {
      var c = r.pingCache;
      c !== null && c.delete(o), o = cn(), r.pingedLanes |= r.suspendedLanes & l, Bt === r && (Wt & l) === l && (Nt === 4 || Nt === 3 && (Wt & 130023424) === Wt && 500 > at() - vm ? fo(r, 0) : gm |= l), gn(r, o);
    }
    function CE(r, o) {
      o === 0 && (r.mode & 1 ? (o = ic, ic <<= 1, !(ic & 130023424) && (ic = 4194304)) : o = 1);
      var l = cn();
      r = Fr(r, o), r !== null && (ya(r, o, l), gn(r, l));
    }
    function HP(r) {
      var o = r.memoizedState, l = 0;
      o !== null && (l = o.retryLane), CE(r, l);
    }
    function BP(r, o) {
      var l = 0;
      switch (r.tag) {
        case 13:
          var c = r.stateNode, h = r.memoizedState;
          h !== null && (l = h.retryLane);
          break;
        case 19:
          c = r.stateNode;
          break;
        default:
          throw Error(n(314));
      }
      c !== null && c.delete(o), CE(r, l);
    }
    var TE;
    TE = function(r, o, l) {
      if (r !== null)
        if (r.memoizedProps !== o.pendingProps || fn.current)
          pn = !0;
        else {
          if (!(r.lanes & l) && !(o.flags & 128))
            return pn = !1, _P(r, o, l);
          pn = !!(r.flags & 131072);
        }
      else
        pn = !1, dt && o.flags & 1048576 && rS(o, Oc, o.index);
      switch (o.lanes = 0, o.tag) {
        case 2:
          var c = o.type;
          Uc(r, o), r = o.pendingProps;
          var h = us(o, Xt.current);
          ps(o, l), h = Zp(null, o, c, r, h, l);
          var g = Xp();
          return o.flags |= 1, typeof h == "object" && h !== null && typeof h.render == "function" && h.$$typeof === void 0 ? (o.tag = 1, o.memoizedState = null, o.updateQueue = null, hn(c) ? (g = !0, bc(o)) : g = !1, o.memoizedState = h.state !== null && h.state !== void 0 ? h.state : null, Up(o), h.updater = Pc, o.stateNode = h, h._reactInternals = o, zp(o, c, r, l), o = om(null, o, c, !0, g, l)) : (o.tag = 0, dt && g && kp(o), un(null, o, h, l), o = o.child), o;
        case 16:
          c = o.elementType;
          e: {
            switch (Uc(r, o), r = o.pendingProps, h = c._init, c = h(c._payload), o.type = c, h = o.tag = $P(c), r = Qn(c, r), h) {
              case 0:
                o = im(null, o, c, r, l);
                break e;
              case 1:
                o = XS(null, o, c, r, l);
                break e;
              case 11:
                o = GS(null, o, c, r, l);
                break e;
              case 14:
                o = qS(null, o, c, Qn(c.type, r), l);
                break e;
            }
            throw Error(n(
              306,
              c,
              ""
            ));
          }
          return o;
        case 0:
          return c = o.type, h = o.pendingProps, h = o.elementType === c ? h : Qn(c, h), im(r, o, c, h, l);
        case 1:
          return c = o.type, h = o.pendingProps, h = o.elementType === c ? h : Qn(c, h), XS(r, o, c, h, l);
        case 3:
          e: {
            if (JS(o), r === null)
              throw Error(n(387));
            c = o.pendingProps, g = o.memoizedState, h = g.element, uS(r, o), kc(o, c, null, l);
            var w = o.memoizedState;
            if (c = w.element, g.isDehydrated)
              if (g = { element: c, isDehydrated: !1, cache: w.cache, pendingSuspenseBoundaries: w.pendingSuspenseBoundaries, transitions: w.transitions }, o.updateQueue.baseState = g, o.memoizedState = g, o.flags & 256) {
                h = vs(Error(n(423)), o), o = QS(r, o, c, l, h);
                break e;
              } else if (c !== h) {
                h = vs(Error(n(424)), o), o = QS(r, o, c, l, h);
                break e;
              } else
                for (xn = pi(o.stateNode.containerInfo.firstChild), En = o, dt = !0, Jn = null, l = yS(o, null, c, l), o.child = l; l; )
                  l.flags = l.flags & -3 | 4096, l = l.sibling;
            else {
              if (fs(), c === h) {
                o = Br(r, o, l);
                break e;
              }
              un(r, o, c, l);
            }
            o = o.child;
          }
          return o;
        case 5:
          return wS(o), r === null && Np(o), c = o.type, h = o.pendingProps, g = r !== null ? r.memoizedProps : null, w = h.children, Tp(c, h) ? w = null : g !== null && Tp(c, g) && (o.flags |= 32), ZS(r, o), un(r, o, w, l), o.child;
        case 6:
          return r === null && Np(o), null;
        case 13:
          return eE(r, o, l);
        case 4:
          return Vp(o, o.stateNode.containerInfo), c = o.pendingProps, r === null ? o.child = ms(o, null, c, l) : un(r, o, c, l), o.child;
        case 11:
          return c = o.type, h = o.pendingProps, h = o.elementType === c ? h : Qn(c, h), GS(r, o, c, h, l);
        case 7:
          return un(r, o, o.pendingProps, l), o.child;
        case 8:
          return un(r, o, o.pendingProps.children, l), o.child;
        case 12:
          return un(r, o, o.pendingProps.children, l), o.child;
        case 10:
          e: {
            if (c = o.type._context, h = o.pendingProps, g = o.memoizedProps, w = h.value, rt(Rc, c._currentValue), c._currentValue = w, g !== null)
              if (Xn(g.value, w)) {
                if (g.children === h.children && !fn.current) {
                  o = Br(r, o, l);
                  break e;
                }
              } else
                for (g = o.child, g !== null && (g.return = o); g !== null; ) {
                  var b = g.dependencies;
                  if (b !== null) {
                    w = g.child;
                    for (var _ = b.firstContext; _ !== null; ) {
                      if (_.context === c) {
                        if (g.tag === 1) {
                          _ = Hr(-1, l & -l), _.tag = 2;
                          var H = g.updateQueue;
                          if (H !== null) {
                            H = H.shared;
                            var K = H.pending;
                            K === null ? _.next = _ : (_.next = K.next, K.next = _), H.pending = _;
                          }
                        }
                        g.lanes |= l, _ = g.alternate, _ !== null && (_.lanes |= l), Hp(
                          g.return,
                          l,
                          o
                        ), b.lanes |= l;
                        break;
                      }
                      _ = _.next;
                    }
                  } else if (g.tag === 10)
                    w = g.type === o.type ? null : g.child;
                  else if (g.tag === 18) {
                    if (w = g.return, w === null)
                      throw Error(n(341));
                    w.lanes |= l, b = w.alternate, b !== null && (b.lanes |= l), Hp(w, l, o), w = g.sibling;
                  } else
                    w = g.child;
                  if (w !== null)
                    w.return = g;
                  else
                    for (w = g; w !== null; ) {
                      if (w === o) {
                        w = null;
                        break;
                      }
                      if (g = w.sibling, g !== null) {
                        g.return = w.return, w = g;
                        break;
                      }
                      w = w.return;
                    }
                  g = w;
                }
            un(r, o, h.children, l), o = o.child;
          }
          return o;
        case 9:
          return h = o.type, c = o.pendingProps.children, ps(o, l), h = Nn(h), c = c(h), o.flags |= 1, un(r, o, c, l), o.child;
        case 14:
          return c = o.type, h = Qn(c, o.pendingProps), h = Qn(c.type, h), qS(r, o, c, h, l);
        case 15:
          return YS(r, o, o.type, o.pendingProps, l);
        case 17:
          return c = o.type, h = o.pendingProps, h = o.elementType === c ? h : Qn(c, h), Uc(r, o), o.tag = 1, hn(c) ? (r = !0, bc(o)) : r = !1, ps(o, l), pS(o, c, h), zp(o, c, h, l), om(null, o, c, !0, r, l);
        case 19:
          return nE(r, o, l);
        case 22:
          return KS(r, o, l);
      }
      throw Error(n(156, o.tag));
    };
    function OE(r, o) {
      return eo(r, o);
    }
    function UP(r, o, l, c) {
      this.tag = r, this.key = l, this.sibling = this.child = this.return = this.stateNode = this.type = this.elementType = null, this.index = 0, this.ref = null, this.pendingProps = o, this.dependencies = this.memoizedState = this.updateQueue = this.memoizedProps = null, this.mode = c, this.subtreeFlags = this.flags = 0, this.deletions = null, this.childLanes = this.lanes = 0, this.alternate = null;
    }
    function Mn(r, o, l, c) {
      return new UP(r, o, l, c);
    }
    function Tm(r) {
      return r = r.prototype, !(!r || !r.isReactComponent);
    }
    function $P(r) {
      if (typeof r == "function")
        return Tm(r) ? 1 : 0;
      if (r != null) {
        if (r = r.$$typeof, r === re)
          return 11;
        if (r === be)
          return 14;
      }
      return 2;
    }
    function Ti(r, o) {
      var l = r.alternate;
      return l === null ? (l = Mn(r.tag, o, r.key, r.mode), l.elementType = r.elementType, l.type = r.type, l.stateNode = r.stateNode, l.alternate = r, r.alternate = l) : (l.pendingProps = o, l.type = r.type, l.flags = 0, l.subtreeFlags = 0, l.deletions = null), l.flags = r.flags & 14680064, l.childLanes = r.childLanes, l.lanes = r.lanes, l.child = r.child, l.memoizedProps = r.memoizedProps, l.memoizedState = r.memoizedState, l.updateQueue = r.updateQueue, o = r.dependencies, l.dependencies = o === null ? null : { lanes: o.lanes, firstContext: o.firstContext }, l.sibling = r.sibling, l.index = r.index, l.ref = r.ref, l;
    }
    function Jc(r, o, l, c, h, g) {
      var w = 2;
      if (c = r, typeof r == "function")
        Tm(r) && (w = 1);
      else if (typeof r == "string")
        w = 5;
      else
        e:
          switch (r) {
            case R:
              return po(l.children, h, g, o);
            case j:
              w = 8, h |= 8;
              break;
            case G:
              return r = Mn(12, l, o, h | 2), r.elementType = G, r.lanes = g, r;
            case we:
              return r = Mn(13, l, o, h), r.elementType = we, r.lanes = g, r;
            case ye:
              return r = Mn(19, l, o, h), r.elementType = ye, r.lanes = g, r;
            case ge:
              return Qc(l, h, g, o);
            default:
              if (typeof r == "object" && r !== null)
                switch (r.$$typeof) {
                  case ee:
                    w = 10;
                    break e;
                  case W:
                    w = 9;
                    break e;
                  case re:
                    w = 11;
                    break e;
                  case be:
                    w = 14;
                    break e;
                  case Be:
                    w = 16, c = null;
                    break e;
                }
              throw Error(n(130, r == null ? r : typeof r, ""));
          }
      return o = Mn(w, l, o, h), o.elementType = r, o.type = c, o.lanes = g, o;
    }
    function po(r, o, l, c) {
      return r = Mn(7, r, c, o), r.lanes = l, r;
    }
    function Qc(r, o, l, c) {
      return r = Mn(22, r, c, o), r.elementType = ge, r.lanes = l, r.stateNode = { isHidden: !1 }, r;
    }
    function Om(r, o, l) {
      return r = Mn(6, r, null, o), r.lanes = l, r;
    }
    function _m(r, o, l) {
      return o = Mn(4, r.children !== null ? r.children : [], r.key, o), o.lanes = l, o.stateNode = { containerInfo: r.containerInfo, pendingChildren: null, implementation: r.implementation }, o;
    }
    function zP(r, o, l, c, h) {
      this.tag = o, this.containerInfo = r, this.finishedWork = this.pingCache = this.current = this.pendingChildren = null, this.timeoutHandle = -1, this.callbackNode = this.pendingContext = this.context = null, this.callbackPriority = 0, this.eventTimes = ep(0), this.expirationTimes = ep(-1), this.entangledLanes = this.finishedLanes = this.mutableReadLanes = this.expiredLanes = this.pingedLanes = this.suspendedLanes = this.pendingLanes = 0, this.entanglements = ep(0), this.identifierPrefix = c, this.onRecoverableError = h, this.mutableSourceEagerHydrationData = null;
    }
    function Rm(r, o, l, c, h, g, w, b, _) {
      return r = new zP(r, o, l, b, _), o === 1 ? (o = 1, g === !0 && (o |= 8)) : o = 0, g = Mn(3, null, null, o), r.current = g, g.stateNode = r, g.memoizedState = { element: c, isDehydrated: l, cache: null, transitions: null, pendingSuspenseBoundaries: null }, Up(g), r;
    }
    function VP(r, o, l) {
      var c = 3 < arguments.length && arguments[3] !== void 0 ? arguments[3] : null;
      return { $$typeof: P, key: c == null ? null : "" + c, children: r, containerInfo: o, implementation: l };
    }
    function _E(r) {
      if (!r)
        return gi;
      r = r._reactInternals;
      e: {
        if (pr(r) !== r || r.tag !== 1)
          throw Error(n(170));
        var o = r;
        do {
          switch (o.tag) {
            case 3:
              o = o.stateNode.context;
              break e;
            case 1:
              if (hn(o.type)) {
                o = o.stateNode.__reactInternalMemoizedMergedChildContext;
                break e;
              }
          }
          o = o.return;
        } while (o !== null);
        throw Error(n(171));
      }
      if (r.tag === 1) {
        var l = r.type;
        if (hn(l))
          return eS(r, l, o);
      }
      return o;
    }
    function RE(r, o, l, c, h, g, w, b, _) {
      return r = Rm(l, c, !0, r, h, g, w, b, _), r.context = _E(null), l = r.current, c = cn(), h = bi(l), g = Hr(c, h), g.callback = o ?? null, wi(l, g, h), r.current.lanes = h, ya(r, h, c), gn(r, c), r;
    }
    function ed(r, o, l, c) {
      var h = o.current, g = cn(), w = bi(h);
      return l = _E(l), o.context === null ? o.context = l : o.pendingContext = l, o = Hr(g, w), o.payload = { element: r }, c = c === void 0 ? null : c, c !== null && (o.callback = c), r = wi(h, o, w), r !== null && (nr(r, h, w, g), Ac(r, h, w)), w;
    }
    function td(r) {
      if (r = r.current, !r.child)
        return null;
      switch (r.child.tag) {
        case 5:
          return r.child.stateNode;
        default:
          return r.child.stateNode;
      }
    }
    function LE(r, o) {
      if (r = r.memoizedState, r !== null && r.dehydrated !== null) {
        var l = r.retryLane;
        r.retryLane = l !== 0 && l < o ? l : o;
      }
    }
    function Lm(r, o) {
      LE(r, o), (r = r.alternate) && LE(r, o);
    }
    function WP() {
      return null;
    }
    var AE = typeof reportError == "function" ? reportError : function(r) {
      console.error(r);
    };
    function Am(r) {
      this._internalRoot = r;
    }
    nd.prototype.render = Am.prototype.render = function(r) {
      var o = this._internalRoot;
      if (o === null)
        throw Error(n(409));
      ed(r, o, null, null);
    }, nd.prototype.unmount = Am.prototype.unmount = function() {
      var r = this._internalRoot;
      if (r !== null) {
        this._internalRoot = null;
        var o = r.containerInfo;
        co(function() {
          ed(null, r, null, null);
        }), o[Nr] = null;
      }
    };
    function nd(r) {
      this._internalRoot = r;
    }
    nd.prototype.unstable_scheduleHydration = function(r) {
      if (r) {
        var o = fw();
        r = { blockedOn: null, target: r, priority: o };
        for (var l = 0; l < di.length && o !== 0 && o < di[l].priority; l++)
          ;
        di.splice(l, 0, r), l === 0 && mw(r);
      }
    };
    function km(r) {
      return !(!r || r.nodeType !== 1 && r.nodeType !== 9 && r.nodeType !== 11);
    }
    function rd(r) {
      return !(!r || r.nodeType !== 1 && r.nodeType !== 9 && r.nodeType !== 11 && (r.nodeType !== 8 || r.nodeValue !== " react-mount-point-unstable "));
    }
    function kE() {
    }
    function GP(r, o, l, c, h) {
      if (h) {
        if (typeof c == "function") {
          var g = c;
          c = function() {
            var H = td(w);
            g.call(H);
          };
        }
        var w = RE(o, c, r, 0, null, !1, !1, "", kE);
        return r._reactRootContainer = w, r[Nr] = w.current, Pa(r.nodeType === 8 ? r.parentNode : r), co(), w;
      }
      for (; h = r.lastChild; )
        r.removeChild(h);
      if (typeof c == "function") {
        var b = c;
        c = function() {
          var H = td(_);
          b.call(H);
        };
      }
      var _ = Rm(r, 0, !1, null, null, !1, !1, "", kE);
      return r._reactRootContainer = _, r[Nr] = _.current, Pa(r.nodeType === 8 ? r.parentNode : r), co(function() {
        ed(o, _, l, c);
      }), _;
    }
    function id(r, o, l, c, h) {
      var g = l._reactRootContainer;
      if (g) {
        var w = g;
        if (typeof h == "function") {
          var b = h;
          h = function() {
            var _ = td(w);
            b.call(_);
          };
        }
        ed(o, w, r, h);
      } else
        w = GP(l, o, r, h, c);
      return td(w);
    }
    cw = function(r) {
      switch (r.tag) {
        case 3:
          var o = r.stateNode;
          if (o.current.memoizedState.isDehydrated) {
            var l = va(o.pendingLanes);
            l !== 0 && (tp(o, l | 1), gn(o, at()), !(ze & 6) && (Ss = at() + 500, vi()));
          }
          break;
        case 13:
          co(function() {
            var c = Fr(r, 1);
            if (c !== null) {
              var h = cn();
              nr(c, r, 1, h);
            }
          }), Lm(r, 1);
      }
    }, np = function(r) {
      if (r.tag === 13) {
        var o = Fr(r, 134217728);
        if (o !== null) {
          var l = cn();
          nr(o, r, 134217728, l);
        }
        Lm(r, 134217728);
      }
    }, dw = function(r) {
      if (r.tag === 13) {
        var o = bi(r), l = Fr(r, o);
        if (l !== null) {
          var c = cn();
          nr(l, r, o, c);
        }
        Lm(r, o);
      }
    }, fw = function() {
      return Xe;
    }, hw = function(r, o) {
      var l = Xe;
      try {
        return Xe = r, o();
      } finally {
        Xe = l;
      }
    }, Fe = function(r, o, l) {
      switch (o) {
        case "input":
          if (dr(r, l), o = l.name, l.type === "radio" && o != null) {
            for (l = r; l.parentNode; )
              l = l.parentNode;
            for (l = l.querySelectorAll("input[name=" + JSON.stringify("" + o) + '][type="radio"]'), o = 0; o < l.length; o++) {
              var c = l[o];
              if (c !== r && c.form === r.form) {
                var h = Ec(c);
                if (!h)
                  throw Error(n(90));
                xt(c), dr(c, h);
              }
            }
          }
          break;
        case "textarea":
          An(r, l);
          break;
        case "select":
          o = l.value, o != null && Ln(r, !!l.multiple, o, !1);
      }
    }, an = xm, Pr = co;
    var qP = { usingClientEntryPoint: !1, Events: [Da, as, Ec, Re, $e, xm] }, Ka = { findFiberByHostInstance: no, bundleType: 0, version: "18.2.0", rendererPackageName: "react-dom" }, YP = { bundleType: Ka.bundleType, version: Ka.version, rendererPackageName: Ka.rendererPackageName, rendererConfig: Ka.rendererConfig, overrideHookState: null, overrideHookStateDeletePath: null, overrideHookStateRenamePath: null, overrideProps: null, overridePropsDeletePath: null, overridePropsRenamePath: null, setErrorHandler: null, setSuspenseHandler: null, scheduleUpdate: null, currentDispatcherRef: B.ReactCurrentDispatcher, findHostInstanceByFiber: function(r) {
      return r = si(r), r === null ? null : r.stateNode;
    }, findFiberByHostInstance: Ka.findFiberByHostInstance || WP, findHostInstancesForRefresh: null, scheduleRefresh: null, scheduleRoot: null, setRefreshHandler: null, getCurrentFiber: null, reconcilerVersion: "18.2.0-next-9e3b772b8-20220608" };
    if (typeof __REACT_DEVTOOLS_GLOBAL_HOOK__ < "u") {
      var od = __REACT_DEVTOOLS_GLOBAL_HOOK__;
      if (!od.isDisabled && od.supportsFiber)
        try {
          nc = od.inject(YP), mr = od;
        } catch {
        }
    }
    return dn.__SECRET_INTERNALS_DO_NOT_USE_OR_YOU_WILL_BE_FIRED = qP, dn.createPortal = function(r, o) {
      var l = 2 < arguments.length && arguments[2] !== void 0 ? arguments[2] : null;
      if (!km(o))
        throw Error(n(200));
      return VP(r, o, null, l);
    }, dn.createRoot = function(r, o) {
      if (!km(r))
        throw Error(n(299));
      var l = !1, c = "", h = AE;
      return o != null && (o.unstable_strictMode === !0 && (l = !0), o.identifierPrefix !== void 0 && (c = o.identifierPrefix), o.onRecoverableError !== void 0 && (h = o.onRecoverableError)), o = Rm(r, 1, !1, null, null, l, !1, c, h), r[Nr] = o.current, Pa(r.nodeType === 8 ? r.parentNode : r), new Am(o);
    }, dn.findDOMNode = function(r) {
      if (r == null)
        return null;
      if (r.nodeType === 1)
        return r;
      var o = r._reactInternals;
      if (o === void 0)
        throw typeof r.render == "function" ? Error(n(188)) : (r = Object.keys(r).join(","), Error(n(268, r)));
      return r = si(o), r = r === null ? null : r.stateNode, r;
    }, dn.flushSync = function(r) {
      return co(r);
    }, dn.hydrate = function(r, o, l) {
      if (!rd(o))
        throw Error(n(200));
      return id(null, r, o, !0, l);
    }, dn.hydrateRoot = function(r, o, l) {
      if (!km(r))
        throw Error(n(405));
      var c = l != null && l.hydratedSources || null, h = !1, g = "", w = AE;
      if (l != null && (l.unstable_strictMode === !0 && (h = !0), l.identifierPrefix !== void 0 && (g = l.identifierPrefix), l.onRecoverableError !== void 0 && (w = l.onRecoverableError)), o = RE(o, null, r, 1, l ?? null, h, !1, g, w), r[Nr] = o.current, Pa(r), c)
        for (r = 0; r < c.length; r++)
          l = c[r], h = l._getVersion, h = h(l._source), o.mutableSourceEagerHydrationData == null ? o.mutableSourceEagerHydrationData = [l, h] : o.mutableSourceEagerHydrationData.push(
            l,
            h
          );
      return new nd(o);
    }, dn.render = function(r, o, l) {
      if (!rd(o))
        throw Error(n(200));
      return id(null, r, o, !1, l);
    }, dn.unmountComponentAtNode = function(r) {
      if (!rd(r))
        throw Error(n(40));
      return r._reactRootContainer ? (co(function() {
        id(null, null, r, !1, function() {
          r._reactRootContainer = null, r[Nr] = null;
        });
      }), !0) : !1;
    }, dn.unstable_batchedUpdates = xm, dn.unstable_renderSubtreeIntoContainer = function(r, o, l, c) {
      if (!rd(l))
        throw Error(n(200));
      if (r == null || r._reactInternals === void 0)
        throw Error(n(38));
      return id(r, o, l, !1, c);
    }, dn.version = "18.2.0-next-9e3b772b8-20220608", dn;
  }
  function Wg() {
    if (!(typeof __REACT_DEVTOOLS_GLOBAL_HOOK__ > "u" || typeof __REACT_DEVTOOLS_GLOBAL_HOOK__.checkDCE != "function"))
      try {
        __REACT_DEVTOOLS_GLOBAL_HOOK__.checkDCE(Wg);
      } catch (t) {
        console.error(t);
      }
  }
  Wg(), Ug.exports = Kb();
  var Ld = Ug.exports;
  const Zb = /* @__PURE__ */ Ym(Ld);
  var Xb = /* @__PURE__ */ Jb() ? N.useLayoutEffect : N.useEffect;
  function Jb() {
    return !!(typeof window < "u" && window.document && window.document.createElement);
  }
  function Qb() {
    var t = N.useState(/* @__PURE__ */ Object.create(null)), e = t[1];
    return N.useCallback(function() {
      e(/* @__PURE__ */ Object.create(null));
    }, []);
  }
  var eC = function(e) {
    var n = e.children, i = e.type, s = i === void 0 ? "reach-portal" : i, a = N.useRef(null), u = N.useRef(null), d = Qb();
    return Xb(function() {
      if (a.current) {
        var f = a.current.ownerDocument;
        return u.current = f == null ? void 0 : f.createElement(s), f.body.appendChild(u.current), d(), function() {
          u.current && u.current.ownerDocument && u.current.ownerDocument.body.removeChild(u.current);
        };
      }
    }, [s, d]), u.current ? /* @__PURE__ */ Ld.createPortal(n, u.current) : /* @__PURE__ */ N.createElement("span", {
      ref: a
    });
  };
  /*! *****************************************************************************
  Copyright (c) Microsoft Corporation.
  
  Permission to use, copy, modify, and/or distribute this software for any
  purpose with or without fee is hereby granted.
  
  THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
  REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
  AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
  INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
  LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
  OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
  PERFORMANCE OF THIS SOFTWARE.
  ***************************************************************************** */
  var ie = function() {
    return ie = Object.assign || function(e) {
      for (var n, i = 1, s = arguments.length; i < s; i++) {
        n = arguments[i];
        for (var a in n)
          Object.prototype.hasOwnProperty.call(n, a) && (e[a] = n[a]);
      }
      return e;
    }, ie.apply(this, arguments);
  };
  function Ad(t, e) {
    var n = {};
    for (var i in t)
      Object.prototype.hasOwnProperty.call(t, i) && e.indexOf(i) < 0 && (n[i] = t[i]);
    if (t != null && typeof Object.getOwnPropertySymbols == "function")
      for (var s = 0, i = Object.getOwnPropertySymbols(t); s < i.length; s++)
        e.indexOf(i[s]) < 0 && Object.prototype.propertyIsEnumerable.call(t, i[s]) && (n[i[s]] = t[i[s]]);
    return n;
  }
  function je(t) {
    var e = typeof Symbol == "function" && Symbol.iterator, n = e && t[e], i = 0;
    if (n)
      return n.call(t);
    if (t && typeof t.length == "number")
      return {
        next: function() {
          return t && i >= t.length && (t = void 0), { value: t && t[i++], done: !t };
        }
      };
    throw new TypeError(e ? "Object is not iterable." : "Symbol.iterator is not defined.");
  }
  function Ve(t, e) {
    var n = typeof Symbol == "function" && t[Symbol.iterator];
    if (!n)
      return t;
    var i = n.call(t), s, a = [], u;
    try {
      for (; (e === void 0 || e-- > 0) && !(s = i.next()).done; )
        a.push(s.value);
    } catch (d) {
      u = { error: d };
    } finally {
      try {
        s && !s.done && (n = i.return) && n.call(i);
      } finally {
        if (u)
          throw u.error;
      }
    }
    return a;
  }
  function it(t, e, n) {
    if (n || arguments.length === 2)
      for (var i = 0, s = e.length, a; i < s; i++)
        (a || !(i in e)) && (a || (a = Array.prototype.slice.call(e, 0, i)), a[i] = e[i]);
    return t.concat(a || Array.prototype.slice.call(e));
  }
  var Je;
  (function(t) {
    t.Start = "xstate.start", t.Stop = "xstate.stop", t.Raise = "xstate.raise", t.Send = "xstate.send", t.Cancel = "xstate.cancel", t.NullEvent = "", t.Assign = "xstate.assign", t.After = "xstate.after", t.DoneState = "done.state", t.DoneInvoke = "done.invoke", t.Log = "xstate.log", t.Init = "xstate.init", t.Invoke = "xstate.invoke", t.ErrorExecution = "error.execution", t.ErrorCommunication = "error.communication", t.ErrorPlatform = "error.platform", t.ErrorCustom = "xstate.error", t.Update = "xstate.update", t.Pure = "xstate.pure", t.Choose = "xstate.choose";
  })(Je || (Je = {}));
  var So;
  (function(t) {
    t.Parent = "#_parent", t.Internal = "#_internal";
  })(So || (So = {}));
  var kd = Je.Start, Pd = Je.Stop, Rs = Je.Raise, wl = Je.Send, Gg = Je.Cancel, tC = Je.NullEvent, Id = Je.Assign;
  Je.After, Je.DoneState;
  var qg = Je.Log, nC = Je.Init, Nd = Je.Invoke;
  Je.ErrorExecution;
  var Yg = Je.ErrorPlatform, rC = Je.ErrorCustom, Kg = Je.Update, iC = Je.Choose, oC = Je.Pure, Zg = ".", Xg = {}, Dd = "xstate.guard", sC = "", Sl;
  function jd(t, e, n) {
    n === void 0 && (n = Zg);
    var i = Ls(t, n), s = Ls(e, n);
    return Ye(s) ? Ye(i) ? s === i : !1 : Ye(i) ? i in s : Object.keys(i).every(function(a) {
      return a in s ? jd(i[a], s[a]) : !1;
    });
  }
  function Jg(t) {
    try {
      return Ye(t) || typeof t == "number" ? "".concat(t) : t.type;
    } catch {
      throw new Error("Events must be strings or objects with a string event.type property.");
    }
  }
  function Md(t, e) {
    try {
      return Eo(t) ? t : t.toString().split(e);
    } catch {
      throw new Error("'".concat(t, "' is not a valid state path."));
    }
  }
  function aC(t) {
    return typeof t == "object" && "value" in t && "context" in t && "event" in t && "_event" in t;
  }
  function Ls(t, e) {
    if (aC(t))
      return t.value;
    if (Eo(t))
      return El(t);
    if (typeof t != "string")
      return t;
    var n = Md(t, e);
    return El(n);
  }
  function El(t) {
    if (t.length === 1)
      return t[0];
    for (var e = {}, n = e, i = 0; i < t.length - 1; i++)
      i === t.length - 2 ? n[t[i]] = t[i + 1] : (n[t[i]] = {}, n = n[t[i]]);
    return e;
  }
  function As(t, e) {
    for (var n = {}, i = Object.keys(t), s = 0; s < i.length; s++) {
      var a = i[s];
      n[a] = e(t[a], a, t, s);
    }
    return n;
  }
  function Qg(t, e, n) {
    var i, s, a = {};
    try {
      for (var u = je(Object.keys(t)), d = u.next(); !d.done; d = u.next()) {
        var f = d.value, p = t[f];
        n(p) && (a[f] = e(p, f, t));
      }
    } catch (m) {
      i = {
        error: m
      };
    } finally {
      try {
        d && !d.done && (s = u.return) && s.call(u);
      } finally {
        if (i)
          throw i.error;
      }
    }
    return a;
  }
  var lC = function(t) {
    return function(e) {
      var n, i, s = e;
      try {
        for (var a = je(t), u = a.next(); !u.done; u = a.next()) {
          var d = u.value;
          s = s[d];
        }
      } catch (f) {
        n = {
          error: f
        };
      } finally {
        try {
          u && !u.done && (i = a.return) && i.call(a);
        } finally {
          if (n)
            throw n.error;
        }
      }
      return s;
    };
  };
  function uC(t, e) {
    return function(n) {
      var i, s, a = n;
      try {
        for (var u = je(t), d = u.next(); !d.done; d = u.next()) {
          var f = d.value;
          a = a[e][f];
        }
      } catch (p) {
        i = {
          error: p
        };
      } finally {
        try {
          d && !d.done && (s = u.return) && s.call(u);
        } finally {
          if (i)
            throw i.error;
        }
      }
      return a;
    };
  }
  function xl(t) {
    if (!t)
      return [[]];
    if (Ye(t))
      return [[t]];
    var e = ft(Object.keys(t).map(function(n) {
      var i = t[n];
      return typeof i != "string" && (!i || !Object.keys(i).length) ? [[n]] : xl(t[n]).map(function(s) {
        return [n].concat(s);
      });
    }));
    return e;
  }
  function ft(t) {
    var e;
    return (e = []).concat.apply(e, it([], Ve(t), !1));
  }
  function ev(t) {
    return Eo(t) ? t : [t];
  }
  function Un(t) {
    return t === void 0 ? [] : ev(t);
  }
  function bl(t, e, n) {
    var i, s;
    if (qe(t))
      return t(e, n.data);
    var a = {};
    try {
      for (var u = je(Object.keys(t)), d = u.next(); !d.done; d = u.next()) {
        var f = d.value, p = t[f];
        qe(p) ? a[f] = p(e, n.data) : a[f] = p;
      }
    } catch (m) {
      i = {
        error: m
      };
    } finally {
      try {
        d && !d.done && (s = u.return) && s.call(u);
      } finally {
        if (i)
          throw i.error;
      }
    }
    return a;
  }
  function cC(t) {
    return /^(done|error)\./.test(t);
  }
  function tv(t) {
    return !!(t instanceof Promise || t !== null && (qe(t) || typeof t == "object") && qe(t.then));
  }
  function dC(t) {
    return t !== null && typeof t == "object" && "transition" in t && typeof t.transition == "function";
  }
  function fC(t, e) {
    var n, i, s = Ve([[], []], 2), a = s[0], u = s[1];
    try {
      for (var d = je(t), f = d.next(); !f.done; f = d.next()) {
        var p = f.value;
        e(p) ? a.push(p) : u.push(p);
      }
    } catch (m) {
      n = {
        error: m
      };
    } finally {
      try {
        f && !f.done && (i = d.return) && i.call(d);
      } finally {
        if (n)
          throw n.error;
      }
    }
    return [a, u];
  }
  function nv(t, e) {
    return As(t.states, function(n, i) {
      if (n) {
        var s = (Ye(e) ? void 0 : e[i]) || (n ? n.current : void 0);
        if (s)
          return {
            current: s,
            states: nv(n, s)
          };
      }
    });
  }
  function hC(t, e) {
    return {
      current: e,
      states: nv(t, e)
    };
  }
  function rv(t, e, n, i) {
    var s = t && n.reduce(function(a, u) {
      var d, f, p = u.assignment, m = {
        state: i,
        action: u,
        _event: e
      }, v = {};
      if (qe(p))
        v = p(a, e.data, m);
      else
        try {
          for (var y = je(Object.keys(p)), E = y.next(); !E.done; E = y.next()) {
            var S = E.value, x = p[S];
            v[S] = qe(x) ? x(a, e.data, m) : x;
          }
        } catch (C) {
          d = {
            error: C
          };
        } finally {
          try {
            E && !E.done && (f = y.return) && f.call(y);
          } finally {
            if (d)
              throw d.error;
          }
        }
      return Object.assign({}, a, v);
    }, t);
    return s;
  }
  var pC = function() {
  };
  function Eo(t) {
    return Array.isArray(t);
  }
  function qe(t) {
    return typeof t == "function";
  }
  function Ye(t) {
    return typeof t == "string";
  }
  function iv(t, e) {
    if (t)
      return Ye(t) ? {
        type: Dd,
        name: t,
        predicate: e ? e[t] : void 0
      } : qe(t) ? {
        type: Dd,
        name: t.name,
        predicate: t
      } : t;
  }
  function mC(t) {
    try {
      return "subscribe" in t && qe(t.subscribe);
    } catch {
      return !1;
    }
  }
  var $r = /* @__PURE__ */ function() {
    return typeof Symbol == "function" && Symbol.observable || "@@observable";
  }();
  Sl = {}, Sl[$r] = function() {
    return this;
  }, Sl[Symbol.observable] = function() {
    return this;
  };
  function xo(t) {
    return !!t && "__xstatenode" in t;
  }
  function gC(t) {
    return !!t && typeof t.send == "function";
  }
  function Cl(t, e) {
    return Ye(t) || typeof t == "number" ? ie({
      type: t
    }, e) : t;
  }
  function $t(t, e) {
    if (!Ye(t) && "$$type" in t && t.$$type === "scxml")
      return t;
    var n = Cl(t);
    return ie({
      name: n.type,
      data: n,
      $$type: "scxml",
      type: "external"
    }, e);
  }
  function bo(t, e) {
    var n = ev(e).map(function(i) {
      return typeof i > "u" || typeof i == "string" || xo(i) ? {
        target: i,
        event: t
      } : ie(ie({}, i), {
        event: t
      });
    });
    return n;
  }
  function vC(t) {
    if (!(t === void 0 || t === sC))
      return Un(t);
  }
  function ov(t, e, n, i, s) {
    var a = t.options.guards, u = {
      state: s,
      cond: e,
      _event: i
    };
    if (e.type === Dd)
      return ((a == null ? void 0 : a[e.name]) || e.predicate)(n, i.data, u);
    var d = a == null ? void 0 : a[e.type];
    if (!d)
      throw new Error("Guard '".concat(e.type, "' is not implemented on machine '").concat(t.id, "'."));
    return d(n, i.data, u);
  }
  function sv(t) {
    return typeof t == "string" ? {
      type: t
    } : t;
  }
  function Tl(t, e, n) {
    var i = function() {
    }, s = typeof t == "object", a = s ? t : null;
    return {
      next: ((s ? t.next : t) || i).bind(a),
      error: ((s ? t.error : e) || i).bind(a),
      complete: ((s ? t.complete : n) || i).bind(a)
    };
  }
  function Ol(t, e) {
    return "".concat(t, ":invocation[").concat(e, "]");
  }
  function Fd(t) {
    return (t.type === Rs || t.type === wl && t.to === So.Internal) && typeof t.delay != "number";
  }
  var Co = /* @__PURE__ */ $t({
    type: nC
  });
  function Hd(t, e) {
    return e && e[t] || void 0;
  }
  function ks(t, e) {
    var n;
    if (Ye(t) || typeof t == "number") {
      var i = Hd(t, e);
      qe(i) ? n = {
        type: t,
        exec: i
      } : i ? n = i : n = {
        type: t,
        exec: void 0
      };
    } else if (qe(t))
      n = {
        // Convert action to string if unnamed
        type: t.name || t.toString(),
        exec: t
      };
    else {
      var i = Hd(t.type, e);
      if (qe(i))
        n = ie(ie({}, t), {
          exec: i
        });
      else if (i) {
        var s = i.type || t.type;
        n = ie(ie(ie({}, i), t), {
          type: s
        });
      } else
        n = t;
    }
    return n;
  }
  var zr = function(t, e) {
    if (!t)
      return [];
    var n = Eo(t) ? t : [t];
    return n.map(function(i) {
      return ks(i, e);
    });
  };
  function Bd(t) {
    var e = ks(t);
    return ie(ie({
      id: Ye(t) ? t : e.id
    }, e), {
      type: e.type
    });
  }
  function yC(t, e) {
    return {
      type: Rs,
      event: typeof t == "function" ? t : Cl(t),
      delay: e ? e.delay : void 0,
      id: e == null ? void 0 : e.id
    };
  }
  function wC(t, e, n, i) {
    var s = {
      _event: n
    }, a = $t(qe(t.event) ? t.event(e, n.data, s) : t.event), u;
    if (Ye(t.delay)) {
      var d = i && i[t.delay];
      u = qe(d) ? d(e, n.data, s) : d;
    } else
      u = qe(t.delay) ? t.delay(e, n.data, s) : t.delay;
    return ie(ie({}, t), {
      type: Rs,
      _event: a,
      delay: u
    });
  }
  function SC(t, e) {
    return {
      to: e ? e.to : void 0,
      type: wl,
      event: qe(t) ? t : Cl(t),
      delay: e ? e.delay : void 0,
      // TODO: don't auto-generate IDs here like that
      // there is too big chance of the ID collision
      id: e && e.id !== void 0 ? e.id : qe(t) ? t.name : Jg(t)
    };
  }
  function EC(t, e, n, i) {
    var s = {
      _event: n
    }, a = $t(qe(t.event) ? t.event(e, n.data, s) : t.event), u;
    if (Ye(t.delay)) {
      var d = i && i[t.delay];
      u = qe(d) ? d(e, n.data, s) : d;
    } else
      u = qe(t.delay) ? t.delay(e, n.data, s) : t.delay;
    var f = qe(t.to) ? t.to(e, n.data, s) : t.to;
    return ie(ie({}, t), {
      to: f,
      _event: a,
      event: a.data,
      delay: u
    });
  }
  var xC = function(t, e, n) {
    return ie(ie({}, t), {
      value: Ye(t.expr) ? t.expr : t.expr(e, n.data, {
        _event: n
      })
    });
  }, bC = function(t) {
    return {
      type: Gg,
      sendId: t
    };
  };
  function CC(t) {
    var e = Bd(t);
    return {
      type: Je.Start,
      activity: e,
      exec: void 0
    };
  }
  function TC(t) {
    var e = qe(t) ? t : Bd(t);
    return {
      type: Je.Stop,
      activity: e,
      exec: void 0
    };
  }
  function OC(t, e, n) {
    var i = qe(t.activity) ? t.activity(e, n.data) : t.activity, s = typeof i == "string" ? {
      id: i
    } : i, a = {
      type: Je.Stop,
      activity: s
    };
    return a;
  }
  var _C = function(t) {
    return {
      type: Id,
      assignment: t
    };
  };
  function RC(t, e) {
    var n = e ? "#".concat(e) : "";
    return "".concat(Je.After, "(").concat(t, ")").concat(n);
  }
  function _l(t, e) {
    var n = "".concat(Je.DoneState, ".").concat(t), i = {
      type: n,
      data: e
    };
    return i.toString = function() {
      return n;
    }, i;
  }
  function Rl(t, e) {
    var n = "".concat(Je.DoneInvoke, ".").concat(t), i = {
      type: n,
      data: e
    };
    return i.toString = function() {
      return n;
    }, i;
  }
  function Ps(t, e) {
    var n = "".concat(Je.ErrorPlatform, ".").concat(t), i = {
      type: n,
      data: e
    };
    return i.toString = function() {
      return n;
    }, i;
  }
  var LC = function(t) {
    var e, n, i = [];
    try {
      for (var s = je(t), a = s.next(); !a.done; a = s.next())
        for (var u = a.value, d = 0; d < u.actions.length; ) {
          if (u.actions[d].type === Id) {
            i.push(u.actions[d]), u.actions.splice(d, 1);
            continue;
          }
          d++;
        }
    } catch (f) {
      e = {
        error: f
      };
    } finally {
      try {
        a && !a.done && (n = s.return) && n.call(s);
      } finally {
        if (e)
          throw e.error;
      }
    }
    return i;
  };
  function Ll(t, e, n, i, s, a, u) {
    u === void 0 && (u = !1);
    var d = u ? [] : LC(s), f = d.length ? rv(n, i, d, e) : n, p = u ? [n] : void 0, m = [];
    function v(S, x) {
      var C;
      switch (x.type) {
        case Rs: {
          var L = wC(x, f, i, t.options.delays);
          return a && typeof L.delay == "number" && a(L, f, i), L;
        }
        case wl:
          var k = EC(x, f, i, t.options.delays);
          return a && k.to !== So.Internal && (S === "entry" ? m.push(k) : a(k, f, i)), k;
        case qg: {
          var I = xC(x, f, i);
          return a == null || a(I, f, i), I;
        }
        case iC: {
          var B = x, V = (C = B.conds.find(function(Be) {
            var ge = iv(Be.cond, t.options.guards);
            return !ge || ov(t, ge, f, i, a ? void 0 : e);
          })) === null || C === void 0 ? void 0 : C.actions;
          if (!V)
            return [];
          var P = Ve(Ll(t, e, f, i, [{
            type: S,
            actions: zr(Un(V), t.options.actions)
          }], a, u), 2), R = P[0], j = P[1];
          return f = j, p == null || p.push(f), R;
        }
        case oC: {
          var V = x.get(f, i.data);
          if (!V)
            return [];
          var G = Ve(Ll(t, e, f, i, [{
            type: S,
            actions: zr(Un(V), t.options.actions)
          }], a, u), 2), ee = G[0], W = G[1];
          return f = W, p == null || p.push(f), ee;
        }
        case Pd: {
          var I = OC(x, f, i);
          return a == null || a(I, n, i), I;
        }
        case Id: {
          f = rv(f, i, [x], a ? void 0 : e), p == null || p.push(f);
          break;
        }
        default:
          var re = ks(x, t.options.actions), we = re.exec;
          if (a)
            a(re, f, i);
          else if (we && p) {
            var ye = p.length - 1, be = ie(ie({}, re), {
              exec: function(Be) {
                for (var ge = [], q = 1; q < arguments.length; q++)
                  ge[q - 1] = arguments[q];
                we.apply(void 0, it([p[ye]], Ve(ge), !1));
              }
            });
            re = be;
          }
          return re;
      }
    }
    function y(S) {
      var x, C, L = [];
      try {
        for (var k = je(S.actions), I = k.next(); !I.done; I = k.next()) {
          var B = I.value, V = v(S.type, B);
          V && (L = L.concat(V));
        }
      } catch (P) {
        x = {
          error: P
        };
      } finally {
        try {
          I && !I.done && (C = k.return) && C.call(k);
        } finally {
          if (x)
            throw x.error;
        }
      }
      return m.forEach(function(P) {
        a(P, f, i);
      }), m.length = 0, L;
    }
    var E = ft(s.map(y));
    return [E, f];
  }
  var To = function(t, e) {
    var n = e(t);
    return n;
  };
  function av(t) {
    var e;
    return e = {
      id: t,
      send: function() {
      },
      subscribe: function() {
        return {
          unsubscribe: function() {
          }
        };
      },
      getSnapshot: function() {
      },
      toJSON: function() {
        return {
          id: t
        };
      }
    }, e[$r] = function() {
      return this;
    }, e;
  }
  function AC(t, e, n, i) {
    var s, a = sv(t.src), u = (s = e == null ? void 0 : e.options.services) === null || s === void 0 ? void 0 : s[a.type], d = t.data ? bl(t.data, n, i) : void 0, f = u ? lv(u, t.id, d) : av(t.id);
    return f.meta = t, f;
  }
  function lv(t, e, n) {
    var i = av(e);
    if (i.deferred = !0, xo(t)) {
      var s = i.state = To(void 0, function() {
        return (n ? t.withContext(n) : t).initialState;
      });
      i.getSnapshot = function() {
        return s;
      };
    }
    return i;
  }
  function kC(t) {
    try {
      return typeof t.send == "function";
    } catch {
      return !1;
    }
  }
  function PC(t) {
    return kC(t) && "id" in t;
  }
  function IC(t) {
    var e;
    return ie((e = {
      subscribe: function() {
        return {
          unsubscribe: function() {
          }
        };
      },
      id: "anonymous",
      getSnapshot: function() {
      }
    }, e[$r] = function() {
      return this;
    }, e), t);
  }
  var Al = function(t) {
    return t.type === "atomic" || t.type === "final";
  };
  function uv(t) {
    return Object.keys(t.states).map(function(e) {
      return t.states[e];
    });
  }
  function Is(t) {
    return uv(t).filter(function(e) {
      return e.type !== "history";
    });
  }
  function cv(t) {
    var e = [t];
    return Al(t) ? e : e.concat(ft(Is(t).map(cv)));
  }
  function Ns(t, e) {
    var n, i, s, a, u, d, f, p, m = new Set(t), v = Ud(m), y = new Set(e);
    try {
      for (var E = je(y), S = E.next(); !S.done; S = E.next())
        for (var x = S.value, C = x.parent; C && !y.has(C); )
          y.add(C), C = C.parent;
    } catch (G) {
      n = {
        error: G
      };
    } finally {
      try {
        S && !S.done && (i = E.return) && i.call(E);
      } finally {
        if (n)
          throw n.error;
      }
    }
    var L = Ud(y);
    try {
      for (var k = je(y), I = k.next(); !I.done; I = k.next()) {
        var x = I.value;
        if (x.type === "compound" && (!L.get(x) || !L.get(x).length))
          v.get(x) ? v.get(x).forEach(function(ee) {
            return y.add(ee);
          }) : x.initialStateNodes.forEach(function(ee) {
            return y.add(ee);
          });
        else if (x.type === "parallel")
          try {
            for (var B = (u = void 0, je(Is(x))), V = B.next(); !V.done; V = B.next()) {
              var P = V.value;
              y.has(P) || (y.add(P), v.get(P) ? v.get(P).forEach(function(ee) {
                return y.add(ee);
              }) : P.initialStateNodes.forEach(function(ee) {
                return y.add(ee);
              }));
            }
          } catch (ee) {
            u = {
              error: ee
            };
          } finally {
            try {
              V && !V.done && (d = B.return) && d.call(B);
            } finally {
              if (u)
                throw u.error;
            }
          }
      }
    } catch (G) {
      s = {
        error: G
      };
    } finally {
      try {
        I && !I.done && (a = k.return) && a.call(k);
      } finally {
        if (s)
          throw s.error;
      }
    }
    try {
      for (var R = je(y), j = R.next(); !j.done; j = R.next())
        for (var x = j.value, C = x.parent; C && !y.has(C); )
          y.add(C), C = C.parent;
    } catch (G) {
      f = {
        error: G
      };
    } finally {
      try {
        j && !j.done && (p = R.return) && p.call(R);
      } finally {
        if (f)
          throw f.error;
      }
    }
    return y;
  }
  function dv(t, e) {
    var n = e.get(t);
    if (!n)
      return {};
    if (t.type === "compound") {
      var i = n[0];
      if (i) {
        if (Al(i))
          return i.key;
      } else
        return {};
    }
    var s = {};
    return n.forEach(function(a) {
      s[a.key] = dv(a, e);
    }), s;
  }
  function Ud(t) {
    var e, n, i = /* @__PURE__ */ new Map();
    try {
      for (var s = je(t), a = s.next(); !a.done; a = s.next()) {
        var u = a.value;
        i.has(u) || i.set(u, []), u.parent && (i.has(u.parent) || i.set(u.parent, []), i.get(u.parent).push(u));
      }
    } catch (d) {
      e = {
        error: d
      };
    } finally {
      try {
        a && !a.done && (n = s.return) && n.call(s);
      } finally {
        if (e)
          throw e.error;
      }
    }
    return i;
  }
  function NC(t, e) {
    var n = Ns([t], e);
    return dv(t, Ud(n));
  }
  function Ds(t, e) {
    return Array.isArray(t) ? t.some(function(n) {
      return n === e;
    }) : t instanceof Set ? t.has(e) : !1;
  }
  function DC(t) {
    return it([], Ve(new Set(ft(it([], Ve(t.map(function(e) {
      return e.ownEvents;
    })), !1)))), !1);
  }
  function kl(t, e) {
    return e.type === "compound" ? Is(e).some(function(n) {
      return n.type === "final" && Ds(t, n);
    }) : e.type === "parallel" ? Is(e).every(function(n) {
      return kl(t, n);
    }) : !1;
  }
  function jC(t) {
    return t === void 0 && (t = []), t.reduce(function(e, n) {
      return n.meta !== void 0 && (e[n.id] = n.meta), e;
    }, {});
  }
  function fv(t) {
    return new Set(ft(t.map(function(e) {
      return e.tags;
    })));
  }
  function hv(t, e) {
    if (t === e)
      return !0;
    if (t === void 0 || e === void 0)
      return !1;
    if (Ye(t) || Ye(e))
      return t === e;
    var n = Object.keys(t), i = Object.keys(e);
    return n.length === i.length && n.every(function(s) {
      return hv(t[s], e[s]);
    });
  }
  function MC(t) {
    return typeof t != "object" || t === null ? !1 : "value" in t && "_event" in t;
  }
  function FC(t, e) {
    var n = t.exec, i = ie(ie({}, t), {
      exec: n !== void 0 ? function() {
        return n(e.context, e.event, {
          action: t,
          state: e,
          _event: e._event
        });
      } : void 0
    });
    return i;
  }
  var Tn = (
    /** @class */
    /* @__PURE__ */ function() {
      function t(e) {
        var n = this, i;
        this.actions = [], this.activities = Xg, this.meta = {}, this.events = [], this.value = e.value, this.context = e.context, this._event = e._event, this._sessionid = e._sessionid, this.event = this._event.data, this.historyValue = e.historyValue, this.history = e.history, this.actions = e.actions || [], this.activities = e.activities || Xg, this.meta = jC(e.configuration), this.events = e.events || [], this.matches = this.matches.bind(this), this.toStrings = this.toStrings.bind(this), this.configuration = e.configuration, this.transitions = e.transitions, this.children = e.children, this.done = !!e.done, this.tags = (i = Array.isArray(e.tags) ? new Set(e.tags) : e.tags) !== null && i !== void 0 ? i : /* @__PURE__ */ new Set(), this.machine = e.machine, Object.defineProperty(this, "nextEvents", {
          get: function() {
            return DC(n.configuration);
          }
        });
      }
      return t.from = function(e, n) {
        if (e instanceof t)
          return e.context !== n ? new t({
            value: e.value,
            context: n,
            _event: e._event,
            _sessionid: null,
            historyValue: e.historyValue,
            history: e.history,
            actions: [],
            activities: e.activities,
            meta: {},
            events: [],
            configuration: [],
            transitions: [],
            children: {}
          }) : e;
        var i = Co;
        return new t({
          value: e,
          context: n,
          _event: i,
          _sessionid: null,
          historyValue: void 0,
          history: void 0,
          actions: [],
          activities: void 0,
          meta: void 0,
          events: [],
          configuration: [],
          transitions: [],
          children: {}
        });
      }, t.create = function(e) {
        return new t(e);
      }, t.inert = function(e, n) {
        if (e instanceof t) {
          if (!e.actions.length)
            return e;
          var i = Co;
          return new t({
            value: e.value,
            context: n,
            _event: i,
            _sessionid: null,
            historyValue: e.historyValue,
            history: e.history,
            activities: e.activities,
            configuration: e.configuration,
            transitions: [],
            children: {}
          });
        }
        return t.from(e, n);
      }, t.prototype.toStrings = function(e, n) {
        var i = this;
        if (e === void 0 && (e = this.value), n === void 0 && (n = "."), Ye(e))
          return [e];
        var s = Object.keys(e);
        return s.concat.apply(s, it([], Ve(s.map(function(a) {
          return i.toStrings(e[a], n).map(function(u) {
            return a + n + u;
          });
        })), !1));
      }, t.prototype.toJSON = function() {
        var e = this;
        e.configuration, e.transitions;
        var n = e.tags;
        e.machine;
        var i = Ad(e, ["configuration", "transitions", "tags", "machine"]);
        return ie(ie({}, i), {
          tags: Array.from(n)
        });
      }, t.prototype.matches = function(e) {
        return jd(e, this.value);
      }, t.prototype.hasTag = function(e) {
        return this.tags.has(e);
      }, t.prototype.can = function(e) {
        var n;
        pC(!!this.machine);
        var i = (n = this.machine) === null || n === void 0 ? void 0 : n.getTransitionData(this, e);
        return !!(i != null && i.transitions.length) && // Check that at least one transition is not forbidden
        i.transitions.some(function(s) {
          return s.target !== void 0 || s.actions.length;
        });
      }, t;
    }()
  ), HC = {
    deferEvents: !1
  }, pv = (
    /** @class */
    /* @__PURE__ */ function() {
      function t(e) {
        this.processingEvent = !1, this.queue = [], this.initialized = !1, this.options = ie(ie({}, HC), e);
      }
      return t.prototype.initialize = function(e) {
        if (this.initialized = !0, e) {
          if (!this.options.deferEvents) {
            this.schedule(e);
            return;
          }
          this.process(e);
        }
        this.flushEvents();
      }, t.prototype.schedule = function(e) {
        if (!this.initialized || this.processingEvent) {
          this.queue.push(e);
          return;
        }
        if (this.queue.length !== 0)
          throw new Error("Event queue should be empty when it is not processing events");
        this.process(e), this.flushEvents();
      }, t.prototype.clear = function() {
        this.queue = [];
      }, t.prototype.flushEvents = function() {
        for (var e = this.queue.shift(); e; )
          this.process(e), e = this.queue.shift();
      }, t.prototype.process = function(e) {
        this.processingEvent = !0;
        try {
          e();
        } catch (n) {
          throw this.clear(), n;
        } finally {
          this.processingEvent = !1;
        }
      }, t;
    }()
  ), $d = /* @__PURE__ */ new Map(), BC = 0, js = {
    bookId: function() {
      return "x:".concat(BC++);
    },
    register: function(t, e) {
      return $d.set(t, e), t;
    },
    get: function(t) {
      return $d.get(t);
    },
    free: function(t) {
      $d.delete(t);
    }
  };
  function zd() {
    if (typeof globalThis < "u")
      return globalThis;
    if (typeof self < "u")
      return self;
    if (typeof window < "u")
      return window;
    if (typeof global < "u")
      return global;
  }
  function UC() {
    var t = zd();
    if (t && "__xstate__" in t)
      return t.__xstate__;
  }
  function $C(t) {
    if (zd()) {
      var e = UC();
      e && e.register(t);
    }
  }
  function zC(t, e) {
    e === void 0 && (e = {});
    var n = t.initialState, i = /* @__PURE__ */ new Set(), s = [], a = !1, u = function() {
      if (!a) {
        for (a = !0; s.length > 0; ) {
          var p = s.shift();
          n = t.transition(n, p, f), i.forEach(function(m) {
            return m.next(n);
          });
        }
        a = !1;
      }
    }, d = IC({
      id: e.id,
      send: function(p) {
        s.push(p), u();
      },
      getSnapshot: function() {
        return n;
      },
      subscribe: function(p, m, v) {
        var y = Tl(p, m, v);
        return i.add(y), y.next(n), {
          unsubscribe: function() {
            i.delete(y);
          }
        };
      }
    }), f = {
      parent: e.parent,
      self: d,
      id: e.id || "anonymous",
      observers: i
    };
    return n = t.start ? t.start(f) : n, d;
  }
  var VC = {
    sync: !1,
    autoForward: !1
  }, Dt;
  (function(t) {
    t[t.NotStarted = 0] = "NotStarted", t[t.Running = 1] = "Running", t[t.Stopped = 2] = "Stopped";
  })(Dt || (Dt = {}));
  var WC = (
    /** @class */
    /* @__PURE__ */ function() {
      function t(e, n) {
        n === void 0 && (n = t.defaultOptions);
        var i = this;
        this.machine = e, this.delayedEventsMap = {}, this.listeners = /* @__PURE__ */ new Set(), this.contextListeners = /* @__PURE__ */ new Set(), this.stopListeners = /* @__PURE__ */ new Set(), this.doneListeners = /* @__PURE__ */ new Set(), this.eventListeners = /* @__PURE__ */ new Set(), this.sendListeners = /* @__PURE__ */ new Set(), this.initialized = !1, this.status = Dt.NotStarted, this.children = /* @__PURE__ */ new Map(), this.forwardTo = /* @__PURE__ */ new Set(), this._outgoingQueue = [], this.init = this.start, this.send = function(m, v) {
          if (Eo(m))
            return i.batch(m), i.state;
          var y = $t(Cl(m, v));
          if (i.status === Dt.Stopped)
            return i.state;
          if (i.status !== Dt.Running && !i.options.deferEvents)
            throw new Error('Event "'.concat(y.name, '" was sent to uninitialized service "').concat(
              i.machine.id,
              `". Make sure .start() is called for this service, or set { deferEvents: true } in the service options.
Event: `
            ).concat(JSON.stringify(y.data)));
          return i.scheduler.schedule(function() {
            i.forward(y);
            var E = i._nextState(y);
            i.update(E, y);
          }), i._state;
        }, this.sendTo = function(m, v, y) {
          var E = i.parent && (v === So.Parent || i.parent.id === v), S = E ? i.parent : Ye(v) ? v === So.Internal ? i : i.children.get(v) || js.get(v) : gC(v) ? v : void 0;
          if (!S) {
            if (!E)
              throw new Error("Unable to send event to child '".concat(v, "' from service '").concat(i.id, "'."));
            return;
          }
          if ("machine" in S) {
            if (i.status !== Dt.Stopped || i.parent !== S || // we need to send events to the parent from exit handlers of a machine that reached its final state
            i.state.done) {
              var x = ie(ie({}, m), {
                name: m.name === rC ? "".concat(Ps(i.id)) : m.name,
                origin: i.sessionId
              });
              !y && i.machine.config.predictableActionArguments ? i._outgoingQueue.push([S, x]) : S.send(x);
            }
          } else
            !y && i.machine.config.predictableActionArguments ? i._outgoingQueue.push([S, m.data]) : S.send(m.data);
        }, this._exec = function(m, v, y, E) {
          E === void 0 && (E = i.machine.options.actions);
          var S = m.exec || Hd(m.type, E), x = qe(S) ? S : S ? S.exec : m.exec;
          if (x)
            try {
              return x(v, y.data, i.machine.config.predictableActionArguments ? {
                action: m,
                _event: y
              } : {
                action: m,
                state: i.state,
                _event: y
              });
            } catch (ye) {
              throw i.parent && i.parent.send({
                type: "xstate.error",
                data: ye
              }), ye;
            }
          switch (m.type) {
            case Rs: {
              var C = m;
              i.defer(C);
              break;
            }
            case wl:
              var L = m;
              if (typeof L.delay == "number") {
                i.defer(L);
                return;
              } else
                L.to ? i.sendTo(L._event, L.to, y === Co) : i.send(L._event);
              break;
            case Gg:
              i.cancel(m.sendId);
              break;
            case kd: {
              if (i.status !== Dt.Running)
                return;
              var k = m.activity;
              if (
                // in v4 with `predictableActionArguments` invokes are called eagerly when the `this.state` still points to the previous state
                !i.machine.config.predictableActionArguments && !i.state.activities[k.id || k.type]
              )
                break;
              if (k.type === Je.Invoke) {
                var I = sv(k.src), B = i.machine.options.services ? i.machine.options.services[I.type] : void 0, V = k.id, P = k.data, R = "autoForward" in k ? k.autoForward : !!k.forward;
                if (!B)
                  return;
                var j = P ? bl(P, v, y) : void 0;
                if (typeof B == "string")
                  return;
                var G = qe(B) ? B(v, y.data, {
                  data: j,
                  src: I,
                  meta: k.meta
                }) : B;
                if (!G)
                  return;
                var ee = void 0;
                xo(G) && (G = j ? G.withContext(j) : G, ee = {
                  autoForward: R
                }), i.spawn(G, V, ee);
              } else
                i.spawnActivity(k);
              break;
            }
            case Pd: {
              i.stopChild(m.activity.id);
              break;
            }
            case qg:
              var W = m, re = W.label, we = W.value;
              re ? i.logger(re, we) : i.logger(we);
              break;
          }
        };
        var s = ie(ie({}, t.defaultOptions), n), a = s.clock, u = s.logger, d = s.parent, f = s.id, p = f !== void 0 ? f : e.id;
        this.id = p, this.logger = u, this.clock = a, this.parent = d, this.options = s, this.scheduler = new pv({
          deferEvents: this.options.deferEvents
        }), this.sessionId = js.bookId();
      }
      return Object.defineProperty(t.prototype, "initialState", {
        get: function() {
          var e = this;
          return this._initialState ? this._initialState : To(this, function() {
            return e._initialState = e.machine.initialState, e._initialState;
          });
        },
        enumerable: !1,
        configurable: !0
      }), Object.defineProperty(t.prototype, "state", {
        /**
         * @deprecated Use `.getSnapshot()` instead.
         */
        get: function() {
          return this._state;
        },
        enumerable: !1,
        configurable: !0
      }), t.prototype.execute = function(e, n) {
        var i, s;
        try {
          for (var a = je(e.actions), u = a.next(); !u.done; u = a.next()) {
            var d = u.value;
            this.exec(d, e, n);
          }
        } catch (f) {
          i = {
            error: f
          };
        } finally {
          try {
            u && !u.done && (s = a.return) && s.call(a);
          } finally {
            if (i)
              throw i.error;
          }
        }
      }, t.prototype.update = function(e, n) {
        var i, s, a, u, d, f, p, m, v = this;
        if (e._sessionid = this.sessionId, this._state = e, (!this.machine.config.predictableActionArguments || // this is currently required to execute initial actions as the `initialState` gets cached
        // we can't just recompute it (and execute actions while doing so) because we try to preserve identity of actors created within initial assigns
        n === Co) && this.options.execute)
          this.execute(this.state);
        else
          for (var y = void 0; y = this._outgoingQueue.shift(); )
            y[0].send(y[1]);
        if (this.children.forEach(function(G) {
          v.state.children[G.id] = G;
        }), this.devTools && this.devTools.send(n.data, e), e.event)
          try {
            for (var E = je(this.eventListeners), S = E.next(); !S.done; S = E.next()) {
              var x = S.value;
              x(e.event);
            }
          } catch (G) {
            i = {
              error: G
            };
          } finally {
            try {
              S && !S.done && (s = E.return) && s.call(E);
            } finally {
              if (i)
                throw i.error;
            }
          }
        try {
          for (var C = je(this.listeners), L = C.next(); !L.done; L = C.next()) {
            var x = L.value;
            x(e, e.event);
          }
        } catch (G) {
          a = {
            error: G
          };
        } finally {
          try {
            L && !L.done && (u = C.return) && u.call(C);
          } finally {
            if (a)
              throw a.error;
          }
        }
        try {
          for (var k = je(this.contextListeners), I = k.next(); !I.done; I = k.next()) {
            var B = I.value;
            B(this.state.context, this.state.history ? this.state.history.context : void 0);
          }
        } catch (G) {
          d = {
            error: G
          };
        } finally {
          try {
            I && !I.done && (f = k.return) && f.call(k);
          } finally {
            if (d)
              throw d.error;
          }
        }
        if (this.state.done) {
          var V = e.configuration.find(function(G) {
            return G.type === "final" && G.parent === v.machine;
          }), P = V && V.doneData ? bl(V.doneData, e.context, n) : void 0;
          this._doneEvent = Rl(this.id, P);
          try {
            for (var R = je(this.doneListeners), j = R.next(); !j.done; j = R.next()) {
              var x = j.value;
              x(this._doneEvent);
            }
          } catch (G) {
            p = {
              error: G
            };
          } finally {
            try {
              j && !j.done && (m = R.return) && m.call(R);
            } finally {
              if (p)
                throw p.error;
            }
          }
          this._stop(), this._stopChildren(), js.free(this.sessionId);
        }
      }, t.prototype.onTransition = function(e) {
        return this.listeners.add(e), this.status === Dt.Running && e(this.state, this.state.event), this;
      }, t.prototype.subscribe = function(e, n, i) {
        var s = this, a = Tl(e, n, i);
        this.listeners.add(a.next), this.status !== Dt.NotStarted && a.next(this.state);
        var u = function() {
          s.doneListeners.delete(u), s.stopListeners.delete(u), a.complete();
        };
        return this.status === Dt.Stopped ? a.complete() : (this.onDone(u), this.onStop(u)), {
          unsubscribe: function() {
            s.listeners.delete(a.next), s.doneListeners.delete(u), s.stopListeners.delete(u);
          }
        };
      }, t.prototype.onEvent = function(e) {
        return this.eventListeners.add(e), this;
      }, t.prototype.onSend = function(e) {
        return this.sendListeners.add(e), this;
      }, t.prototype.onChange = function(e) {
        return this.contextListeners.add(e), this;
      }, t.prototype.onStop = function(e) {
        return this.stopListeners.add(e), this;
      }, t.prototype.onDone = function(e) {
        return this.status === Dt.Stopped && this._doneEvent ? e(this._doneEvent) : this.doneListeners.add(e), this;
      }, t.prototype.off = function(e) {
        return this.listeners.delete(e), this.eventListeners.delete(e), this.sendListeners.delete(e), this.stopListeners.delete(e), this.doneListeners.delete(e), this.contextListeners.delete(e), this;
      }, t.prototype.start = function(e) {
        var n = this;
        if (this.status === Dt.Running)
          return this;
        this.machine._init(), js.register(this.sessionId, this), this.initialized = !0, this.status = Dt.Running;
        var i = e === void 0 ? this.initialState : To(this, function() {
          return MC(e) ? n.machine.resolveState(e) : n.machine.resolveState(Tn.from(e, n.machine.context));
        });
        return this.options.devTools && this.attachDev(), this.scheduler.initialize(function() {
          n.update(i, Co);
        }), this;
      }, t.prototype._stopChildren = function() {
        this.children.forEach(function(e) {
          qe(e.stop) && e.stop();
        }), this.children.clear();
      }, t.prototype._stop = function() {
        var e, n, i, s, a, u, d, f, p, m;
        try {
          for (var v = je(this.listeners), y = v.next(); !y.done; y = v.next()) {
            var E = y.value;
            this.listeners.delete(E);
          }
        } catch (R) {
          e = {
            error: R
          };
        } finally {
          try {
            y && !y.done && (n = v.return) && n.call(v);
          } finally {
            if (e)
              throw e.error;
          }
        }
        try {
          for (var S = je(this.stopListeners), x = S.next(); !x.done; x = S.next()) {
            var E = x.value;
            E(), this.stopListeners.delete(E);
          }
        } catch (R) {
          i = {
            error: R
          };
        } finally {
          try {
            x && !x.done && (s = S.return) && s.call(S);
          } finally {
            if (i)
              throw i.error;
          }
        }
        try {
          for (var C = je(this.contextListeners), L = C.next(); !L.done; L = C.next()) {
            var E = L.value;
            this.contextListeners.delete(E);
          }
        } catch (R) {
          a = {
            error: R
          };
        } finally {
          try {
            L && !L.done && (u = C.return) && u.call(C);
          } finally {
            if (a)
              throw a.error;
          }
        }
        try {
          for (var k = je(this.doneListeners), I = k.next(); !I.done; I = k.next()) {
            var E = I.value;
            this.doneListeners.delete(E);
          }
        } catch (R) {
          d = {
            error: R
          };
        } finally {
          try {
            I && !I.done && (f = k.return) && f.call(k);
          } finally {
            if (d)
              throw d.error;
          }
        }
        if (!this.initialized)
          return this;
        this.initialized = !1, this.status = Dt.Stopped, this._initialState = void 0;
        try {
          for (var B = je(Object.keys(this.delayedEventsMap)), V = B.next(); !V.done; V = B.next()) {
            var P = V.value;
            this.clock.clearTimeout(this.delayedEventsMap[P]);
          }
        } catch (R) {
          p = {
            error: R
          };
        } finally {
          try {
            V && !V.done && (m = B.return) && m.call(B);
          } finally {
            if (p)
              throw p.error;
          }
        }
        this.scheduler.clear(), this.scheduler = new pv({
          deferEvents: this.options.deferEvents
        });
      }, t.prototype.stop = function() {
        var e = this, n = this.scheduler;
        return this._stop(), n.schedule(function() {
          var i;
          if (!(!((i = e._state) === null || i === void 0) && i.done)) {
            var s = $t({
              type: "xstate.stop"
            }), a = To(e, function() {
              var u = ft(it([], Ve(e.state.configuration), !1).sort(function(v, y) {
                return y.order - v.order;
              }).map(function(v) {
                return zr(v.onExit, e.machine.options.actions);
              })), d = Ve(Ll(e.machine, e.state, e.state.context, s, [{
                type: "exit",
                actions: u
              }], e.machine.config.predictableActionArguments ? e._exec : void 0, e.machine.config.predictableActionArguments || e.machine.config.preserveActionOrder), 2), f = d[0], p = d[1], m = new Tn({
                value: e.state.value,
                context: p,
                _event: s,
                _sessionid: e.sessionId,
                historyValue: void 0,
                history: e.state,
                actions: f.filter(function(v) {
                  return !Fd(v);
                }),
                activities: {},
                events: [],
                configuration: [],
                transitions: [],
                children: {},
                done: e.state.done,
                tags: e.state.tags,
                machine: e.machine
              });
              return m.changed = !0, m;
            });
            e.update(a, s), e._stopChildren(), js.free(e.sessionId);
          }
        }), this;
      }, t.prototype.batch = function(e) {
        var n = this;
        if (!(this.status === Dt.NotStarted && this.options.deferEvents)) {
          if (this.status !== Dt.Running)
            throw new Error(
              // tslint:disable-next-line:max-line-length
              "".concat(e.length, ' event(s) were sent to uninitialized service "').concat(this.machine.id, '". Make sure .start() is called for this service, or set { deferEvents: true } in the service options.')
            );
        }
        if (e.length) {
          var i = !!this.machine.config.predictableActionArguments && this._exec;
          this.scheduler.schedule(function() {
            var s, a, u = n.state, d = !1, f = [], p = function(E) {
              var S = $t(E);
              n.forward(S), u = To(n, function() {
                return n.machine.transition(u, S, void 0, i || void 0);
              }), f.push.apply(f, it([], Ve(n.machine.config.predictableActionArguments ? u.actions : u.actions.map(function(x) {
                return FC(x, u);
              })), !1)), d = d || !!u.changed;
            };
            try {
              for (var m = je(e), v = m.next(); !v.done; v = m.next()) {
                var y = v.value;
                p(y);
              }
            } catch (E) {
              s = {
                error: E
              };
            } finally {
              try {
                v && !v.done && (a = m.return) && a.call(m);
              } finally {
                if (s)
                  throw s.error;
              }
            }
            u.changed = d, u.actions = f, n.update(u, $t(e[e.length - 1]));
          });
        }
      }, t.prototype.sender = function(e) {
        return this.send.bind(this, e);
      }, t.prototype._nextState = function(e, n) {
        var i = this;
        n === void 0 && (n = !!this.machine.config.predictableActionArguments && this._exec);
        var s = $t(e);
        if (s.name.indexOf(Yg) === 0 && !this.state.nextEvents.some(function(u) {
          return u.indexOf(Yg) === 0;
        }))
          throw s.data.data;
        var a = To(this, function() {
          return i.machine.transition(i.state, s, void 0, n || void 0);
        });
        return a;
      }, t.prototype.nextState = function(e) {
        return this._nextState(e, !1);
      }, t.prototype.forward = function(e) {
        var n, i;
        try {
          for (var s = je(this.forwardTo), a = s.next(); !a.done; a = s.next()) {
            var u = a.value, d = this.children.get(u);
            if (!d)
              throw new Error("Unable to forward event '".concat(e, "' from interpreter '").concat(this.id, "' to nonexistant child '").concat(u, "'."));
            d.send(e);
          }
        } catch (f) {
          n = {
            error: f
          };
        } finally {
          try {
            a && !a.done && (i = s.return) && i.call(s);
          } finally {
            if (n)
              throw n.error;
          }
        }
      }, t.prototype.defer = function(e) {
        var n = this, i = this.clock.setTimeout(function() {
          "to" in e && e.to ? n.sendTo(e._event, e.to, !0) : n.send(e._event);
        }, e.delay);
        e.id && (this.delayedEventsMap[e.id] = i);
      }, t.prototype.cancel = function(e) {
        this.clock.clearTimeout(this.delayedEventsMap[e]), delete this.delayedEventsMap[e];
      }, t.prototype.exec = function(e, n, i) {
        i === void 0 && (i = this.machine.options.actions), this._exec(e, n.context, n._event, i);
      }, t.prototype.removeChild = function(e) {
        var n;
        this.children.delete(e), this.forwardTo.delete(e), (n = this.state) === null || n === void 0 || delete n.children[e];
      }, t.prototype.stopChild = function(e) {
        var n = this.children.get(e);
        n && (this.removeChild(e), qe(n.stop) && n.stop());
      }, t.prototype.spawn = function(e, n, i) {
        if (this.status !== Dt.Running)
          return lv(e, n);
        if (tv(e))
          return this.spawnPromise(Promise.resolve(e), n);
        if (qe(e))
          return this.spawnCallback(e, n);
        if (PC(e))
          return this.spawnActor(e, n);
        if (mC(e))
          return this.spawnObservable(e, n);
        if (xo(e))
          return this.spawnMachine(e, ie(ie({}, i), {
            id: n
          }));
        if (dC(e))
          return this.spawnBehavior(e, n);
        throw new Error('Unable to spawn entity "'.concat(n, '" of type "').concat(typeof e, '".'));
      }, t.prototype.spawnMachine = function(e, n) {
        var i = this;
        n === void 0 && (n = {});
        var s = new t(e, ie(ie({}, this.options), {
          parent: this,
          id: n.id || e.id
        })), a = ie(ie({}, VC), n);
        a.sync && s.onTransition(function(d) {
          i.send(Kg, {
            state: d,
            id: s.id
          });
        });
        var u = s;
        return this.children.set(s.id, u), a.autoForward && this.forwardTo.add(s.id), s.onDone(function(d) {
          i.removeChild(s.id), i.send($t(d, {
            origin: s.id
          }));
        }).start(), u;
      }, t.prototype.spawnBehavior = function(e, n) {
        var i = zC(e, {
          id: n,
          parent: this
        });
        return this.children.set(n, i), i;
      }, t.prototype.spawnPromise = function(e, n) {
        var i, s = this, a = !1, u;
        e.then(function(f) {
          a || (u = f, s.removeChild(n), s.send($t(Rl(n, f), {
            origin: n
          })));
        }, function(f) {
          if (!a) {
            s.removeChild(n);
            var p = Ps(n, f);
            try {
              s.send($t(p, {
                origin: n
              }));
            } catch {
              s.devTools && s.devTools.send(p, s.state), s.machine.strict && s.stop();
            }
          }
        });
        var d = (i = {
          id: n,
          send: function() {
          },
          subscribe: function(f, p, m) {
            var v = Tl(f, p, m), y = !1;
            return e.then(function(E) {
              y || (v.next(E), !y && v.complete());
            }, function(E) {
              y || v.error(E);
            }), {
              unsubscribe: function() {
                return y = !0;
              }
            };
          },
          stop: function() {
            a = !0;
          },
          toJSON: function() {
            return {
              id: n
            };
          },
          getSnapshot: function() {
            return u;
          }
        }, i[$r] = function() {
          return this;
        }, i);
        return this.children.set(n, d), d;
      }, t.prototype.spawnCallback = function(e, n) {
        var i, s = this, a = !1, u = /* @__PURE__ */ new Set(), d = /* @__PURE__ */ new Set(), f, p = function(y) {
          f = y, d.forEach(function(E) {
            return E(y);
          }), !a && s.send($t(y, {
            origin: n
          }));
        }, m;
        try {
          m = e(p, function(y) {
            u.add(y);
          });
        } catch (y) {
          this.send(Ps(n, y));
        }
        if (tv(m))
          return this.spawnPromise(m, n);
        var v = (i = {
          id: n,
          send: function(y) {
            return u.forEach(function(E) {
              return E(y);
            });
          },
          subscribe: function(y) {
            var E = Tl(y);
            return d.add(E.next), {
              unsubscribe: function() {
                d.delete(E.next);
              }
            };
          },
          stop: function() {
            a = !0, qe(m) && m();
          },
          toJSON: function() {
            return {
              id: n
            };
          },
          getSnapshot: function() {
            return f;
          }
        }, i[$r] = function() {
          return this;
        }, i);
        return this.children.set(n, v), v;
      }, t.prototype.spawnObservable = function(e, n) {
        var i, s = this, a, u = e.subscribe(function(f) {
          a = f, s.send($t(f, {
            origin: n
          }));
        }, function(f) {
          s.removeChild(n), s.send($t(Ps(n, f), {
            origin: n
          }));
        }, function() {
          s.removeChild(n), s.send($t(Rl(n), {
            origin: n
          }));
        }), d = (i = {
          id: n,
          send: function() {
          },
          subscribe: function(f, p, m) {
            return e.subscribe(f, p, m);
          },
          stop: function() {
            return u.unsubscribe();
          },
          getSnapshot: function() {
            return a;
          },
          toJSON: function() {
            return {
              id: n
            };
          }
        }, i[$r] = function() {
          return this;
        }, i);
        return this.children.set(n, d), d;
      }, t.prototype.spawnActor = function(e, n) {
        return this.children.set(n, e), e;
      }, t.prototype.spawnActivity = function(e) {
        var n = this.machine.options && this.machine.options.activities ? this.machine.options.activities[e.type] : void 0;
        if (n) {
          var i = n(this.state.context, e);
          this.spawnEffect(e.id, i);
        }
      }, t.prototype.spawnEffect = function(e, n) {
        var i;
        this.children.set(e, (i = {
          id: e,
          send: function() {
          },
          subscribe: function() {
            return {
              unsubscribe: function() {
              }
            };
          },
          stop: n || void 0,
          getSnapshot: function() {
          },
          toJSON: function() {
            return {
              id: e
            };
          }
        }, i[$r] = function() {
          return this;
        }, i));
      }, t.prototype.attachDev = function() {
        var e = zd();
        if (this.options.devTools && e) {
          if (e.__REDUX_DEVTOOLS_EXTENSION__) {
            var n = typeof this.options.devTools == "object" ? this.options.devTools : void 0;
            this.devTools = e.__REDUX_DEVTOOLS_EXTENSION__.connect(ie(ie({
              name: this.id,
              autoPause: !0,
              stateSanitizer: function(i) {
                return {
                  value: i.value,
                  context: i.context,
                  actions: i.actions
                };
              }
            }, n), {
              features: ie({
                jump: !1,
                skip: !1
              }, n ? n.features : void 0)
            }), this.machine), this.devTools.init(this.state);
          }
          $C(this);
        }
      }, t.prototype.toJSON = function() {
        return {
          id: this.id
        };
      }, t.prototype[$r] = function() {
        return this;
      }, t.prototype.getSnapshot = function() {
        return this.status === Dt.NotStarted ? this.initialState : this._state;
      }, t.defaultOptions = {
        execute: !0,
        deferEvents: !0,
        clock: {
          setTimeout: function(e, n) {
            return setTimeout(e, n);
          },
          clearTimeout: function(e) {
            return clearTimeout(e);
          }
        },
        logger: /* @__PURE__ */ console.log.bind(console),
        devTools: !1
      }, t.interpret = mv, t;
    }()
  );
  function mv(t, e) {
    var n = new WC(t, e);
    return n;
  }
  function GC(t) {
    if (typeof t == "string") {
      var e = {
        type: t
      };
      return e.toString = function() {
        return t;
      }, e;
    }
    return t;
  }
  function Pl(t) {
    return ie(ie({
      type: Nd
    }, t), {
      toJSON: function() {
        t.onDone, t.onError;
        var e = Ad(t, ["onDone", "onError"]);
        return ie(ie({}, e), {
          type: Nd,
          src: GC(t.src)
        });
      }
    });
  }
  var Il = "", Vd = "#", Wd = "*", Oo = {}, _o = function(t) {
    return t[0] === Vd;
  }, qC = function() {
    return {
      actions: {},
      guards: {},
      services: {},
      activities: {},
      delays: {}
    };
  }, YC = (
    /** @class */
    /* @__PURE__ */ function() {
      function t(e, n, i, s) {
        i === void 0 && (i = "context" in e ? e.context : void 0);
        var a = this, u;
        this.config = e, this._context = i, this.order = -1, this.__xstatenode = !0, this.__cache = {
          events: void 0,
          relativeValue: /* @__PURE__ */ new Map(),
          initialStateValue: void 0,
          initialState: void 0,
          on: void 0,
          transitions: void 0,
          candidates: {},
          delayedTransitions: void 0
        }, this.idMap = {}, this.tags = [], this.options = Object.assign(qC(), n), this.parent = s == null ? void 0 : s.parent, this.key = this.config.key || (s == null ? void 0 : s.key) || this.config.id || "(machine)", this.machine = this.parent ? this.parent.machine : this, this.path = this.parent ? this.parent.path.concat(this.key) : [], this.delimiter = this.config.delimiter || (this.parent ? this.parent.delimiter : Zg), this.id = this.config.id || it([this.machine.key], Ve(this.path), !1).join(this.delimiter), this.version = this.parent ? this.parent.version : this.config.version, this.type = this.config.type || (this.config.parallel ? "parallel" : this.config.states && Object.keys(this.config.states).length ? "compound" : this.config.history ? "history" : "atomic"), this.schema = this.parent ? this.machine.schema : (u = this.config.schema) !== null && u !== void 0 ? u : {}, this.description = this.config.description, this.initial = this.config.initial, this.states = this.config.states ? As(this.config.states, function(p, m) {
          var v, y = new t(p, {}, void 0, {
            parent: a,
            key: m
          });
          return Object.assign(a.idMap, ie((v = {}, v[y.id] = y, v), y.idMap)), y;
        }) : Oo;
        var d = 0;
        function f(p) {
          var m, v;
          p.order = d++;
          try {
            for (var y = je(uv(p)), E = y.next(); !E.done; E = y.next()) {
              var S = E.value;
              f(S);
            }
          } catch (x) {
            m = {
              error: x
            };
          } finally {
            try {
              E && !E.done && (v = y.return) && v.call(y);
            } finally {
              if (m)
                throw m.error;
            }
          }
        }
        f(this), this.history = this.config.history === !0 ? "shallow" : this.config.history || !1, this._transient = !!this.config.always || (this.config.on ? Array.isArray(this.config.on) ? this.config.on.some(function(p) {
          var m = p.event;
          return m === Il;
        }) : Il in this.config.on : !1), this.strict = !!this.config.strict, this.onEntry = Un(this.config.entry || this.config.onEntry).map(function(p) {
          return ks(p);
        }), this.onExit = Un(this.config.exit || this.config.onExit).map(function(p) {
          return ks(p);
        }), this.meta = this.config.meta, this.doneData = this.type === "final" ? this.config.data : void 0, this.invoke = Un(this.config.invoke).map(function(p, m) {
          var v, y;
          if (xo(p)) {
            var E = Ol(a.id, m);
            return a.machine.options.services = ie((v = {}, v[E] = p, v), a.machine.options.services), Pl({
              src: E,
              id: E
            });
          } else if (Ye(p.src)) {
            var E = p.id || Ol(a.id, m);
            return Pl(ie(ie({}, p), {
              id: E,
              src: p.src
            }));
          } else if (xo(p.src) || qe(p.src)) {
            var E = p.id || Ol(a.id, m);
            return a.machine.options.services = ie((y = {}, y[E] = p.src, y), a.machine.options.services), Pl(ie(ie({
              id: E
            }, p), {
              src: E
            }));
          } else {
            var S = p.src;
            return Pl(ie(ie({
              id: Ol(a.id, m)
            }, p), {
              src: S
            }));
          }
        }), this.activities = Un(this.config.activities).concat(this.invoke).map(function(p) {
          return Bd(p);
        }), this.transition = this.transition.bind(this), this.tags = Un(this.config.tags);
      }
      return t.prototype._init = function() {
        this.__cache.transitions || cv(this).forEach(function(e) {
          return e.on;
        });
      }, t.prototype.withConfig = function(e, n) {
        var i = this.options, s = i.actions, a = i.activities, u = i.guards, d = i.services, f = i.delays;
        return new t(this.config, {
          actions: ie(ie({}, s), e.actions),
          activities: ie(ie({}, a), e.activities),
          guards: ie(ie({}, u), e.guards),
          services: ie(ie({}, d), e.services),
          delays: ie(ie({}, f), e.delays)
        }, n ?? this.context);
      }, t.prototype.withContext = function(e) {
        return new t(this.config, this.options, e);
      }, Object.defineProperty(t.prototype, "context", {
        get: function() {
          return qe(this._context) ? this._context() : this._context;
        },
        enumerable: !1,
        configurable: !0
      }), Object.defineProperty(t.prototype, "definition", {
        /**
         * The well-structured state node definition.
         */
        get: function() {
          return {
            id: this.id,
            key: this.key,
            version: this.version,
            context: this.context,
            type: this.type,
            initial: this.initial,
            history: this.history,
            states: As(this.states, function(e) {
              return e.definition;
            }),
            on: this.on,
            transitions: this.transitions,
            entry: this.onEntry,
            exit: this.onExit,
            activities: this.activities || [],
            meta: this.meta,
            order: this.order || -1,
            data: this.doneData,
            invoke: this.invoke,
            description: this.description,
            tags: this.tags
          };
        },
        enumerable: !1,
        configurable: !0
      }), t.prototype.toJSON = function() {
        return this.definition;
      }, Object.defineProperty(t.prototype, "on", {
        /**
         * The mapping of events to transitions.
         */
        get: function() {
          if (this.__cache.on)
            return this.__cache.on;
          var e = this.transitions;
          return this.__cache.on = e.reduce(function(n, i) {
            return n[i.eventType] = n[i.eventType] || [], n[i.eventType].push(i), n;
          }, {});
        },
        enumerable: !1,
        configurable: !0
      }), Object.defineProperty(t.prototype, "after", {
        get: function() {
          return this.__cache.delayedTransitions || (this.__cache.delayedTransitions = this.getDelayedTransitions(), this.__cache.delayedTransitions);
        },
        enumerable: !1,
        configurable: !0
      }), Object.defineProperty(t.prototype, "transitions", {
        /**
         * All the transitions that can be taken from this state node.
         */
        get: function() {
          return this.__cache.transitions || (this.__cache.transitions = this.formatTransitions(), this.__cache.transitions);
        },
        enumerable: !1,
        configurable: !0
      }), t.prototype.getCandidates = function(e) {
        if (this.__cache.candidates[e])
          return this.__cache.candidates[e];
        var n = e === Il, i = this.transitions.filter(function(s) {
          var a = s.eventType === e;
          return n ? a : a || s.eventType === Wd;
        });
        return this.__cache.candidates[e] = i, i;
      }, t.prototype.getDelayedTransitions = function() {
        var e = this, n = this.config.after;
        if (!n)
          return [];
        var i = function(a, u) {
          var d = qe(a) ? "".concat(e.id, ":delay[").concat(u, "]") : a, f = RC(d, e.id);
          return e.onEntry.push(SC(f, {
            delay: a
          })), e.onExit.push(bC(f)), f;
        }, s = Eo(n) ? n.map(function(a, u) {
          var d = i(a.delay, u);
          return ie(ie({}, a), {
            event: d
          });
        }) : ft(Object.keys(n).map(function(a, u) {
          var d = n[a], f = Ye(d) ? {
            target: d
          } : d, p = isNaN(+a) ? a : +a, m = i(p, u);
          return Un(f).map(function(v) {
            return ie(ie({}, v), {
              event: m,
              delay: p
            });
          });
        }));
        return s.map(function(a) {
          var u = a.delay;
          return ie(ie({}, e.formatTransition(a)), {
            delay: u
          });
        });
      }, t.prototype.getStateNodes = function(e) {
        var n, i = this;
        if (!e)
          return [];
        var s = e instanceof Tn ? e.value : Ls(e, this.delimiter);
        if (Ye(s)) {
          var a = this.getStateNode(s).initial;
          return a !== void 0 ? this.getStateNodes((n = {}, n[s] = a, n)) : [this, this.states[s]];
        }
        var u = Object.keys(s), d = [this];
        return d.push.apply(d, it([], Ve(ft(u.map(function(f) {
          return i.getStateNode(f).getStateNodes(s[f]);
        }))), !1)), d;
      }, t.prototype.handles = function(e) {
        var n = Jg(e);
        return this.events.includes(n);
      }, t.prototype.resolveState = function(e) {
        var n = e instanceof Tn ? e : Tn.create(e), i = Array.from(Ns([], this.getStateNodes(n.value)));
        return new Tn(ie(ie({}, n), {
          value: this.resolve(n.value),
          configuration: i,
          done: kl(i, this),
          tags: fv(i),
          machine: this.machine
        }));
      }, t.prototype.transitionLeafNode = function(e, n, i) {
        var s = this.getStateNode(e), a = s.next(n, i);
        return !a || !a.transitions.length ? this.next(n, i) : a;
      }, t.prototype.transitionCompoundNode = function(e, n, i) {
        var s = Object.keys(e), a = this.getStateNode(s[0]), u = a._transition(e[s[0]], n, i);
        return !u || !u.transitions.length ? this.next(n, i) : u;
      }, t.prototype.transitionParallelNode = function(e, n, i) {
        var s, a, u = {};
        try {
          for (var d = je(Object.keys(e)), f = d.next(); !f.done; f = d.next()) {
            var p = f.value, m = e[p];
            if (m) {
              var v = this.getStateNode(p), y = v._transition(m, n, i);
              y && (u[p] = y);
            }
          }
        } catch (L) {
          s = {
            error: L
          };
        } finally {
          try {
            f && !f.done && (a = d.return) && a.call(d);
          } finally {
            if (s)
              throw s.error;
          }
        }
        var E = Object.keys(u).map(function(L) {
          return u[L];
        }), S = ft(E.map(function(L) {
          return L.transitions;
        })), x = E.some(function(L) {
          return L.transitions.length > 0;
        });
        if (!x)
          return this.next(n, i);
        var C = ft(Object.keys(u).map(function(L) {
          return u[L].configuration;
        }));
        return {
          transitions: S,
          exitSet: ft(E.map(function(L) {
            return L.exitSet;
          })),
          configuration: C,
          source: n,
          actions: ft(Object.keys(u).map(function(L) {
            return u[L].actions;
          }))
        };
      }, t.prototype._transition = function(e, n, i) {
        return Ye(e) ? this.transitionLeafNode(e, n, i) : Object.keys(e).length === 1 ? this.transitionCompoundNode(e, n, i) : this.transitionParallelNode(e, n, i);
      }, t.prototype.getTransitionData = function(e, n) {
        return this._transition(e.value, e, $t(n));
      }, t.prototype.next = function(e, n) {
        var i, s, a = this, u = n.name, d = [], f = [], p;
        try {
          for (var m = je(this.getCandidates(u)), v = m.next(); !v.done; v = m.next()) {
            var y = v.value, E = y.cond, S = y.in, x = e.context, C = S ? Ye(S) && _o(S) ? (
              // Check if in state by ID
              e.matches(Ls(this.getStateNodeById(S).path, this.delimiter))
            ) : (
              // Check if in state by relative grandparent
              jd(Ls(S, this.delimiter), lC(this.path.slice(0, -2))(e.value))
            ) : !0, L = !1;
            try {
              L = !E || ov(this.machine, E, x, n, e);
            } catch (B) {
              throw new Error("Unable to evaluate guard '".concat(E.name || E.type, "' in transition for event '").concat(u, "' in state node '").concat(this.id, `':
`).concat(B.message));
            }
            if (L && C) {
              y.target !== void 0 && (f = y.target), d.push.apply(d, it([], Ve(y.actions), !1)), p = y;
              break;
            }
          }
        } catch (B) {
          i = {
            error: B
          };
        } finally {
          try {
            v && !v.done && (s = m.return) && s.call(m);
          } finally {
            if (i)
              throw i.error;
          }
        }
        if (p) {
          if (!f.length)
            return {
              transitions: [p],
              exitSet: [],
              configuration: e.value ? [this] : [],
              source: e,
              actions: d
            };
          var k = ft(f.map(function(B) {
            return a.getRelativeStateNodes(B, e.historyValue);
          })), I = !!p.internal;
          return {
            transitions: [p],
            exitSet: I ? [] : ft(f.map(function(B) {
              return a.getPotentiallyReenteringNodes(B);
            })),
            configuration: k,
            source: e,
            actions: d
          };
        }
      }, t.prototype.getPotentiallyReenteringNodes = function(e) {
        if (this.order < e.order)
          return [this];
        for (var n = [], i = this, s = e; i && i !== s; )
          n.push(i), i = i.parent;
        return i !== s ? [] : (n.push(s), n);
      }, t.prototype.getActions = function(e, n, i, s, a, u, d) {
        var f, p, m, v, y = this, E = u ? Ns([], this.getStateNodes(u.value)) : [], S = /* @__PURE__ */ new Set();
        try {
          for (var x = je(Array.from(e).sort(function(W, re) {
            return W.order - re.order;
          })), C = x.next(); !C.done; C = x.next()) {
            var L = C.value;
            (!Ds(E, L) || Ds(i.exitSet, L) || L.parent && S.has(L.parent)) && S.add(L);
          }
        } catch (W) {
          f = {
            error: W
          };
        } finally {
          try {
            C && !C.done && (p = x.return) && p.call(x);
          } finally {
            if (f)
              throw f.error;
          }
        }
        try {
          for (var k = je(E), I = k.next(); !I.done; I = k.next()) {
            var L = I.value;
            (!Ds(e, L) || Ds(i.exitSet, L.parent)) && i.exitSet.push(L);
          }
        } catch (W) {
          m = {
            error: W
          };
        } finally {
          try {
            I && !I.done && (v = k.return) && v.call(k);
          } finally {
            if (m)
              throw m.error;
          }
        }
        i.exitSet.sort(function(W, re) {
          return re.order - W.order;
        });
        var B = Array.from(S).sort(function(W, re) {
          return W.order - re.order;
        }), V = new Set(i.exitSet), P = ft(B.map(function(W) {
          var re = [];
          if (W.type !== "final")
            return re;
          var we = W.parent;
          if (!we.parent)
            return re;
          re.push(
            _l(W.id, W.doneData),
            // TODO: deprecate - final states should not emit done events for their own state.
            _l(we.id, W.doneData ? bl(W.doneData, s, a) : void 0)
          );
          var ye = we.parent;
          return ye.type === "parallel" && Is(ye).every(function(be) {
            return kl(i.configuration, be);
          }) && re.push(_l(ye.id)), re;
        })), R = B.map(function(W) {
          var re = W.onEntry, we = W.activities.map(function(ye) {
            return CC(ye);
          });
          return {
            type: "entry",
            actions: zr(d ? it(it([], Ve(re), !1), Ve(we), !1) : it(it([], Ve(we), !1), Ve(re), !1), y.machine.options.actions)
          };
        }).concat({
          type: "state_done",
          actions: P.map(function(W) {
            return yC(W);
          })
        }), j = Array.from(V).map(function(W) {
          return {
            type: "exit",
            actions: zr(it(it([], Ve(W.onExit), !1), Ve(W.activities.map(function(re) {
              return TC(re);
            })), !1), y.machine.options.actions)
          };
        }), G = j.concat({
          type: "transition",
          actions: zr(i.actions, this.machine.options.actions)
        }).concat(R);
        if (n) {
          var ee = zr(ft(it([], Ve(e), !1).sort(function(W, re) {
            return re.order - W.order;
          }).map(function(W) {
            return W.onExit;
          })), this.machine.options.actions).filter(function(W) {
            return !Fd(W);
          });
          return G.concat({
            type: "stop",
            actions: ee
          });
        }
        return G;
      }, t.prototype.transition = function(e, n, i, s) {
        e === void 0 && (e = this.initialState);
        var a = $t(n), u;
        if (e instanceof Tn)
          u = i === void 0 ? e : this.resolveState(Tn.from(e, i));
        else {
          var d = Ye(e) ? this.resolve(El(this.getResolvedPath(e))) : this.resolve(e), f = i ?? this.machine.context;
          u = this.resolveState(Tn.from(d, f));
        }
        if (this.strict && !this.events.includes(a.name) && !cC(a.name))
          throw new Error("Machine '".concat(this.id, "' does not accept event '").concat(a.name, "'"));
        var p = this._transition(u.value, u, a) || {
          transitions: [],
          configuration: [],
          exitSet: [],
          source: u,
          actions: []
        }, m = Ns([], this.getStateNodes(u.value)), v = p.configuration.length ? Ns(m, p.configuration) : m;
        return p.configuration = it([], Ve(v), !1), this.resolveTransition(p, u, u.context, s, a);
      }, t.prototype.resolveRaisedTransition = function(e, n, i, s) {
        var a, u = e.actions;
        return e = this.transition(e, n, void 0, s), e._event = i, e.event = i.data, (a = e.actions).unshift.apply(a, it([], Ve(u), !1)), e;
      }, t.prototype.resolveTransition = function(e, n, i, s, a) {
        var u, d, f, p, m = this;
        a === void 0 && (a = Co);
        var v = e.configuration, y = !n || e.transitions.length > 0, E = y ? e.configuration : n ? n.configuration : [], S = kl(E, this), x = y ? NC(this.machine, v) : void 0, C = n ? n.historyValue ? n.historyValue : e.source ? this.machine.historyValue(n.value) : void 0 : void 0, L = this.getActions(new Set(E), S, e, i, a, n, s), k = n ? ie({}, n.activities) : {};
        try {
          for (var I = je(L), B = I.next(); !B.done; B = I.next()) {
            var V = B.value;
            try {
              for (var P = (f = void 0, je(V.actions)), R = P.next(); !R.done; R = P.next()) {
                var j = R.value;
                j.type === kd ? k[j.activity.id || j.activity.type] = j : j.type === Pd && (k[j.activity.id || j.activity.type] = !1);
              }
            } catch (de) {
              f = {
                error: de
              };
            } finally {
              try {
                R && !R.done && (p = P.return) && p.call(P);
              } finally {
                if (f)
                  throw f.error;
              }
            }
          }
        } catch (de) {
          u = {
            error: de
          };
        } finally {
          try {
            B && !B.done && (d = I.return) && d.call(I);
          } finally {
            if (u)
              throw u.error;
          }
        }
        var G = Ve(Ll(this, n, i, a, L, s, this.machine.config.predictableActionArguments || this.machine.config.preserveActionOrder), 2), ee = G[0], W = G[1], re = Ve(fC(ee, Fd), 2), we = re[0], ye = re[1], be = ee.filter(function(de) {
          var Oe;
          return de.type === kd && ((Oe = de.activity) === null || Oe === void 0 ? void 0 : Oe.type) === Nd;
        }), Be = be.reduce(function(de, Oe) {
          return de[Oe.activity.id] = AC(Oe.activity, m.machine, W, a), de;
        }, n ? ie({}, n.children) : {}), ge = new Tn({
          value: x || n.value,
          context: W,
          _event: a,
          // Persist _sessionid between states
          _sessionid: n ? n._sessionid : null,
          historyValue: x ? C ? hC(C, x) : void 0 : n ? n.historyValue : void 0,
          history: !x || e.source ? n : void 0,
          actions: x ? ye : [],
          activities: x ? k : n ? n.activities : {},
          events: [],
          configuration: E,
          transitions: e.transitions,
          children: Be,
          done: S,
          tags: fv(E),
          machine: this
        }), q = i !== W;
        ge.changed = a.name === Kg || q;
        var Q = ge.history;
        Q && delete Q.history;
        var T = !S && (this._transient || v.some(function(de) {
          return de._transient;
        }));
        if (!y && (!T || a.name === Il))
          return ge;
        var U = ge;
        if (!S)
          for (T && (U = this.resolveRaisedTransition(U, {
            type: tC
          }, a, s)); we.length; ) {
            var X = we.shift();
            U = this.resolveRaisedTransition(U, X._event, a, s);
          }
        var Se = U.changed || (Q ? !!U.actions.length || q || typeof Q.value != typeof U.value || !hv(U.value, Q.value) : void 0);
        return U.changed = Se, U.history = Q, U;
      }, t.prototype.getStateNode = function(e) {
        if (_o(e))
          return this.machine.getStateNodeById(e);
        if (!this.states)
          throw new Error("Unable to retrieve child state '".concat(e, "' from '").concat(this.id, "'; no child states exist."));
        var n = this.states[e];
        if (!n)
          throw new Error("Child state '".concat(e, "' does not exist on '").concat(this.id, "'"));
        return n;
      }, t.prototype.getStateNodeById = function(e) {
        var n = _o(e) ? e.slice(Vd.length) : e;
        if (n === this.id)
          return this;
        var i = this.machine.idMap[n];
        if (!i)
          throw new Error("Child state node '#".concat(n, "' does not exist on machine '").concat(this.id, "'"));
        return i;
      }, t.prototype.getStateNodeByPath = function(e) {
        if (typeof e == "string" && _o(e))
          try {
            return this.getStateNodeById(e.slice(1));
          } catch {
          }
        for (var n = Md(e, this.delimiter).slice(), i = this; n.length; ) {
          var s = n.shift();
          if (!s.length)
            break;
          i = i.getStateNode(s);
        }
        return i;
      }, t.prototype.resolve = function(e) {
        var n, i = this;
        if (!e)
          return this.initialStateValue || Oo;
        switch (this.type) {
          case "parallel":
            return As(this.initialStateValue, function(a, u) {
              return a ? i.getStateNode(u).resolve(e[u] || a) : Oo;
            });
          case "compound":
            if (Ye(e)) {
              var s = this.getStateNode(e);
              return s.type === "parallel" || s.type === "compound" ? (n = {}, n[e] = s.initialStateValue, n) : e;
            }
            return Object.keys(e).length ? As(e, function(a, u) {
              return a ? i.getStateNode(u).resolve(a) : Oo;
            }) : this.initialStateValue || {};
          default:
            return e || Oo;
        }
      }, t.prototype.getResolvedPath = function(e) {
        if (_o(e)) {
          var n = this.machine.idMap[e.slice(Vd.length)];
          if (!n)
            throw new Error("Unable to find state node '".concat(e, "'"));
          return n.path;
        }
        return Md(e, this.delimiter);
      }, Object.defineProperty(t.prototype, "initialStateValue", {
        get: function() {
          var e;
          if (this.__cache.initialStateValue)
            return this.__cache.initialStateValue;
          var n;
          if (this.type === "parallel")
            n = Qg(this.states, function(i) {
              return i.initialStateValue || Oo;
            }, function(i) {
              return i.type !== "history";
            });
          else if (this.initial !== void 0) {
            if (!this.states[this.initial])
              throw new Error("Initial state '".concat(this.initial, "' not found on '").concat(this.key, "'"));
            n = Al(this.states[this.initial]) ? this.initial : (e = {}, e[this.initial] = this.states[this.initial].initialStateValue, e);
          } else
            n = {};
          return this.__cache.initialStateValue = n, this.__cache.initialStateValue;
        },
        enumerable: !1,
        configurable: !0
      }), t.prototype.getInitialState = function(e, n) {
        this._init();
        var i = this.getStateNodes(e);
        return this.resolveTransition({
          configuration: i,
          exitSet: [],
          transitions: [],
          source: void 0,
          actions: []
        }, void 0, n ?? this.machine.context, void 0);
      }, Object.defineProperty(t.prototype, "initialState", {
        /**
         * The initial State instance, which includes all actions to be executed from
         * entering the initial state.
         */
        get: function() {
          var e = this.initialStateValue;
          if (!e)
            throw new Error("Cannot retrieve initial state from simple state '".concat(this.id, "'."));
          return this.getInitialState(e);
        },
        enumerable: !1,
        configurable: !0
      }), Object.defineProperty(t.prototype, "target", {
        /**
         * The target state value of the history state node, if it exists. This represents the
         * default state value to transition to if no history value exists yet.
         */
        get: function() {
          var e;
          if (this.type === "history") {
            var n = this.config;
            Ye(n.target) ? e = _o(n.target) ? El(this.machine.getStateNodeById(n.target).path.slice(this.path.length - 1)) : n.target : e = n.target;
          }
          return e;
        },
        enumerable: !1,
        configurable: !0
      }), t.prototype.getRelativeStateNodes = function(e, n, i) {
        return i === void 0 && (i = !0), i ? e.type === "history" ? e.resolveHistory(n) : e.initialStateNodes : [e];
      }, Object.defineProperty(t.prototype, "initialStateNodes", {
        get: function() {
          var e = this;
          if (Al(this))
            return [this];
          if (this.type === "compound" && !this.initial)
            return [this];
          var n = xl(this.initialStateValue);
          return ft(n.map(function(i) {
            return e.getFromRelativePath(i);
          }));
        },
        enumerable: !1,
        configurable: !0
      }), t.prototype.getFromRelativePath = function(e) {
        if (!e.length)
          return [this];
        var n = Ve(e), i = n[0], s = n.slice(1);
        if (!this.states)
          throw new Error("Cannot retrieve subPath '".concat(i, "' from node with no states"));
        var a = this.getStateNode(i);
        if (a.type === "history")
          return a.resolveHistory();
        if (!this.states[i])
          throw new Error("Child state '".concat(i, "' does not exist on '").concat(this.id, "'"));
        return this.states[i].getFromRelativePath(s);
      }, t.prototype.historyValue = function(e) {
        if (Object.keys(this.states).length)
          return {
            current: e || this.initialStateValue,
            states: Qg(this.states, function(n, i) {
              if (!e)
                return n.historyValue();
              var s = Ye(e) ? void 0 : e[i];
              return n.historyValue(s || n.initialStateValue);
            }, function(n) {
              return !n.history;
            })
          };
      }, t.prototype.resolveHistory = function(e) {
        var n = this;
        if (this.type !== "history")
          return [this];
        var i = this.parent;
        if (!e) {
          var s = this.target;
          return s ? ft(xl(s).map(function(u) {
            return i.getFromRelativePath(u);
          })) : i.initialStateNodes;
        }
        var a = uC(i.path, "states")(e).current;
        return Ye(a) ? [i.getStateNode(a)] : ft(xl(a).map(function(u) {
          return n.history === "deep" ? i.getFromRelativePath(u) : [i.states[u[0]]];
        }));
      }, Object.defineProperty(t.prototype, "stateIds", {
        /**
         * All the state node IDs of this state node and its descendant state nodes.
         */
        get: function() {
          var e = this, n = ft(Object.keys(this.states).map(function(i) {
            return e.states[i].stateIds;
          }));
          return [this.id].concat(n);
        },
        enumerable: !1,
        configurable: !0
      }), Object.defineProperty(t.prototype, "events", {
        /**
         * All the event types accepted by this state node and its descendants.
         */
        get: function() {
          var e, n, i, s;
          if (this.__cache.events)
            return this.__cache.events;
          var a = this.states, u = new Set(this.ownEvents);
          if (a)
            try {
              for (var d = je(Object.keys(a)), f = d.next(); !f.done; f = d.next()) {
                var p = f.value, m = a[p];
                if (m.states)
                  try {
                    for (var v = (i = void 0, je(m.events)), y = v.next(); !y.done; y = v.next()) {
                      var E = y.value;
                      u.add("".concat(E));
                    }
                  } catch (S) {
                    i = {
                      error: S
                    };
                  } finally {
                    try {
                      y && !y.done && (s = v.return) && s.call(v);
                    } finally {
                      if (i)
                        throw i.error;
                    }
                  }
              }
            } catch (S) {
              e = {
                error: S
              };
            } finally {
              try {
                f && !f.done && (n = d.return) && n.call(d);
              } finally {
                if (e)
                  throw e.error;
              }
            }
          return this.__cache.events = Array.from(u);
        },
        enumerable: !1,
        configurable: !0
      }), Object.defineProperty(t.prototype, "ownEvents", {
        /**
         * All the events that have transitions directly from this state node.
         *
         * Excludes any inert events.
         */
        get: function() {
          var e = new Set(this.transitions.filter(function(n) {
            return !(!n.target && !n.actions.length && n.internal);
          }).map(function(n) {
            return n.eventType;
          }));
          return Array.from(e);
        },
        enumerable: !1,
        configurable: !0
      }), t.prototype.resolveTarget = function(e) {
        var n = this;
        if (e !== void 0)
          return e.map(function(i) {
            if (!Ye(i))
              return i;
            var s = i[0] === n.delimiter;
            if (s && !n.parent)
              return n.getStateNodeByPath(i.slice(1));
            var a = s ? n.key + i : i;
            if (n.parent)
              try {
                var u = n.parent.getStateNodeByPath(a);
                return u;
              } catch (d) {
                throw new Error("Invalid transition definition for state node '".concat(n.id, `':
`).concat(d.message));
              }
            else
              return n.getStateNodeByPath(a);
          });
      }, t.prototype.formatTransition = function(e) {
        var n = this, i = vC(e.target), s = "internal" in e ? e.internal : i ? i.some(function(f) {
          return Ye(f) && f[0] === n.delimiter;
        }) : !0, a = this.machine.options.guards, u = this.resolveTarget(i), d = ie(ie({}, e), {
          actions: zr(Un(e.actions)),
          cond: iv(e.cond, a),
          target: u,
          source: this,
          internal: s,
          eventType: e.event,
          toJSON: function() {
            return ie(ie({}, d), {
              target: d.target ? d.target.map(function(f) {
                return "#".concat(f.id);
              }) : void 0,
              source: "#".concat(n.id)
            });
          }
        });
        return d;
      }, t.prototype.formatTransitions = function() {
        var e, n, i = this, s;
        if (!this.config.on)
          s = [];
        else if (Array.isArray(this.config.on))
          s = this.config.on;
        else {
          var a = this.config.on, u = Wd, d = a[u], f = d === void 0 ? [] : d, p = Ad(a, [typeof u == "symbol" ? u : u + ""]);
          s = ft(Object.keys(p).map(function(k) {
            var I = bo(k, p[k]);
            return I;
          }).concat(bo(Wd, f)));
        }
        var m = this.config.always ? bo("", this.config.always) : [], v = this.config.onDone ? bo(String(_l(this.id)), this.config.onDone) : [], y = ft(this.invoke.map(function(k) {
          var I = [];
          return k.onDone && I.push.apply(I, it([], Ve(bo(String(Rl(k.id)), k.onDone)), !1)), k.onError && I.push.apply(I, it([], Ve(bo(String(Ps(k.id)), k.onError)), !1)), I;
        })), E = this.after, S = ft(it(it(it(it([], Ve(v), !1), Ve(y), !1), Ve(s), !1), Ve(m), !1).map(function(k) {
          return Un(k).map(function(I) {
            return i.formatTransition(I);
          });
        }));
        try {
          for (var x = je(E), C = x.next(); !C.done; C = x.next()) {
            var L = C.value;
            S.push(L);
          }
        } catch (k) {
          e = {
            error: k
          };
        } finally {
          try {
            C && !C.done && (n = x.return) && n.call(x);
          } finally {
            if (e)
              throw e.error;
          }
        }
        return S;
      }, t;
    }()
  );
  function KC(t, e, n) {
    return n === void 0 && (n = t.context), new YC(t, e, n);
  }
  var ZC = _C, Gd;
  (function(t) {
    t[t.Effect = 1] = "Effect", t[t.LayoutEffect = 2] = "LayoutEffect";
  })(Gd || (Gd = {}));
  var Ms = N.useLayoutEffect;
  function gv(t) {
    var e = N.useRef();
    return e.current || (e.current = { v: t() }), e.current.v;
  }
  var XC = function(t, e) {
    var n = typeof Symbol == "function" && t[Symbol.iterator];
    if (!n)
      return t;
    var i = n.call(t), s, a = [], u;
    try {
      for (; (e === void 0 || e-- > 0) && !(s = i.next()).done; )
        a.push(s.value);
    } catch (d) {
      u = { error: d };
    } finally {
      try {
        s && !s.done && (n = i.return) && n.call(i);
      } finally {
        if (u)
          throw u.error;
      }
    }
    return a;
  }, JC = function(t) {
    var e = typeof Symbol == "function" && Symbol.iterator, n = e && t[e], i = 0;
    if (n)
      return n.call(t);
    if (t && typeof t.length == "number")
      return {
        next: function() {
          return t && i >= t.length && (t = void 0), { value: t && t[i++], done: !t };
        }
      };
    throw new TypeError(e ? "Object is not iterable." : "Symbol.iterator is not defined.");
  };
  function QC(t, e) {
    var n, i, s = XC([[], []], 2), a = s[0], u = s[1];
    try {
      for (var d = JC(t), f = d.next(); !f.done; f = d.next()) {
        var p = f.value;
        e(p) ? a.push(p) : u.push(p);
      }
    } catch (m) {
      n = { error: m };
    } finally {
      try {
        f && !f.done && (i = d.return) && i.call(d);
      } finally {
        if (n)
          throw n.error;
      }
    }
    return [a, u];
  }
  var Fs = function(t, e) {
    var n = typeof Symbol == "function" && t[Symbol.iterator];
    if (!n)
      return t;
    var i = n.call(t), s, a = [], u;
    try {
      for (; (e === void 0 || e-- > 0) && !(s = i.next()).done; )
        a.push(s.value);
    } catch (d) {
      u = { error: d };
    } finally {
      try {
        s && !s.done && (n = i.return) && n.call(i);
      } finally {
        if (u)
          throw u.error;
      }
    }
    return a;
  }, vv = function(t, e, n) {
    if (n || arguments.length === 2)
      for (var i = 0, s = e.length, a; i < s; i++)
        (a || !(i in e)) && (a || (a = Array.prototype.slice.call(e, 0, i)), a[i] = e[i]);
    return t.concat(a || Array.prototype.slice.call(e));
  };
  function yv(t, e) {
    var n = t.exec, i = n(e.context, e._event.data, {
      action: t,
      state: e,
      _event: e._event
    });
    i();
  }
  function eT(t) {
    var e = N.useRef([]), n = N.useRef([]);
    Ms(function() {
      var i = t.subscribe(function(s) {
        var a, u;
        if (s.actions.length) {
          var d = s.actions.filter(function(v) {
            return typeof v.exec == "function" && "__effect" in v.exec;
          }), f = Fs(QC(d, function(v) {
            return v.exec.__effect === Gd.Effect;
          }), 2), p = f[0], m = f[1];
          (a = e.current).push.apply(a, vv([], Fs(p.map(function(v) {
            return [v, s];
          })), !1)), (u = n.current).push.apply(u, vv([], Fs(m.map(function(v) {
            return [v, s];
          })), !1));
        }
      });
      return function() {
        i.unsubscribe();
      };
    }, []), Ms(function() {
      for (; n.current.length; ) {
        var i = Fs(n.current.shift(), 2), s = i[0], a = i[1];
        yv(s, a);
      }
    }), N.useEffect(function() {
      for (; e.current.length; ) {
        var i = Fs(e.current.shift(), 2), s = i[0], a = i[1];
        yv(s, a);
      }
    });
  }
  var Hs = function() {
    return Hs = Object.assign || function(t) {
      for (var e, n = 1, i = arguments.length; n < i; n++) {
        e = arguments[n];
        for (var s in e)
          Object.prototype.hasOwnProperty.call(e, s) && (t[s] = e[s]);
      }
      return t;
    }, Hs.apply(this, arguments);
  }, tT = function(t, e) {
    var n = {};
    for (var i in t)
      Object.prototype.hasOwnProperty.call(t, i) && e.indexOf(i) < 0 && (n[i] = t[i]);
    if (t != null && typeof Object.getOwnPropertySymbols == "function")
      for (var s = 0, i = Object.getOwnPropertySymbols(t); s < i.length; s++)
        e.indexOf(i[s]) < 0 && Object.prototype.propertyIsEnumerable.call(t, i[s]) && (n[i[s]] = t[i[s]]);
    return n;
  };
  function nT(t, e, n) {
    if (typeof t == "object")
      return t;
    var i = function() {
    };
    return {
      next: t,
      error: e || i,
      complete: n || i
    };
  }
  function rT(t, e, n) {
    e === void 0 && (e = {});
    var i = gv(function() {
      return typeof t == "function" ? t() : t;
    }), s = e.context, a = e.guards, u = e.actions, d = e.activities, f = e.services, p = e.delays, m = e.state, v = tT(e, ["context", "guards", "actions", "activities", "services", "delays", "state"]), y = gv(function() {
      var E = {
        context: s,
        guards: a,
        actions: u,
        activities: d,
        services: f,
        delays: p
      }, S = i.withConfig(E, function() {
        return Hs(Hs({}, i.context), s);
      });
      return mv(S, Hs({ deferEvents: !0 }, v));
    });
    return Ms(function() {
      var E;
      return n && (E = y.subscribe(nT(n))), function() {
        E == null || E.unsubscribe();
      };
    }, [n]), Ms(function() {
      return y.start(m ? Tn.create(m) : void 0), function() {
        y.stop();
      };
    }, []), Ms(function() {
      Object.assign(y.machine.options.actions, u), Object.assign(y.machine.options.guards, a), Object.assign(y.machine.options.activities, d), Object.assign(y.machine.options.services, f), Object.assign(y.machine.options.delays, p);
    }, [u, a, d, f, p]), eT(y), y;
  }
  var iT = function(t, e) {
    var n = typeof Symbol == "function" && t[Symbol.iterator];
    if (!n)
      return t;
    var i = n.call(t), s, a = [], u;
    try {
      for (; (e === void 0 || e-- > 0) && !(s = i.next()).done; )
        a.push(s.value);
    } catch (d) {
      u = { error: d };
    } finally {
      try {
        s && !s.done && (n = i.return) && n.call(i);
      } finally {
        if (u)
          throw u.error;
      }
    }
    return a;
  };
  function oT(t, e) {
    e === void 0 && (e = {});
    var n = N.useCallback(function(d) {
      var f = d.changed === void 0 && Object.keys(d.children).length;
      (d.changed || f) && u(d);
    }, []), i = rT(t, e, n), s = iT(N.useState(function() {
      var d = i.machine.initialState;
      return e.state ? Tn.create(e.state) : d;
    }), 2), a = s[0], u = s[1];
    return [a, i.send, i];
  }
  function vt() {
    return vt = Object.assign ? Object.assign.bind() : function(t) {
      for (var e = 1; e < arguments.length; e++) {
        var n = arguments[e];
        for (var i in n)
          ({}).hasOwnProperty.call(n, i) && (t[i] = n[i]);
      }
      return t;
    }, vt.apply(null, arguments);
  }
  function Ro(t, e) {
    if (t == null)
      return {};
    var n = {};
    for (var i in t)
      if ({}.hasOwnProperty.call(t, i)) {
        if (e.indexOf(i) !== -1)
          continue;
        n[i] = t[i];
      }
    return n;
  }
  const De = {
    arr: Array.isArray,
    obj: (t) => Object.prototype.toString.call(t) === "[object Object]",
    fun: (t) => typeof t == "function",
    str: (t) => typeof t == "string",
    num: (t) => typeof t == "number",
    und: (t) => t === void 0,
    nul: (t) => t === null,
    set: (t) => t instanceof Set,
    map: (t) => t instanceof Map,
    equ(t, e) {
      if (typeof t != typeof e)
        return !1;
      if (De.str(t) || De.num(t))
        return t === e;
      if (De.obj(t) && De.obj(e) && Object.keys(t).length + Object.keys(e).length === 0)
        return !0;
      let n;
      for (n in t)
        if (!(n in e))
          return !1;
      for (n in e)
        if (t[n] !== e[n])
          return !1;
      return De.und(n) ? t === e : !0;
    }
  };
  function sT(t, e) {
    return e === void 0 && (e = !0), (n) => (De.arr(n) ? n : Object.keys(n)).reduce((i, s) => {
      const a = e ? s[0].toLowerCase() + s.substring(1) : s;
      return i[a] = t(a), i;
    }, t);
  }
  function aT() {
    const t = N.useState(!1), e = t[1];
    return N.useCallback(() => e((i) => !i), []);
  }
  function Pi(t, e) {
    return De.und(t) || De.nul(t) ? e : t;
  }
  function Nl(t) {
    return De.und(t) ? [] : De.arr(t) ? t : [t];
  }
  function Lo(t) {
    for (var e = arguments.length, n = new Array(e > 1 ? e - 1 : 0), i = 1; i < e; i++)
      n[i - 1] = arguments[i];
    return De.fun(t) ? t(...n) : t;
  }
  function lT(t) {
    return t.to, t.from, t.config, t.onStart, t.onRest, t.onFrame, t.children, t.reset, t.reverse, t.force, t.immediate, t.delay, t.attach, t.destroyed, t.interpolateTo, t.ref, t.lazy, Ro(t, ["to", "from", "config", "onStart", "onRest", "onFrame", "children", "reset", "reverse", "force", "immediate", "delay", "attach", "destroyed", "interpolateTo", "ref", "lazy"]);
  }
  function qd(t) {
    const e = lT(t);
    if (De.und(e))
      return vt({
        to: e
      }, t);
    const n = Object.keys(t).reduce((i, s) => De.und(e[s]) ? vt({}, i, {
      [s]: t[s]
    }) : i, {});
    return vt({
      to: e
    }, n);
  }
  function uT(t, e) {
    return e && (De.fun(e) ? e(t) : De.obj(e) && (e.current = t)), t;
  }
  class $n {
    constructor() {
      this.payload = void 0, this.children = [];
    }
    getAnimatedValue() {
      return this.getValue();
    }
    getPayload() {
      return this.payload || this;
    }
    attach() {
    }
    detach() {
    }
    getChildren() {
      return this.children;
    }
    addChild(e) {
      this.children.length === 0 && this.attach(), this.children.push(e);
    }
    removeChild(e) {
      const n = this.children.indexOf(e);
      this.children.splice(n, 1), this.children.length === 0 && this.detach();
    }
  }
  class Yd extends $n {
    constructor() {
      super(...arguments), this.payload = [], this.attach = () => this.payload.forEach((e) => e instanceof $n && e.addChild(this)), this.detach = () => this.payload.forEach((e) => e instanceof $n && e.removeChild(this));
    }
  }
  class wv extends $n {
    constructor() {
      super(...arguments), this.payload = {}, this.attach = () => Object.values(this.payload).forEach((e) => e instanceof $n && e.addChild(this)), this.detach = () => Object.values(this.payload).forEach((e) => e instanceof $n && e.removeChild(this));
    }
    getValue(e) {
      e === void 0 && (e = !1);
      const n = {};
      for (const i in this.payload) {
        const s = this.payload[i];
        e && !(s instanceof $n) || (n[i] = s instanceof $n ? s[e ? "getAnimatedValue" : "getValue"]() : s);
      }
      return n;
    }
    getAnimatedValue() {
      return this.getValue(!0);
    }
  }
  let Kd;
  function cT(t, e) {
    Kd = {
      fn: t,
      transform: e
    };
  }
  let Sv;
  function dT(t) {
    Sv = t;
  }
  let Ev = (t) => typeof window < "u" ? window.requestAnimationFrame(t) : -1, Dl;
  function fT(t) {
    Dl = t;
  }
  let xv = () => Date.now(), hT = (t) => t.current, bv;
  function pT(t) {
    bv = t;
  }
  class mT extends wv {
    constructor(e, n) {
      super(), this.update = void 0, this.payload = e.style ? vt({}, e, {
        style: bv(e.style)
      }) : e, this.update = n, this.attach();
    }
  }
  const gT = (t) => De.fun(t) && !(t.prototype instanceof gt.Component), vT = (t) => N.forwardRef((n, i) => {
    const s = aT(), a = N.useRef(!0), u = N.useRef(null), d = N.useRef(null), f = N.useCallback((y) => {
      const E = u.current, S = () => {
        let x = !1;
        d.current && (x = Kd.fn(d.current, u.current.getAnimatedValue())), (!d.current || x === !1) && s();
      };
      u.current = new mT(y, S), E && E.detach();
    }, []);
    N.useEffect(() => () => {
      a.current = !1, u.current && u.current.detach();
    }, []), N.useImperativeHandle(i, () => hT(d)), f(n);
    const p = u.current.getValue();
    p.scrollTop, p.scrollLeft;
    const m = Ro(p, ["scrollTop", "scrollLeft"]), v = gT(t) ? void 0 : (y) => d.current = uT(y, i);
    return gt.createElement(t, vt({}, m, {
      ref: v
    }));
  });
  let Bs = !1;
  const Ii = /* @__PURE__ */ new Set(), Cv = () => {
    if (!Bs)
      return !1;
    let t = xv();
    for (let e of Ii) {
      let n = !1;
      for (let i = 0; i < e.configs.length; i++) {
        let s = e.configs[i], a, u;
        for (let d = 0; d < s.animatedValues.length; d++) {
          let f = s.animatedValues[d];
          if (f.done)
            continue;
          let p = s.fromValues[d], m = s.toValues[d], v = f.lastPosition, y = m instanceof $n, E = Array.isArray(s.initialVelocity) ? s.initialVelocity[d] : s.initialVelocity;
          if (y && (m = m.getValue()), s.immediate) {
            f.setValue(m), f.done = !0;
            continue;
          }
          if (typeof p == "string" || typeof m == "string") {
            f.setValue(m), f.done = !0;
            continue;
          }
          if (s.duration !== void 0)
            v = p + s.easing((t - f.startTime) / s.duration) * (m - p), a = t >= f.startTime + s.duration;
          else if (s.decay)
            v = p + E / (1 - 0.998) * (1 - Math.exp(-(1 - 0.998) * (t - f.startTime))), a = Math.abs(f.lastPosition - v) < 0.1, a && (m = v);
          else {
            u = f.lastTime !== void 0 ? f.lastTime : t, E = f.lastVelocity !== void 0 ? f.lastVelocity : s.initialVelocity, t > u + 64 && (u = t);
            let S = Math.floor(t - u);
            for (let k = 0; k < S; ++k) {
              let I = -s.tension * (v - m), B = -s.friction * E, V = (I + B) / s.mass;
              E = E + V * 1 / 1e3, v = v + E * 1 / 1e3;
            }
            let x = s.clamp && s.tension !== 0 ? p < m ? v > m : v < m : !1, C = Math.abs(E) <= s.precision, L = s.tension !== 0 ? Math.abs(m - v) <= s.precision : !0;
            a = x || C && L, f.lastVelocity = E, f.lastTime = t;
          }
          y && !s.toValues[d].done && (a = !1), a ? (f.value !== m && (v = m), f.done = !0) : n = !0, f.setValue(v), f.lastPosition = v;
        }
        e.props.onFrame && (e.values[s.name] = s.interpolation.getValue());
      }
      e.props.onFrame && e.props.onFrame(e.values), n || (Ii.delete(e), e.stop(!0));
    }
    return Ii.size ? Ev(Cv) : Bs = !1, Bs;
  }, yT = (t) => {
    Ii.has(t) || Ii.add(t), Bs || (Bs = !0, Ev(Cv));
  }, wT = (t) => {
    Ii.has(t) && Ii.delete(t);
  };
  function jl(t, e, n) {
    if (typeof t == "function")
      return t;
    if (Array.isArray(t))
      return jl({
        range: t,
        output: e,
        extrapolate: n
      });
    if (Dl && typeof t.output[0] == "string")
      return Dl(t);
    const i = t, s = i.output, a = i.range || [0, 1], u = i.extrapolateLeft || i.extrapolate || "extend", d = i.extrapolateRight || i.extrapolate || "extend", f = i.easing || ((p) => p);
    return (p) => {
      const m = ET(p, a);
      return ST(p, a[m], a[m + 1], s[m], s[m + 1], f, u, d, i.map);
    };
  }
  function ST(t, e, n, i, s, a, u, d, f) {
    let p = f ? f(t) : t;
    if (p < e) {
      if (u === "identity")
        return p;
      u === "clamp" && (p = e);
    }
    if (p > n) {
      if (d === "identity")
        return p;
      d === "clamp" && (p = n);
    }
    return i === s ? i : e === n ? t <= e ? i : s : (e === -1 / 0 ? p = -p : n === 1 / 0 ? p = p - e : p = (p - e) / (n - e), p = a(p), i === -1 / 0 ? p = -p : s === 1 / 0 ? p = p + i : p = p * (s - i) + i, p);
  }
  function ET(t, e) {
    for (var n = 1; n < e.length - 1 && !(e[n] >= t); ++n)
      ;
    return n - 1;
  }
  class Ao extends Yd {
    constructor(e, n, i, s) {
      super(), this.calc = void 0, this.payload = e instanceof Yd && !(e instanceof Ao) ? e.getPayload() : Array.isArray(e) ? e : [e], this.calc = jl(n, i, s);
    }
    getValue() {
      return this.calc(...this.payload.map((e) => e.getValue()));
    }
    updateConfig(e, n, i) {
      this.calc = jl(e, n, i);
    }
    interpolate(e, n, i) {
      return new Ao(this, e, n, i);
    }
  }
  const ko = (t, e, n) => t && new Ao(t, e, n), xT = {
    default: {
      tension: 170,
      friction: 26
    },
    gentle: {
      tension: 120,
      friction: 14
    },
    wobbly: {
      tension: 180,
      friction: 12
    },
    stiff: {
      tension: 210,
      friction: 20
    },
    slow: {
      tension: 280,
      friction: 60
    },
    molasses: {
      tension: 280,
      friction: 120
    }
  };
  function Tv(t, e) {
    "update" in t ? e.add(t) : t.getChildren().forEach((n) => Tv(n, e));
  }
  class Zd extends $n {
    constructor(e) {
      var n;
      super(), n = this, this.animatedStyles = /* @__PURE__ */ new Set(), this.value = void 0, this.startPosition = void 0, this.lastPosition = void 0, this.lastVelocity = void 0, this.startTime = void 0, this.lastTime = void 0, this.done = !1, this.setValue = function(i, s) {
        s === void 0 && (s = !0), n.value = i, s && n.flush();
      }, this.value = e, this.startPosition = e, this.lastPosition = e;
    }
    flush() {
      this.animatedStyles.size === 0 && Tv(this, this.animatedStyles), this.animatedStyles.forEach((e) => e.update());
    }
    clearStyles() {
      this.animatedStyles.clear();
    }
    getValue() {
      return this.value;
    }
    interpolate(e, n, i) {
      return new Ao(this, e, n, i);
    }
  }
  class bT extends Yd {
    constructor(e) {
      super(), this.payload = e.map((n) => new Zd(n));
    }
    setValue(e, n) {
      n === void 0 && (n = !0), Array.isArray(e) ? e.length === this.payload.length && e.forEach((i, s) => this.payload[s].setValue(i, n)) : this.payload.forEach((i) => i.setValue(e, n));
    }
    getValue() {
      return this.payload.map((e) => e.getValue());
    }
    interpolate(e, n) {
      return new Ao(this, e, n);
    }
  }
  let CT = 0, TT = class {
    constructor() {
      this.id = void 0, this.idle = !0, this.hasChanged = !1, this.guid = 0, this.local = 0, this.props = {}, this.merged = {}, this.animations = {}, this.interpolations = {}, this.values = {}, this.configs = [], this.listeners = [], this.queue = [], this.localQueue = void 0, this.getValues = () => this.interpolations, this.id = CT++;
    }
    /** update(props)
     *  This function filters input props and creates an array of tasks which are executed in .start()
     *  Each task is allowed to carry a delay, which means it can execute asnychroneously */
    update(e) {
      if (!e)
        return this;
      const n = qd(e), i = n.delay, s = i === void 0 ? 0 : i, a = n.to, u = Ro(n, ["delay", "to"]);
      if (De.arr(a) || De.fun(a))
        this.queue.push(vt({}, u, {
          delay: s,
          to: a
        }));
      else if (a) {
        let d = {};
        Object.entries(a).forEach((f) => {
          let p = f[0], m = f[1];
          const v = vt({
            to: {
              [p]: m
            },
            delay: Lo(s, p)
          }, u), y = d[v.delay] && d[v.delay].to;
          d[v.delay] = vt({}, d[v.delay], v, {
            to: vt({}, y, v.to)
          });
        }), this.queue = Object.values(d);
      }
      return this.queue = this.queue.sort((d, f) => d.delay - f.delay), this.diff(u), this;
    }
    /** start(onEnd)
     *  This function either executes a queue, if present, or starts the frameloop, which animates */
    start(e) {
      if (this.queue.length) {
        this.idle = !1, this.localQueue && this.localQueue.forEach((s) => {
          let a = s.from, u = a === void 0 ? {} : a, d = s.to, f = d === void 0 ? {} : d;
          De.obj(u) && (this.merged = vt({}, u, this.merged)), De.obj(f) && (this.merged = vt({}, this.merged, f));
        });
        const n = this.local = ++this.guid, i = this.localQueue = this.queue;
        this.queue = [], i.forEach((s, a) => {
          let u = s.delay, d = Ro(s, ["delay"]);
          const f = (m) => {
            a === i.length - 1 && n === this.guid && m && (this.idle = !0, this.props.onRest && this.props.onRest(this.merged)), e && e();
          };
          let p = De.arr(d.to) || De.fun(d.to);
          u ? setTimeout(() => {
            n === this.guid && (p ? this.runAsync(d, f) : this.diff(d).start(f));
          }, u) : p ? this.runAsync(d, f) : this.diff(d).start(f);
        });
      } else
        De.fun(e) && this.listeners.push(e), this.props.onStart && this.props.onStart(), yT(this);
      return this;
    }
    stop(e) {
      return this.listeners.forEach((n) => n(e)), this.listeners = [], this;
    }
    /** Pause sets onEnd listeners free, but also removes the controller from the frameloop */
    pause(e) {
      return this.stop(!0), e && wT(this), this;
    }
    runAsync(e, n) {
      var i = this;
      e.delay;
      let s = Ro(e, ["delay"]);
      const a = this.local;
      let u = Promise.resolve(void 0);
      if (De.arr(s.to))
        for (let d = 0; d < s.to.length; d++) {
          const f = d, p = vt({}, s, qd(s.to[f]));
          De.arr(p.config) && (p.config = p.config[f]), u = u.then(() => {
            if (a === this.guid)
              return new Promise((m) => this.diff(p).start(m));
          });
        }
      else if (De.fun(s.to)) {
        let d = 0, f;
        u = u.then(() => s.to(
          // next(props)
          (p) => {
            const m = vt({}, s, qd(p));
            if (De.arr(m.config) && (m.config = m.config[d]), d++, a === this.guid)
              return f = new Promise((v) => this.diff(m).start(v));
          },
          // cancel()
          function(p) {
            return p === void 0 && (p = !0), i.stop(p);
          }
        ).then(() => f));
      }
      u.then(n);
    }
    diff(e) {
      this.props = vt({}, this.props, e);
      let n = this.props, i = n.from, s = i === void 0 ? {} : i, a = n.to, u = a === void 0 ? {} : a, d = n.config, f = d === void 0 ? {} : d, p = n.reverse, m = n.attach, v = n.reset, y = n.immediate;
      if (p) {
        var E = [u, s];
        s = E[0], u = E[1];
      }
      this.merged = vt({}, s, this.merged, u), this.hasChanged = !1;
      let S = m && m(this);
      if (this.animations = Object.entries(this.merged).reduce((x, C) => {
        let L = C[0], k = C[1], I = x[L] || {};
        const B = De.num(k), V = De.str(k) && !k.startsWith("#") && !/\d/.test(k) && !Sv[k], P = De.arr(k), R = !B && !P && !V;
        let j = De.und(s[L]) ? k : s[L], G = B || P || V ? k : 1, ee = Lo(f, L);
        S && (G = S.animations[L].parent);
        let W = I.parent, re = I.interpolation, we = Nl(S ? G.getPayload() : G), ye, be = k;
        R && (be = Dl({
          range: [0, 1],
          output: [k, k]
        })(1));
        let Be = re && re.getValue();
        const q = !De.und(W) && I.animatedValues.some((X) => !X.done), Q = !De.equ(be, Be), T = !De.equ(be, I.previous), U = !De.equ(ee, I.config);
        if (v || T && Q || U) {
          if (B || V)
            W = re = I.parent || new Zd(j);
          else if (P)
            W = re = I.parent || new bT(j);
          else if (R) {
            let X = I.interpolation && I.interpolation.calc(I.parent.value);
            X = X !== void 0 && !v ? X : j, I.parent ? (W = I.parent, W.setValue(0, !1)) : W = new Zd(0);
            const Se = {
              output: [X, k]
            };
            I.interpolation ? (re = I.interpolation, I.interpolation.updateConfig(Se)) : re = W.interpolate(Se);
          }
          return we = Nl(S ? G.getPayload() : G), ye = Nl(W.getPayload()), v && !R && W.setValue(j, !1), this.hasChanged = !0, ye.forEach((X) => {
            X.startPosition = X.value, X.lastPosition = X.value, X.lastVelocity = q ? X.lastVelocity : void 0, X.lastTime = q ? X.lastTime : void 0, X.startTime = xv(), X.done = !1, X.animatedStyles.clear();
          }), Lo(y, L) && W.setValue(R ? G : k, !1), vt({}, x, {
            [L]: vt({}, I, {
              name: L,
              parent: W,
              interpolation: re,
              animatedValues: ye,
              toValues: we,
              previous: be,
              config: ee,
              fromValues: Nl(W.getValue()),
              immediate: Lo(y, L),
              initialVelocity: Pi(ee.velocity, 0),
              clamp: Pi(ee.clamp, !1),
              precision: Pi(ee.precision, 0.01),
              tension: Pi(ee.tension, 170),
              friction: Pi(ee.friction, 26),
              mass: Pi(ee.mass, 1),
              duration: ee.duration,
              easing: Pi(ee.easing, (X) => X),
              decay: ee.decay
            })
          });
        } else
          return Q ? x : (R && (W.setValue(1, !1), re.updateConfig({
            output: [be, be]
          })), W.done = !0, this.hasChanged = !0, vt({}, x, {
            [L]: vt({}, x[L], {
              previous: be
            })
          }));
      }, this.animations), this.hasChanged) {
        this.configs = Object.values(this.animations), this.values = {}, this.interpolations = {};
        for (let x in this.animations)
          this.interpolations[x] = this.animations[x].interpolation, this.values[x] = this.animations[x].interpolation.getValue();
      }
      return this;
    }
    destroy() {
      this.stop(), this.props = {}, this.merged = {}, this.animations = {}, this.interpolations = {}, this.values = {}, this.configs = [], this.local = 0;
    }
  };
  const OT = (t, e) => {
    const n = N.useRef(!1), i = N.useRef(), s = De.fun(e), a = N.useMemo(() => {
      i.current && (i.current.map((v) => v.destroy()), i.current = void 0);
      let m;
      return [new Array(t).fill().map((v, y) => {
        const E = new TT(), S = s ? Lo(e, y, E) : e[y];
        return y === 0 && (m = S.ref), E.update(S), m || E.start(), E;
      }), m];
    }, [t]), u = a[0], d = a[1];
    i.current = u, N.useImperativeHandle(d, () => ({
      start: () => Promise.all(i.current.map((m) => new Promise((v) => m.start(v)))),
      stop: (m) => i.current.forEach((v) => v.stop(m)),
      get controllers() {
        return i.current;
      }
    }));
    const f = N.useMemo(() => (m) => i.current.map((v, y) => {
      v.update(s ? Lo(m, y, v) : m[y]), d || v.start();
    }), [t]);
    N.useEffect(() => {
      n.current ? s || f(e) : d || i.current.forEach((m) => m.start());
    }), N.useEffect(() => (n.current = !0, () => i.current.forEach((m) => m.destroy())), []);
    const p = i.current.map((m) => m.getValues());
    return s ? [p, f, (m) => i.current.forEach((v) => v.pause(m))] : p;
  }, _T = (t) => {
    const e = De.fun(t), n = OT(1, e ? t : [t]), i = n[0], s = n[1], a = n[2];
    return e ? [i[0], s, a] : i;
  };
  class RT extends wv {
    constructor(e) {
      e === void 0 && (e = {}), super(), e.transform && !(e.transform instanceof $n) && (e = Kd.transform(e)), this.payload = e;
    }
  }
  const Ml = {
    transparent: 0,
    aliceblue: 4042850303,
    antiquewhite: 4209760255,
    aqua: 16777215,
    aquamarine: 2147472639,
    azure: 4043309055,
    beige: 4126530815,
    bisque: 4293182719,
    black: 255,
    blanchedalmond: 4293643775,
    blue: 65535,
    blueviolet: 2318131967,
    brown: 2771004159,
    burlywood: 3736635391,
    burntsienna: 3934150143,
    cadetblue: 1604231423,
    chartreuse: 2147418367,
    chocolate: 3530104575,
    coral: 4286533887,
    cornflowerblue: 1687547391,
    cornsilk: 4294499583,
    crimson: 3692313855,
    cyan: 16777215,
    darkblue: 35839,
    darkcyan: 9145343,
    darkgoldenrod: 3095792639,
    darkgray: 2846468607,
    darkgreen: 6553855,
    darkgrey: 2846468607,
    darkkhaki: 3182914559,
    darkmagenta: 2332068863,
    darkolivegreen: 1433087999,
    darkorange: 4287365375,
    darkorchid: 2570243327,
    darkred: 2332033279,
    darksalmon: 3918953215,
    darkseagreen: 2411499519,
    darkslateblue: 1211993087,
    darkslategray: 793726975,
    darkslategrey: 793726975,
    darkturquoise: 13554175,
    darkviolet: 2483082239,
    deeppink: 4279538687,
    deepskyblue: 12582911,
    dimgray: 1768516095,
    dimgrey: 1768516095,
    dodgerblue: 512819199,
    firebrick: 2988581631,
    floralwhite: 4294635775,
    forestgreen: 579543807,
    fuchsia: 4278255615,
    gainsboro: 3705462015,
    ghostwhite: 4177068031,
    gold: 4292280575,
    goldenrod: 3668254975,
    gray: 2155905279,
    green: 8388863,
    greenyellow: 2919182335,
    grey: 2155905279,
    honeydew: 4043305215,
    hotpink: 4285117695,
    indianred: 3445382399,
    indigo: 1258324735,
    ivory: 4294963455,
    khaki: 4041641215,
    lavender: 3873897215,
    lavenderblush: 4293981695,
    lawngreen: 2096890111,
    lemonchiffon: 4294626815,
    lightblue: 2916673279,
    lightcoral: 4034953471,
    lightcyan: 3774873599,
    lightgoldenrodyellow: 4210742015,
    lightgray: 3553874943,
    lightgreen: 2431553791,
    lightgrey: 3553874943,
    lightpink: 4290167295,
    lightsalmon: 4288707327,
    lightseagreen: 548580095,
    lightskyblue: 2278488831,
    lightslategray: 2005441023,
    lightslategrey: 2005441023,
    lightsteelblue: 2965692159,
    lightyellow: 4294959359,
    lime: 16711935,
    limegreen: 852308735,
    linen: 4210091775,
    magenta: 4278255615,
    maroon: 2147483903,
    mediumaquamarine: 1724754687,
    mediumblue: 52735,
    mediumorchid: 3126187007,
    mediumpurple: 2473647103,
    mediumseagreen: 1018393087,
    mediumslateblue: 2070474495,
    mediumspringgreen: 16423679,
    mediumturquoise: 1221709055,
    mediumvioletred: 3340076543,
    midnightblue: 421097727,
    mintcream: 4127193855,
    mistyrose: 4293190143,
    moccasin: 4293178879,
    navajowhite: 4292783615,
    navy: 33023,
    oldlace: 4260751103,
    olive: 2155872511,
    olivedrab: 1804477439,
    orange: 4289003775,
    orangered: 4282712319,
    orchid: 3664828159,
    palegoldenrod: 4008225535,
    palegreen: 2566625535,
    paleturquoise: 2951671551,
    palevioletred: 3681588223,
    papayawhip: 4293907967,
    peachpuff: 4292524543,
    peru: 3448061951,
    pink: 4290825215,
    plum: 3718307327,
    powderblue: 2967529215,
    purple: 2147516671,
    rebeccapurple: 1714657791,
    red: 4278190335,
    rosybrown: 3163525119,
    royalblue: 1097458175,
    saddlebrown: 2336560127,
    salmon: 4202722047,
    sandybrown: 4104413439,
    seagreen: 780883967,
    seashell: 4294307583,
    sienna: 2689740287,
    silver: 3233857791,
    skyblue: 2278484991,
    slateblue: 1784335871,
    slategray: 1887473919,
    slategrey: 1887473919,
    snow: 4294638335,
    springgreen: 16744447,
    steelblue: 1182971135,
    tan: 3535047935,
    teal: 8421631,
    thistle: 3636451583,
    tomato: 4284696575,
    turquoise: 1088475391,
    violet: 4001558271,
    wheat: 4125012991,
    white: 4294967295,
    whitesmoke: 4126537215,
    yellow: 4294902015,
    yellowgreen: 2597139199
  }, zn = "[-+]?\\d*\\.?\\d+", Fl = zn + "%";
  function Hl() {
    for (var t = arguments.length, e = new Array(t), n = 0; n < t; n++)
      e[n] = arguments[n];
    return "\\(\\s*(" + e.join(")\\s*,\\s*(") + ")\\s*\\)";
  }
  const LT = new RegExp("rgb" + Hl(zn, zn, zn)), AT = new RegExp("rgba" + Hl(zn, zn, zn, zn)), kT = new RegExp("hsl" + Hl(zn, Fl, Fl)), PT = new RegExp("hsla" + Hl(zn, Fl, Fl, zn)), IT = /^#([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/, NT = /^#([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/, DT = /^#([0-9a-fA-F]{6})$/, jT = /^#([0-9a-fA-F]{8})$/;
  function MT(t) {
    let e;
    return typeof t == "number" ? t >>> 0 === t && t >= 0 && t <= 4294967295 ? t : null : (e = DT.exec(t)) ? parseInt(e[1] + "ff", 16) >>> 0 : Ml.hasOwnProperty(t) ? Ml[t] : (e = LT.exec(t)) ? (Po(e[1]) << 24 | // r
    Po(e[2]) << 16 | // g
    Po(e[3]) << 8 | // b
    255) >>> // a
    0 : (e = AT.exec(t)) ? (Po(e[1]) << 24 | // r
    Po(e[2]) << 16 | // g
    Po(e[3]) << 8 | // b
    Rv(e[4])) >>> // a
    0 : (e = IT.exec(t)) ? parseInt(
      e[1] + e[1] + // r
      e[2] + e[2] + // g
      e[3] + e[3] + // b
      "ff",
      // a
      16
    ) >>> 0 : (e = jT.exec(t)) ? parseInt(e[1], 16) >>> 0 : (e = NT.exec(t)) ? parseInt(
      e[1] + e[1] + // r
      e[2] + e[2] + // g
      e[3] + e[3] + // b
      e[4] + e[4],
      // a
      16
    ) >>> 0 : (e = kT.exec(t)) ? (Ov(
      _v(e[1]),
      // h
      Bl(e[2]),
      // s
      Bl(e[3])
      // l
    ) | 255) >>> // a
    0 : (e = PT.exec(t)) ? (Ov(
      _v(e[1]),
      // h
      Bl(e[2]),
      // s
      Bl(e[3])
      // l
    ) | Rv(e[4])) >>> // a
    0 : null;
  }
  function Xd(t, e, n) {
    return n < 0 && (n += 1), n > 1 && (n -= 1), n < 1 / 6 ? t + (e - t) * 6 * n : n < 1 / 2 ? e : n < 2 / 3 ? t + (e - t) * (2 / 3 - n) * 6 : t;
  }
  function Ov(t, e, n) {
    const i = n < 0.5 ? n * (1 + e) : n + e - n * e, s = 2 * n - i, a = Xd(s, i, t + 1 / 3), u = Xd(s, i, t), d = Xd(s, i, t - 1 / 3);
    return Math.round(a * 255) << 24 | Math.round(u * 255) << 16 | Math.round(d * 255) << 8;
  }
  function Po(t) {
    const e = parseInt(t, 10);
    return e < 0 ? 0 : e > 255 ? 255 : e;
  }
  function _v(t) {
    return (parseFloat(t) % 360 + 360) % 360 / 360;
  }
  function Rv(t) {
    const e = parseFloat(t);
    return e < 0 ? 0 : e > 1 ? 255 : Math.round(e * 255);
  }
  function Bl(t) {
    const e = parseFloat(t);
    return e < 0 ? 0 : e > 100 ? 1 : e / 100;
  }
  function Lv(t) {
    let e = MT(t);
    if (e === null)
      return t;
    e = e || 0;
    let n = (e & 4278190080) >>> 24, i = (e & 16711680) >>> 16, s = (e & 65280) >>> 8, a = (e & 255) / 255;
    return `rgba(${n}, ${i}, ${s}, ${a})`;
  }
  const Ul = /[+\-]?(?:0|[1-9]\d*)(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, FT = /(#(?:[0-9a-f]{2}){2,4}|(#[0-9a-f]{3})|(rgb|hsl)a?\((-?\d+%?[,\s]+){2,3}\s*[\d\.]+%?\))/gi, HT = new RegExp(`(${Object.keys(Ml).join("|")})`, "g"), BT = (t) => {
    const e = t.output.map((s) => s.replace(FT, Lv)).map((s) => s.replace(HT, Lv)), n = e[0].match(Ul).map(() => []);
    e.forEach((s) => {
      s.match(Ul).forEach((a, u) => n[u].push(+a));
    });
    const i = e[0].match(Ul).map((s, a) => jl(vt({}, t, {
      output: n[a]
    })));
    return (s) => {
      let a = 0;
      return e[0].replace(Ul, () => i[a++](s)).replace(/rgba\(([0-9\.-]+), ([0-9\.-]+), ([0-9\.-]+), ([0-9\.-]+)\)/gi, (u, d, f, p, m) => `rgba(${Math.round(d)}, ${Math.round(f)}, ${Math.round(p)}, ${m})`);
    };
  };
  let Us = {
    animationIterationCount: !0,
    borderImageOutset: !0,
    borderImageSlice: !0,
    borderImageWidth: !0,
    boxFlex: !0,
    boxFlexGroup: !0,
    boxOrdinalGroup: !0,
    columnCount: !0,
    columns: !0,
    flex: !0,
    flexGrow: !0,
    flexPositive: !0,
    flexShrink: !0,
    flexNegative: !0,
    flexOrder: !0,
    gridRow: !0,
    gridRowEnd: !0,
    gridRowSpan: !0,
    gridRowStart: !0,
    gridColumn: !0,
    gridColumnEnd: !0,
    gridColumnSpan: !0,
    gridColumnStart: !0,
    fontWeight: !0,
    lineClamp: !0,
    lineHeight: !0,
    opacity: !0,
    order: !0,
    orphans: !0,
    tabSize: !0,
    widows: !0,
    zIndex: !0,
    zoom: !0,
    // SVG-related properties
    fillOpacity: !0,
    floodOpacity: !0,
    stopOpacity: !0,
    strokeDasharray: !0,
    strokeDashoffset: !0,
    strokeMiterlimit: !0,
    strokeOpacity: !0,
    strokeWidth: !0
  };
  const UT = (t, e) => t + e.charAt(0).toUpperCase() + e.substring(1), $T = ["Webkit", "Ms", "Moz", "O"];
  Us = Object.keys(Us).reduce((t, e) => ($T.forEach((n) => t[UT(n, e)] = t[e]), t), Us);
  function zT(t, e, n) {
    return e == null || typeof e == "boolean" || e === "" ? "" : !n && typeof e == "number" && e !== 0 && !(Us.hasOwnProperty(t) && Us[t]) ? e + "px" : ("" + e).trim();
  }
  const Av = {};
  pT((t) => new RT(t)), fT(BT), dT(Ml), cT((t, e) => {
    if (t.nodeType && t.setAttribute !== void 0) {
      const s = e.style, a = e.children, u = e.scrollTop, d = e.scrollLeft, f = Ro(e, ["style", "children", "scrollTop", "scrollLeft"]), p = t.nodeName === "filter" || t.parentNode && t.parentNode.nodeName === "filter";
      u !== void 0 && (t.scrollTop = u), d !== void 0 && (t.scrollLeft = d), a !== void 0 && (t.textContent = a);
      for (let m in s)
        if (s.hasOwnProperty(m)) {
          var n = m.indexOf("--") === 0, i = zT(m, s[m], n);
          m === "float" && (m = "cssFloat"), n ? t.style.setProperty(m, i) : t.style[m] = i;
        }
      for (let m in f) {
        const v = p ? m : Av[m] || (Av[m] = m.replace(/([A-Z])/g, (y) => "-" + y.toLowerCase()));
        typeof t.getAttribute(v) < "u" && t.setAttribute(v, f[m]);
      }
      return;
    } else
      return !1;
  }, (t) => t);
  const VT = [
    "a",
    "abbr",
    "address",
    "area",
    "article",
    "aside",
    "audio",
    "b",
    "base",
    "bdi",
    "bdo",
    "big",
    "blockquote",
    "body",
    "br",
    "button",
    "canvas",
    "caption",
    "cite",
    "code",
    "col",
    "colgroup",
    "data",
    "datalist",
    "dd",
    "del",
    "details",
    "dfn",
    "dialog",
    "div",
    "dl",
    "dt",
    "em",
    "embed",
    "fieldset",
    "figcaption",
    "figure",
    "footer",
    "form",
    "h1",
    "h2",
    "h3",
    "h4",
    "h5",
    "h6",
    "head",
    "header",
    "hgroup",
    "hr",
    "html",
    "i",
    "iframe",
    "img",
    "input",
    "ins",
    "kbd",
    "keygen",
    "label",
    "legend",
    "li",
    "link",
    "main",
    "map",
    "mark",
    "menu",
    "menuitem",
    "meta",
    "meter",
    "nav",
    "noscript",
    "object",
    "ol",
    "optgroup",
    "option",
    "output",
    "p",
    "param",
    "picture",
    "pre",
    "progress",
    "q",
    "rp",
    "rt",
    "ruby",
    "s",
    "samp",
    "script",
    "section",
    "select",
    "small",
    "source",
    "span",
    "strong",
    "style",
    "sub",
    "summary",
    "sup",
    "table",
    "tbody",
    "td",
    "textarea",
    "tfoot",
    "th",
    "thead",
    "time",
    "title",
    "tr",
    "track",
    "u",
    "ul",
    "var",
    "video",
    "wbr",
    // SVG
    "circle",
    "clipPath",
    "defs",
    "ellipse",
    "foreignObject",
    "g",
    "image",
    "line",
    "linearGradient",
    "mask",
    "path",
    "pattern",
    "polygon",
    "polyline",
    "radialGradient",
    "rect",
    "stop",
    "svg",
    "text",
    "tspan"
  ], WT = sT(vT, !1)(VT);
  function kv(t, e) {
    return t.map(function(n, i) {
      return n + e[i];
    });
  }
  function Pv(t, e) {
    return t.map(function(n, i) {
      return n - e[i];
    });
  }
  function Jd(t) {
    return Math.hypot.apply(Math, t);
  }
  function GT(t, e, n) {
    var i = Jd(e), s = i === 0 ? 0 : 1 / i, a = n === 0 ? 0 : 1 / n, u = a * i, d = e.map(function(m) {
      return a * m;
    }), f = e.map(function(m) {
      return s * m;
    }), p = Jd(t);
    return {
      velocities: d,
      velocity: u,
      distance: p,
      direction: f
    };
  }
  function Qd(t) {
    return Math.sign ? Math.sign(t) : +(t > 0) - +(t < 0) || +t;
  }
  function qT(t, e, n) {
    return Math.max(e, Math.min(t, n));
  }
  function YT(t, e) {
    return Math.pow(t, e * 5);
  }
  function Iv(t, e, n) {
    return e === 0 || Math.abs(e) === 1 / 0 ? YT(t, n) : t * e * n / (e + n * t);
  }
  function $s(t, e, n, i) {
    return i === void 0 && (i = 0.15), i === 0 ? qT(t, e, n) : t < e ? -Iv(e - t, n - e, i) + e : t > n ? +Iv(t - n, n - e, i) + n : t;
  }
  function Nv(t, e) {
    for (var n = 0; n < e.length; n++) {
      var i = e[n];
      i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(t, i.key, i);
    }
  }
  function KT(t, e, n) {
    return e && Nv(t.prototype, e), n && Nv(t, n), t;
  }
  function tn() {
    return tn = Object.assign || function(t) {
      for (var e = 1; e < arguments.length; e++) {
        var n = arguments[e];
        for (var i in n)
          Object.prototype.hasOwnProperty.call(n, i) && (t[i] = n[i]);
      }
      return t;
    }, tn.apply(this, arguments);
  }
  function Dv(t, e) {
    t.prototype = Object.create(e.prototype), t.prototype.constructor = t, t.__proto__ = e;
  }
  function ZT(t, e) {
    if (t == null)
      return {};
    var n = {}, i = Object.keys(t), s, a;
    for (a = 0; a < i.length; a++)
      s = i[a], !(e.indexOf(s) >= 0) && (n[s] = t[s]);
    return n;
  }
  function $l(t) {
    if (t === void 0)
      throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
    return t;
  }
  function XT(t, e) {
    if (t) {
      if (typeof t == "string")
        return jv(t, e);
      var n = Object.prototype.toString.call(t).slice(8, -1);
      if (n === "Object" && t.constructor && (n = t.constructor.name), n === "Map" || n === "Set")
        return Array.from(t);
      if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n))
        return jv(t, e);
    }
  }
  function jv(t, e) {
    (e == null || e > t.length) && (e = t.length);
    for (var n = 0, i = new Array(e); n < e; n++)
      i[n] = t[n];
    return i;
  }
  function zl(t, e) {
    var n;
    if (typeof Symbol > "u" || t[Symbol.iterator] == null) {
      if (Array.isArray(t) || (n = XT(t)) || e && t && typeof t.length == "number") {
        n && (t = n);
        var i = 0;
        return function() {
          return i >= t.length ? {
            done: !0
          } : {
            done: !1,
            value: t[i++]
          };
        };
      }
      throw new TypeError(`Invalid attempt to iterate non-iterable instance.
In order to be iterable, non-array objects must have a [Symbol.iterator]() method.`);
    }
    return n = t[Symbol.iterator](), n.next.bind(n);
  }
  function Mv() {
  }
  function Fv() {
    for (var t = arguments.length, e = new Array(t), n = 0; n < t; n++)
      e[n] = arguments[n];
    return e.length === 0 ? Mv : e.length === 1 ? e[0] : function() {
      for (var i, s = zl(e), a; !(a = s()).done; ) {
        var u = a.value;
        i = u.apply(this, arguments) || i;
      }
      return i;
    };
  }
  function Vr(t, e) {
    if (t === void 0) {
      if (e === void 0)
        throw new Error("Must define fallback value if undefined is expected");
      t = e;
    }
    return Array.isArray(t) ? t : [t, t];
  }
  function Vl(t) {
    if (typeof t == "function") {
      for (var e = arguments.length, n = new Array(e > 1 ? e - 1 : 0), i = 1; i < e; i++)
        n[i - 1] = arguments[i];
      return t.apply(void 0, n);
    } else
      return t;
  }
  function ef(t, e) {
    t === void 0 && (t = {});
    for (var n = {}, i = 0, s = Object.entries(e); i < s.length; i++) {
      var a = s[i], u = a[0], d = a[1];
      switch (typeof d) {
        case "function":
          n[u] = d.call(n, t[u], u, t);
          break;
        case "object":
          n[u] = ef(t[u], d);
          break;
        case "boolean":
          d && (n[u] = t[u]);
          break;
      }
    }
    return n;
  }
  var JT = 180, QT = 0.15, e2 = 0.5, t2 = 60, n2 = {
    threshold: function(e) {
      return e === void 0 && (e = 0), Vr(e);
    },
    rubberband: function(e) {
      switch (e === void 0 && (e = 0), e) {
        case !0:
          return Vr(QT);
        case !1:
          return Vr(0);
        default:
          return Vr(e);
      }
    },
    enabled: function(e) {
      return e === void 0 && (e = !0), e;
    },
    triggerAllEvents: function(e) {
      return e === void 0 && (e = !1), e;
    },
    initial: function(e) {
      return e === void 0 && (e = 0), typeof e == "function" ? e : Vr(e);
    }
  }, Hv = /* @__PURE__ */ tn({}, n2, {
    axis: !0,
    lockDirection: function(e) {
      return e === void 0 && (e = !1), e;
    },
    bounds: function(e) {
      if (e === void 0 && (e = {}), typeof e == "function")
        return function(v) {
          return Hv.bounds(e(v));
        };
      var n = e, i = n.left, s = i === void 0 ? -1 / 0 : i, a = n.right, u = a === void 0 ? 1 / 0 : a, d = n.top, f = d === void 0 ? -1 / 0 : d, p = n.bottom, m = p === void 0 ? 1 / 0 : p;
      return [[s, u], [f, m]];
    }
  }), r2 = typeof window < "u" && window.document && window.document.createElement, i2 = {
    enabled: function(e) {
      return e === void 0 && (e = !0), e;
    },
    domTarget: !0,
    window: /* @__PURE__ */ function(t) {
      function e(n) {
        return t.apply(this, arguments);
      }
      return e.toString = function() {
        return t.toString();
      }, e;
    }(function(t) {
      return t === void 0 && (t = r2 ? window : void 0), t;
    }),
    eventOptions: function(e) {
      var n = e === void 0 ? {} : e, i = n.passive, s = i === void 0 ? !0 : i, a = n.capture, u = a === void 0 ? !1 : a;
      return {
        passive: s,
        capture: u
      };
    }
  }, o2 = /* @__PURE__ */ tn({}, Hv, {
    threshold: function(e, n, i) {
      var s = i.filterTaps, a = s === void 0 ? !1 : s, u = i.lockDirection, d = u === void 0 ? !1 : u, f = i.axis, p = f === void 0 ? void 0 : f, m = Vr(e, a ? 3 : d || p ? 1 : 0);
      return this.filterTaps = a || m[0] + m[1] > 0, m;
    },
    swipeVelocity: function(e) {
      return e === void 0 && (e = e2), Vr(e);
    },
    swipeDistance: function(e) {
      return e === void 0 && (e = t2), Vr(e);
    },
    delay: function(e) {
      switch (e === void 0 && (e = 0), e) {
        case !0:
          return JT;
        case !1:
          return 0;
        default:
          return e;
      }
    }
  });
  function s2(t) {
    return t === void 0 && (t = {}), ef(t, i2);
  }
  function a2(t) {
    return t === void 0 && (t = {}), ef(t, o2);
  }
  function l2(t) {
    var e = t.domTarget, n = t.eventOptions, i = t.window, s = t.enabled, a = ZT(t, ["domTarget", "eventOptions", "window", "enabled"]), u = s2({
      domTarget: e,
      eventOptions: n,
      window: i,
      enabled: s
    });
    return u.drag = a2(a), u;
  }
  function zs(t) {
    return tn({
      _active: !1,
      _blocked: !1,
      _intentional: [!1, !1],
      _movement: [0, 0],
      _initial: [0, 0],
      _bounds: [[-1 / 0, 1 / 0], [-1 / 0, 1 / 0]],
      _lastEventType: void 0,
      event: void 0,
      // currentTarget: undefined,
      // pointerId: undefined,
      intentional: !1,
      values: [0, 0],
      velocities: [0, 0],
      delta: [0, 0],
      movement: [0, 0],
      offset: [0, 0],
      lastOffset: [0, 0],
      direction: [0, 0],
      initial: [0, 0],
      previous: [0, 0],
      first: !1,
      last: !1,
      active: !1,
      timeStamp: 0,
      startTime: 0,
      elapsedTime: 0,
      cancel: Mv,
      canceled: !1,
      memo: void 0,
      args: void 0
    }, t);
  }
  function Bv() {
    var t = {
      hovering: !1,
      scrolling: !1,
      wheeling: !1,
      dragging: !1,
      moving: !1,
      pinching: !1,
      touches: 0,
      buttons: 0,
      down: !1,
      shiftKey: !1,
      altKey: !1,
      metaKey: !1,
      ctrlKey: !1
    }, e = zs({
      axis: void 0,
      xy: [0, 0],
      vxvy: [0, 0],
      velocity: 0,
      distance: 0,
      _isTap: !0,
      _delayedEvent: !1,
      _pointerId: void 0,
      tap: !1,
      swipe: [0, 0]
    }), n = zs({
      da: [0, 0],
      vdva: [0, 0],
      // @ts-ignore origin can never be passed as undefined in userland
      origin: void 0,
      turns: 0
    }), i = zs({
      axis: void 0,
      xy: [0, 0],
      vxvy: [0, 0],
      velocity: 0,
      distance: 0
    }), s = zs({
      axis: void 0,
      xy: [0, 0],
      vxvy: [0, 0],
      velocity: 0,
      distance: 0
    }), a = zs({
      axis: void 0,
      xy: [0, 0],
      vxvy: [0, 0],
      velocity: 0,
      distance: 0
    });
    return {
      shared: t,
      drag: e,
      pinch: n,
      wheel: i,
      move: s,
      scroll: a
    };
  }
  var Ni = /* @__PURE__ */ new Map(), u2 = /* @__PURE__ */ function() {
    function t(n, i) {
      var s = this;
      i === void 0 && (i = []), this.controller = n, this.args = i, this.debounced = !0, this.setTimeout = function(a, u) {
        var d;
        u === void 0 && (u = 140), clearTimeout(s.controller.timeouts[s.stateKey]);
        for (var f = arguments.length, p = new Array(f > 2 ? f - 2 : 0), m = 2; m < f; m++)
          p[m - 2] = arguments[m];
        s.controller.timeouts[s.stateKey] = (d = window).setTimeout.apply(d, [a, u].concat(p));
      }, this.clearTimeout = function() {
        clearTimeout(s.controller.timeouts[s.stateKey]);
      }, this.fireGestureHandler = function(a) {
        if (a === void 0 && (a = !1), s.state._blocked)
          return s.debounced || (s.state._active = !1, s.clean()), null;
        if (!a && !s.state.intentional && !s.config.triggerAllEvents)
          return null;
        if (s.state.intentional) {
          var u = s.state.active, d = s.state._active;
          s.state.active = d, s.state.first = d && !u, s.state.last = u && !d, s.controller.state.shared[s.ingKey] = d;
        }
        var f = tn({}, s.controller.state.shared, s.state, s.mapStateValues(s.state)), p = s.handler(f);
        return s.state.memo = p !== void 0 ? p : s.state.memo, s.state._active || s.clean(), f;
      };
    }
    var e = t.prototype;
    return e.updateSharedState = function(i) {
      Object.assign(this.controller.state.shared, i);
    }, e.updateGestureState = function(i) {
      Object.assign(this.state, i);
    }, e.checkIntentionality = function(i, s) {
      return {
        _intentional: i,
        _blocked: !1
      };
    }, e.getMovement = function(i) {
      var s = this.config, a = s.initial, u = s.bounds, d = s.rubberband, f = s.threshold, p = this.state, m = p._bounds, v = p._initial, y = p._active, E = p._intentional, S = p.lastOffset, x = p.movement, C = this.getInternalMovement(i, this.state), L = E[0] === !1 ? Uv(C[0], f[0]) : E[0], k = E[1] === !1 ? Uv(C[1], f[1]) : E[1], I = this.checkIntentionality([L, k], C);
      if (I._blocked)
        return tn({}, I, {
          _movement: C,
          delta: [0, 0]
        });
      var B = I._intentional, V = C, P, R;
      if (B[0] !== !1 && E[0] === !1 && (R = Vl(a, this.state), P = Vl(u, this.state), v[0] = R[0], m[0] = P[0]), B[1] !== !1 && E[1] === !1) {
        var j, G;
        R = (j = R) != null ? j : Vl(a, this.state), P = (G = P) != null ? G : Vl(u, this.state), v[1] = R[1], m[1] = P[1];
      }
      var ee = [B[0] !== !1 ? C[0] - B[0] : v[0], B[1] !== !1 ? C[1] - B[1] : v[1]], W = kv(ee, S), re = y ? d : [0, 0];
      return ee = $v(m, kv(ee, v), re), tn({}, I, {
        intentional: B[0] !== !1 || B[1] !== !1,
        _initial: v,
        _movement: V,
        movement: ee,
        values: i,
        offset: $v(m, W, re),
        delta: Pv(ee, x)
      });
    }, e.clean = function() {
      this.clearTimeout();
    }, KT(t, [{
      key: "config",
      get: function() {
        return this.controller.config[this.stateKey];
      }
      // Is the gesture enabled
    }, {
      key: "enabled",
      get: function() {
        return this.controller.config.enabled && this.config.enabled;
      }
      // Returns the controller state for a given gesture
    }, {
      key: "state",
      get: function() {
        return this.controller.state[this.stateKey];
      }
      // Returns the gesture handler
    }, {
      key: "handler",
      get: function() {
        return this.controller.handlers[this.stateKey];
      }
    }]), t;
  }();
  function Uv(t, e) {
    return Math.abs(t) >= e ? Qd(t) * e : !1;
  }
  function $v(t, e, n) {
    var i = e[0], s = e[1], a = n[0], u = n[1], d = t[0], f = d[0], p = d[1], m = t[1], v = m[0], y = m[1];
    return [$s(i, f, p, a), $s(s, v, y, u)];
  }
  function tf(t, e, n) {
    var i = t.state, s = t.args, a = e.timeStamp, u = e.type, d = i.values, f = n ? 0 : a - i.startTime;
    return {
      _lastEventType: u,
      event: e,
      timeStamp: a,
      elapsedTime: f,
      args: s,
      previous: d
    };
  }
  function c2(t, e, n) {
    var i = t.state.offset, s = n.timeStamp;
    return tn({}, Bv()[t.stateKey], {
      _active: !0,
      values: e,
      initial: e,
      offset: i,
      lastOffset: i,
      startTime: s
    });
  }
  function d2(t, e) {
    return function(n) {
      for (var i = arguments.length, s = new Array(i > 1 ? i - 1 : 0), a = 1; a < i; a++)
        s[a - 1] = arguments[a];
      return t.call.apply(t, [this, tn({}, e, {
        event: n
      })].concat(s));
    };
  }
  var f2 = function(e) {
    var n = this;
    this.classes = e, this.bind = function() {
      for (var i = {}, s = arguments.length, a = new Array(s), u = 0; u < s; u++)
        a[u] = arguments[u];
      for (var d = zl(n.classes), f; !(f = d()).done; ) {
        var p = f.value;
        new p(n, a).addBindings(i);
      }
      for (var m = 0, v = Object.entries(n.nativeRefs); m < v.length; m++) {
        var y = v[m], E = y[0], S = y[1];
        nf(i, E, d2(S, tn({}, n.state.shared, {
          args: a
        })));
      }
      return n.config.domTarget ? g2(n, i) : v2(n, i);
    }, this.effect = function() {
      return n.config.domTarget && n.bind(), n.clean;
    }, this.clean = function() {
      var i = Vv(n.config), s = n.config.eventOptions;
      i && Vs(i, zv(n.domListeners), s), Object.values(n.timeouts).forEach(clearTimeout), h2(n);
    }, this.state = Bv(), this.timeouts = {}, this.domListeners = [], this.windowListeners = {};
  };
  function h2(t) {
    var e = t.config, n = e.window, i = e.eventOptions, s = t.windowListeners;
    if (n) {
      for (var a in s) {
        var u = s[a];
        Vs(n, u, i);
      }
      t.windowListeners = {};
    }
  }
  function p2(t, e) {
    var n = t.config, i = t.windowListeners;
    n.window && (Vs(n.window, i[e], n.eventOptions), delete i[e]);
  }
  function m2(t, e, n) {
    var i = t.config, s = t.windowListeners;
    n === void 0 && (n = []), i.window && (Vs(i.window, s[e], i.eventOptions), Wv(i.window, s[e] = n, i.eventOptions));
  }
  function g2(t, e) {
    var n = t.config, i = t.domListeners, s = Vv(n);
    if (!s)
      throw new Error("domTarget must be defined");
    var a = n.eventOptions;
    Vs(s, zv(i), a);
    for (var u = 0, d = Object.entries(e); u < d.length; u++) {
      var f = d[u], p = f[0], m = f[1], v = p.slice(2).toLowerCase();
      i.push([v, Fv.apply(void 0, m)]);
    }
    Wv(s, i, a);
  }
  function v2(t, e) {
    for (var n = t.config, i = {}, s = n.eventOptions.capture ? "Capture" : "", a = 0, u = Object.entries(e); a < u.length; a++) {
      var d = u[a], f = d[0], p = d[1], m = Array.isArray(p) ? p : [p], v = f + s;
      i[v] = Fv.apply(void 0, m);
    }
    return i;
  }
  function zv(t) {
    return t === void 0 && (t = []), t.splice(0, t.length);
  }
  function Vv(t) {
    var e = t.domTarget;
    return e && "current" in e ? e.current : e;
  }
  function nf(t, e, n) {
    t[e] || (t[e] = []), t[e].push(n);
  }
  function Wv(t, e, n) {
    e === void 0 && (e = []), n === void 0 && (n = {});
    for (var i = zl(e), s; !(s = i()).done; ) {
      var a = s.value, u = a[0], d = a[1];
      t.addEventListener(u, d, n);
    }
  }
  function Vs(t, e, n) {
    e === void 0 && (e = []), n === void 0 && (n = {});
    for (var i = zl(e), s; !(s = i()).done; ) {
      var a = s.value, u = a[0], d = a[1];
      t.removeEventListener(u, d, n);
    }
  }
  function y2(t, e, n) {
    n === void 0 && (n = {});
    var i = S2(t), s = gt.useMemo(function() {
      return new f2(i);
    }, []);
    return s.config = e, s.handlers = t, s.nativeRefs = n, gt.useEffect(s.effect, []), s.config.domTarget ? w2 : s.bind;
  }
  function w2() {
  }
  function S2(t) {
    var e = /* @__PURE__ */ new Set();
    return t.drag && e.add(Ni.get("drag")), t.wheel && e.add(Ni.get("wheel")), t.scroll && e.add(Ni.get("scroll")), t.move && e.add(Ni.get("move")), t.pinch && e.add(Ni.get("pinch")), t.hover && e.add(Ni.get("hover")), e;
  }
  var E2 = /* @__PURE__ */ function(t) {
    Dv(e, t);
    function e() {
      return t.apply(this, arguments) || this;
    }
    var n = e.prototype;
    return n.getInternalMovement = function(s, a) {
      return Pv(s, a.initial);
    }, n.checkIntentionality = function(s, a) {
      if (s[0] === !1 && s[1] === !1)
        return {
          _intentional: s,
          axis: this.state.axis
        };
      var u = a.map(Math.abs), d = u[0], f = u[1], p = this.state.axis || (d > f ? "x" : d < f ? "y" : void 0);
      return !this.config.axis && !this.config.lockDirection ? {
        _intentional: s,
        _blocked: !1,
        axis: p
      } : p ? this.config.axis && p !== this.config.axis ? {
        _intentional: s,
        _blocked: !0,
        axis: p
      } : (s[p === "x" ? 1 : 0] = !1, {
        _intentional: s,
        _blocked: !1,
        axis: p
      }) : {
        _intentional: [!1, !1],
        _blocked: !1,
        axis: p
      };
    }, n.getKinematics = function(s, a) {
      var u = this.getMovement(s);
      if (!u._blocked) {
        var d = a.timeStamp - this.state.timeStamp;
        Object.assign(u, GT(u.movement, u.delta, d));
      }
      return u;
    }, n.mapStateValues = function(s) {
      return {
        xy: s.values,
        vxvy: s.velocities
      };
    }, e;
  }(u2);
  function Gv(t) {
    if ("touches" in t) {
      var e = t.targetTouches, n = t.changedTouches;
      return e.length > 0 ? e : n;
    }
    return null;
  }
  function qv(t) {
    var e = "buttons" in t ? t.buttons : 0, n = Gv(t), i = n && n.length || 0, s = i > 0 || e > 0, a = t.shiftKey, u = t.altKey, d = t.metaKey, f = t.ctrlKey;
    return {
      touches: i,
      down: s,
      buttons: e,
      shiftKey: a,
      altKey: u,
      metaKey: d,
      ctrlKey: f
    };
  }
  function Yv(t) {
    var e = Gv(t), n = e ? e[0] : t, i = n.clientX, s = n.clientY;
    return [i, s];
  }
  var x2 = 3, b2 = 220, C2 = /* @__PURE__ */ function(t) {
    Dv(e, t);
    function e() {
      var i;
      return i = t.apply(this, arguments) || this, i.ingKey = "dragging", i.stateKey = "drag", i.onDragStart = function(s) {
        !i.enabled || i.state._active || (m2(i.controller, i.stateKey, [["pointermove", i.onDragChange], ["pointerup", i.onDragEnd], ["pointercancel", i.onDragEnd]]), i.updateGestureState({
          _pointerId: s.pointerId
        }), i.config.delay > 0 ? (i.state._delayedEvent = !0, "persist" in s && typeof s.persist == "function" && s.persist(), i.setTimeout(i.startDrag.bind($l(i)), i.config.delay, s)) : i.startDrag(s));
      }, i.onDragChange = function(s) {
        if (!i.state.canceled && s.pointerId === i.state._pointerId) {
          if (!i.state._active) {
            i.state._delayedEvent && (i.clearTimeout(), i.startDrag(s));
            return;
          }
          var a = qv(s);
          if (!a.down) {
            i.onDragEnd(s);
            return;
          }
          i.updateSharedState(a);
          var u = Yv(s), d = i.getKinematics(u, s), f = tf($l(i), s), p = i.state._isTap, m = Jd(d._movement);
          p && m >= x2 && (p = !1), i.updateGestureState(tn({}, f, d, {
            _isTap: p
          })), i.fireGestureHandler();
        }
      }, i.onDragEnd = function(s) {
        if (s.pointerId === i.state._pointerId) {
          i.state._active = !1, i.updateSharedState({
            down: !1,
            buttons: 0,
            touches: 0
          });
          var a = i.state._isTap, u = i.state.velocities, d = u[0], f = u[1], p = i.state.movement, m = p[0], v = p[1], y = i.state._intentional, E = y[0], S = y[1], x = i.config.swipeVelocity, C = x[0], L = x[1], k = i.config.swipeDistance, I = k[0], B = k[1], V = tn({}, tf($l(i), s), i.getMovement(i.state.values)), P = [0, 0];
          V.elapsedTime < b2 && (E !== !1 && Math.abs(d) > C && Math.abs(m) > I && (P[0] = Qd(d)), S !== !1 && Math.abs(f) > L && Math.abs(v) > B && (P[1] = Qd(f))), i.updateGestureState(tn({}, V, {
            tap: a,
            swipe: P
          })), i.fireGestureHandler(a === !0);
        }
      }, i.clean = function() {
        t.prototype.clean.call($l(i)), i.state._delayedEvent = !1, p2(i.controller, i.stateKey);
      }, i.onCancel = function() {
        i.state.canceled || (i.updateGestureState({
          canceled: !0
        }), i.state._active = !1, i.updateSharedState({
          down: !1,
          buttons: 0,
          touches: 0
        }), requestAnimationFrame(function() {
          return i.fireGestureHandler();
        }));
      }, i.onClick = function(s) {
        i.state._isTap || s.stopPropagation();
      }, i;
    }
    var n = e.prototype;
    return n.startDrag = function(s) {
      var a = Yv(s);
      this.updateSharedState(qv(s)), this.updateGestureState(tn({}, c2(this, a, s), tf(this, s, !0), {
        _pointerId: s.pointerId,
        cancel: this.onCancel
      })), this.updateGestureState(this.getMovement(a)), this.fireGestureHandler();
    }, n.addBindings = function(s) {
      if (nf(s, "onPointerDown", this.onDragStart), this.config.filterTaps) {
        var a = this.controller.config.eventOptions.capture ? "onClick" : "onClickCapture";
        nf(s, a, this.onClick);
      }
    }, e;
  }(E2);
  function T2(t, e) {
    var n, i = [], s, a = !1;
    function u() {
      for (var d = arguments.length, f = new Array(d), p = 0; p < d; p++)
        f[p] = arguments[p];
      return a && n === this && e(f, i) || (s = t.apply(this, f), a = !0, n = this, i = f), s;
    }
    return u;
  }
  function Wl(t, e) {
    if (t === e)
      return !0;
    if (t && e && typeof t == "object" && typeof e == "object") {
      if (t.constructor !== e.constructor)
        return !1;
      var n, i, s;
      if (Array.isArray(t)) {
        if (n = t.length, n !== e.length)
          return !1;
        for (i = n; i-- !== 0; )
          if (!Wl(t[i], e[i]))
            return !1;
        return !0;
      }
      var a;
      if (typeof Map == "function" && t instanceof Map && e instanceof Map) {
        if (t.size !== e.size)
          return !1;
        for (a = t.entries(); !(i = a.next()).done; )
          if (!e.has(i.value[0]))
            return !1;
        for (a = t.entries(); !(i = a.next()).done; )
          if (!Wl(i.value[1], e.get(i.value[0])))
            return !1;
        return !0;
      }
      if (typeof Set == "function" && t instanceof Set && e instanceof Set) {
        if (t.size !== e.size)
          return !1;
        for (a = t.entries(); !(i = a.next()).done; )
          if (!e.has(i.value[0]))
            return !1;
        return !0;
      }
      if (t.constructor === RegExp)
        return t.source === e.source && t.flags === e.flags;
      if (t.valueOf !== Object.prototype.valueOf)
        return t.valueOf() === e.valueOf();
      if (t.toString !== Object.prototype.toString)
        return t.toString() === e.toString();
      if (s = Object.keys(t), n = s.length, n !== Object.keys(e).length)
        return !1;
      for (i = n; i-- !== 0; )
        if (!Object.prototype.hasOwnProperty.call(e, s[i]))
          return !1;
      if (typeof Element < "u" && t instanceof Element)
        return !1;
      for (i = n; i-- !== 0; )
        if (!(s[i] === "_owner" && t.$$typeof) && !Wl(t[s[i]], e[s[i]]))
          return !1;
      return !0;
    }
    return t !== t && e !== e;
  }
  function O2(t, e) {
    try {
      return Wl(t, e);
    } catch (n) {
      if ((n.message || "").match(/stack|recursion/i))
        return console.warn("react-fast-compare cannot handle circular refs"), !1;
      throw n;
    }
  }
  function _2(t, e) {
    e === void 0 && (e = {}), Ni.set("drag", C2);
    var n = N.useRef();
    return n.current || (n.current = T2(l2, O2)), y2({
      drag: t
    }, n.current(e));
  }
  /*!
  * tabbable 5.3.3
  * @license MIT, https://github.com/focus-trap/tabbable/blob/master/LICENSE
  */
  var Kv = ["input", "select", "textarea", "a[href]", "button", "[tabindex]:not(slot)", "audio[controls]", "video[controls]", '[contenteditable]:not([contenteditable="false"])', "details>summary:first-of-type", "details"], Gl = /* @__PURE__ */ Kv.join(","), Zv = typeof Element > "u", Di = Zv ? function() {
  } : Element.prototype.matches || Element.prototype.msMatchesSelector || Element.prototype.webkitMatchesSelector, rf = !Zv && Element.prototype.getRootNode ? function(t) {
    return t.getRootNode();
  } : function(t) {
    return t.ownerDocument;
  }, Xv = function(e, n, i) {
    var s = Array.prototype.slice.apply(e.querySelectorAll(Gl));
    return n && Di.call(e, Gl) && s.unshift(e), s = s.filter(i), s;
  }, Jv = function t(e, n, i) {
    for (var s = [], a = Array.from(e); a.length; ) {
      var u = a.shift();
      if (u.tagName === "SLOT") {
        var d = u.assignedElements(), f = d.length ? d : u.children, p = t(f, !0, i);
        i.flatten ? s.push.apply(s, p) : s.push({
          scope: u,
          candidates: p
        });
      } else {
        var m = Di.call(u, Gl);
        m && i.filter(u) && (n || !e.includes(u)) && s.push(u);
        var v = u.shadowRoot || // check for an undisclosed shadow
        typeof i.getShadowRoot == "function" && i.getShadowRoot(u), y = !i.shadowRootFilter || i.shadowRootFilter(u);
        if (v && y) {
          var E = t(v === !0 ? u.children : v.children, !0, i);
          i.flatten ? s.push.apply(s, E) : s.push({
            scope: u,
            candidates: E
          });
        } else
          a.unshift.apply(a, u.children);
      }
    }
    return s;
  }, Qv = function(e, n) {
    return e.tabIndex < 0 && (n || /^(AUDIO|VIDEO|DETAILS)$/.test(e.tagName) || e.isContentEditable) && isNaN(parseInt(e.getAttribute("tabindex"), 10)) ? 0 : e.tabIndex;
  }, R2 = function(e, n) {
    return e.tabIndex === n.tabIndex ? e.documentOrder - n.documentOrder : e.tabIndex - n.tabIndex;
  }, ey = function(e) {
    return e.tagName === "INPUT";
  }, L2 = function(e) {
    return ey(e) && e.type === "hidden";
  }, A2 = function(e) {
    var n = e.tagName === "DETAILS" && Array.prototype.slice.apply(e.children).some(function(i) {
      return i.tagName === "SUMMARY";
    });
    return n;
  }, k2 = function(e, n) {
    for (var i = 0; i < e.length; i++)
      if (e[i].checked && e[i].form === n)
        return e[i];
  }, P2 = function(e) {
    if (!e.name)
      return !0;
    var n = e.form || rf(e), i = function(d) {
      return n.querySelectorAll('input[type="radio"][name="' + d + '"]');
    }, s;
    if (typeof window < "u" && typeof window.CSS < "u" && typeof window.CSS.escape == "function")
      s = i(window.CSS.escape(e.name));
    else
      try {
        s = i(e.name);
      } catch (u) {
        return console.error("Looks like you have a radio button with a name attribute containing invalid CSS selector characters and need the CSS.escape polyfill: %s", u.message), !1;
      }
    var a = k2(s, e.form);
    return !a || a === e;
  }, I2 = function(e) {
    return ey(e) && e.type === "radio";
  }, N2 = function(e) {
    return I2(e) && !P2(e);
  }, ty = function(e) {
    var n = e.getBoundingClientRect(), i = n.width, s = n.height;
    return i === 0 && s === 0;
  }, D2 = function(e, n) {
    var i = n.displayCheck, s = n.getShadowRoot;
    if (getComputedStyle(e).visibility === "hidden")
      return !0;
    var a = Di.call(e, "details>summary:first-of-type"), u = a ? e.parentElement : e;
    if (Di.call(u, "details:not([open]) *"))
      return !0;
    var d = rf(e).host, f = (d == null ? void 0 : d.ownerDocument.contains(d)) || e.ownerDocument.contains(e);
    if (!i || i === "full") {
      if (typeof s == "function") {
        for (var p = e; e; ) {
          var m = e.parentElement, v = rf(e);
          if (m && !m.shadowRoot && s(m) === !0)
            return ty(e);
          e.assignedSlot ? e = e.assignedSlot : !m && v !== e.ownerDocument ? e = v.host : e = m;
        }
        e = p;
      }
      if (f)
        return !e.getClientRects().length;
    } else if (i === "non-zero-area")
      return ty(e);
    return !1;
  }, j2 = function(e) {
    if (/^(INPUT|BUTTON|SELECT|TEXTAREA)$/.test(e.tagName))
      for (var n = e.parentElement; n; ) {
        if (n.tagName === "FIELDSET" && n.disabled) {
          for (var i = 0; i < n.children.length; i++) {
            var s = n.children.item(i);
            if (s.tagName === "LEGEND")
              return Di.call(n, "fieldset[disabled] *") ? !0 : !s.contains(e);
          }
          return !0;
        }
        n = n.parentElement;
      }
    return !1;
  }, ql = function(e, n) {
    return !(n.disabled || L2(n) || D2(n, e) || // For a details element with a summary, the summary element gets the focus
    A2(n) || j2(n));
  }, of = function(e, n) {
    return !(N2(n) || Qv(n) < 0 || !ql(e, n));
  }, M2 = function(e) {
    var n = parseInt(e.getAttribute("tabindex"), 10);
    return !!(isNaN(n) || n >= 0);
  }, F2 = function t(e) {
    var n = [], i = [];
    return e.forEach(function(s, a) {
      var u = !!s.scope, d = u ? s.scope : s, f = Qv(d, u), p = u ? t(s.candidates) : d;
      f === 0 ? u ? n.push.apply(n, p) : n.push(d) : i.push({
        documentOrder: a,
        tabIndex: f,
        item: s,
        isScope: u,
        content: p
      });
    }), i.sort(R2).reduce(function(s, a) {
      return a.isScope ? s.push.apply(s, a.content) : s.push(a.content), s;
    }, []).concat(n);
  }, H2 = function(e, n) {
    n = n || {};
    var i;
    return n.getShadowRoot ? i = Jv([e], n.includeContainer, {
      filter: of.bind(null, n),
      flatten: !1,
      getShadowRoot: n.getShadowRoot,
      shadowRootFilter: M2
    }) : i = Xv(e, n.includeContainer, of.bind(null, n)), F2(i);
  }, B2 = function(e, n) {
    n = n || {};
    var i;
    return n.getShadowRoot ? i = Jv([e], n.includeContainer, {
      filter: ql.bind(null, n),
      flatten: !0,
      getShadowRoot: n.getShadowRoot
    }) : i = Xv(e, n.includeContainer, ql.bind(null, n)), i;
  }, Yl = function(e, n) {
    if (n = n || {}, !e)
      throw new Error("No node provided");
    return Di.call(e, Gl) === !1 ? !1 : of(n, e);
  }, U2 = /* @__PURE__ */ Kv.concat("iframe").join(","), sf = function(e, n) {
    if (n = n || {}, !e)
      throw new Error("No node provided");
    return Di.call(e, U2) === !1 ? !1 : ql(n, e);
  };
  /*!
  * focus-trap 6.9.4
  * @license MIT, https://github.com/focus-trap/focus-trap/blob/master/LICENSE
  */
  function ny(t, e) {
    var n = Object.keys(t);
    if (Object.getOwnPropertySymbols) {
      var i = Object.getOwnPropertySymbols(t);
      e && (i = i.filter(function(s) {
        return Object.getOwnPropertyDescriptor(t, s).enumerable;
      })), n.push.apply(n, i);
    }
    return n;
  }
  function ry(t) {
    for (var e = 1; e < arguments.length; e++) {
      var n = arguments[e] != null ? arguments[e] : {};
      e % 2 ? ny(Object(n), !0).forEach(function(i) {
        $2(t, i, n[i]);
      }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(t, Object.getOwnPropertyDescriptors(n)) : ny(Object(n)).forEach(function(i) {
        Object.defineProperty(t, i, Object.getOwnPropertyDescriptor(n, i));
      });
    }
    return t;
  }
  function $2(t, e, n) {
    return e in t ? Object.defineProperty(t, e, {
      value: n,
      enumerable: !0,
      configurable: !0,
      writable: !0
    }) : t[e] = n, t;
  }
  var iy = /* @__PURE__ */ function() {
    var t = [];
    return {
      activateTrap: function(n) {
        if (t.length > 0) {
          var i = t[t.length - 1];
          i !== n && i.pause();
        }
        var s = t.indexOf(n);
        s === -1 || t.splice(s, 1), t.push(n);
      },
      deactivateTrap: function(n) {
        var i = t.indexOf(n);
        i !== -1 && t.splice(i, 1), t.length > 0 && t[t.length - 1].unpause();
      }
    };
  }(), z2 = function(e) {
    return e.tagName && e.tagName.toLowerCase() === "input" && typeof e.select == "function";
  }, V2 = function(e) {
    return e.key === "Escape" || e.key === "Esc" || e.keyCode === 27;
  }, W2 = function(e) {
    return e.key === "Tab" || e.keyCode === 9;
  }, oy = function(e) {
    return setTimeout(e, 0);
  }, sy = function(e, n) {
    var i = -1;
    return e.every(function(s, a) {
      return n(s) ? (i = a, !1) : !0;
    }), i;
  }, Ws = function(e) {
    for (var n = arguments.length, i = new Array(n > 1 ? n - 1 : 0), s = 1; s < n; s++)
      i[s - 1] = arguments[s];
    return typeof e == "function" ? e.apply(void 0, i) : e;
  }, Kl = function(e) {
    return e.target.shadowRoot && typeof e.composedPath == "function" ? e.composedPath()[0] : e.target;
  }, G2 = function(e, n) {
    var i = (n == null ? void 0 : n.document) || document, s = ry({
      returnFocusOnDeactivate: !0,
      escapeDeactivates: !0,
      delayInitialFocus: !0
    }, n), a = {
      // containers given to createFocusTrap()
      // @type {Array<HTMLElement>}
      containers: [],
      // list of objects identifying tabbable nodes in `containers` in the trap
      // NOTE: it's possible that a group has no tabbable nodes if nodes get removed while the trap
      //  is active, but the trap should never get to a state where there isn't at least one group
      //  with at least one tabbable node in it (that would lead to an error condition that would
      //  result in an error being thrown)
      // @type {Array<{
      //   container: HTMLElement,
      //   tabbableNodes: Array<HTMLElement>, // empty if none
      //   focusableNodes: Array<HTMLElement>, // empty if none
      //   firstTabbableNode: HTMLElement|null,
      //   lastTabbableNode: HTMLElement|null,
      //   nextTabbableNode: (node: HTMLElement, forward: boolean) => HTMLElement|undefined
      // }>}
      containerGroups: [],
      // same order/length as `containers` list
      // references to objects in `containerGroups`, but only those that actually have
      //  tabbable nodes in them
      // NOTE: same order as `containers` and `containerGroups`, but __not necessarily__
      //  the same length
      tabbableGroups: [],
      nodeFocusedBeforeActivation: null,
      mostRecentlyFocusedNode: null,
      active: !1,
      paused: !1,
      // timer ID for when delayInitialFocus is true and initial focus in this trap
      //  has been delayed during activation
      delayInitialFocusTimer: void 0
    }, u, d = function(P, R, j) {
      return P && P[R] !== void 0 ? P[R] : s[j || R];
    }, f = function(P) {
      return a.containerGroups.findIndex(function(R) {
        var j = R.container, G = R.tabbableNodes;
        return j.contains(P) || // fall back to explicit tabbable search which will take into consideration any
        //  web components if the `tabbableOptions.getShadowRoot` option was used for
        //  the trap, enabling shadow DOM support in tabbable (`Node.contains()` doesn't
        //  look inside web components even if open)
        G.find(function(ee) {
          return ee === P;
        });
      });
    }, p = function(P) {
      var R = s[P];
      if (typeof R == "function") {
        for (var j = arguments.length, G = new Array(j > 1 ? j - 1 : 0), ee = 1; ee < j; ee++)
          G[ee - 1] = arguments[ee];
        R = R.apply(void 0, G);
      }
      if (R === !0 && (R = void 0), !R) {
        if (R === void 0 || R === !1)
          return R;
        throw new Error("`".concat(P, "` was specified but was not a node, or did not return a node"));
      }
      var W = R;
      if (typeof R == "string" && (W = i.querySelector(R), !W))
        throw new Error("`".concat(P, "` as selector refers to no known node"));
      return W;
    }, m = function() {
      var P = p("initialFocus");
      if (P === !1)
        return !1;
      if (P === void 0)
        if (f(i.activeElement) >= 0)
          P = i.activeElement;
        else {
          var R = a.tabbableGroups[0], j = R && R.firstTabbableNode;
          P = j || p("fallbackFocus");
        }
      if (!P)
        throw new Error("Your focus-trap needs to have at least one focusable element");
      return P;
    }, v = function() {
      if (a.containerGroups = a.containers.map(function(P) {
        var R = H2(P, s.tabbableOptions), j = B2(P, s.tabbableOptions);
        return {
          container: P,
          tabbableNodes: R,
          focusableNodes: j,
          firstTabbableNode: R.length > 0 ? R[0] : null,
          lastTabbableNode: R.length > 0 ? R[R.length - 1] : null,
          /**
           * Finds the __tabbable__ node that follows the given node in the specified direction,
           *  in this container, if any.
           * @param {HTMLElement} node
           * @param {boolean} [forward] True if going in forward tab order; false if going
           *  in reverse.
           * @returns {HTMLElement|undefined} The next tabbable node, if any.
           */
          nextTabbableNode: function(ee) {
            var W = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : !0, re = j.findIndex(function(we) {
              return we === ee;
            });
            if (!(re < 0))
              return W ? j.slice(re + 1).find(function(we) {
                return Yl(we, s.tabbableOptions);
              }) : j.slice(0, re).reverse().find(function(we) {
                return Yl(we, s.tabbableOptions);
              });
          }
        };
      }), a.tabbableGroups = a.containerGroups.filter(function(P) {
        return P.tabbableNodes.length > 0;
      }), a.tabbableGroups.length <= 0 && !p("fallbackFocus"))
        throw new Error("Your focus-trap must have at least one container with at least one tabbable node in it at all times");
    }, y = function V(P) {
      if (P !== !1 && P !== i.activeElement) {
        if (!P || !P.focus) {
          V(m());
          return;
        }
        P.focus({
          preventScroll: !!s.preventScroll
        }), a.mostRecentlyFocusedNode = P, z2(P) && P.select();
      }
    }, E = function(P) {
      var R = p("setReturnFocus", P);
      return R || (R === !1 ? !1 : P);
    }, S = function(P) {
      var R = Kl(P);
      if (!(f(R) >= 0)) {
        if (Ws(s.clickOutsideDeactivates, P)) {
          u.deactivate({
            // if, on deactivation, we should return focus to the node originally-focused
            //  when the trap was activated (or the configured `setReturnFocus` node),
            //  then assume it's also OK to return focus to the outside node that was
            //  just clicked, causing deactivation, as long as that node is focusable;
            //  if it isn't focusable, then return focus to the original node focused
            //  on activation (or the configured `setReturnFocus` node)
            // NOTE: by setting `returnFocus: false`, deactivate() will do nothing,
            //  which will result in the outside click setting focus to the node
            //  that was clicked, whether it's focusable or not; by setting
            //  `returnFocus: true`, we'll attempt to re-focus the node originally-focused
            //  on activation (or the configured `setReturnFocus` node)
            returnFocus: s.returnFocusOnDeactivate && !sf(R, s.tabbableOptions)
          });
          return;
        }
        Ws(s.allowOutsideClick, P) || P.preventDefault();
      }
    }, x = function(P) {
      var R = Kl(P), j = f(R) >= 0;
      j || R instanceof Document ? j && (a.mostRecentlyFocusedNode = R) : (P.stopImmediatePropagation(), y(a.mostRecentlyFocusedNode || m()));
    }, C = function(P) {
      var R = Kl(P);
      v();
      var j = null;
      if (a.tabbableGroups.length > 0) {
        var G = f(R), ee = G >= 0 ? a.containerGroups[G] : void 0;
        if (G < 0)
          P.shiftKey ? j = a.tabbableGroups[a.tabbableGroups.length - 1].lastTabbableNode : j = a.tabbableGroups[0].firstTabbableNode;
        else if (P.shiftKey) {
          var W = sy(a.tabbableGroups, function(ge) {
            var q = ge.firstTabbableNode;
            return R === q;
          });
          if (W < 0 && (ee.container === R || sf(R, s.tabbableOptions) && !Yl(R, s.tabbableOptions) && !ee.nextTabbableNode(R, !1)) && (W = G), W >= 0) {
            var re = W === 0 ? a.tabbableGroups.length - 1 : W - 1, we = a.tabbableGroups[re];
            j = we.lastTabbableNode;
          }
        } else {
          var ye = sy(a.tabbableGroups, function(ge) {
            var q = ge.lastTabbableNode;
            return R === q;
          });
          if (ye < 0 && (ee.container === R || sf(R, s.tabbableOptions) && !Yl(R, s.tabbableOptions) && !ee.nextTabbableNode(R)) && (ye = G), ye >= 0) {
            var be = ye === a.tabbableGroups.length - 1 ? 0 : ye + 1, Be = a.tabbableGroups[be];
            j = Be.firstTabbableNode;
          }
        }
      } else
        j = p("fallbackFocus");
      j && (P.preventDefault(), y(j));
    }, L = function(P) {
      if (V2(P) && Ws(s.escapeDeactivates, P) !== !1) {
        P.preventDefault(), u.deactivate();
        return;
      }
      if (W2(P)) {
        C(P);
        return;
      }
    }, k = function(P) {
      var R = Kl(P);
      f(R) >= 0 || Ws(s.clickOutsideDeactivates, P) || Ws(s.allowOutsideClick, P) || (P.preventDefault(), P.stopImmediatePropagation());
    }, I = function() {
      if (a.active)
        return iy.activateTrap(u), a.delayInitialFocusTimer = s.delayInitialFocus ? oy(function() {
          y(m());
        }) : y(m()), i.addEventListener("focusin", x, !0), i.addEventListener("mousedown", S, {
          capture: !0,
          passive: !1
        }), i.addEventListener("touchstart", S, {
          capture: !0,
          passive: !1
        }), i.addEventListener("click", k, {
          capture: !0,
          passive: !1
        }), i.addEventListener("keydown", L, {
          capture: !0,
          passive: !1
        }), u;
    }, B = function() {
      if (a.active)
        return i.removeEventListener("focusin", x, !0), i.removeEventListener("mousedown", S, !0), i.removeEventListener("touchstart", S, !0), i.removeEventListener("click", k, !0), i.removeEventListener("keydown", L, !0), u;
    };
    return u = {
      get active() {
        return a.active;
      },
      get paused() {
        return a.paused;
      },
      activate: function(P) {
        if (a.active)
          return this;
        var R = d(P, "onActivate"), j = d(P, "onPostActivate"), G = d(P, "checkCanFocusTrap");
        G || v(), a.active = !0, a.paused = !1, a.nodeFocusedBeforeActivation = i.activeElement, R && R();
        var ee = function() {
          G && v(), I(), j && j();
        };
        return G ? (G(a.containers.concat()).then(ee, ee), this) : (ee(), this);
      },
      deactivate: function(P) {
        if (!a.active)
          return this;
        var R = ry({
          onDeactivate: s.onDeactivate,
          onPostDeactivate: s.onPostDeactivate,
          checkCanReturnFocus: s.checkCanReturnFocus
        }, P);
        clearTimeout(a.delayInitialFocusTimer), a.delayInitialFocusTimer = void 0, B(), a.active = !1, a.paused = !1, iy.deactivateTrap(u);
        var j = d(R, "onDeactivate"), G = d(R, "onPostDeactivate"), ee = d(R, "checkCanReturnFocus"), W = d(R, "returnFocus", "returnFocusOnDeactivate");
        j && j();
        var re = function() {
          oy(function() {
            W && y(E(a.nodeFocusedBeforeActivation)), G && G();
          });
        };
        return W && ee ? (ee(E(a.nodeFocusedBeforeActivation)).then(re, re), this) : (re(), this);
      },
      pause: function() {
        return a.paused || !a.active ? this : (a.paused = !0, B(), this);
      },
      unpause: function() {
        return !a.paused || !a.active ? this : (a.paused = !1, v(), I(), this);
      },
      updateContainerElements: function(P) {
        var R = [].concat(P).filter(Boolean);
        return a.containers = R.map(function(j) {
          return typeof j == "string" ? i.querySelector(j) : j;
        }), a.active && v(), this;
      }
    }, u.updateContainerElements(e), u;
  };
  function q2(t) {
    if (Array.isArray(t)) {
      for (var e = 0, n = Array(t.length); e < t.length; e++)
        n[e] = t[e];
      return n;
    } else
      return Array.from(t);
  }
  var af = !1;
  if (typeof window < "u") {
    var ay = {
      get passive() {
        af = !0;
      }
    };
    window.addEventListener("testPassive", null, ay), window.removeEventListener("testPassive", null, ay);
  }
  var ly = typeof window < "u" && window.navigator && window.navigator.platform && (/iP(ad|hone|od)/.test(window.navigator.platform) || window.navigator.platform === "MacIntel" && window.navigator.maxTouchPoints > 1), Wr = [], Zl = !1, uy = -1, Gs = void 0, qs = void 0, cy = function(e) {
    return Wr.some(function(n) {
      return !!(n.options.allowTouchMove && n.options.allowTouchMove(e));
    });
  }, Xl = function(e) {
    var n = e || window.event;
    return cy(n.target) || n.touches.length > 1 ? !0 : (n.preventDefault && n.preventDefault(), !1);
  }, Y2 = function(e) {
    if (qs === void 0) {
      var n = !!e && e.reserveScrollBarGap === !0, i = window.innerWidth - document.documentElement.clientWidth;
      n && i > 0 && (qs = document.body.style.paddingRight, document.body.style.paddingRight = i + "px");
    }
    Gs === void 0 && (Gs = document.body.style.overflow, document.body.style.overflow = "hidden");
  }, K2 = function() {
    qs !== void 0 && (document.body.style.paddingRight = qs, qs = void 0), Gs !== void 0 && (document.body.style.overflow = Gs, Gs = void 0);
  }, Z2 = function(e) {
    return e ? e.scrollHeight - e.scrollTop <= e.clientHeight : !1;
  }, X2 = function(e, n) {
    var i = e.targetTouches[0].clientY - uy;
    return cy(e.target) ? !1 : n && n.scrollTop === 0 && i > 0 || Z2(n) && i < 0 ? Xl(e) : (e.stopPropagation(), !0);
  }, J2 = function(e, n) {
    if (!e) {
      console.error("disableBodyScroll unsuccessful - targetElement must be provided when calling disableBodyScroll on IOS devices.");
      return;
    }
    if (!Wr.some(function(s) {
      return s.targetElement === e;
    })) {
      var i = {
        targetElement: e,
        options: n || {}
      };
      Wr = [].concat(q2(Wr), [i]), ly ? (e.ontouchstart = function(s) {
        s.targetTouches.length === 1 && (uy = s.targetTouches[0].clientY);
      }, e.ontouchmove = function(s) {
        s.targetTouches.length === 1 && X2(s, e);
      }, Zl || (document.addEventListener("touchmove", Xl, af ? { passive: !1 } : void 0), Zl = !0)) : Y2(n);
    }
  }, Q2 = function(e) {
    if (!e) {
      console.error("enableBodyScroll unsuccessful - targetElement must be provided when calling enableBodyScroll on IOS devices.");
      return;
    }
    Wr = Wr.filter(function(n) {
      return n.targetElement !== e;
    }), ly ? (e.ontouchstart = null, e.ontouchmove = null, Zl && Wr.length === 0 && (document.removeEventListener("touchmove", Xl, af ? { passive: !1 } : void 0), Zl = !1)) : Wr.length || K2();
  }, ji = [], eO = function() {
    return ji.some(function(t) {
      return t.activeTargets.length > 0;
    });
  }, tO = function() {
    return ji.some(function(t) {
      return t.skippedTargets.length > 0;
    });
  }, dy = "ResizeObserver loop completed with undelivered notifications.", nO = function() {
    var t;
    typeof ErrorEvent == "function" ? t = new ErrorEvent("error", {
      message: dy
    }) : (t = document.createEvent("Event"), t.initEvent("error", !1, !1), t.message = dy), window.dispatchEvent(t);
  }, Ys;
  (function(t) {
    t.BORDER_BOX = "border-box", t.CONTENT_BOX = "content-box", t.DEVICE_PIXEL_CONTENT_BOX = "device-pixel-content-box";
  })(Ys || (Ys = {}));
  var Mi = function(t) {
    return Object.freeze(t);
  }, rO = /* @__PURE__ */ function() {
    function t(e, n) {
      this.inlineSize = e, this.blockSize = n, Mi(this);
    }
    return t;
  }(), fy = function() {
    function t(e, n, i, s) {
      return this.x = e, this.y = n, this.width = i, this.height = s, this.top = this.y, this.left = this.x, this.bottom = this.top + this.height, this.right = this.left + this.width, Mi(this);
    }
    return t.prototype.toJSON = function() {
      var e = this, n = e.x, i = e.y, s = e.top, a = e.right, u = e.bottom, d = e.left, f = e.width, p = e.height;
      return { x: n, y: i, top: s, right: a, bottom: u, left: d, width: f, height: p };
    }, t.fromRect = function(e) {
      return new t(e.x, e.y, e.width, e.height);
    }, t;
  }(), lf = function(t) {
    return t instanceof SVGElement && "getBBox" in t;
  }, hy = function(t) {
    if (lf(t)) {
      var e = t.getBBox(), n = e.width, i = e.height;
      return !n && !i;
    }
    var s = t, a = s.offsetWidth, u = s.offsetHeight;
    return !(a || u || t.getClientRects().length);
  }, py = function(t) {
    var e;
    if (t instanceof Element)
      return !0;
    var n = (e = t == null ? void 0 : t.ownerDocument) === null || e === void 0 ? void 0 : e.defaultView;
    return !!(n && t instanceof n.Element);
  }, iO = function(t) {
    switch (t.tagName) {
      case "INPUT":
        if (t.type !== "image")
          break;
      case "VIDEO":
      case "AUDIO":
      case "EMBED":
      case "OBJECT":
      case "CANVAS":
      case "IFRAME":
      case "IMG":
        return !0;
    }
    return !1;
  }, Ks = typeof window < "u" ? window : {}, Jl = /* @__PURE__ */ new WeakMap(), my = /auto|scroll/, oO = /^tb|vertical/, sO = /msie|trident/i.test(Ks.navigator && Ks.navigator.userAgent), ar = function(t) {
    return parseFloat(t || "0");
  }, Io = function(t, e, n) {
    return t === void 0 && (t = 0), e === void 0 && (e = 0), n === void 0 && (n = !1), new rO((n ? e : t) || 0, (n ? t : e) || 0);
  }, gy = Mi({
    devicePixelContentBoxSize: Io(),
    borderBoxSize: Io(),
    contentBoxSize: Io(),
    contentRect: new fy(0, 0, 0, 0)
  }), vy = function(t, e) {
    if (e === void 0 && (e = !1), Jl.has(t) && !e)
      return Jl.get(t);
    if (hy(t))
      return Jl.set(t, gy), gy;
    var n = getComputedStyle(t), i = lf(t) && t.ownerSVGElement && t.getBBox(), s = !sO && n.boxSizing === "border-box", a = oO.test(n.writingMode || ""), u = !i && my.test(n.overflowY || ""), d = !i && my.test(n.overflowX || ""), f = i ? 0 : ar(n.paddingTop), p = i ? 0 : ar(n.paddingRight), m = i ? 0 : ar(n.paddingBottom), v = i ? 0 : ar(n.paddingLeft), y = i ? 0 : ar(n.borderTopWidth), E = i ? 0 : ar(n.borderRightWidth), S = i ? 0 : ar(n.borderBottomWidth), x = i ? 0 : ar(n.borderLeftWidth), C = v + p, L = f + m, k = x + E, I = y + S, B = d ? t.offsetHeight - I - t.clientHeight : 0, V = u ? t.offsetWidth - k - t.clientWidth : 0, P = s ? C + k : 0, R = s ? L + I : 0, j = i ? i.width : ar(n.width) - P - V, G = i ? i.height : ar(n.height) - R - B, ee = j + C + V + k, W = G + L + B + I, re = Mi({
      devicePixelContentBoxSize: Io(Math.round(j * devicePixelRatio), Math.round(G * devicePixelRatio), a),
      borderBoxSize: Io(ee, W, a),
      contentBoxSize: Io(j, G, a),
      contentRect: new fy(v, f, j, G)
    });
    return Jl.set(t, re), re;
  }, yy = function(t, e, n) {
    var i = vy(t, n), s = i.borderBoxSize, a = i.contentBoxSize, u = i.devicePixelContentBoxSize;
    switch (e) {
      case Ys.DEVICE_PIXEL_CONTENT_BOX:
        return u;
      case Ys.BORDER_BOX:
        return s;
      default:
        return a;
    }
  }, aO = /* @__PURE__ */ function() {
    function t(e) {
      var n = vy(e);
      this.target = e, this.contentRect = n.contentRect, this.borderBoxSize = Mi([n.borderBoxSize]), this.contentBoxSize = Mi([n.contentBoxSize]), this.devicePixelContentBoxSize = Mi([n.devicePixelContentBoxSize]);
    }
    return t;
  }(), wy = function(t) {
    if (hy(t))
      return 1 / 0;
    for (var e = 0, n = t.parentNode; n; )
      e += 1, n = n.parentNode;
    return e;
  }, lO = function() {
    var t = 1 / 0, e = [];
    ji.forEach(function(u) {
      if (u.activeTargets.length !== 0) {
        var d = [];
        u.activeTargets.forEach(function(p) {
          var m = new aO(p.target), v = wy(p.target);
          d.push(m), p.lastReportedSize = yy(p.target, p.observedBox), v < t && (t = v);
        }), e.push(function() {
          u.callback.call(u.observer, d, u.observer);
        }), u.activeTargets.splice(0, u.activeTargets.length);
      }
    });
    for (var n = 0, i = e; n < i.length; n++) {
      var s = i[n];
      s();
    }
    return t;
  }, Sy = function(t) {
    ji.forEach(function(n) {
      n.activeTargets.splice(0, n.activeTargets.length), n.skippedTargets.splice(0, n.skippedTargets.length), n.observationTargets.forEach(function(s) {
        s.isActive() && (wy(s.target) > t ? n.activeTargets.push(s) : n.skippedTargets.push(s));
      });
    });
  }, uO = function() {
    var t = 0;
    for (Sy(t); eO(); )
      t = lO(), Sy(t);
    return tO() && nO(), t > 0;
  }, uf, Ey = [], cO = function() {
    return Ey.splice(0).forEach(function(t) {
      return t();
    });
  }, dO = function(t) {
    if (!uf) {
      var e = 0, n = document.createTextNode(""), i = { characterData: !0 };
      new MutationObserver(function() {
        return cO();
      }).observe(n, i), uf = function() {
        n.textContent = "".concat(e ? e-- : e++);
      };
    }
    Ey.push(t), uf();
  }, fO = function(t) {
    dO(function() {
      requestAnimationFrame(t);
    });
  }, Ql = 0, hO = function() {
    return !!Ql;
  }, pO = 250, mO = { attributes: !0, characterData: !0, childList: !0, subtree: !0 }, xy = [
    "resize",
    "load",
    "transitionend",
    "animationend",
    "animationstart",
    "animationiteration",
    "keyup",
    "keydown",
    "mouseup",
    "mousedown",
    "mouseover",
    "mouseout",
    "blur",
    "focus"
  ], by = function(t) {
    return t === void 0 && (t = 0), Date.now() + t;
  }, cf = !1, gO = function() {
    function t() {
      var e = this;
      this.stopped = !0, this.listener = function() {
        return e.schedule();
      };
    }
    return t.prototype.run = function(e) {
      var n = this;
      if (e === void 0 && (e = pO), !cf) {
        cf = !0;
        var i = by(e);
        fO(function() {
          var s = !1;
          try {
            s = uO();
          } finally {
            if (cf = !1, e = i - by(), !hO())
              return;
            s ? n.run(1e3) : e > 0 ? n.run(e) : n.start();
          }
        });
      }
    }, t.prototype.schedule = function() {
      this.stop(), this.run();
    }, t.prototype.observe = function() {
      var e = this, n = function() {
        return e.observer && e.observer.observe(document.body, mO);
      };
      document.body ? n() : Ks.addEventListener("DOMContentLoaded", n);
    }, t.prototype.start = function() {
      var e = this;
      this.stopped && (this.stopped = !1, this.observer = new MutationObserver(this.listener), this.observe(), xy.forEach(function(n) {
        return Ks.addEventListener(n, e.listener, !0);
      }));
    }, t.prototype.stop = function() {
      var e = this;
      this.stopped || (this.observer && this.observer.disconnect(), xy.forEach(function(n) {
        return Ks.removeEventListener(n, e.listener, !0);
      }), this.stopped = !0);
    }, t;
  }(), df = new gO(), Cy = function(t) {
    !Ql && t > 0 && df.start(), Ql += t, !Ql && df.stop();
  }, vO = function(t) {
    return !lf(t) && !iO(t) && getComputedStyle(t).display === "inline";
  }, yO = function() {
    function t(e, n) {
      this.target = e, this.observedBox = n || Ys.CONTENT_BOX, this.lastReportedSize = {
        inlineSize: 0,
        blockSize: 0
      };
    }
    return t.prototype.isActive = function() {
      var e = yy(this.target, this.observedBox, !0);
      return vO(this.target) && (this.lastReportedSize = e), this.lastReportedSize.inlineSize !== e.inlineSize || this.lastReportedSize.blockSize !== e.blockSize;
    }, t;
  }(), wO = /* @__PURE__ */ function() {
    function t(e, n) {
      this.activeTargets = [], this.skippedTargets = [], this.observationTargets = [], this.observer = e, this.callback = n;
    }
    return t;
  }(), eu = /* @__PURE__ */ new WeakMap(), Ty = function(t, e) {
    for (var n = 0; n < t.length; n += 1)
      if (t[n].target === e)
        return n;
    return -1;
  }, tu = function() {
    function t() {
    }
    return t.connect = function(e, n) {
      var i = new wO(e, n);
      eu.set(e, i);
    }, t.observe = function(e, n, i) {
      var s = eu.get(e), a = s.observationTargets.length === 0;
      Ty(s.observationTargets, n) < 0 && (a && ji.push(s), s.observationTargets.push(new yO(n, i && i.box)), Cy(1), df.schedule());
    }, t.unobserve = function(e, n) {
      var i = eu.get(e), s = Ty(i.observationTargets, n), a = i.observationTargets.length === 1;
      s >= 0 && (a && ji.splice(ji.indexOf(i), 1), i.observationTargets.splice(s, 1), Cy(-1));
    }, t.disconnect = function(e) {
      var n = this, i = eu.get(e);
      i.observationTargets.slice().forEach(function(s) {
        return n.unobserve(e, s.target);
      }), i.activeTargets.splice(0, i.activeTargets.length);
    }, t;
  }(), SO = function() {
    function t(e) {
      if (arguments.length === 0)
        throw new TypeError("Failed to construct 'ResizeObserver': 1 argument required, but only 0 present.");
      if (typeof e != "function")
        throw new TypeError("Failed to construct 'ResizeObserver': The callback provided as parameter 1 is not a function.");
      tu.connect(this, e);
    }
    return t.prototype.observe = function(e, n) {
      if (arguments.length === 0)
        throw new TypeError("Failed to execute 'observe' on 'ResizeObserver': 1 argument required, but only 0 present.");
      if (!py(e))
        throw new TypeError("Failed to execute 'observe' on 'ResizeObserver': parameter 1 is not of type 'Element");
      tu.observe(this, e, n);
    }, t.prototype.unobserve = function(e) {
      if (arguments.length === 0)
        throw new TypeError("Failed to execute 'unobserve' on 'ResizeObserver': 1 argument required, but only 0 present.");
      if (!py(e))
        throw new TypeError("Failed to execute 'unobserve' on 'ResizeObserver': parameter 1 is not of type 'Element");
      tu.unobserve(this, e);
    }, t.prototype.disconnect = function() {
      tu.disconnect(this);
    }, t.toString = function() {
      return "function ResizeObserver () { [polyfill code] }";
    }, t;
  }();
  function qt() {
    return qt = Object.assign || function(t) {
      for (var e = 1; e < arguments.length; e++) {
        var n = arguments[e];
        for (var i in n)
          Object.prototype.hasOwnProperty.call(n, i) && (t[i] = n[i]);
      }
      return t;
    }, qt.apply(this, arguments);
  }
  function nu(t, e) {
    if (t == null)
      return {};
    var n, i, s = {}, a = Object.keys(t);
    for (i = 0; i < a.length; i++)
      e.indexOf(n = a[i]) >= 0 || (s[n] = t[n]);
    return s;
  }
  var Zs = typeof window < "u" ? N.useLayoutEffect : N.useEffect;
  function Xs(t, e, n) {
    return e = (e = +e) == e ? e : 0, n = (n = +n) == n ? n : 0, (t = +t) == t && (t = (t = t <= n ? t : n) >= e ? t : e), t;
  }
  function ru(t) {
    var e = Math.round(t);
    if (Number.isNaN(t))
      throw new TypeError("Found a NaN! Check your snapPoints / defaultSnap / snapTo ");
    return e;
  }
  var EO = { box: "border-box" };
  function ff(t, e) {
    var n = e.label, i = e.enabled, s = e.resizeSourceRef, a = N.useState(0), u = a[0], d = a[1];
    N.useDebugValue(n + ": " + u);
    var f = N.useCallback(function(p) {
      d(p[0].borderBoxSize[0].blockSize), s.current = "element";
    }, [s]);
    return Zs(function() {
      if (t.current && i) {
        var p = new SO(f);
        return p.observe(t.current, EO), function() {
          p.disconnect();
        };
      }
    }, [t, f, i]), i ? u : 0;
  }
  function Yt(t) {
    return t === void 0 && (t = 1e3), new Promise(function(e) {
      return setTimeout(e, t);
    });
  }
  var Oy = { DRAG: { target: "#overlay.dragging", actions: "onOpenEnd" } }, _y = { RESIZE: { target: "#overlay.resizing", actions: "onOpenEnd" } }, xO = KC({ id: "overlay", initial: "closed", context: { initialState: "CLOSED" }, states: { closed: { on: { OPEN: "opening", CLOSE: void 0 } }, opening: { initial: "start", states: { start: { invoke: { src: "onOpenStart", onDone: "transition" } }, transition: { always: [{ target: "immediately", cond: "initiallyOpen" }, { target: "smoothly", cond: "initiallyClosed" }] }, immediately: { initial: "open", states: { open: { invoke: { src: "openImmediately", onDone: "activating" } }, activating: { invoke: { src: "activate", onDone: "#overlay.opening.end" }, on: qt({}, Oy, _y) } } }, smoothly: { initial: "visuallyHidden", states: { visuallyHidden: { invoke: { src: "renderVisuallyHidden", onDone: "activating" } }, activating: { invoke: { src: "activate", onDone: "open" } }, open: { invoke: { src: "openSmoothly", onDone: "#overlay.opening.end" }, on: qt({}, Oy, _y) } } }, end: { invoke: { src: "onOpenEnd", onDone: "done" }, on: { CLOSE: "#overlay.closing", DRAG: "#overlay.dragging" } }, done: { type: "final" } }, on: qt({}, { CLOSE: { target: "#overlay.closing", actions: "onOpenCancel" } }), onDone: "open" }, open: { on: { DRAG: "#overlay.dragging", SNAP: "snapping", RESIZE: "resizing" } }, dragging: { on: { SNAP: "snapping" } }, snapping: { initial: "start", states: { start: { invoke: { src: "onSnapStart", onDone: "snappingSmoothly" }, entry: [ZC({ y: function(t, e) {
    return e.payload.y;
  }, velocity: function(t, e) {
    return e.payload.velocity;
  }, snapSource: function(t, e) {
    var n = e.payload.source;
    return n === void 0 ? "custom" : n;
  } })] }, snappingSmoothly: { invoke: { src: "snapSmoothly", onDone: "end" } }, end: { invoke: { src: "onSnapEnd", onDone: "done" }, on: { RESIZE: "#overlay.resizing", SNAP: "#overlay.snapping", CLOSE: "#overlay.closing", DRAG: "#overlay.dragging" } }, done: { type: "final" } }, on: { SNAP: { target: "snapping", actions: "onSnapEnd" }, RESIZE: { target: "#overlay.resizing", actions: "onSnapCancel" }, DRAG: { target: "#overlay.dragging", actions: "onSnapCancel" }, CLOSE: { target: "#overlay.closing", actions: "onSnapCancel" } }, onDone: "open" }, resizing: { initial: "start", states: { start: { invoke: { src: "onResizeStart", onDone: "resizingSmoothly" } }, resizingSmoothly: { invoke: { src: "resizeSmoothly", onDone: "end" } }, end: { invoke: { src: "onResizeEnd", onDone: "done" }, on: { SNAP: "#overlay.snapping", CLOSE: "#overlay.closing", DRAG: "#overlay.dragging" } }, done: { type: "final" } }, on: { RESIZE: { target: "resizing", actions: "onResizeEnd" }, SNAP: { target: "snapping", actions: "onResizeCancel" }, DRAG: { target: "#overlay.dragging", actions: "onResizeCancel" }, CLOSE: { target: "#overlay.closing", actions: "onResizeCancel" } }, onDone: "open" }, closing: { initial: "start", states: { start: { invoke: { src: "onCloseStart", onDone: "deactivating" }, on: { OPEN: { target: "#overlay.open", actions: "onCloseCancel" } } }, deactivating: { invoke: { src: "deactivate", onDone: "closingSmoothly" } }, closingSmoothly: { invoke: { src: "closeSmoothly", onDone: "end" } }, end: { invoke: { src: "onCloseEnd", onDone: "done" }, on: { OPEN: { target: "#overlay.opening", actions: "onCloseCancel" } } }, done: { type: "final" } }, on: { CLOSE: void 0, OPEN: { target: "#overlay.opening", actions: "onCloseCancel" } }, onDone: "closed" } }, on: { CLOSE: "closing" } }, { actions: { onOpenCancel: function(t, e) {
  }, onSnapCancel: function(t, e) {
  }, onResizeCancel: function(t, e) {
  }, onCloseCancel: function(t, e) {
  }, onOpenEnd: function(t, e) {
  }, onSnapEnd: function(t, e) {
  }, onRezizeEnd: function(t, e) {
  } }, services: { onSnapStart: function() {
    try {
      return Promise.resolve(Yt()).then(function() {
      });
    } catch (t) {
      return Promise.reject(t);
    }
  }, onOpenStart: function() {
    try {
      return Promise.resolve(Yt()).then(function() {
      });
    } catch (t) {
      return Promise.reject(t);
    }
  }, onCloseStart: function() {
    try {
      return Promise.resolve(Yt()).then(function() {
      });
    } catch (t) {
      return Promise.reject(t);
    }
  }, onResizeStart: function() {
    try {
      return Promise.resolve(Yt()).then(function() {
      });
    } catch (t) {
      return Promise.reject(t);
    }
  }, onSnapEnd: function() {
    try {
      return Promise.resolve(Yt()).then(function() {
      });
    } catch (t) {
      return Promise.reject(t);
    }
  }, onOpenEnd: function() {
    try {
      return Promise.resolve(Yt()).then(function() {
      });
    } catch (t) {
      return Promise.reject(t);
    }
  }, onCloseEnd: function() {
    try {
      return Promise.resolve(Yt()).then(function() {
      });
    } catch (t) {
      return Promise.reject(t);
    }
  }, onResizeEnd: function() {
    try {
      return Promise.resolve(Yt()).then(function() {
      });
    } catch (t) {
      return Promise.reject(t);
    }
  }, renderVisuallyHidden: function(t, e) {
    try {
      return Promise.resolve(Yt()).then(function() {
      });
    } catch (n) {
      return Promise.reject(n);
    }
  }, activate: function(t, e) {
    try {
      return Promise.resolve(Yt()).then(function() {
      });
    } catch (n) {
      return Promise.reject(n);
    }
  }, deactivate: function(t, e) {
    try {
      return Promise.resolve(Yt()).then(function() {
      });
    } catch (n) {
      return Promise.reject(n);
    }
  }, openSmoothly: function(t, e) {
    try {
      return Promise.resolve(Yt()).then(function() {
      });
    } catch (n) {
      return Promise.reject(n);
    }
  }, openImmediately: function(t, e) {
    try {
      return Promise.resolve(Yt()).then(function() {
      });
    } catch (n) {
      return Promise.reject(n);
    }
  }, snapSmoothly: function(t, e) {
    try {
      return Promise.resolve(Yt()).then(function() {
      });
    } catch (n) {
      return Promise.reject(n);
    }
  }, resizeSmoothly: function(t, e) {
    try {
      return Promise.resolve(Yt()).then(function() {
      });
    } catch (n) {
      return Promise.reject(n);
    }
  }, closeSmoothly: function(t, e) {
    try {
      return Promise.resolve(Yt()).then(function() {
      });
    } catch (n) {
      return Promise.reject(n);
    }
  } }, guards: { initiallyClosed: function(t) {
    return t.initialState === "CLOSED";
  }, initiallyOpen: function(t) {
    return t.initialState === "OPEN";
  } } }), bO = ["children", "sibling", "className", "footer", "header", "open", "initialState", "lastSnapRef", "initialFocusRef", "onDismiss", "maxHeight", "defaultSnap", "snapPoints", "blocking", "scrollLocking", "style", "onSpringStart", "onSpringCancel", "onSpringEnd", "reserveScrollBarGap", "expandOnContentDrag"], CO = ["velocity"], TO = ["onRest", "config"], Ry = xT.default, OO = Ry.tension, iu = Ry.friction, _O = gt.forwardRef(function(t, e) {
    var n = t.children, i = t.sibling, s = t.className, a = t.footer, u = t.header, d = t.open, f = t.initialState, p = t.lastSnapRef, m = t.initialFocusRef, v = t.onDismiss, y = t.maxHeight, E = t.defaultSnap, S = E === void 0 ? LO : E, x = t.snapPoints, C = x === void 0 ? AO : x, L = t.blocking, k = L === void 0 || L, I = t.scrollLocking, B = I === void 0 || I, V = t.style, P = t.onSpringStart, R = t.onSpringCancel, j = t.onSpringEnd, G = t.reserveScrollBarGap, ee = G === void 0 ? k : G, W = t.expandOnContentDrag, re = W !== void 0 && W, we = nu(t, bO), ye = function() {
      var Z = N.useState(!1), ve = Z[0], ae = Z[1], Ie = N.useState({}), Qe = Ie[0], Fe = Ie[1], Ue = N.useCallback(function(We) {
        return Fe(function(nt) {
          var Re;
          return qt({}, nt, ((Re = {})[We] = !1, Re));
        }), function() {
          Fe(function(nt) {
            var Re;
            return qt({}, nt, ((Re = {})[We] = !0, Re));
          });
        };
      }, []);
      return N.useEffect(function() {
        var We = Object.values(Qe);
        We.length !== 0 && We.every(Boolean) && ae(!0);
      }, [Qe]), { ready: ve, registerReady: Ue };
    }(), be = ye.ready, Be = ye.registerReady, ge = N.useRef(!1), q = N.useRef(P), Q = N.useRef(R), T = N.useRef(j);
    N.useEffect(function() {
      q.current = P, Q.current = R, T.current = j;
    }, [R, P, j]);
    var U, X, Se = _T(function() {
      return { y: 0, ready: 0, maxHeight: 0, minSnap: 0, maxSnap: 0 };
    }), de = Se[0], Oe = Se[1], _e = N.useRef(null), Pe = N.useRef(null), Ae = N.useRef(null), st = N.useRef(null), ti = N.useRef(null), Rn = N.useRef(null), xt = N.useRef(0), qn = N.useRef(), Zi = N.useRef(!1), Yn = (U = N.useMemo(function() {
      return typeof window < "u" ? window.matchMedia("(prefers-reduced-motion: reduce)") : null;
    }, []), X = N.useRef(U == null ? void 0 : U.matches), N.useDebugValue(X.current ? "reduce" : "no-preference"), N.useEffect(function() {
      var Z = function(ve) {
        X.current = ve.matches;
      };
      return U == null || U.addListener(Z), function() {
        return U == null ? void 0 : U.removeListener(Z);
      };
    }, [U]), X), Lr = function(Z) {
      var ve = Z.targetRef, ae = Z.enabled, Ie = Z.reserveScrollBarGap, Qe = N.useRef({ activate: function() {
        throw new TypeError("Tried to activate scroll lock too early");
      }, deactivate: function() {
      } });
      return N.useDebugValue(ae ? "Enabled" : "Disabled"), N.useEffect(function() {
        if (!ae)
          return Qe.current.deactivate(), void (Qe.current = { activate: function() {
          }, deactivate: function() {
          } });
        var Fe = ve.current, Ue = !1;
        Qe.current = { activate: function() {
          Ue || (Ue = !0, J2(Fe, { allowTouchMove: function(We) {
            return We.closest("[data-body-scroll-lock-ignore]");
          }, reserveScrollBarGap: Ie }));
        }, deactivate: function() {
          Ue && (Ue = !1, Q2(Fe));
        } };
      }, [ae, ve, Ie]), Qe;
    }({ targetRef: Pe, enabled: be && B, reserveScrollBarGap: ee }), dr = function(Z) {
      var ve = Z.targetRef, ae = Z.enabled, Ie = N.useRef({ activate: function() {
        throw new TypeError("Tried to activate aria hider too early");
      }, deactivate: function() {
      } });
      return N.useDebugValue(ae ? "Enabled" : "Disabled"), N.useEffect(function() {
        if (!ae)
          return Ie.current.deactivate(), void (Ie.current = { activate: function() {
          }, deactivate: function() {
          } });
        var Qe = ve.current, Fe = !1, Ue = [], We = [];
        Ie.current = { activate: function() {
          if (!Fe) {
            Fe = !0;
            var nt = Qe.parentNode;
            document.querySelectorAll("body > *").forEach(function(Re) {
              if (Re !== nt) {
                var $e = Re.getAttribute("aria-hidden");
                $e !== null && $e !== "false" || (Ue.push($e), We.push(Re), Re.setAttribute("aria-hidden", "true"));
              }
            });
          }
        }, deactivate: function() {
          Fe && (Fe = !1, We.forEach(function(nt, Re) {
            var $e = Ue[Re];
            $e === null ? nt.removeAttribute("aria-hidden") : nt.setAttribute("aria-hidden", $e);
          }), Ue = [], We = []);
        } };
      }, [ve, ae]), Ie;
    }({ targetRef: _e, enabled: be && k }), Ar = function(Z) {
      var ve = Z.targetRef, ae = Z.fallbackRef, Ie = Z.initialFocusRef, Qe = Z.enabled, Fe = N.useRef({ activate: function() {
        throw new TypeError("Tried to activate focus trap too early");
      }, deactivate: function() {
      } });
      return N.useDebugValue(Qe ? "Enabled" : "Disabled"), N.useEffect(function() {
        if (!Qe)
          return Fe.current.deactivate(), void (Fe.current = { activate: function() {
          }, deactivate: function() {
          } });
        var Ue = ae.current, We = G2(ve.current, { onActivate: void 0, initialFocus: Ie ? function() {
          return (Ie == null ? void 0 : Ie.current) || Ue;
        } : void 0, fallbackFocus: Ue, escapeDeactivates: !1, clickOutsideDeactivates: !1 }), nt = !1;
        Fe.current = { activate: function() {
          try {
            return nt ? Promise.resolve() : (nt = !0, Promise.resolve(We.activate()).then(function() {
              return Promise.resolve(new Promise(function(Re) {
                return setTimeout(function() {
                  return Re(void 0);
                }, 0);
              })).then(function() {
              });
            }));
          } catch (Re) {
            return Promise.reject(Re);
          }
        }, deactivate: function() {
          nt && (nt = !1, We.deactivate());
        } };
      }, [Qe, ae, Ie, ve]), Fe;
    }({ targetRef: _e, fallbackRef: Rn, initialFocusRef: m || void 0, enabled: be && k && m !== !1 }), ni = function(Z) {
      var ve = Z.getSnapPoints, ae = Z.heightRef, Ie = Z.lastSnapRef, Qe = Z.ready, Fe = function(Lt) {
        var zt = Lt.contentRef, wn = Lt.controlledMaxHeight, bt = Lt.footerEnabled, Ir = Lt.footerRef, kn = Lt.headerEnabled, Zt = Lt.headerRef, hr = Lt.registerReady, oi = Lt.resizeSourceRef, Ku = N.useMemo(function() {
          return hr("contentHeight");
        }, [hr]), Zu = function(si, ma, eo) {
          var to = N.useMemo(function() {
            return ma("maxHeight");
          }, [ma]), Ju = N.useState(function() {
            return ru(si) || typeof window < "u" ? window.innerHeight : 0;
          }), Qu = Ju[0], at = Ju[1], ec = Qu > 0, ai = N.useRef(0);
          return N.useDebugValue(si ? "controlled" : "auto"), N.useEffect(function() {
            ec && to();
          }, [ec, to]), Zs(function() {
            if (si)
              return at(ru(si)), void (eo.current = "maxheightprop");
            var ga = function() {
              ai.current || (ai.current = requestAnimationFrame(function() {
                at(window.innerHeight), eo.current = "window", ai.current = 0;
              }));
            };
            return window.addEventListener("resize", ga), at(window.innerHeight), eo.current = "window", to(), function() {
              window.removeEventListener("resize", ga), cancelAnimationFrame(ai.current);
            };
          }, [si, to, eo]), Qu;
        }(wn, hr, oi), ha = ff(Zt, { label: "headerHeight", enabled: kn, resizeSourceRef: oi }), pr = ff(zt, { label: "contentHeight", enabled: !0, resizeSourceRef: oi }), Qo = ff(Ir, { label: "footerHeight", enabled: bt, resizeSourceRef: oi }), pa = Math.min(Zu - ha - Qo, pr) + ha + Qo;
        N.useDebugValue("minHeight: " + pa);
        var Xu = pr > 0;
        return N.useEffect(function() {
          Xu && Ku();
        }, [Xu, Ku]), { maxHeight: Zu, minHeight: pa, headerHeight: ha, footerHeight: Qo };
      }({ contentRef: Z.contentRef, controlledMaxHeight: Z.controlledMaxHeight, footerEnabled: Z.footerEnabled, footerRef: Z.footerRef, headerEnabled: Z.headerEnabled, headerRef: Z.headerRef, registerReady: Z.registerReady, resizeSourceRef: Z.resizeSourceRef }), Ue = Fe.maxHeight, We = Fe.minHeight, nt = Fe.headerHeight, Re = Fe.footerHeight, $e = function(Lt, zt) {
        var wn = [].concat(Lt).map(ru).reduce(function(Zt, hr) {
          return Zt.add(Xs(hr, 0, zt)), Zt;
        }, /* @__PURE__ */ new Set()), bt = Array.from(wn), Ir = Math.min.apply(Math, bt);
        if (Number.isNaN(Ir))
          throw new TypeError("minSnap is NaN");
        var kn = Math.max.apply(Math, bt);
        if (Number.isNaN(kn))
          throw new TypeError("maxSnap is NaN");
        return { snapPoints: bt, minSnap: Ir, maxSnap: kn };
      }(Qe ? ve({ height: ae.current, footerHeight: Re, headerHeight: nt, minHeight: We, maxHeight: Ue }) : [0], Ue), an = $e.snapPoints, Pr = $e.minSnap, ln = $e.maxSnap;
      return N.useDebugValue("minSnap: " + Pr + ", maxSnap:" + ln), { minSnap: Pr, maxSnap: ln, findSnap: function(Lt) {
        var zt = ru(typeof Lt == "function" ? Lt({ footerHeight: Re, headerHeight: nt, height: ae.current, minHeight: We, maxHeight: Ue, snapPoints: an, lastSnap: Ie.current }) : Lt);
        return an.reduce(function(wn, bt) {
          return Math.abs(bt - zt) < Math.abs(wn - zt) ? bt : wn;
        }, Pr);
      }, maxHeight: Ue };
    }({ contentRef: Ae, controlledMaxHeight: y, footerEnabled: !!a, footerRef: ti, getSnapPoints: C, headerEnabled: u !== !1, headerRef: st, heightRef: xt, lastSnapRef: p, ready: be, registerReady: Be, resizeSourceRef: qn }), Kn = ni.minSnap, Ln = ni.maxSnap, kr = ni.maxHeight, Xi = ni.findSnap, An = N.useRef(kr), on = N.useRef(Kn), ht = N.useRef(Ln), ri = N.useRef(Xi), sn = N.useRef(0);
    Zs(function() {
      An.current = kr, ht.current = Ln, on.current = Kn, ri.current = Xi, sn.current = Xi(S);
    }, [Xi, S, kr, Ln, Kn]);
    var Ft = N.useCallback(function(Z) {
      var ve = Z.onRest, ae = Z.config, Ie = (ae = ae === void 0 ? {} : ae).velocity, Qe = Ie === void 0 ? 1 : Ie, Fe = nu(ae, CO), Ue = nu(Z, TO);
      return new Promise(function(We) {
        return Oe(qt({}, Ue, { config: qt({ velocity: Qe }, Fe, { mass: 1, tension: OO, friction: Math.max(iu, iu + (iu - iu * Qe)) }), onRest: function() {
          var nt = [].slice.call(arguments);
          We.apply(void 0, nt), ve == null || ve.apply(void 0, nt);
        } }));
      });
    }, [Oe]), ii = oT(xO, { devTools: !1, actions: { onOpenCancel: N.useCallback(function() {
      return Q.current == null ? void 0 : Q.current({ type: "OPEN" });
    }, []), onSnapCancel: N.useCallback(function(Z) {
      return Q.current == null ? void 0 : Q.current({ type: "SNAP", source: Z.snapSource });
    }, []), onCloseCancel: N.useCallback(function() {
      return Q.current == null ? void 0 : Q.current({ type: "CLOSE" });
    }, []), onResizeCancel: N.useCallback(function() {
      return Q.current == null ? void 0 : Q.current({ type: "RESIZE", source: qn.current });
    }, []), onOpenEnd: N.useCallback(function() {
      return T.current == null ? void 0 : T.current({ type: "OPEN" });
    }, []), onSnapEnd: N.useCallback(function(Z, ve) {
      return T.current == null ? void 0 : T.current({ type: "SNAP", source: Z.snapSource });
    }, []), onResizeEnd: N.useCallback(function() {
      return T.current == null ? void 0 : T.current({ type: "RESIZE", source: qn.current });
    }, []) }, context: { initialState: f }, services: { onSnapStart: N.useCallback(function(Z, ve) {
      try {
        return Promise.resolve(q.current == null ? void 0 : q.current({ type: "SNAP", source: ve.payload.source || "custom" }));
      } catch (ae) {
        return Promise.reject(ae);
      }
    }, []), onOpenStart: N.useCallback(function() {
      try {
        return Promise.resolve(q.current == null ? void 0 : q.current({ type: "OPEN" }));
      } catch (Z) {
        return Promise.reject(Z);
      }
    }, []), onCloseStart: N.useCallback(function() {
      try {
        return Promise.resolve(q.current == null ? void 0 : q.current({ type: "CLOSE" }));
      } catch (Z) {
        return Promise.reject(Z);
      }
    }, []), onResizeStart: N.useCallback(function() {
      try {
        return Promise.resolve(q.current == null ? void 0 : q.current({ type: "RESIZE", source: qn.current }));
      } catch (Z) {
        return Promise.reject(Z);
      }
    }, []), onSnapEnd: N.useCallback(function(Z, ve) {
      try {
        return Promise.resolve(T.current == null ? void 0 : T.current({ type: "SNAP", source: Z.snapSource }));
      } catch (ae) {
        return Promise.reject(ae);
      }
    }, []), onOpenEnd: N.useCallback(function() {
      try {
        return Promise.resolve(T.current == null ? void 0 : T.current({ type: "OPEN" }));
      } catch (Z) {
        return Promise.reject(Z);
      }
    }, []), onCloseEnd: N.useCallback(function() {
      try {
        return Promise.resolve(T.current == null ? void 0 : T.current({ type: "CLOSE" }));
      } catch (Z) {
        return Promise.reject(Z);
      }
    }, []), onResizeEnd: N.useCallback(function() {
      try {
        return Promise.resolve(T.current == null ? void 0 : T.current({ type: "RESIZE", source: qn.current }));
      } catch (Z) {
        return Promise.reject(Z);
      }
    }, []), renderVisuallyHidden: N.useCallback(function(Z, ve) {
      try {
        return Promise.resolve(Ft({ y: sn.current, ready: 0, maxHeight: An.current, maxSnap: ht.current, minSnap: sn.current, immediate: !0 })).then(function() {
        });
      } catch (ae) {
        return Promise.reject(ae);
      }
    }, [Ft]), activate: N.useCallback(function(Z, ve) {
      try {
        return ge.current = !0, Promise.resolve(Promise.all([Lr.current.activate(), Ar.current.activate(), dr.current.activate()])).then(function() {
        });
      } catch (ae) {
        return Promise.reject(ae);
      }
    }, [dr, Ar, Lr]), deactivate: N.useCallback(function() {
      try {
        return Lr.current.deactivate(), Ar.current.deactivate(), dr.current.deactivate(), ge.current = !1, Promise.resolve();
      } catch (Z) {
        return Promise.reject(Z);
      }
    }, [dr, Ar, Lr]), openImmediately: N.useCallback(function() {
      try {
        return xt.current = sn.current, Promise.resolve(Ft({ y: sn.current, ready: 1, maxHeight: An.current, maxSnap: ht.current, minSnap: sn.current, immediate: !0 })).then(function() {
        });
      } catch (Z) {
        return Promise.reject(Z);
      }
    }, [Ft]), openSmoothly: N.useCallback(function() {
      try {
        return Promise.resolve(Ft({ y: 0, ready: 1, maxHeight: An.current, maxSnap: ht.current, minSnap: sn.current, immediate: !0 })).then(function() {
          return xt.current = sn.current, Promise.resolve(Ft({ y: sn.current, ready: 1, maxHeight: An.current, maxSnap: ht.current, minSnap: sn.current, immediate: Yn.current })).then(function() {
          });
        });
      } catch (Z) {
        return Promise.reject(Z);
      }
    }, [Ft, Yn]), snapSmoothly: N.useCallback(function(Z, ve) {
      try {
        var ae = ri.current(Z.y);
        return xt.current = ae, p.current = ae, Promise.resolve(Ft({ y: ae, ready: 1, maxHeight: An.current, maxSnap: ht.current, minSnap: on.current, immediate: Yn.current, config: { velocity: Z.velocity } })).then(function() {
        });
      } catch (Ie) {
        return Promise.reject(Ie);
      }
    }, [Ft, p, Yn]), resizeSmoothly: N.useCallback(function() {
      try {
        var Z = ri.current(xt.current);
        return xt.current = Z, p.current = Z, Promise.resolve(Ft({ y: Z, ready: 1, maxHeight: An.current, maxSnap: ht.current, minSnap: on.current, immediate: qn.current !== "element" || Yn.current })).then(function() {
        });
      } catch (ve) {
        return Promise.reject(ve);
      }
    }, [Ft, p, Yn]), closeSmoothly: N.useCallback(function(Z, ve) {
      try {
        return Ft({ minSnap: xt.current, immediate: !0 }), xt.current = 0, Promise.resolve(Ft({ y: 0, maxHeight: An.current, maxSnap: ht.current, immediate: Yn.current })).then(function() {
          return Promise.resolve(Ft({ ready: 0, immediate: !0 })).then(function() {
          });
        });
      } catch (ae) {
        return Promise.reject(ae);
      }
    }, [Ft, Yn]) } }), Ji = ii[0], fr = ii[1];
    N.useEffect(function() {
      be && fr(d ? "OPEN" : "CLOSE");
    }, [d, fr, be]), Zs(function() {
      (kr || Ln || Kn) && fr("RESIZE");
    }, [kr, Ln, Kn, fr]), N.useEffect(function() {
      return function() {
        Lr.current.deactivate(), Ar.current.deactivate(), dr.current.deactivate();
      };
    }, [dr, Ar, Lr]), N.useImperativeHandle(e, function() {
      return { snapTo: function(Z, ve) {
        var ae = ve === void 0 ? {} : ve, Ie = ae.velocity, Qe = Ie === void 0 ? 1 : Ie, Fe = ae.source, Ue = Fe === void 0 ? "custom" : Fe;
        fr("SNAP", { payload: { y: ri.current(Z), velocity: Qe, source: Ue } });
      }, get height() {
        return xt.current;
      } };
    }, [fr]), N.useEffect(function() {
      var Z = Pe.current, ve = function(Ie) {
        Zi.current && Ie.preventDefault();
      }, ae = function(Ie) {
        Z.scrollTop < 0 && (requestAnimationFrame(function() {
          Z.style.overflow = "hidden", Z.scrollTop = 0, Z.style.removeProperty("overflow");
        }), Ie.preventDefault());
      };
      return re && (Z.addEventListener("scroll", ve), Z.addEventListener("touchmove", ve), Z.addEventListener("touchstart", ae)), function() {
        Z.removeEventListener("scroll", ve), Z.removeEventListener("touchmove", ve), Z.removeEventListener("touchstart", ae);
      };
    }, [re, Pe]);
    var Qi = _2(function(Z) {
      var ve = Z.args, ae = (ve = ve === void 0 ? [] : ve)[0], Ie = (ae = ae === void 0 ? {} : ae).closeOnTap, Qe = Ie !== void 0 && Ie, Fe = ae.isContentDragging, Ue = Fe !== void 0 && Fe, We = Z.cancel, nt = Z.direction[1], Re = Z.down, $e = Z.first, an = Z.last, Pr = Z.memo, ln = Pr === void 0 ? de.y.getValue() : Pr, Lt = Z.tap, zt = Z.velocity, wn = -1 * Z.movement[1];
      if (!ge.current)
        return We(), ln;
      if (v && Qe && Lt)
        return We(), setTimeout(function() {
          return v();
        }, 0), ln;
      if (Lt)
        return ln;
      var bt = ln + wn, Ir = wn * zt, kn = Math.max(on.current, Math.min(ht.current, bt + 2 * Ir));
      if (!Re && v && nt > 0 && bt + Ir < on.current / 2)
        return We(), v(), ln;
      var Zt = Re ? v || on.current !== ht.current ? $s(bt, v ? 0 : on.current, ht.current, 0.55) : bt < on.current ? $s(bt, on.current, 2 * ht.current, 0.55) : $s(bt, on.current / 2, ht.current, 0.55) : kn;
      return re && Ue ? (Zt >= ht.current && (Zt = ht.current), ln === ht.current && Pe.current.scrollTop > 0 && (Zt = ht.current), Zi.current = Zt < ht.current) : Zi.current = !1, $e && fr("DRAG"), an ? (fr("SNAP", { payload: { y: Zt, velocity: zt > 0.05 ? zt : 1, source: "dragging" } }), ln) : (Oe({ y: Zt, ready: 1, maxHeight: An.current, maxSnap: ht.current, minSnap: on.current, immediate: !0, config: { velocity: zt } }), ln);
    }, { filterTaps: !0 });
    if (Number.isNaN(ht.current))
      throw new TypeError("maxSnapRef is NaN!!");
    if (Number.isNaN(on.current))
      throw new TypeError("minSnapRef is NaN!!");
    var Yu = function(Z) {
      var ve, ae = Z.spring, Ie = ko([ae.y, ae.maxHeight], function(Re, $e) {
        return Math.round(Xs($e - Re, 0, 16)) + "px";
      }), Qe = ko([ae.y, ae.minSnap, ae.maxSnap], function(Re, $e, an) {
        return Xs(Re, $e, an) + "px";
      }), Fe = ko([ae.y, ae.minSnap, ae.maxSnap], function(Re, $e, an) {
        return Re < $e ? $e - Re + "px" : Re > an ? an - Re + "px" : "0px";
      }), Ue = ko([ae.y, ae.maxSnap], function(Re, $e) {
        return Re >= $e ? Math.ceil(Re - $e) : 0;
      }), We = ko([ae.y, ae.minSnap], function(Re, $e) {
        if (!$e)
          return 0;
        var an = Math.max($e / 2 - 45, 0);
        return Xs((Re - an) * (1 / (Math.min($e / 2 + 45, $e) - an) + 0), 0, 1);
      }), nt = ko([ae.y, ae.minSnap], function(Re, $e) {
        return $e ? Xs(Re / $e, 0, 1) : 0;
      });
      return (ve = {})["--rsbs-content-opacity"] = We, ve["--rsbs-backdrop-opacity"] = nt, ve["--rsbs-antigap-scale-y"] = Ue, ve["--rsbs-overlay-translate-y"] = Fe, ve["--rsbs-overlay-rounded"] = Ie, ve["--rsbs-overlay-h"] = Qe, ve;
    }({ spring: de });
    return gt.createElement(WT.div, qt({}, we, { "data-rsbs-root": !0, "data-rsbs-state": RO.find(Ji.matches), "data-rsbs-is-blocking": k, "data-rsbs-is-dismissable": !!v, "data-rsbs-has-header": !!u, "data-rsbs-has-footer": !!a, className: s, ref: _e, style: qt({}, Yu, V, { opacity: de.ready }) }), i, k && /* @__PURE__ */ gt.createElement("div", qt({ key: "backdrop", "data-rsbs-backdrop": !0 }, Qi({ closeOnTap: !0 }))), /* @__PURE__ */ gt.createElement("div", { key: "overlay", "aria-modal": "true", role: "dialog", "data-rsbs-overlay": !0, tabIndex: -1, ref: Rn, onKeyDown: function(Z) {
      Z.key === "Escape" && (Z.stopPropagation(), v && v());
    } }, u !== !1 && /* @__PURE__ */ gt.createElement("div", qt({ key: "header", "data-rsbs-header": !0, ref: st }, Qi()), u), /* @__PURE__ */ gt.createElement("div", qt({ key: "scroll", "data-rsbs-scroll": !0, ref: Pe }, re ? Qi({ isContentDragging: !0 }) : {}), /* @__PURE__ */ gt.createElement("div", { "data-rsbs-content": !0, ref: Ae }, n)), a && /* @__PURE__ */ gt.createElement("div", qt({ key: "footer", ref: ti, "data-rsbs-footer": !0 }, Qi()), a)));
  }), RO = ["closed", "opening", "open", "closing", "dragging", "snapping", "resizing"];
  function LO(t) {
    var e = t.lastSnap;
    return e ?? Math.min.apply(Math, t.snapPoints);
  }
  function AO(t) {
    return t.minHeight;
  }
  var kO = ["onSpringStart", "onSpringEnd", "skipInitialTransition"], PO = N.forwardRef(function(t, e) {
    var n = t.onSpringStart, i = t.onSpringEnd, s = t.skipInitialTransition, a = nu(t, kO), u = N.useState(!1), d = u[0], f = u[1], p = N.useRef(), m = N.useRef(null), v = N.useRef(s && a.open ? "OPEN" : "CLOSED");
    Zs(function() {
      if (a.open)
        return cancelAnimationFrame(p.current), f(!0), function() {
          v.current = "CLOSED";
        };
    }, [a.open]);
    var y = N.useCallback(function(S) {
      return Promise.resolve(n == null ? void 0 : n(S)).then(function() {
        S.type === "OPEN" && cancelAnimationFrame(p.current);
      });
    }, [n]), E = N.useCallback(function(S) {
      return Promise.resolve(i == null ? void 0 : i(S)).then(function() {
        S.type === "CLOSE" && (p.current = requestAnimationFrame(function() {
          return f(!1);
        }));
      });
    }, [i]);
    return d ? /* @__PURE__ */ gt.createElement(eC, { "data-rsbs-portal": !0 }, /* @__PURE__ */ gt.createElement(_O, qt({}, a, { lastSnapRef: m, ref: e, initialState: v.current, onSpringStart: y, onSpringEnd: E }))) : null;
  }), Ly = { WALLET_API_URL: "https://api-wallet.tiendanube.com", WALLET_BR_API_HOST: "https://api.nuvem.com.br", WALLET_LATAM_API_HOST: "https://api.nube.com", NODE_ENV: "production", WALLET_IFRAME_URL: "https://nuvempay.nuvemshop.com.br", WALLET_LIB_AUTH_URL: "https://wallet.tiendanube.com/auth.js", LATEST_COMMIT_HASH: "2a7dc915ddb83314d33e954845a64049f00be454", BR_EXPRESS_CHECKOUT_HOST: "https://nuvem.com.br", LATAM_EXPRESS_CHECKOUT_HOST: "https://nube.com" }, IO = Object.defineProperty, NO = (t, e, n) => e in t ? IO(t, e, { enumerable: !0, configurable: !0, writable: !0, value: n }) : t[e] = n, M = (t, e, n) => NO(t, typeof e != "symbol" ? e + "" : e, n);
  function DO(t) {
    return t && t.__esModule && Object.prototype.hasOwnProperty.call(t, "default") ? t.default : t;
  }
  var Ay = { exports: {} };
  /*!
  	Copyright (c) 2018 Jed Watson.
  	Licensed under the MIT License (MIT), see
  	http://jedwatson.github.io/classnames
  */
  var ky;
  function jO() {
    return ky || (ky = 1, function(t) {
      (function() {
        var e = {}.hasOwnProperty;
        function n() {
          for (var a = "", u = 0; u < arguments.length; u++) {
            var d = arguments[u];
            d && (a = s(a, i(d)));
          }
          return a;
        }
        function i(a) {
          if (typeof a == "string" || typeof a == "number")
            return a;
          if (typeof a != "object")
            return "";
          if (Array.isArray(a))
            return n.apply(null, a);
          if (a.toString !== Object.prototype.toString && !a.toString.toString().includes("[native code]"))
            return a.toString();
          var u = "";
          for (var d in a)
            e.call(a, d) && a[d] && (u = s(u, d));
          return u;
        }
        function s(a, u) {
          return u ? a ? a + " " + u : a + u : a;
        }
        t.exports ? (n.default = n, t.exports = n) : window.classNames = n;
      })();
    }(Ay)), Ay.exports;
  }
  var MO = jO();
  const Gr = /* @__PURE__ */ DO(MO);
  var hf = { column: "wallet-lib-core_19vhn320", row: "wallet-lib-core_19vhn321", fullWidthRow: "wallet-lib-core_19vhn322" }, FO = { gap: { small: "wallet-lib-core_19vhn323" } };
  function No({
    children: t,
    justifyContent: e = "center",
    alignItems: n = "center",
    flex: i = "unset",
    overflow: s = "visible",
    whiteSpace: a = "normal"
  }) {
    return /* @__PURE__ */ O.jsx("div", {
      className: hf.column,
      style: {
        justifyContent: e,
        alignItems: n,
        flex: i,
        overflow: s,
        whiteSpace: a
      },
      children: t
    });
  }
  function ou({
    children: t,
    justifyContent: e = "center",
    alignItems: n = "center",
    gap: i
  }) {
    return /* @__PURE__ */ O.jsx("div", {
      className: Gr(hf.row, i && FO.gap[i]),
      style: {
        justifyContent: e,
        alignItems: n
      },
      children: t
    });
  }
  function HO({
    children: t,
    justifyContent: e = "center",
    alignItems: n = "center"
  }) {
    return /* @__PURE__ */ O.jsx("div", {
      className: hf.fullWidthRow,
      style: {
        justifyContent: e,
        alignItems: n
      },
      children: t
    });
  }
  var Js = { xSmall: "wallet-lib-core_1q2fgur0", small: "wallet-lib-core_1q2fgur1", large: "wallet-lib-core_1q2fgur2", sMedium: "wallet-lib-core_1q2fgur3", medium: "wallet-lib-core_1q2fgur4", slarge: "wallet-lib-core_1q2fgur5", xLarge: "wallet-lib-core_1q2fgur6", xxLarge: "wallet-lib-core_1q2fgur7", xSmallTop: "wallet-lib-core_1q2fgur8", smallTop: "wallet-lib-core_1q2fgur9", largeTop: "wallet-lib-core_1q2fgura", sMediumTop: "wallet-lib-core_1q2fgurb", mediumTop: "wallet-lib-core_1q2fgurc", slargeTop: "wallet-lib-core_1q2fgurd", xLargeTop: "wallet-lib-core_1q2fgure", xxLargeTop: "wallet-lib-core_1q2fgurf", xSmallRight: "wallet-lib-core_1q2fgurg", smallRight: "wallet-lib-core_1q2fgurh", largeRight: "wallet-lib-core_1q2fguri", sMediumRight: "wallet-lib-core_1q2fgurj", mediumRight: "wallet-lib-core_1q2fgurk", slargeRight: "wallet-lib-core_1q2fgurl", xLargeRight: "wallet-lib-core_1q2fgurm", xxLargeRight: "wallet-lib-core_1q2fgurn", xSmallVertical: "wallet-lib-core_1q2fguro", smallVertical: "wallet-lib-core_1q2fgurp", largeVertical: "wallet-lib-core_1q2fgurq", sMediumVertical: "wallet-lib-core_1q2fgurr", mediumVertical: "wallet-lib-core_1q2fgurs", slargeVertical: "wallet-lib-core_1q2fgurt", xLargeVertical: "wallet-lib-core_1q2fguru", xxLargeVertical: "wallet-lib-core_1q2fgurv", xSmallHorizontal: "wallet-lib-core_1q2fgurw", smallHorizontal: "wallet-lib-core_1q2fgurx", largeHorizontal: "wallet-lib-core_1q2fgury", sMediumHorizontal: "wallet-lib-core_1q2fgurz", mediumHorizontal: "wallet-lib-core_1q2fgur10", slargeHorizontal: "wallet-lib-core_1q2fgur11", xLargeHorizontal: "wallet-lib-core_1q2fgur12", xxLargeHorizontal: "wallet-lib-core_1q2fgur13", xSmallBottom: "wallet-lib-core_1q2fgur14", smallBottom: "wallet-lib-core_1q2fgur15", largeBottom: "wallet-lib-core_1q2fgur16", sMediumBottom: "wallet-lib-core_1q2fgur17", mediumBottom: "wallet-lib-core_1q2fgur18", slargeBottom: "wallet-lib-core_1q2fgur19", xLargeBottom: "wallet-lib-core_1q2fgur1a", xxLargeBottom: "wallet-lib-core_1q2fgur1b" };
  const su = ({
    children: t,
    id: e,
    size: n = "small"
  }) => /* @__PURE__ */ O.jsx("div", {
    id: e,
    className: Js[`${n}Top`],
    children: t
  }), pf = ({
    children: t,
    id: e,
    size: n = "small"
  }) => /* @__PURE__ */ O.jsx("div", {
    id: e,
    className: Js[`${n}Right`],
    children: t
  }), Py = ({
    children: t,
    id: e,
    size: n = "small"
  }) => /* @__PURE__ */ O.jsx("div", {
    id: e,
    className: Js[`${n}Vertical`],
    children: t
  }), Fi = ({
    children: t,
    id: e,
    size: n = "small"
  }) => /* @__PURE__ */ O.jsx("div", {
    id: e,
    className: Js[`${n}Horizontal`],
    children: t
  }), mf = ({
    children: t,
    id: e,
    size: n = "small"
  }) => /* @__PURE__ */ O.jsx("div", {
    id: e,
    className: Js[`${n}Bottom`],
    children: t
  });
  var BO = "var(--wallet-lib-core_t8w95s0)", Iy = "wallet-lib-core_t8w95s1", UO = { quickAccessBadge: "wallet-lib-core_t8w95s2" };
  function $O(t) {
    var e = t.match(/^var\((.*)\)$/);
    return e ? e[1] : t;
  }
  function Ny(t, e) {
    var n = {};
    {
      var i = t;
      for (var s in i) {
        var a = i[s];
        a != null && (n[$O(s)] = a);
      }
    }
    return Object.defineProperty(n, "toString", {
      value: function() {
        return Object.keys(this).map((u) => "".concat(u, ":").concat(this[u])).join(";");
      },
      writable: !1
    }), n;
  }
  var gf = { palette: { sunsetPink: "var(--wallet-lib-core_18owxaz0)", nimbusPrimaryInteractive: "var(--wallet-lib-core_18owxaz1)", nimbusPrimaryInteractiveHover: "var(--wallet-lib-core_18owxaz2)", nimbusPrimaryInteractivePressed: "var(--wallet-lib-core_18owxaz3)", nimbusPrimaryTextLow: "var(--wallet-lib-core_18owxaz4)", nimbusPrimaryTextHigh: "var(--wallet-lib-core_18owxaz5)", nimbusPrimarySurface: "var(--wallet-lib-core_18owxaz6)", nimbusNeutralBackground: "var(--wallet-lib-core_18owxaz7)", nimbusNeutralSurface: "var(--wallet-lib-core_18owxaz8)", nimbusNeutralSurfaceDisabled: "var(--wallet-lib-core_18owxaz9)", nimbusNeutralSurfaceHighlight: "var(--wallet-lib-core_18owxaza)", nimbusNeutralInteractive: "var(--wallet-lib-core_18owxazb)", nimbusNeutralInteractiveHover: "var(--wallet-lib-core_18owxazc)", nimbusNeutralInteractivePressed: "var(--wallet-lib-core_18owxazd)", nimbusNeutralTextLow: "var(--wallet-lib-core_18owxaze)", nimbusNeutralTextLowDark: "var(--wallet-lib-core_18owxazf)", nimbusNeutralTextHigh: "var(--wallet-lib-core_18owxazg)", nimbusNeutralTextDisabled: "var(--wallet-lib-core_18owxazh)", nimbusDangerInteractive: "var(--wallet-lib-core_18owxazi)", nimbusDangerSurface: "var(--wallet-lib-core_18owxazj)", nimbusDangerTextLow: "var(--wallet-lib-core_18owxazk)", nimbusSuccessInteractive: "var(--wallet-lib-core_18owxazl)", white: "var(--wallet-lib-core_18owxazm)", theme: "var(--wallet-lib-core_18owxazn)", theme10: "var(--wallet-lib-core_18owxazo)", theme50: "var(--wallet-lib-core_18owxazp)", backdrop: "var(--wallet-lib-core_18owxazq)" }, spacing: { xSmall: "var(--wallet-lib-core_18owxazx)", small: "var(--wallet-lib-core_18owxazy)", sMedium: "var(--wallet-lib-core_18owxazz)", medium: "var(--wallet-lib-core_18owxaz10)", slarge: "var(--wallet-lib-core_18owxaz11)", large: "var(--wallet-lib-core_18owxaz12)", xLarge: "var(--wallet-lib-core_18owxaz13)", xxLarge: "var(--wallet-lib-core_18owxaz14)" } }, Dy = "wallet-lib-core_18owxaz1d", jy = "wallet-lib-core_18owxaz1e";
  function My(t, e) {
    return Ny({
      [t]: `${gf.palette[e]} !important`
    });
  }
  var zO = { default: "wallet-lib-core_9s6q6o0", wallet: "wallet-lib-core_9s6q6o1" }, VO = { title: "wallet-lib-core_9s6q6o2", h4: "wallet-lib-core_9s6q6o3", secondaryButton: "wallet-lib-core_9s6q6o4", heading2: "wallet-lib-core_9s6q6o5", heading3: "wallet-lib-core_9s6q6o6", smallDark: "wallet-lib-core_9s6q6o7", small: "wallet-lib-core_9s6q6o8", normal: "wallet-lib-core_9s6q6o9", bold: "wallet-lib-core_9s6q6oa", subtitle: "wallet-lib-core_9s6q6ob", primaryBold: "wallet-lib-core_9s6q6oc", primaryInteractive: "wallet-lib-core_9s6q6od", disabled: "wallet-lib-core_9s6q6oe", fullWidth: "wallet-lib-core_9s6q6of" }, WO = { normal: "wallet-lib-core_9s6q6og", medium: "wallet-lib-core_9s6q6oh", bold: "wallet-lib-core_9s6q6oi", semiBold: "wallet-lib-core_9s6q6oj" }, GO = { small: "wallet-lib-core_9s6q6ok", medium: "wallet-lib-core_9s6q6ol", smallest: "wallet-lib-core_9s6q6om", h4: "wallet-lib-core_9s6q6on" }, qO = "wallet-lib-core_9s6q6oo", YO = { underline: "wallet-lib-core_9s6q6op" }, KO = { centered: "wallet-lib-core_9s6q6oq" };
  function Qs({
    children: t,
    font: e = "default",
    color: n = "theme",
    type: i,
    size: s,
    weight: a,
    textDecoration: u
  }) {
    const d = My(BO, n);
    return /* @__PURE__ */ O.jsx("span", {
      className: Gr(qO, Iy, zO[e], i && VO[i], s && GO[s], a && WO[a], u && YO[u]),
      style: d,
      children: t
    });
  }
  var vf = { horizontal: "wallet-lib-core_p0efj50", horizontalWithLabel: "wallet-lib-core_p0efj51" };
  const yf = () => /* @__PURE__ */ O.jsx("div", {
    className: vf.horizontal
  }), ZO = () => {
    const {
      t
    } = or();
    return /* @__PURE__ */ O.jsxs(HO, {
      children: [/* @__PURE__ */ O.jsx("div", {
        className: vf.horizontalWithLabel
      }), /* @__PURE__ */ O.jsx(Fi, {
        size: "slarge",
        children: /* @__PURE__ */ O.jsx(No, {
          children: /* @__PURE__ */ O.jsx(Qs, {
            size: "smallest",
            color: "theme50",
            children: t("general.or").toUpperCase()
          })
        })
      }), /* @__PURE__ */ O.jsx("div", {
        className: vf.horizontalWithLabel
      })]
    });
  }, Fy = { and: "e", close: "Fechar", or: "ou", privacyPolicy: "Política de Privacidade", privacyPolicyLink: "https://www.nuvemshop.com.br/politica-de-privacidade", termsAndConditionsLink: "https://www.nuvemshop.com.br/funcionalidades/nuvem/termos-e-condicoes", termsOfUse: "Termos de uso", termsOfUseWallet: "Termos de uso da Nuvem", wallet: "Nuvem", walletLogo: "logoNuvem", walletLogoAlt: "Logo Nuvem", buyWith: "Comprar com", quickBuyWith: "Compra rápida com", oneClickBuyWith: "Compra em 1 clique com" }, Hy = { codeResent: "Código reenviado", invalidCode: "Código incorreto", quickAccess: "Acesso rápido", resend: "Receber código por e-mail", resendEmailOnly: "Reenviar código", resendTimer: "Reenvie novamente em", resendViaSms: "Receber código por SMS", resendViaWhatsApp: "Receber código por WhatsApp", subtitle: "Suas informações de compra serão automaticamente preenchidas. Rápido e seguro!", title: "Insira o código recebido por {{channel}}", viaEmail: "Receber por e-mail", viaSMS: "Receber por SMS", viaWhatsApp: "Receber por WhatsApp" }, By = {
    general: Fy,
    otp: Hy
  }, XO = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
    __proto__: null,
    default: By,
    general: Fy,
    otp: Hy
  }, Symbol.toStringTag, { value: "Module" })), Uy = { and: "y", close: "Cerrar", or: "o", privacyPolicy: "Políticas de privacidad", privacyPolicyLink: "https://www.tiendanube.com/politicas-de-privacidad", termsAndConditionsLink: "https://www.tiendanube.com/nube/terminos-de-uso", termsOfUse: "Términos de uso", termsOfUseWallet: "Términos de uso de Nube", wallet: "Nube", walletLogo: "logoNube", walletLogoAlt: "Logo Nube", buyWith: "Comprá con", quickBuyWith: "Compra rápida con", oneClickBuyWith: "Comprá en 1 clic con" }, $y = { codeResent: "¡Código reenviado!", invalidCode: "Código incorrecto", quickAccess: "Acceso rápido", resend: "Recibir código por e-mail", resendEmailOnly: "Reenviar código", resendTimer: "Reenviá nuevamente en", resendViaSms: "Recibir código por SMS", resendViaWhatsApp: "Recibir código por WhatsApp", subtitle: "Tus datos de compra son completados automáticamente. ¡Rápido y seguro!", title: "Ingresá el código recibido por {{channel}}", viaEmail: "Recibir por e-mail", viaSMS: "Recibir por SMS", viaWhatsApp: "Recibir por WhatsApp" }, zy = {
    general: Uy,
    otp: $y
  }, JO = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
    __proto__: null,
    default: zy,
    general: Uy,
    otp: $y
  }, Symbol.toStringTag, { value: "Module" })), Vy = { and: "y", close: "Cerrar", or: "o", privacyPolicy: "Políticas de privacidad", privacyPolicyLink: "https://www.tiendanube.com/mx/politicas-de-privacidad", termsAndConditionsLink: "https://www.tiendanube.com/mx/nube/terminos-de-uso", termsOfUse: "Términos de uso", termsOfUseWallet: "Términos de uso de Nube", wallet: "Nube", walletLogo: "logoNube", walletLogoAlt: "Logo Nube", buyWith: "Compra con", quickBuyWith: "Compra rápida con", oneClickBuyWith: "Compra en 1 clic con" }, Wy = { codeResent: "¡Código reenviado!", invalidCode: "Código incorrecto", quickAccess: "Acceso rápido", resend: "Recibir código por e-mail", resendEmailOnly: "Reenviar código", resendTimer: "Reenvíalo nuevamente en", resendViaSms: "Recibir código por SMS", resendViaWhatsApp: "Recibir código por WhatsApp", subtitle: "Tus datos de compra son completados automáticamente. ¡Rápido y seguro!", title: "Ingresa el código recibido por {{channel}}", viaEmail: "Recibir por e-mail", viaSMS: "Recibir por SMS", viaWhatsApp: "Recibir por WhatsApp" }, Gy = {
    general: Vy,
    otp: Wy
  }, QO = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
    __proto__: null,
    default: Gy,
    general: Vy,
    otp: Wy
  }, Symbol.toStringTag, { value: "Module" })), qy = { and: "y", close: "Cerrar", or: "o", privacyPolicy: "Políticas de privacidad", privacyPolicyLink: "https://www.tiendanube.com/mx/politicas-de-privacidad", termsAndConditionsLink: "https://www.tiendanube.com/mx/nube/terminos-de-uso", termsOfUse: "Términos de uso", termsOfUseWallet: "Términos de uso de Nube", wallet: "Nube", walletLogo: "logoNube", walletLogoAlt: "Logo Nube", buyWith: "Compra con", quickBuyWith: "Compra rápida con", oneClickBuyWith: "Compra en 1 clic con" }, Yy = { codeResent: "¡Código reenviado!", invalidCode: "Código incorrecto", quickAccess: "Acceso rápido", resend: "Recibir código por e-mail", resendEmailOnly: "Reenviar código", resendTimer: "Reenvíalo nuevamente en", resendViaSms: "Recibir código por SMS", resendViaWhatsApp: "Recibir código por WhatsApp", subtitle: "Tus datos de compra son completados automáticamente. ¡Rápido y seguro!", title: "Ingresa el código recibido por {{channel}}", viaEmail: "Recibir por e-mail", viaSMS: "Recibir por SMS", viaWhatsApp: "Recibir por WhatsApp" }, Ky = {
    general: qy,
    otp: Yy
  }, e_ = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
    __proto__: null,
    default: Ky,
    general: qy,
    otp: Yy
  }, Symbol.toStringTag, { value: "Module" })), t_ = "translation", ea = {
    "pt-BR": {
      translation: By || XO
    },
    "es-AR": {
      translation: zy || JO
    },
    "es-MX": {
      translation: Gy || QO
    },
    es: {
      translation: Ky || e_
    }
  };
  kt.use(tg).init({
    resources: ea,
    lng: "pt-BR",
    defaultNS: t_,
    ns: "translation",
    interpolation: {
      escapeValue: !1
    },
    returnNull: !1
  });
  /*! js-cookie v3.0.5 | MIT */
  function au(t) {
    for (var e = 1; e < arguments.length; e++) {
      var n = arguments[e];
      for (var i in n)
        t[i] = n[i];
    }
    return t;
  }
  var n_ = {
    read: function(t) {
      return t[0] === '"' && (t = t.slice(1, -1)), t.replace(/(%[\dA-F]{2})+/gi, decodeURIComponent);
    },
    write: function(t) {
      return encodeURIComponent(t).replace(
        /%(2[346BF]|3[AC-F]|40|5[BDE]|60|7[BCD])/g,
        decodeURIComponent
      );
    }
  };
  function wf(t, e) {
    function n(s, a, u) {
      if (!(typeof document > "u")) {
        u = au({}, e, u), typeof u.expires == "number" && (u.expires = new Date(Date.now() + u.expires * 864e5)), u.expires && (u.expires = u.expires.toUTCString()), s = encodeURIComponent(s).replace(/%(2[346B]|5E|60|7C)/g, decodeURIComponent).replace(/[()]/g, escape);
        var d = "";
        for (var f in u)
          u[f] && (d += "; " + f, u[f] !== !0 && (d += "=" + u[f].split(";")[0]));
        return document.cookie = s + "=" + t.write(a, s) + d;
      }
    }
    function i(s) {
      if (!(typeof document > "u" || arguments.length && !s)) {
        for (var a = document.cookie ? document.cookie.split("; ") : [], u = {}, d = 0; d < a.length; d++) {
          var f = a[d].split("="), p = f.slice(1).join("=");
          try {
            var m = decodeURIComponent(f[0]);
            if (u[m] = t.read(p, m), s === m)
              break;
          } catch {
          }
        }
        return s ? u[s] : u;
      }
    }
    return Object.create(
      {
        set: n,
        get: i,
        remove: function(s, a) {
          n(
            s,
            "",
            au({}, a, {
              expires: -1
            })
          );
        },
        withAttributes: function(s) {
          return wf(this.converter, au({}, this.attributes, s));
        },
        withConverter: function(s) {
          return wf(au({}, this.converter, s), this.attributes);
        }
      },
      {
        attributes: { value: Object.freeze(e) },
        converter: { value: Object.freeze(t) }
      }
    );
  }
  var Tt = wf(n_, { path: "/" }), Sf = function() {
    return Sf = Object.assign || function(t) {
      for (var e, n = 1, i = arguments.length; n < i; n++) {
        e = arguments[n];
        for (var s in e)
          Object.prototype.hasOwnProperty.call(e, s) && (t[s] = e[s]);
      }
      return t;
    }, Sf.apply(this, arguments);
  };
  function Sr(t, e, n, i) {
    function s(a) {
      return a instanceof n ? a : new n(function(u) {
        u(a);
      });
    }
    return new (n || (n = Promise))(function(a, u) {
      function d(m) {
        try {
          p(i.next(m));
        } catch (v) {
          u(v);
        }
      }
      function f(m) {
        try {
          p(i.throw(m));
        } catch (v) {
          u(v);
        }
      }
      function p(m) {
        m.done ? a(m.value) : s(m.value).then(d, f);
      }
      p((i = i.apply(t, e || [])).next());
    });
  }
  function lr(t, e) {
    var n = { label: 0, sent: function() {
      if (a[0] & 1)
        throw a[1];
      return a[1];
    }, trys: [], ops: [] }, i, s, a, u = Object.create((typeof Iterator == "function" ? Iterator : Object).prototype);
    return u.next = d(0), u.throw = d(1), u.return = d(2), typeof Symbol == "function" && (u[Symbol.iterator] = function() {
      return this;
    }), u;
    function d(p) {
      return function(m) {
        return f([p, m]);
      };
    }
    function f(p) {
      if (i)
        throw new TypeError("Generator is already executing.");
      for (; u && (u = 0, p[0] && (n = 0)), n; )
        try {
          if (i = 1, s && (a = p[0] & 2 ? s.return : p[0] ? s.throw || ((a = s.return) && a.call(s), 0) : s.next) && !(a = a.call(s, p[1])).done)
            return a;
          switch (s = 0, a && (p = [p[0] & 2, a.value]), p[0]) {
            case 0:
            case 1:
              a = p;
              break;
            case 4:
              return n.label++, { value: p[1], done: !1 };
            case 5:
              n.label++, s = p[1], p = [0];
              continue;
            case 7:
              p = n.ops.pop(), n.trys.pop();
              continue;
            default:
              if (a = n.trys, !(a = a.length > 0 && a[a.length - 1]) && (p[0] === 6 || p[0] === 2)) {
                n = 0;
                continue;
              }
              if (p[0] === 3 && (!a || p[1] > a[0] && p[1] < a[3])) {
                n.label = p[1];
                break;
              }
              if (p[0] === 6 && n.label < a[1]) {
                n.label = a[1], a = p;
                break;
              }
              if (a && n.label < a[2]) {
                n.label = a[2], n.ops.push(p);
                break;
              }
              a[2] && n.ops.pop(), n.trys.pop();
              continue;
          }
          p = e.call(t, n);
        } catch (m) {
          p = [6, m], s = 0;
        } finally {
          i = a = 0;
        }
      if (p[0] & 5)
        throw p[1];
      return { value: p[0] ? p[1] : void 0, done: !0 };
    }
  }
  function Zy() {
    for (var t = 0, e = 0, n = arguments.length; e < n; e++)
      t += arguments[e].length;
    for (var i = Array(t), s = 0, e = 0; e < n; e++)
      for (var a = arguments[e], u = 0, d = a.length; u < d; u++, s++)
        i[s] = a[u];
    return i;
  }
  var Xy = "3.3.6";
  function Do(t, e) {
    return new Promise(function(n) {
      return setTimeout(n, t, e);
    });
  }
  function r_(t, e) {
    e === void 0 && (e = 1 / 0);
    var n = window.requestIdleCallback;
    return n ? new Promise(function(i) {
      return n.call(window, function() {
        return i();
      }, { timeout: e });
    }) : Do(Math.min(t, e));
  }
  function i_(t) {
    return t && typeof t.then == "function";
  }
  function Jy(t, e) {
    try {
      var n = t();
      i_(n) ? n.then(function(i) {
        return e(!0, i);
      }, function(i) {
        return e(!1, i);
      }) : e(!0, n);
    } catch (i) {
      e(!1, i);
    }
  }
  function Qy(t, e, n) {
    return n === void 0 && (n = 16), Sr(this, void 0, void 0, function() {
      var i, s, a;
      return lr(this, function(u) {
        switch (u.label) {
          case 0:
            i = Date.now(), s = 0, u.label = 1;
          case 1:
            return s < t.length ? (e(t[s], s), a = Date.now(), a >= i + n ? (i = a, [4, Do(0)]) : [3, 3]) : [3, 4];
          case 2:
            u.sent(), u.label = 3;
          case 3:
            return ++s, [3, 1];
          case 4:
            return [
              2
              /*return*/
            ];
        }
      });
    });
  }
  function Ef(t) {
    t.then(void 0, function() {
    });
  }
  function qr(t, e) {
    t = [t[0] >>> 16, t[0] & 65535, t[1] >>> 16, t[1] & 65535], e = [e[0] >>> 16, e[0] & 65535, e[1] >>> 16, e[1] & 65535];
    var n = [0, 0, 0, 0];
    return n[3] += t[3] + e[3], n[2] += n[3] >>> 16, n[3] &= 65535, n[2] += t[2] + e[2], n[1] += n[2] >>> 16, n[2] &= 65535, n[1] += t[1] + e[1], n[0] += n[1] >>> 16, n[1] &= 65535, n[0] += t[0] + e[0], n[0] &= 65535, [n[0] << 16 | n[1], n[2] << 16 | n[3]];
  }
  function On(t, e) {
    t = [t[0] >>> 16, t[0] & 65535, t[1] >>> 16, t[1] & 65535], e = [e[0] >>> 16, e[0] & 65535, e[1] >>> 16, e[1] & 65535];
    var n = [0, 0, 0, 0];
    return n[3] += t[3] * e[3], n[2] += n[3] >>> 16, n[3] &= 65535, n[2] += t[2] * e[3], n[1] += n[2] >>> 16, n[2] &= 65535, n[2] += t[3] * e[2], n[1] += n[2] >>> 16, n[2] &= 65535, n[1] += t[1] * e[3], n[0] += n[1] >>> 16, n[1] &= 65535, n[1] += t[2] * e[2], n[0] += n[1] >>> 16, n[1] &= 65535, n[1] += t[3] * e[1], n[0] += n[1] >>> 16, n[1] &= 65535, n[0] += t[0] * e[3] + t[1] * e[2] + t[2] * e[1] + t[3] * e[0], n[0] &= 65535, [n[0] << 16 | n[1], n[2] << 16 | n[3]];
  }
  function jo(t, e) {
    return e %= 64, e === 32 ? [t[1], t[0]] : e < 32 ? [t[0] << e | t[1] >>> 32 - e, t[1] << e | t[0] >>> 32 - e] : (e -= 32, [t[1] << e | t[0] >>> 32 - e, t[0] << e | t[1] >>> 32 - e]);
  }
  function yn(t, e) {
    return e %= 64, e === 0 ? t : e < 32 ? [t[0] << e | t[1] >>> 32 - e, t[1] << e] : [t[1] << e - 32, 0];
  }
  function ct(t, e) {
    return [t[0] ^ e[0], t[1] ^ e[1]];
  }
  function e0(t) {
    return t = ct(t, [0, t[0] >>> 1]), t = On(t, [4283543511, 3981806797]), t = ct(t, [0, t[0] >>> 1]), t = On(t, [3301882366, 444984403]), t = ct(t, [0, t[0] >>> 1]), t;
  }
  function o_(t, e) {
    t = t || "", e = e || 0;
    var n = t.length % 16, i = t.length - n, s = [0, e], a = [0, e], u = [0, 0], d = [0, 0], f = [2277735313, 289559509], p = [1291169091, 658871167], m;
    for (m = 0; m < i; m = m + 16)
      u = [
        t.charCodeAt(m + 4) & 255 | (t.charCodeAt(m + 5) & 255) << 8 | (t.charCodeAt(m + 6) & 255) << 16 | (t.charCodeAt(m + 7) & 255) << 24,
        t.charCodeAt(m) & 255 | (t.charCodeAt(m + 1) & 255) << 8 | (t.charCodeAt(m + 2) & 255) << 16 | (t.charCodeAt(m + 3) & 255) << 24
      ], d = [
        t.charCodeAt(m + 12) & 255 | (t.charCodeAt(m + 13) & 255) << 8 | (t.charCodeAt(m + 14) & 255) << 16 | (t.charCodeAt(m + 15) & 255) << 24,
        t.charCodeAt(m + 8) & 255 | (t.charCodeAt(m + 9) & 255) << 8 | (t.charCodeAt(m + 10) & 255) << 16 | (t.charCodeAt(m + 11) & 255) << 24
      ], u = On(u, f), u = jo(u, 31), u = On(u, p), s = ct(s, u), s = jo(s, 27), s = qr(s, a), s = qr(On(s, [0, 5]), [0, 1390208809]), d = On(d, p), d = jo(d, 33), d = On(d, f), a = ct(a, d), a = jo(a, 31), a = qr(a, s), a = qr(On(a, [0, 5]), [0, 944331445]);
    switch (u = [0, 0], d = [0, 0], n) {
      case 15:
        d = ct(d, yn([0, t.charCodeAt(m + 14)], 48));
      case 14:
        d = ct(d, yn([0, t.charCodeAt(m + 13)], 40));
      case 13:
        d = ct(d, yn([0, t.charCodeAt(m + 12)], 32));
      case 12:
        d = ct(d, yn([0, t.charCodeAt(m + 11)], 24));
      case 11:
        d = ct(d, yn([0, t.charCodeAt(m + 10)], 16));
      case 10:
        d = ct(d, yn([0, t.charCodeAt(m + 9)], 8));
      case 9:
        d = ct(d, [0, t.charCodeAt(m + 8)]), d = On(d, p), d = jo(d, 33), d = On(d, f), a = ct(a, d);
      case 8:
        u = ct(u, yn([0, t.charCodeAt(m + 7)], 56));
      case 7:
        u = ct(u, yn([0, t.charCodeAt(m + 6)], 48));
      case 6:
        u = ct(u, yn([0, t.charCodeAt(m + 5)], 40));
      case 5:
        u = ct(u, yn([0, t.charCodeAt(m + 4)], 32));
      case 4:
        u = ct(u, yn([0, t.charCodeAt(m + 3)], 24));
      case 3:
        u = ct(u, yn([0, t.charCodeAt(m + 2)], 16));
      case 2:
        u = ct(u, yn([0, t.charCodeAt(m + 1)], 8));
      case 1:
        u = ct(u, [0, t.charCodeAt(m)]), u = On(u, f), u = jo(u, 31), u = On(u, p), s = ct(s, u);
    }
    return s = ct(s, [0, t.length]), a = ct(a, [0, t.length]), s = qr(s, a), a = qr(a, s), s = e0(s), a = e0(a), s = qr(s, a), a = qr(a, s), ("00000000" + (s[0] >>> 0).toString(16)).slice(-8) + ("00000000" + (s[1] >>> 0).toString(16)).slice(-8) + ("00000000" + (a[0] >>> 0).toString(16)).slice(-8) + ("00000000" + (a[1] >>> 0).toString(16)).slice(-8);
  }
  function s_(t) {
    var e;
    return Sf({ name: t.name, message: t.message, stack: (e = t.stack) === null || e === void 0 ? void 0 : e.split(`
`) }, t);
  }
  function a_(t, e) {
    for (var n = 0, i = t.length; n < i; ++n)
      if (t[n] === e)
        return !0;
    return !1;
  }
  function l_(t, e) {
    return !a_(t, e);
  }
  function xf(t) {
    return parseInt(t);
  }
  function Vn(t) {
    return parseFloat(t);
  }
  function Er(t, e) {
    return typeof t == "number" && isNaN(t) ? e : t;
  }
  function Wn(t) {
    return t.reduce(function(e, n) {
      return e + (n ? 1 : 0);
    }, 0);
  }
  function t0(t, e) {
    if (e === void 0 && (e = 1), Math.abs(e) >= 1)
      return Math.round(t / e) * e;
    var n = 1 / e;
    return Math.round(t * n) / n;
  }
  function u_(t) {
    for (var e, n, i = "Unexpected syntax '" + t + "'", s = /^\s*([a-z-]*)(.*)$/i.exec(t), a = s[1] || void 0, u = {}, d = /([.:#][\w-]+|\[.+?\])/gi, f = function(y, E) {
      u[y] = u[y] || [], u[y].push(E);
    }; ; ) {
      var p = d.exec(s[2]);
      if (!p)
        break;
      var m = p[0];
      switch (m[0]) {
        case ".":
          f("class", m.slice(1));
          break;
        case "#":
          f("id", m.slice(1));
          break;
        case "[": {
          var v = /^\[([\w-]+)([~|^$*]?=("(.*?)"|([\w-]+)))?(\s+[is])?\]$/.exec(m);
          if (v)
            f(v[1], (n = (e = v[4]) !== null && e !== void 0 ? e : v[5]) !== null && n !== void 0 ? n : "");
          else
            throw new Error(i);
          break;
        }
        default:
          throw new Error(i);
      }
    }
    return [a, u];
  }
  function n0(t) {
    return t && typeof t == "object" && "message" in t ? t : { message: t };
  }
  function c_(t) {
    return typeof t != "function";
  }
  function d_(t, e) {
    var n = new Promise(function(i) {
      var s = Date.now();
      Jy(t.bind(null, e), function() {
        for (var a = [], u = 0; u < arguments.length; u++)
          a[u] = arguments[u];
        var d = Date.now() - s;
        if (!a[0])
          return i(function() {
            return { error: n0(a[1]), duration: d };
          });
        var f = a[1];
        if (c_(f))
          return i(function() {
            return { value: f, duration: d };
          });
        i(function() {
          return new Promise(function(p) {
            var m = Date.now();
            Jy(f, function() {
              for (var v = [], y = 0; y < arguments.length; y++)
                v[y] = arguments[y];
              var E = d + Date.now() - m;
              if (!v[0])
                return p({ error: n0(v[1]), duration: E });
              p({ value: v[1], duration: E });
            });
          });
        });
      });
    });
    return Ef(n), function() {
      return n.then(function(i) {
        return i();
      });
    };
  }
  function f_(t, e, n) {
    var i = Object.keys(t).filter(function(a) {
      return l_(n, a);
    }), s = Array(i.length);
    return Qy(i, function(a, u) {
      s[u] = d_(t[a], e);
    }), function() {
      return Sr(this, void 0, void 0, function() {
        var a, u, d, f, p, m, v;
        return lr(this, function(y) {
          switch (y.label) {
            case 0:
              for (a = {}, u = 0, d = i; u < d.length; u++)
                f = d[u], a[f] = void 0;
              p = Array(i.length), m = function() {
                var E;
                return lr(this, function(S) {
                  switch (S.label) {
                    case 0:
                      return E = !0, [4, Qy(i, function(x, C) {
                        if (!p[C])
                          if (s[C]) {
                            var L = s[C]().then(function(k) {
                              return a[x] = k;
                            });
                            Ef(L), p[C] = L;
                          } else
                            E = !1;
                      })];
                    case 1:
                      return S.sent(), E ? [2, "break"] : [4, Do(1)];
                    case 2:
                      return S.sent(), [
                        2
                        /*return*/
                      ];
                  }
                });
              }, y.label = 1;
            case 1:
              return [5, m()];
            case 2:
              if (v = y.sent(), v === "break")
                return [3, 4];
              y.label = 3;
            case 3:
              return [3, 1];
            case 4:
              return [4, Promise.all(p)];
            case 5:
              return y.sent(), [2, a];
          }
        });
      });
    };
  }
  function r0() {
    var t = window, e = navigator;
    return Wn([
      "MSCSSMatrix" in t,
      "msSetImmediate" in t,
      "msIndexedDB" in t,
      "msMaxTouchPoints" in e,
      "msPointerEnabled" in e
    ]) >= 4;
  }
  function h_() {
    var t = window, e = navigator;
    return Wn(["msWriteProfilerMark" in t, "MSStream" in t, "msLaunchUri" in e, "msSaveBlob" in e]) >= 3 && !r0();
  }
  function bf() {
    var t = window, e = navigator;
    return Wn([
      "webkitPersistentStorage" in e,
      "webkitTemporaryStorage" in e,
      e.vendor.indexOf("Google") === 0,
      "webkitResolveLocalFileSystemURL" in t,
      "BatteryManager" in t,
      "webkitMediaStream" in t,
      "webkitSpeechGrammar" in t
    ]) >= 5;
  }
  function ta() {
    var t = window, e = navigator;
    return Wn([
      "ApplePayError" in t,
      "CSSPrimitiveValue" in t,
      "Counter" in t,
      e.vendor.indexOf("Apple") === 0,
      "getStorageUpdates" in e,
      "WebKitMediaKeys" in t
    ]) >= 4;
  }
  function Cf() {
    var t = window;
    return Wn([
      "safari" in t,
      !("DeviceMotionEvent" in t),
      !("ongestureend" in t),
      !("standalone" in navigator)
    ]) >= 3;
  }
  function p_() {
    var t, e, n = window;
    return Wn([
      "buildID" in navigator,
      "MozAppearance" in ((e = (t = document.documentElement) === null || t === void 0 ? void 0 : t.style) !== null && e !== void 0 ? e : {}),
      "onmozfullscreenchange" in n,
      "mozInnerScreenX" in n,
      "CSSMozDocumentRule" in n,
      "CanvasCaptureMediaStream" in n
    ]) >= 4;
  }
  function m_() {
    var t = window;
    return Wn([
      !("MediaSettingsRange" in t),
      "RTCEncodedAudioFrame" in t,
      "" + t.Intl == "[object Intl]",
      "" + t.Reflect == "[object Reflect]"
    ]) >= 3;
  }
  function g_() {
    var t = window;
    return Wn([
      "DOMRectList" in t,
      "RTCPeerConnectionIceEvent" in t,
      "SVGGeometryElement" in t,
      "ontransitioncancel" in t
    ]) >= 3;
  }
  function v_() {
    if (navigator.platform === "iPad")
      return !0;
    var t = screen, e = t.width / t.height;
    return Wn([
      "MediaSource" in window,
      !!Element.prototype.webkitRequestFullscreen,
      // iPhone 4S that runs iOS 9 matches this. But it won't match the criteria above, so it won't be detected as iPad.
      e > 0.65 && e < 1.53
    ]) >= 2;
  }
  function y_() {
    var t = document;
    return t.fullscreenElement || t.msFullscreenElement || t.mozFullScreenElement || t.webkitFullscreenElement || null;
  }
  function w_() {
    var t = document;
    return (t.exitFullscreen || t.msExitFullscreen || t.mozCancelFullScreen || t.webkitExitFullscreen).call(t);
  }
  function i0() {
    var t = bf(), e = p_();
    if (!t && !e)
      return !1;
    var n = window;
    return Wn([
      "onorientationchange" in n,
      "orientation" in n,
      t && !("SharedWorker" in n),
      e && /android/i.test(navigator.appVersion)
    ]) >= 2;
  }
  function S_() {
    var t = window, e = t.OfflineAudioContext || t.webkitOfflineAudioContext;
    if (!e)
      return -2;
    if (E_())
      return -1;
    var n = 4500, i = 5e3, s = new e(1, i, 44100), a = s.createOscillator();
    a.type = "triangle", a.frequency.value = 1e4;
    var u = s.createDynamicsCompressor();
    u.threshold.value = -50, u.knee.value = 40, u.ratio.value = 12, u.attack.value = 0, u.release.value = 0.25, a.connect(u), u.connect(s.destination), a.start(0);
    var d = x_(s), f = d[0], p = d[1], m = f.then(function(v) {
      return b_(v.getChannelData(0).subarray(n));
    }, function(v) {
      if (v.name === "timeout" || v.name === "suspended")
        return -3;
      throw v;
    });
    return Ef(m), function() {
      return p(), m;
    };
  }
  function E_() {
    return ta() && !Cf() && !g_();
  }
  function x_(t) {
    var e = 3, n = 500, i = 500, s = 5e3, a = function() {
    }, u = new Promise(function(d, f) {
      var p = !1, m = 0, v = 0;
      t.oncomplete = function(S) {
        return d(S.renderedBuffer);
      };
      var y = function() {
        setTimeout(function() {
          return f(o0(
            "timeout"
            /* Timeout */
          ));
        }, Math.min(i, v + s - Date.now()));
      }, E = function() {
        try {
          switch (t.startRendering(), t.state) {
            case "running":
              v = Date.now(), p && y();
              break;
            case "suspended":
              document.hidden || m++, p && m >= e ? f(o0(
                "suspended"
                /* Suspended */
              )) : setTimeout(E, n);
              break;
          }
        } catch (S) {
          f(S);
        }
      };
      E(), a = function() {
        p || (p = !0, v > 0 && y());
      };
    });
    return [u, a];
  }
  function b_(t) {
    for (var e = 0, n = 0; n < t.length; ++n)
      e += Math.abs(t[n]);
    return e;
  }
  function o0(t) {
    var e = new Error(t);
    return e.name = t, e;
  }
  function s0(t, e, n) {
    var i, s, a;
    return n === void 0 && (n = 50), Sr(this, void 0, void 0, function() {
      var u, d;
      return lr(this, function(f) {
        switch (f.label) {
          case 0:
            u = document, f.label = 1;
          case 1:
            return u.body ? [3, 3] : [4, Do(n)];
          case 2:
            return f.sent(), [3, 1];
          case 3:
            d = u.createElement("iframe"), f.label = 4;
          case 4:
            return f.trys.push([4, , 10, 11]), [4, new Promise(function(p, m) {
              var v = !1, y = function() {
                v = !0, p();
              }, E = function(C) {
                v = !0, m(C);
              };
              d.onload = y, d.onerror = E;
              var S = d.style;
              S.setProperty("display", "block", "important"), S.position = "absolute", S.top = "0", S.left = "0", S.visibility = "hidden", e && "srcdoc" in d ? d.srcdoc = e : d.src = "about:blank", u.body.appendChild(d);
              var x = function() {
                var C, L;
                v || (((L = (C = d.contentWindow) === null || C === void 0 ? void 0 : C.document) === null || L === void 0 ? void 0 : L.readyState) === "complete" ? y() : setTimeout(x, 10));
              };
              x();
            })];
          case 5:
            f.sent(), f.label = 6;
          case 6:
            return !((s = (i = d.contentWindow) === null || i === void 0 ? void 0 : i.document) === null || s === void 0) && s.body ? [3, 8] : [4, Do(n)];
          case 7:
            return f.sent(), [3, 6];
          case 8:
            return [4, t(d, d.contentWindow)];
          case 9:
            return [2, f.sent()];
          case 10:
            return (a = d.parentNode) === null || a === void 0 || a.removeChild(d), [
              7
              /*endfinally*/
            ];
          case 11:
            return [
              2
              /*return*/
            ];
        }
      });
    });
  }
  function C_(t) {
    for (var e = u_(t), n = e[0], i = e[1], s = document.createElement(n ?? "div"), a = 0, u = Object.keys(i); a < u.length; a++) {
      var d = u[a], f = i[d].join(" ");
      d === "style" ? T_(s.style, f) : s.setAttribute(d, f);
    }
    return s;
  }
  function T_(t, e) {
    for (var n = 0, i = e.split(";"); n < i.length; n++) {
      var s = i[n], a = /^\s*([\w-]+)\s*:\s*(.+?)(\s*!([\w-]+))?\s*$/.exec(s);
      if (a) {
        var u = a[1], d = a[2], f = a[4];
        t.setProperty(u, d, f || "");
      }
    }
  }
  var O_ = "mmMwWLliI0O&1", __ = "48px", Mo = ["monospace", "sans-serif", "serif"], a0 = [
    // This is android-specific font from "Roboto" family
    "sans-serif-thin",
    "ARNO PRO",
    "Agency FB",
    "Arabic Typesetting",
    "Arial Unicode MS",
    "AvantGarde Bk BT",
    "BankGothic Md BT",
    "Batang",
    "Bitstream Vera Sans Mono",
    "Calibri",
    "Century",
    "Century Gothic",
    "Clarendon",
    "EUROSTILE",
    "Franklin Gothic",
    "Futura Bk BT",
    "Futura Md BT",
    "GOTHAM",
    "Gill Sans",
    "HELV",
    "Haettenschweiler",
    "Helvetica Neue",
    "Humanst521 BT",
    "Leelawadee",
    "Letter Gothic",
    "Levenim MT",
    "Lucida Bright",
    "Lucida Sans",
    "Menlo",
    "MS Mincho",
    "MS Outlook",
    "MS Reference Specialty",
    "MS UI Gothic",
    "MT Extra",
    "MYRIAD PRO",
    "Marlett",
    "Meiryo UI",
    "Microsoft Uighur",
    "Minion Pro",
    "Monotype Corsiva",
    "PMingLiU",
    "Pristina",
    "SCRIPTINA",
    "Segoe UI Light",
    "Serifa",
    "SimHei",
    "Small Fonts",
    "Staccato222 BT",
    "TRAJAN PRO",
    "Univers CE 55 Medium",
    "Vrinda",
    "ZWAdobeF"
  ];
  function R_() {
    return s0(function(t, e) {
      var n = e.document, i = n.body;
      i.style.fontSize = __;
      var s = n.createElement("div"), a = {}, u = {}, d = function(x) {
        var C = n.createElement("span"), L = C.style;
        return L.position = "absolute", L.top = "0", L.left = "0", L.fontFamily = x, C.textContent = O_, s.appendChild(C), C;
      }, f = function(x, C) {
        return d("'" + x + "'," + C);
      }, p = function() {
        return Mo.map(d);
      }, m = function() {
        for (var x = {}, C = function(B) {
          x[B] = Mo.map(function(V) {
            return f(B, V);
          });
        }, L = 0, k = a0; L < k.length; L++) {
          var I = k[L];
          C(I);
        }
        return x;
      }, v = function(x) {
        return Mo.some(function(C, L) {
          return x[L].offsetWidth !== a[C] || x[L].offsetHeight !== u[C];
        });
      }, y = p(), E = m();
      i.appendChild(s);
      for (var S = 0; S < Mo.length; S++)
        a[Mo[S]] = y[S].offsetWidth, u[Mo[S]] = y[S].offsetHeight;
      return a0.filter(function(x) {
        return v(E[x]);
      });
    });
  }
  function L_() {
    var t = navigator.plugins;
    if (t) {
      for (var e = [], n = 0; n < t.length; ++n) {
        var i = t[n];
        if (i) {
          for (var s = [], a = 0; a < i.length; ++a) {
            var u = i[a];
            s.push({
              type: u.type,
              suffixes: u.suffixes
            });
          }
          e.push({
            name: i.name,
            description: i.description,
            mimeTypes: s
          });
        }
      }
      return e;
    }
  }
  function A_() {
    var t = !1, e, n, i = k_(), s = i[0], a = i[1];
    if (!P_(s, a))
      e = n = "";
    else {
      t = I_(a), N_(s, a);
      var u = Tf(s), d = Tf(s);
      u !== d ? e = n = "unstable" : (n = u, D_(s, a), e = Tf(s));
    }
    return { winding: t, geometry: e, text: n };
  }
  function k_() {
    var t = document.createElement("canvas");
    return t.width = 1, t.height = 1, [t, t.getContext("2d")];
  }
  function P_(t, e) {
    return !!(e && t.toDataURL);
  }
  function I_(t) {
    return t.rect(0, 0, 10, 10), t.rect(2, 2, 6, 6), !t.isPointInPath(5, 5, "evenodd");
  }
  function N_(t, e) {
    t.width = 240, t.height = 60, e.textBaseline = "alphabetic", e.fillStyle = "#f60", e.fillRect(100, 1, 62, 20), e.fillStyle = "#069", e.font = '11pt "Times New Roman"';
    var n = "Cwm fjordbank gly 😃";
    e.fillText(n, 2, 15), e.fillStyle = "rgba(102, 204, 0, 0.2)", e.font = "18pt Arial", e.fillText(n, 4, 45);
  }
  function D_(t, e) {
    t.width = 122, t.height = 110, e.globalCompositeOperation = "multiply";
    for (var n = 0, i = [
      ["#f2f", 40, 40],
      ["#2ff", 80, 40],
      ["#ff2", 60, 80]
    ]; n < i.length; n++) {
      var s = i[n], a = s[0], u = s[1], d = s[2];
      e.fillStyle = a, e.beginPath(), e.arc(u, d, 40, 0, Math.PI * 2, !0), e.closePath(), e.fill();
    }
    e.fillStyle = "#f9c", e.arc(60, 60, 60, 0, Math.PI * 2, !0), e.arc(60, 60, 20, 0, Math.PI * 2, !0), e.fill("evenodd");
  }
  function Tf(t) {
    return t.toDataURL();
  }
  function j_() {
    var t = navigator, e = 0, n;
    t.maxTouchPoints !== void 0 ? e = xf(t.maxTouchPoints) : t.msMaxTouchPoints !== void 0 && (e = t.msMaxTouchPoints);
    try {
      document.createEvent("TouchEvent"), n = !0;
    } catch {
      n = !1;
    }
    var i = "ontouchstart" in window;
    return {
      maxTouchPoints: e,
      touchEvent: n,
      touchStart: i
    };
  }
  function M_() {
    return navigator.oscpu;
  }
  function F_() {
    var t = navigator, e = [], n = t.language || t.userLanguage || t.browserLanguage || t.systemLanguage;
    if (n !== void 0 && e.push([n]), Array.isArray(t.languages))
      bf() && m_() || e.push(t.languages);
    else if (typeof t.languages == "string") {
      var i = t.languages;
      i && e.push(i.split(","));
    }
    return e;
  }
  function H_() {
    return window.screen.colorDepth;
  }
  function B_() {
    return Er(Vn(navigator.deviceMemory), void 0);
  }
  function U_() {
    var t = screen, e = function(i) {
      return Er(xf(i), null);
    }, n = [e(t.width), e(t.height)];
    return n.sort().reverse(), n;
  }
  var $_ = 2500, z_ = 10, lu, Of;
  function V_() {
    if (Of === void 0) {
      var t = function() {
        var e = _f();
        Rf(e) ? Of = setTimeout(t, $_) : (lu = e, Of = void 0);
      };
      t();
    }
  }
  function W_() {
    var t = this;
    return V_(), function() {
      return Sr(t, void 0, void 0, function() {
        var e;
        return lr(this, function(n) {
          switch (n.label) {
            case 0:
              return e = _f(), Rf(e) ? lu ? [2, Zy(lu)] : y_() ? [4, w_()] : [3, 2] : [3, 2];
            case 1:
              n.sent(), e = _f(), n.label = 2;
            case 2:
              return Rf(e) || (lu = e), [2, e];
          }
        });
      });
    };
  }
  function G_() {
    var t = this, e = W_();
    return function() {
      return Sr(t, void 0, void 0, function() {
        var n, i;
        return lr(this, function(s) {
          switch (s.label) {
            case 0:
              return [4, e()];
            case 1:
              return n = s.sent(), i = function(a) {
                return a === null ? null : t0(a, z_);
              }, [2, [i(n[0]), i(n[1]), i(n[2]), i(n[3])]];
          }
        });
      });
    };
  }
  function _f() {
    var t = screen;
    return [
      Er(Vn(t.availTop), null),
      Er(Vn(t.width) - Vn(t.availWidth) - Er(Vn(t.availLeft), 0), null),
      Er(Vn(t.height) - Vn(t.availHeight) - Er(Vn(t.availTop), 0), null),
      Er(Vn(t.availLeft), null)
    ];
  }
  function Rf(t) {
    for (var e = 0; e < 4; ++e)
      if (t[e])
        return !1;
    return !0;
  }
  function q_() {
    return Er(xf(navigator.hardwareConcurrency), void 0);
  }
  function Y_() {
    var t, e = (t = window.Intl) === null || t === void 0 ? void 0 : t.DateTimeFormat;
    if (e) {
      var n = new e().resolvedOptions().timeZone;
      if (n)
        return n;
    }
    var i = -K_();
    return "UTC" + (i >= 0 ? "+" : "") + Math.abs(i);
  }
  function K_() {
    var t = (/* @__PURE__ */ new Date()).getFullYear();
    return Math.max(
      // `getTimezoneOffset` returns a number as a string in some unidentified cases
      Vn(new Date(t, 0, 1).getTimezoneOffset()),
      Vn(new Date(t, 6, 1).getTimezoneOffset())
    );
  }
  function Z_() {
    try {
      return !!window.sessionStorage;
    } catch {
      return !0;
    }
  }
  function X_() {
    try {
      return !!window.localStorage;
    } catch {
      return !0;
    }
  }
  function J_() {
    if (!(r0() || h_()))
      try {
        return !!window.indexedDB;
      } catch {
        return !0;
      }
  }
  function Q_() {
    return !!window.openDatabase;
  }
  function e4() {
    return navigator.cpuClass;
  }
  function t4() {
    var t = navigator.platform;
    return t === "MacIntel" && ta() && !Cf() ? v_() ? "iPad" : "iPhone" : t;
  }
  function n4() {
    return navigator.vendor || "";
  }
  function r4() {
    for (var t = [], e = 0, n = [
      // Blink and some browsers on iOS
      "chrome",
      // Safari on macOS
      "safari",
      // Chrome on iOS (checked in 85 on 13 and 87 on 14)
      "__crWeb",
      "__gCrWeb",
      // Yandex Browser on iOS, macOS and Android (checked in 21.2 on iOS 14, macOS and Android)
      "yandex",
      // Yandex Browser on iOS (checked in 21.2 on 14)
      "__yb",
      "__ybro",
      // Firefox on iOS (checked in 32 on 14)
      "__firefox__",
      // Edge on iOS (checked in 46 on 14)
      "__edgeTrackingPreventionStatistics",
      "webkit",
      // Opera Touch on iOS (checked in 2.6 on 14)
      "oprt",
      // Samsung Internet on Android (checked in 11.1)
      "samsungAr",
      // UC Browser on Android (checked in 12.10 and 13.0)
      "ucweb",
      "UCShellJava",
      // Puffin on Android (checked in 9.0)
      "puffinDevice"
    ]; e < n.length; e++) {
      var i = n[e], s = window[i];
      s && typeof s == "object" && t.push(i);
    }
    return t.sort();
  }
  function i4() {
    var t = document;
    try {
      t.cookie = "cookietest=1; SameSite=Strict;";
      var e = t.cookie.indexOf("cookietest=") !== -1;
      return t.cookie = "cookietest=1; SameSite=Strict; expires=Thu, 01-Jan-1970 00:00:01 GMT", e;
    } catch {
      return !1;
    }
  }
  function o4() {
    var t = atob;
    return {
      abpIndo: [
        "#Iklan-Melayang",
        "#Kolom-Iklan-728",
        "#SidebarIklan-wrapper",
        t("YVt0aXRsZT0iN25hZ2EgcG9rZXIiIGld"),
        '[title="ALIENBOLA" i]'
      ],
      abpvn: [
        "#quangcaomb",
        t("Lmlvc0Fkc2lvc0Fkcy1sYXlvdXQ="),
        ".quangcao",
        t("W2hyZWZePSJodHRwczovL3I4OC52bi8iXQ=="),
        t("W2hyZWZePSJodHRwczovL3piZXQudm4vIl0=")
      ],
      adBlockFinland: [
        ".mainostila",
        t("LnNwb25zb3JpdA=="),
        ".ylamainos",
        t("YVtocmVmKj0iL2NsaWNrdGhyZ2guYXNwPyJd"),
        t("YVtocmVmXj0iaHR0cHM6Ly9hcHAucmVhZHBlYWsuY29tL2FkcyJd")
      ],
      adBlockPersian: ["#navbar_notice_50", ".kadr", 'TABLE[width="140px"]', "#divAgahi", t("I2FkMl9pbmxpbmU=")],
      adBlockWarningRemoval: [
        "#adblock-honeypot",
        ".adblocker-root",
        ".wp_adblock_detect",
        t("LmhlYWRlci1ibG9ja2VkLWFk"),
        t("I2FkX2Jsb2NrZXI=")
      ],
      adGuardAnnoyances: [
        'amp-embed[type="zen"]',
        ".hs-sosyal",
        "#cookieconsentdiv",
        'div[class^="app_gdpr"]',
        ".as-oil"
      ],
      adGuardBase: [
        ".BetterJsPopOverlay",
        t("I2FkXzMwMFgyNTA="),
        t("I2Jhbm5lcmZsb2F0MjI="),
        t("I2FkLWJhbm5lcg=="),
        t("I2NhbXBhaWduLWJhbm5lcg==")
      ],
      adGuardChinese: [
        t("LlppX2FkX2FfSA=="),
        t("YVtocmVmKj0iL29kMDA1LmNvbSJd"),
        t("YVtocmVmKj0iLmh0aGJldDM0LmNvbSJd"),
        ".qq_nr_lad",
        "#widget-quan"
      ],
      adGuardFrench: [
        t("I2Jsb2NrLXZpZXdzLWFkcy1zaWRlYmFyLWJsb2NrLWJsb2Nr"),
        "#pavePub",
        t("LmFkLWRlc2t0b3AtcmVjdGFuZ2xl"),
        ".mobile_adhesion",
        ".widgetadv"
      ],
      adGuardGerman: [
        t("LmJhbm5lcml0ZW13ZXJidW5nX2hlYWRfMQ=="),
        t("LmJveHN0YXJ0d2VyYnVuZw=="),
        t("LndlcmJ1bmcz"),
        t("YVtocmVmXj0iaHR0cDovL3d3dy5laXMuZGUvaW5kZXgucGh0bWw/cmVmaWQ9Il0="),
        t("YVtocmVmXj0iaHR0cHM6Ly93d3cudGlwaWNvLmNvbS8/YWZmaWxpYXRlSWQ9Il0=")
      ],
      adGuardJapanese: [
        "#kauli_yad_1",
        t("YVtocmVmXj0iaHR0cDovL2FkMi50cmFmZmljZ2F0ZS5uZXQvIl0="),
        t("Ll9wb3BJbl9pbmZpbml0ZV9hZA=="),
        t("LmFkZ29vZ2xl"),
        t("LmFkX3JlZ3VsYXIz")
      ],
      adGuardMobile: [
        t("YW1wLWF1dG8tYWRz"),
        t("LmFtcF9hZA=="),
        'amp-embed[type="24smi"]',
        "#mgid_iframe1",
        t("I2FkX2ludmlld19hcmVh")
      ],
      adGuardRussian: [
        t("YVtocmVmXj0iaHR0cHM6Ly9hZC5sZXRtZWFkcy5jb20vIl0="),
        t("LnJlY2xhbWE="),
        'div[id^="smi2adblock"]',
        t("ZGl2W2lkXj0iQWRGb3hfYmFubmVyXyJd"),
        t("I2FkX3NxdWFyZQ==")
      ],
      adGuardSocial: [
        t("YVtocmVmXj0iLy93d3cuc3R1bWJsZXVwb24uY29tL3N1Ym1pdD91cmw9Il0="),
        t("YVtocmVmXj0iLy90ZWxlZ3JhbS5tZS9zaGFyZS91cmw/Il0="),
        ".etsy-tweet",
        "#inlineShare",
        ".popup-social"
      ],
      adGuardSpanishPortuguese: [
        "#barraPublicidade",
        "#Publicidade",
        "#publiEspecial",
        "#queTooltip",
        t("W2hyZWZePSJodHRwOi8vYWRzLmdsaXNwYS5jb20vIl0=")
      ],
      adGuardTrackingProtection: [
        "#qoo-counter",
        t("YVtocmVmXj0iaHR0cDovL2NsaWNrLmhvdGxvZy5ydS8iXQ=="),
        t("YVtocmVmXj0iaHR0cDovL2hpdGNvdW50ZXIucnUvdG9wL3N0YXQucGhwIl0="),
        t("YVtocmVmXj0iaHR0cDovL3RvcC5tYWlsLnJ1L2p1bXAiXQ=="),
        "#top100counter"
      ],
      adGuardTurkish: [
        "#backkapat",
        t("I3Jla2xhbWk="),
        t("YVtocmVmXj0iaHR0cDovL2Fkc2Vydi5vbnRlay5jb20udHIvIl0="),
        t("YVtocmVmXj0iaHR0cDovL2l6bGVuemkuY29tL2NhbXBhaWduLyJd"),
        t("YVtocmVmXj0iaHR0cDovL3d3dy5pbnN0YWxsYWRzLm5ldC8iXQ==")
      ],
      bulgarian: [
        t("dGQjZnJlZW5ldF90YWJsZV9hZHM="),
        "#ea_intext_div",
        ".lapni-pop-over",
        "#xenium_hot_offers",
        t("I25ld0Fk")
      ],
      easyList: [
        t("I0FEX0NPTlRST0xfMjg="),
        t("LnNlY29uZC1wb3N0LWFkcy13cmFwcGVy"),
        ".universalboxADVBOX03",
        t("LmFkdmVydGlzZW1lbnQtNzI4eDkw"),
        t("LnNxdWFyZV9hZHM=")
      ],
      easyListChina: [
        t("YVtocmVmKj0iLndlbnNpeHVldGFuZy5jb20vIl0="),
        t("LmFwcGd1aWRlLXdyYXBbb25jbGljayo9ImJjZWJvcy5jb20iXQ=="),
        t("LmZyb250cGFnZUFkdk0="),
        "#taotaole",
        "#aafoot.top_box"
      ],
      easyListCookie: [
        "#AdaCompliance.app-notice",
        ".text-center.rgpd",
        ".panel--cookie",
        ".js-cookies-andromeda",
        ".elxtr-consent"
      ],
      easyListCzechSlovak: [
        "#onlajny-stickers",
        t("I3Jla2xhbW5pLWJveA=="),
        t("LnJla2xhbWEtbWVnYWJvYXJk"),
        ".sklik",
        t("W2lkXj0ic2tsaWtSZWtsYW1hIl0=")
      ],
      easyListDutch: [
        t("I2FkdmVydGVudGll"),
        t("I3ZpcEFkbWFya3RCYW5uZXJCbG9jaw=="),
        ".adstekst",
        t("YVtocmVmXj0iaHR0cHM6Ly94bHR1YmUubmwvY2xpY2svIl0="),
        "#semilo-lrectangle"
      ],
      easyListGermany: [
        t("I0FkX1dpbjJkYXk="),
        t("I3dlcmJ1bmdzYm94MzAw"),
        t("YVtocmVmXj0iaHR0cDovL3d3dy5yb3RsaWNodGthcnRlaS5jb20vP3NjPSJd"),
        t("I3dlcmJ1bmdfd2lkZXNreXNjcmFwZXJfc2NyZWVu"),
        t("YVtocmVmXj0iaHR0cDovL2xhbmRpbmcucGFya3BsYXR6a2FydGVpLmNvbS8/YWc9Il0=")
      ],
      easyListItaly: [
        t("LmJveF9hZHZfYW5udW5jaQ=="),
        ".sb-box-pubbliredazionale",
        t("YVtocmVmXj0iaHR0cDovL2FmZmlsaWF6aW9uaWFkcy5zbmFpLml0LyJd"),
        t("YVtocmVmXj0iaHR0cHM6Ly9hZHNlcnZlci5odG1sLml0LyJd"),
        t("YVtocmVmXj0iaHR0cHM6Ly9hZmZpbGlhemlvbmlhZHMuc25haS5pdC8iXQ==")
      ],
      easyListLithuania: [
        t("LnJla2xhbW9zX3RhcnBhcw=="),
        t("LnJla2xhbW9zX251b3JvZG9z"),
        t("aW1nW2FsdD0iUmVrbGFtaW5pcyBza3lkZWxpcyJd"),
        t("aW1nW2FsdD0iRGVkaWt1b3RpLmx0IHNlcnZlcmlhaSJd"),
        t("aW1nW2FsdD0iSG9zdGluZ2FzIFNlcnZlcmlhaS5sdCJd")
      ],
      estonian: [t("QVtocmVmKj0iaHR0cDovL3BheTRyZXN1bHRzMjQuZXUiXQ==")],
      fanboyAnnoyances: [
        "#feedback-tab",
        "#taboola-below-article",
        ".feedburnerFeedBlock",
        ".widget-feedburner-counter",
        '[title="Subscribe to our blog"]'
      ],
      fanboyAntiFacebook: [".util-bar-module-firefly-visible"],
      fanboyEnhancedTrackers: [
        ".open.pushModal",
        "#issuem-leaky-paywall-articles-zero-remaining-nag",
        "#sovrn_container",
        'div[class$="-hide"][zoompage-fontsize][style="display: block;"]',
        ".BlockNag__Card"
      ],
      fanboySocial: [
        ".td-tags-and-social-wrapper-box",
        ".twitterContainer",
        ".youtube-social",
        'a[title^="Like us on Facebook"]',
        'img[alt^="Share on Digg"]'
      ],
      frellwitSwedish: [
        t("YVtocmVmKj0iY2FzaW5vcHJvLnNlIl1bdGFyZ2V0PSJfYmxhbmsiXQ=="),
        t("YVtocmVmKj0iZG9rdG9yLXNlLm9uZWxpbmsubWUiXQ=="),
        "article.category-samarbete",
        t("ZGl2LmhvbGlkQWRz"),
        "ul.adsmodern"
      ],
      greekAdBlock: [
        t("QVtocmVmKj0iYWRtYW4ub3RlbmV0LmdyL2NsaWNrPyJd"),
        t("QVtocmVmKj0iaHR0cDovL2F4aWFiYW5uZXJzLmV4b2R1cy5nci8iXQ=="),
        t("QVtocmVmKj0iaHR0cDovL2ludGVyYWN0aXZlLmZvcnRobmV0LmdyL2NsaWNrPyJd"),
        "DIV.agores300",
        "TABLE.advright"
      ],
      hungarian: [
        "#cemp_doboz",
        ".optimonk-iframe-container",
        t("LmFkX19tYWlu"),
        t("W2NsYXNzKj0iR29vZ2xlQWRzIl0="),
        "#hirdetesek_box"
      ],
      iDontCareAboutCookies: [
        '.alert-info[data-block-track*="CookieNotice"]',
        ".ModuleTemplateCookieIndicator",
        ".o--cookies--container",
        ".cookie-msg-info-container",
        "#cookies-policy-sticky"
      ],
      icelandicAbp: [t("QVtocmVmXj0iL2ZyYW1ld29yay9yZXNvdXJjZXMvZm9ybXMvYWRzLmFzcHgiXQ==")],
      latvian: [
        t("YVtocmVmPSJodHRwOi8vd3d3LnNhbGlkemluaS5sdi8iXVtzdHlsZT0iZGlzcGxheTogYmxvY2s7IHdpZHRoOiAxMjBweDsgaGVpZ2h0OiA0MHB4OyBvdmVyZmxvdzogaGlkZGVuOyBwb3NpdGlvbjogcmVsYXRpdmU7Il0="),
        t("YVtocmVmPSJodHRwOi8vd3d3LnNhbGlkemluaS5sdi8iXVtzdHlsZT0iZGlzcGxheTogYmxvY2s7IHdpZHRoOiA4OHB4OyBoZWlnaHQ6IDMxcHg7IG92ZXJmbG93OiBoaWRkZW47IHBvc2l0aW9uOiByZWxhdGl2ZTsiXQ==")
      ],
      listKr: [
        t("YVtocmVmKj0iLy9hZC5wbGFuYnBsdXMuY28ua3IvIl0="),
        t("I2xpdmVyZUFkV3JhcHBlcg=="),
        t("YVtocmVmKj0iLy9hZHYuaW1hZHJlcC5jby5rci8iXQ=="),
        t("aW5zLmZhc3R2aWV3LWFk"),
        ".revenue_unit_item.dable"
      ],
      listeAr: [
        t("LmdlbWluaUxCMUFk"),
        ".right-and-left-sponsers",
        t("YVtocmVmKj0iLmFmbGFtLmluZm8iXQ=="),
        t("YVtocmVmKj0iYm9vcmFxLm9yZyJd"),
        t("YVtocmVmKj0iZHViaXp6bGUuY29tL2FyLz91dG1fc291cmNlPSJd")
      ],
      listeFr: [
        t("YVtocmVmXj0iaHR0cDovL3Byb21vLnZhZG9yLmNvbS8iXQ=="),
        t("I2FkY29udGFpbmVyX3JlY2hlcmNoZQ=="),
        t("YVtocmVmKj0id2Vib3JhbWEuZnIvZmNnaS1iaW4vIl0="),
        ".site-pub-interstitiel",
        'div[id^="crt-"][data-criteo-id]'
      ],
      officialPolish: [
        "#ceneo-placeholder-ceneo-12",
        t("W2hyZWZePSJodHRwczovL2FmZi5zZW5kaHViLnBsLyJd"),
        t("YVtocmVmXj0iaHR0cDovL2Fkdm1hbmFnZXIudGVjaGZ1bi5wbC9yZWRpcmVjdC8iXQ=="),
        t("YVtocmVmXj0iaHR0cDovL3d3dy50cml6ZXIucGwvP3V0bV9zb3VyY2UiXQ=="),
        t("ZGl2I3NrYXBpZWNfYWQ=")
      ],
      ro: [
        t("YVtocmVmXj0iLy9hZmZ0cmsuYWx0ZXgucm8vQ291bnRlci9DbGljayJd"),
        'a[href^="/magazin/"]',
        t("YVtocmVmXj0iaHR0cHM6Ly9ibGFja2ZyaWRheXNhbGVzLnJvL3Ryay9zaG9wLyJd"),
        t("YVtocmVmXj0iaHR0cHM6Ly9ldmVudC4ycGVyZm9ybWFudC5jb20vZXZlbnRzL2NsaWNrIl0="),
        t("YVtocmVmXj0iaHR0cHM6Ly9sLnByb2ZpdHNoYXJlLnJvLyJd")
      ],
      ruAd: [
        t("YVtocmVmKj0iLy9mZWJyYXJlLnJ1LyJd"),
        t("YVtocmVmKj0iLy91dGltZy5ydS8iXQ=="),
        t("YVtocmVmKj0iOi8vY2hpa2lkaWtpLnJ1Il0="),
        "#pgeldiz",
        ".yandex-rtb-block"
      ],
      thaiAds: [
        "a[href*=macau-uta-popup]",
        t("I2Fkcy1nb29nbGUtbWlkZGxlX3JlY3RhbmdsZS1ncm91cA=="),
        t("LmFkczMwMHM="),
        ".bumq",
        ".img-kosana"
      ],
      webAnnoyancesUltralist: [
        "#mod-social-share-2",
        "#social-tools",
        t("LmN0cGwtZnVsbGJhbm5lcg=="),
        ".zergnet-recommend",
        ".yt.btn-link.btn-md.btn"
      ]
    };
  }
  function s4(t) {
    var e = (t === void 0 ? {} : t).debug;
    return Sr(this, void 0, void 0, function() {
      var n, i, s, a, u, d;
      return lr(this, function(f) {
        switch (f.label) {
          case 0:
            return a4() ? (n = o4(), i = Object.keys(n), s = (d = []).concat.apply(d, i.map(function(p) {
              return n[p];
            })), [4, l4(s)]) : [2, void 0];
          case 1:
            return a = f.sent(), e && u4(n, a), u = i.filter(function(p) {
              var m = n[p], v = Wn(m.map(function(y) {
                return a[y];
              }));
              return v > m.length * 0.6;
            }), u.sort(), [2, u];
        }
      });
    });
  }
  function a4() {
    return ta() || i0();
  }
  function l4(t) {
    var e;
    return Sr(this, void 0, void 0, function() {
      var n, i, s, a, f, u, d, f;
      return lr(this, function(p) {
        switch (p.label) {
          case 0:
            for (n = document, i = n.createElement("div"), s = new Array(t.length), a = {}, l0(i), f = 0; f < t.length; ++f)
              u = C_(t[f]), d = n.createElement("div"), l0(d), d.appendChild(u), i.appendChild(d), s[f] = u;
            p.label = 1;
          case 1:
            return n.body ? [3, 3] : [4, Do(50)];
          case 2:
            return p.sent(), [3, 1];
          case 3:
            n.body.appendChild(i);
            try {
              for (f = 0; f < t.length; ++f)
                s[f].offsetParent || (a[t[f]] = !0);
            } finally {
              (e = i.parentNode) === null || e === void 0 || e.removeChild(i);
            }
            return [2, a];
        }
      });
    });
  }
  function l0(t) {
    t.style.setProperty("display", "block", "important");
  }
  function u4(t, e) {
    for (var n = "DOM blockers debug:\n```", i = 0, s = Object.keys(t); i < s.length; i++) {
      var a = s[i];
      n += `
` + a + ":";
      for (var u = 0, d = t[a]; u < d.length; u++) {
        var f = d[u];
        n += `
  ` + (e[f] ? "🚫" : "➡️") + " " + f;
      }
    }
    console.log(n + "\n```");
  }
  function c4() {
    for (var t = 0, e = ["rec2020", "p3", "srgb"]; t < e.length; t++) {
      var n = e[t];
      if (matchMedia("(color-gamut: " + n + ")").matches)
        return n;
    }
  }
  function d4() {
    if (u0("inverted"))
      return !0;
    if (u0("none"))
      return !1;
  }
  function u0(t) {
    return matchMedia("(inverted-colors: " + t + ")").matches;
  }
  function f4() {
    if (c0("active"))
      return !0;
    if (c0("none"))
      return !1;
  }
  function c0(t) {
    return matchMedia("(forced-colors: " + t + ")").matches;
  }
  var h4 = 100;
  function p4() {
    if (matchMedia("(min-monochrome: 0)").matches) {
      for (var t = 0; t <= h4; ++t)
        if (matchMedia("(max-monochrome: " + t + ")").matches)
          return t;
      throw new Error("Too high value");
    }
  }
  function m4() {
    if (Fo("no-preference"))
      return 0;
    if (Fo("high") || Fo("more"))
      return 1;
    if (Fo("low") || Fo("less"))
      return -1;
    if (Fo("forced"))
      return 10;
  }
  function Fo(t) {
    return matchMedia("(prefers-contrast: " + t + ")").matches;
  }
  function g4() {
    if (d0("reduce"))
      return !0;
    if (d0("no-preference"))
      return !1;
  }
  function d0(t) {
    return matchMedia("(prefers-reduced-motion: " + t + ")").matches;
  }
  function v4() {
    if (f0("high"))
      return !0;
    if (f0("standard"))
      return !1;
  }
  function f0(t) {
    return matchMedia("(dynamic-range: " + t + ")").matches;
  }
  var Ke = Math, nn = function() {
    return 0;
  };
  function y4() {
    var t = Ke.acos || nn, e = Ke.acosh || nn, n = Ke.asin || nn, i = Ke.asinh || nn, s = Ke.atanh || nn, a = Ke.atan || nn, u = Ke.sin || nn, d = Ke.sinh || nn, f = Ke.cos || nn, p = Ke.cosh || nn, m = Ke.tan || nn, v = Ke.tanh || nn, y = Ke.exp || nn, E = Ke.expm1 || nn, S = Ke.log1p || nn, x = function(j) {
      return Ke.pow(Ke.PI, j);
    }, C = function(j) {
      return Ke.log(j + Ke.sqrt(j * j - 1));
    }, L = function(j) {
      return Ke.log(j + Ke.sqrt(j * j + 1));
    }, k = function(j) {
      return Ke.log((1 + j) / (1 - j)) / 2;
    }, I = function(j) {
      return Ke.exp(j) - 1 / Ke.exp(j) / 2;
    }, B = function(j) {
      return (Ke.exp(j) + 1 / Ke.exp(j)) / 2;
    }, V = function(j) {
      return Ke.exp(j) - 1;
    }, P = function(j) {
      return (Ke.exp(2 * j) - 1) / (Ke.exp(2 * j) + 1);
    }, R = function(j) {
      return Ke.log(1 + j);
    };
    return {
      acos: t(0.12312423423423424),
      acosh: e(1e308),
      acoshPf: C(1e154),
      asin: n(0.12312423423423424),
      asinh: i(1),
      asinhPf: L(1),
      atanh: s(0.5),
      atanhPf: k(0.5),
      atan: a(0.5),
      sin: u(-1e300),
      sinh: d(1),
      sinhPf: I(1),
      cos: f(10.000000000123),
      cosh: p(1),
      coshPf: B(1),
      tan: m(-1e300),
      tanh: v(1),
      tanhPf: P(1),
      exp: y(1),
      expm1: E(1),
      expm1Pf: V(1),
      log1p: S(10),
      log1pPf: R(10),
      powPI: x(-100)
    };
  }
  var w4 = "mmMwWLliI0fiflO&1", Lf = {
    /**
     * The default font. User can change it in desktop Chrome, desktop Firefox, IE 11,
     * Android Chrome (but only when the size is ≥ than the default) and Android Firefox.
     */
    default: [],
    /** OS font on macOS. User can change its size and weight. Applies after Safari restart. */
    apple: [{ font: "-apple-system-body" }],
    /** User can change it in desktop Chrome and desktop Firefox. */
    serif: [{ fontFamily: "serif" }],
    /** User can change it in desktop Chrome and desktop Firefox. */
    sans: [{ fontFamily: "sans-serif" }],
    /** User can change it in desktop Chrome and desktop Firefox. */
    mono: [{ fontFamily: "monospace" }],
    /**
     * Check the smallest allowed font size. User can change it in desktop Chrome, desktop Firefox and desktop Safari.
     * The height can be 0 in Chrome on a retina display.
     */
    min: [{ fontSize: "1px" }],
    /** Tells one OS from another in desktop Chrome. */
    system: [{ fontFamily: "system-ui" }]
  };
  function S4() {
    return E4(function(t, e) {
      for (var n = {}, i = {}, s = 0, a = Object.keys(Lf); s < a.length; s++) {
        var u = a[s], d = Lf[u], f = d[0], p = f === void 0 ? {} : f, m = d[1], v = m === void 0 ? w4 : m, y = t.createElement("span");
        y.textContent = v, y.style.whiteSpace = "nowrap";
        for (var E = 0, S = Object.keys(p); E < S.length; E++) {
          var x = S[E], C = p[x];
          C !== void 0 && (y.style[x] = C);
        }
        n[u] = y, e.appendChild(t.createElement("br")), e.appendChild(y);
      }
      for (var L = 0, k = Object.keys(Lf); L < k.length; L++) {
        var u = k[L];
        i[u] = n[u].getBoundingClientRect().width;
      }
      return i;
    });
  }
  function E4(t, e) {
    return e === void 0 && (e = 4e3), s0(function(n, i) {
      var s = i.document, a = s.body, u = a.style;
      u.width = e + "px", u.webkitTextSizeAdjust = u.textSizeAdjust = "none", bf() ? a.style.zoom = "" + 1 / i.devicePixelRatio : ta() && (a.style.zoom = "reset");
      var d = s.createElement("div");
      return d.textContent = Zy(Array(e / 20 << 0)).map(function() {
        return "word";
      }).join(" "), a.appendChild(d), t(s, a);
    }, '<!doctype html><html><head><meta name="viewport" content="width=device-width, initial-scale=1">');
  }
  var x4 = {
    // READ FIRST:
    // See https://github.com/fingerprintjs/fingerprintjs/blob/master/contributing.md#how-to-make-an-entropy-source
    // to learn how entropy source works and how to make your own.
    // The sources run in this exact order.
    // The asynchronous sources are at the start to run in parallel with other sources.
    fonts: R_,
    domBlockers: s4,
    fontPreferences: S4,
    audio: S_,
    screenFrame: G_,
    osCpu: M_,
    languages: F_,
    colorDepth: H_,
    deviceMemory: B_,
    screenResolution: U_,
    hardwareConcurrency: q_,
    timezone: Y_,
    sessionStorage: Z_,
    localStorage: X_,
    indexedDB: J_,
    openDatabase: Q_,
    cpuClass: e4,
    platform: t4,
    plugins: L_,
    canvas: A_,
    touchSupport: j_,
    vendor: n4,
    vendorFlavors: r4,
    cookiesEnabled: i4,
    colorGamut: c4,
    invertedColors: d4,
    forcedColors: f4,
    monochrome: p4,
    contrast: m4,
    reducedMotion: g4,
    hdr: v4,
    math: y4
  };
  function b4(t) {
    return f_(x4, t, []);
  }
  var C4 = "$ if upgrade to Pro: https://fpjs.dev/pro";
  function T4(t) {
    var e = O4(t), n = _4(e);
    return { score: e, comment: C4.replace(/\$/g, "" + n) };
  }
  function O4(t) {
    if (i0())
      return 0.4;
    if (ta())
      return Cf() ? 0.5 : 0.3;
    var e = t.platform.value || "";
    return /^Win/.test(e) ? 0.6 : /^Mac/.test(e) ? 0.5 : 0.7;
  }
  function _4(t) {
    return t0(0.99 + 0.01 * t, 1e-4);
  }
  function R4(t) {
    for (var e = "", n = 0, i = Object.keys(t).sort(); n < i.length; n++) {
      var s = i[n], a = t[s], u = a.error ? "error" : JSON.stringify(a.value);
      e += (e ? "|" : "") + s.replace(/([:|\\])/g, "\\$1") + ":" + u;
    }
    return e;
  }
  function h0(t) {
    return JSON.stringify(t, function(e, n) {
      return n instanceof Error ? s_(n) : n;
    }, 2);
  }
  function p0(t) {
    return o_(R4(t));
  }
  function L4(t) {
    var e, n = T4(t);
    return {
      get visitorId() {
        return e === void 0 && (e = p0(this.components)), e;
      },
      set visitorId(i) {
        e = i;
      },
      confidence: n,
      components: t,
      version: Xy
    };
  }
  function A4(t) {
    return t === void 0 && (t = 50), r_(t, t * 2);
  }
  function k4(t, e) {
    var n = Date.now();
    return {
      get: function(i) {
        return Sr(this, void 0, void 0, function() {
          var s, a, u;
          return lr(this, function(d) {
            switch (d.label) {
              case 0:
                return s = Date.now(), [4, t()];
              case 1:
                return a = d.sent(), u = L4(a), (e || i != null && i.debug) && console.log("Copy the text below to get the debug data:\n\n```\nversion: " + u.version + `
userAgent: ` + navigator.userAgent + `
timeBetweenLoadAndGet: ` + (s - n) + `
visitorId: ` + u.visitorId + `
components: ` + h0(a) + "\n```"), [2, u];
            }
          });
        });
      }
    };
  }
  function P4() {
    if (!(window.__fpjs_d_m || Math.random() >= 1e-3))
      try {
        var t = new XMLHttpRequest();
        t.open("get", "https://m1.openfpcdn.io/fingerprintjs/v" + Xy + "/npm-monitoring", !0), t.send();
      } catch (e) {
        console.error(e);
      }
  }
  function I4(t) {
    var e = t === void 0 ? {} : t, n = e.delayFallback, i = e.debug, s = e.monitoring, a = s === void 0 ? !0 : s;
    return Sr(this, void 0, void 0, function() {
      var u;
      return lr(this, function(d) {
        switch (d.label) {
          case 0:
            return a && P4(), [4, A4(n)];
          case 1:
            return d.sent(), u = b4({ debug: i }), [2, k4(u, i)];
        }
      });
    });
  }
  var N4 = { load: I4, hashComponents: p0, componentsToDebugString: h0 };
  const m0 = class Za {
    constructor() {
      M(this, "callback", null);
    }
    static getInstance() {
      return Za.instance || (Za.instance = new Za()), Za.instance;
    }
    /**
     * Set the callback to handle error reports
     * @param callback - Function to call when errors are reported
     */
    setCallback(e) {
      this.callback = e;
    }
    /**
     * Report an error
     * @param report - Error report with message and optional context
     */
    report(e) {
      if (this.callback)
        try {
          this.callback(e);
        } catch (n) {
          console.error("ErrorHandler: Callback failed", n);
        }
    }
  };
  M(m0, "instance");
  const Hi = m0.getInstance();
  class D4 {
    constructor() {
      M(this, "isLocalStorageAvailable", !1), this.isLocalStorageAvailable = this.checkLocalStorageAvailability();
    }
    /**
     * Check if localStorage is available and accessible
     */
    checkLocalStorageAvailability() {
      try {
        const e = "__storage_test__";
        return window.localStorage.setItem(e, "test"), window.localStorage.removeItem(e), !0;
      } catch (e) {
        return Hi.report({
          message: "localStorage is not available",
          error: e
        }), !1;
      }
    }
    /**
     * Get an item from storage
     * @param key - The storage key
     * @returns The stored value or null if not found/unavailable
     */
    getItem(e) {
      if (this.isLocalStorageAvailable)
        try {
          return window.localStorage.getItem(e);
        } catch (n) {
          return Hi.report({
            message: "Error getting storage item",
            error: n,
            context: {
              key: e
            }
          }), null;
        }
      return null;
    }
    /**
     * Set an item in storage
     * @param key - The storage key
     * @param value - The value to store
     */
    setItem(e, n) {
      if (this.isLocalStorageAvailable)
        try {
          window.localStorage.setItem(e, n);
        } catch (i) {
          Hi.report({
            message: "Error setting storage item",
            error: i,
            context: {
              key: e
            }
          });
        }
      else
        Hi.report({
          message: "Storage not available - localStorage is disabled",
          context: {
            key: e
          }
        });
    }
    /**
     * Remove an item from storage
     * @param key - The storage key
     */
    removeItem(e) {
      if (this.isLocalStorageAvailable)
        try {
          window.localStorage.removeItem(e);
        } catch (n) {
          Hi.report({
            message: "Error removing storage item",
            error: n,
            context: {
              key: e
            }
          });
        }
    }
    /**
     * Clear all items from storage
     */
    clear() {
      if (this.isLocalStorageAvailable)
        try {
          window.localStorage.clear();
        } catch (e) {
          Hi.report({
            message: "Error clearing storage",
            error: e
          });
        }
    }
    /**
     * Check if localStorage is currently available
     * @returns true if localStorage is accessible, false otherwise
     */
    isAvailable() {
      return this.isLocalStorageAvailable;
    }
  }
  const xr = new D4(), j4 = 20 * 60 * 1e3;
  let Ho = class {
    static set(e, n, i = j4) {
      const s = {
        value: n,
        expiresAt: Date.now() + i
      };
      xr.setItem(e, JSON.stringify(s));
    }
    static get(e) {
      const n = xr.getItem(e);
      if (!n)
        return null;
      try {
        const i = JSON.parse(n);
        return Date.now() > i.expiresAt ? (xr.removeItem(e), null) : i.value;
      } catch {
        return xr.removeItem(e), null;
      }
    }
    static remove(e) {
      xr.removeItem(e);
    }
    static clear() {
      xr.clear();
    }
  };
  async function M4(t) {
    const e = new TextEncoder().encode(t), n = await crypto.subtle.digest("SHA-256", e);
    return Array.from(new Uint8Array(n)).map((i) => i.toString(16).padStart(2, "0")).join("");
  }
  function F4() {
    return typeof crypto < "u" && typeof crypto.randomUUID == "function" ? crypto.randomUUID() : typeof crypto < "u" && typeof crypto.getRandomValues == "function" ? H4() : B4();
  }
  function H4() {
    const t = new Uint8Array(16);
    crypto.getRandomValues(t), t[6] = t[6] & 15 | 64, t[8] = t[8] & 63 | 128;
    const e = Array.from(t, (n) => n.toString(16).padStart(2, "0")).join("");
    return [e.slice(0, 8), e.slice(8, 12), e.slice(12, 16), e.slice(16, 20), e.slice(20)].join("-");
  }
  function B4() {
    return "xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx".replace(/[xy]/g, (t) => {
      const e = Math.random() * 16 | 0;
      return (t === "x" ? e : e & 3 | 8).toString(16);
    });
  }
  const Af = "wallet_device_id", kf = "wallet_visitor_id", Pf = "wallet_visitor_components", g0 = class Xa {
    constructor() {
      M(this, "agent", null);
    }
    static getInstance() {
      return Xa.instance ?? (Xa.instance = new Xa()), Xa.instance;
    }
    async initialize() {
      this.agent ?? (this.agent = await N4.load());
    }
    async setCustomVisitor(e, n, i) {
      xr.setItem(Af, e), Ho.set(kf, n), Ho.set(Pf, i);
    }
    getDeviceId() {
      const e = xr.getItem(Af);
      if (e)
        return e;
      const n = F4();
      return xr.setItem(Af, n), n;
    }
    async getVisitorData() {
      const e = Ho.get(kf), n = Ho.get(Pf);
      if (e && n)
        return {
          visitorId: e,
          components: n
        };
      if (!this.agent)
        throw new TypeError("FingerprintJS agent not initialized");
      const i = await this.agent.get(), s = await this.hashComponentsValues(i.components), a = JSON.stringify(s);
      return Ho.set(kf, i.visitorId), Ho.set(Pf, a), {
        visitorId: i.visitorId,
        components: a
      };
    }
    async hashComponentsValues(e) {
      const n = {};
      for (const [i, s] of Object.entries(e)) {
        const a = await M4(JSON.stringify(s));
        n[i] = a.substring(0, 16);
      }
      return n;
    }
  };
  M(g0, "instance", null);
  const br = g0.getInstance();
  class v0 {
    constructor(e, n, i) {
      M(this, "instance"), this.commonOptions = n, this.storeId = i, this.instance = Et.create({
        baseURL: e,
        headers: {
          "Content-Type": "application/json",
          Accept: "application/json"
        }
      });
    }
    async makeRequest(e, n, i, s, a) {
      const u = await this.getVisitorHeaders({
        ...this.commonOptions,
        ...a
      });
      return this.instance.request({
        url: n,
        data: i,
        method: e,
        headers: {
          ...s,
          ...u
        },
        validateStatus: (d) => d >= 200 && d <= 302
      });
    }
    async getVisitorHeaders(e) {
      if (!(e != null && e.sendFingerprint))
        return {};
      try {
        const n = br.getDeviceId(), i = await br.getVisitorData();
        return {
          "x-device-id": n,
          "x-visitor-id": i.visitorId,
          "x-store-id": this.storeId,
          "x-visitor-components": e != null && e.sendVisitorComponents ? i.components : void 0
        };
      } catch (n) {
        await this.logError("Failed to get fingerprint data", n);
      }
      return {};
    }
    async logError(e, n, i) {
      await this.instance.request({
        url: "/v1/logger/user-error",
        data: {
          message: e,
          source: "lib",
          release: Ly.npm_package_version,
          extraContext: {
            error: n.message,
            stack: n.stack,
            ...i
          }
        },
        method: "POST",
        validateStatus: (s) => s >= 200 && s <= 302
      });
    }
  }
  let Bo = class {
    constructor() {
      M(this, "config", ke.getConfig()), M(this, "getRedirectUrl", (e, n = null, i) => {
        const s = this.config.country === "BR" ? ke.getBrExpressCheckoutHost() : ke.getLatamExpressCheckoutHost(), a = n ? `#${Object.entries(n).map(([u, d]) => `${u}=${d}`).join("&")}` : "";
        return `${s}/checkout/v3/${e}/${this.config.cartId}/${i ?? this.config.cartHash}?from_store=1${a}`;
      });
    }
    static isExpressCheckoutHost() {
      return [ke.getBrExpressCheckoutHost(), ke.getLatamExpressCheckoutHost()].includes(`https://${window.location.hostname}`);
    }
    static cameFromExpressCheckout() {
      const e = new URL(document.referrer).origin;
      return [ke.getBrExpressCheckoutHost(), ke.getLatamExpressCheckoutHost()].includes(e);
    }
    static getExpressCheckoutHostByCountry(e) {
      return e === "BR" ? ke.getBrExpressCheckoutHost() : ke.getLatamExpressCheckoutHost();
    }
  }, uu = class {
  };
  M(uu, "isExpressCheckoutHost", Bo.isExpressCheckoutHost), M(uu, "cameFromExpressCheckout", Bo.cameFromExpressCheckout);
  let ke = class {
    static setHostConfig({
      host: e,
      iframeHost: n,
      nuvemshopHost: i,
      brExpressCheckoutHost: s,
      latamExpressCheckoutHost: a
    }) {
      this.config = {
        ...this.config ?? this.getDefaultConfig(),
        host: e,
        iframeHost: n,
        nuvemshopHost: i,
        brExpressCheckoutHost: s,
        latamExpressCheckoutHost: a
      };
    }
    static setGeneralConfig(e) {
      this.config = {
        ...this.config ?? this.getDefaultConfig(),
        ...e,
        source: uu.isExpressCheckoutHost() ? "express-checkout" : e.source ?? "core-checkout"
      };
    }
    static async init() {
      this.getConfig().sendFingerprint && await br.initialize(), this.errorClient ?? (this.errorClient = new v0(this.getWalletHost())), Hi.setCallback((e) => {
        if (!this.errorClient)
          return;
        const n = e.error || new Error(e.message);
        this.errorClient.logError(e.message, n, e.context).catch((i) => {
          console.error("Failed to report error", i);
        });
      });
    }
    static getConfig() {
      return this.config ?? this.getDefaultConfig();
    }
    static getWalletHost() {
      return this.getConfig().host;
    }
    static getIframeHost() {
      return this.getConfig().iframeHost;
    }
    static getNuvemshopHost() {
      return this.getConfig().nuvemshopHost;
    }
    static getBrExpressCheckoutHost() {
      return this.getConfig().brExpressCheckoutHost;
    }
    static getLatamExpressCheckoutHost() {
      return this.getConfig().latamExpressCheckoutHost;
    }
    static getDefaultConfig() {
      return {
        host: void 0,
        iframeHost: void 0,
        nuvemshopHost: void 0,
        brExpressCheckoutHost: void 0,
        latamExpressCheckoutHost: void 0,
        country: "BR",
        language: "pt-BR",
        storeId: "",
        cartId: "",
        cartHash: "",
        tiendanubeSessionId: "",
        tiendanubeConsumerId: "",
        storeName: "",
        storeLogo: "",
        storeUrl: "",
        returnUrl: "",
        source: "core-checkout",
        sendFingerprint: !1
      };
    }
  };
  M(ke, "config", null), M(ke, "errorClient", null);
  const If = class sd {
    static getPersistedConfig(e) {
      var n;
      const i = localStorage.getItem(sd.PERSISTED_ANALYTICS_CONFIG_KEY);
      if (!i)
        return null;
      const s = JSON.parse(i), a = ke.getConfig().cartId;
      return a ? (n = s[a]) == null ? void 0 : n[e] : null;
    }
    static setPersistedConfig(e, n) {
      const i = localStorage.getItem(sd.PERSISTED_ANALYTICS_CONFIG_KEY) ?? "{}", s = JSON.parse(i), a = ke.getConfig().cartId;
      if (!a)
        throw new Error("Cart ID is not set");
      s[a] = {
        ...s[a],
        [e]: n
      }, localStorage.setItem(sd.PERSISTED_ANALYTICS_CONFIG_KEY, JSON.stringify(s));
    }
  };
  M(If, "PERSISTED_ANALYTICS_CONFIG_KEY", "persisted_config"), M(If, "EVENT_KEYS", {
    InitiateCheckout: "initiate-checkout"
  });
  let y0 = If;
  const w0 = class _i extends y0 {
    sendEvent(e, n, i) {
      if (!i.fbPixel)
        return;
      if (!window.fbq)
        throw new Error("window.fbq is not defined");
      if (_i.hasEventBeenSent())
        return;
      this.initialize(i);
      const s = `${_i.EVENT_KEYS[e]}-${ke.getConfig().cartId}`;
      window.fbq("track", e, _i.buildEventPayload(n), {
        eventId: s
      }), this.sendNubeSocialTracking(ke.getConfig().storeUrl, {
        content_ids: n.items.map((a) => a.variantId).join(","),
        num_items: n.items.length.toString(),
        content_type: "product",
        value: n.total.toString(),
        currency: n.currency.toString(),
        cart_id: ke.getConfig().cartId,
        event_name: e,
        event_id: s
      }), _i.markEventAsSent();
    }
    static buildEventPayload(e) {
      return {
        content_ids: e.items.map((n) => n.variantId),
        num_items: e.items.length,
        content_type: "product",
        value: e.total,
        currency: e.currency
      };
    }
    sendNubeSocialTracking(e, n) {
      const i = `https://${e}/fb-capi/`;
      new Image().src = `${i}?${new URLSearchParams(n)}`;
    }
    initialize(e) {
      const n = Tt.get("tn_track"), i = n == null ? void 0 : n.slice(-_i.EXTERNAL_ID_CHAR_LENGTH).toLowerCase(), s = i ? {
        external_id: i
      } : void 0;
      window.fbq("init", e.fbPixel, s, {
        agent: "tiendanube-core"
      });
    }
    static hasEventBeenSent() {
      return _i.getPersistedConfig("fb_pixel_initiate_checkout_sent");
    }
    static markEventAsSent() {
      _i.setPersistedConfig("fb_pixel_initiate_checkout_sent", Date.now().toString());
    }
  };
  M(w0, "EXTERNAL_ID_CHAR_LENGTH", 40);
  let U4 = w0;
  function S0(t) {
    return t !== null && typeof t == "object" && !Array.isArray(t) && Object.keys(t).length === 0;
  }
  function $4(t) {
    return Object.entries(t).reduce((e, [n, i]) => (i && !S0(i) && (e[n] = i), e), {});
  }
  const E0 = {
    FacebookAnalytics: U4,
    TikTokAnalytics: class Ri extends y0 {
      sendEvent(e, n, i) {
        if (!i.tiktokPixel || Ri.hasEventBeenSent())
          return;
        if (!window.ttq)
          throw new Error("window.ttq is not defined");
        const s = `${Ri.EVENT_KEYS[e]}-${ke.getConfig().cartId}`;
        window.ttq.track(e, Ri.buildEventPayload(n), {
          event_id: s
        }), Ri.markEventAsSent();
      }
      static buildEventPayload(e) {
        return {
          quantity: e.items.reduce((n, i) => n + i.quantity, 0),
          content_type: "product",
          value: e.total,
          currency: e.currency,
          contents: e.items.map((n) => $4({
            content_id: n.id,
            quantity: n.quantity,
            price: n.price,
            content_category: Ri.getItemDeepestCategory(n),
            content_name: n.name,
            brand: n.brand
          }))
        };
      }
      static getItemDeepestCategory(e) {
        const n = e.categoriesTaxonomy;
        if (!n || S0(n))
          return null;
        const i = Object.keys(n).sort((a, u) => a.localeCompare(u)), s = i[i.length - 1];
        return n[s];
      }
      static hasEventBeenSent() {
        return Ri.getPersistedConfig("tiktok_pixel_initiate_checkout_sent");
      }
      static markEventAsSent() {
        Ri.setPersistedConfig("tiktok_pixel_initiate_checkout_sent", Date.now().toString());
      }
    }
  }, x0 = class NE extends Error {
    constructor() {
      super("Trying to make request with expired session"), this.name = NE.Name;
    }
  };
  M(x0, "Name", "ExpiredSessionError");
  let b0 = x0;
  class Nf {
    static isCrossStoreCompatible() {
      return !Nf.isSafari();
    }
    static isSafari() {
      return /^((?!chrome|android).)*safari/i.test(navigator.userAgent);
    }
  }
  const C0 = () => /iphone|ipad|ipod/.test(navigator.userAgent.toLowerCase()), Df = () => /android|webos|iphone|ipad|ipod/.test(navigator.userAgent.toLowerCase()), z4 = () => !Df(), T0 = () => window.location.hash.startsWith("#") ? window.location.hash.slice(1) : window.location.hash, Bi = class Cn {
    static isAuthenticated() {
      return !!Tt.get(
        "wallet-session-data"
        /* Session */
      ) || !!Tt.get(
        "wallet-authenticated"
        /* LegacyAuthenticated */
      );
    }
    static isUserLogged() {
      return Cn.isAuthenticated() && !Cn.isDisabled();
    }
    static isLegacyAuthenticated() {
      return !!Tt.get(
        "wallet-authenticated"
        /* LegacyAuthenticated */
      ) && !Tt.get(
        "wallet-session-data"
        /* Session */
      );
    }
    static needsRefresh() {
      const e = Cn.getSameStoreSession();
      return e ? !e.access_token_expiration_date || new Date(e.access_token_expiration_date).getTime() < Date.now() : !0;
    }
    static isCrossStorePossible() {
      if (!Nf.isCrossStoreCompatible())
        return Cn.setCrossStoreImpossible(!0), !1;
      const e = Tt.get(
        "wallet-cross-store-impossible"
        /* CrossStoreImpossible */
      );
      return e ? e === "false" : !0;
    }
    static setCrossStoreImpossible(e) {
      Tt.set("wallet-cross-store-impossible", e ? "true" : "false");
    }
    static storeSession(e) {
      Tt.set("wallet-session-data", JSON.stringify(e), {
        expires: new Date(e.refresh_token_expiration_date),
        ...uu.isExpressCheckoutHost() ? Cn.expressCheckoutSessionConfig() : {}
      }), Cn.storeLegacySession(e);
    }
    static storeSessionType(e) {
      Tt.set(
        "wallet-same-store-authenticated",
        e ? "1" : "2"
        /* CrossStore */
      );
    }
    static isSameStoreAuthenticated() {
      return Cn.getSessionType() === 1;
    }
    static isAuthenticatedWithSameStoreSession() {
      const e = Cn.getSameStoreSession();
      return !!(e != null && e.refresh_token || Tt.get(
        "wallet-authenticated"
        /* LegacyAuthenticated */
      ) && Tt.get(
        "wallet-access-token"
        /* LegacySessionActive */
      ));
    }
    static getSessionType() {
      const e = Tt.get(
        "wallet-same-store-authenticated"
        /* SameStoreType */
      );
      return e ? Number(e) : Cn.isAuthenticated() ? 1 : 0;
    }
    static getAccessToken() {
      var e;
      return (e = Cn.getSameStoreSession()) == null ? void 0 : e.access_token;
    }
    static getRefreshToken() {
      var e;
      return (e = Cn.getSameStoreSession()) == null ? void 0 : e.refresh_token;
    }
    static clearSession() {
      Tt.remove(
        "wallet-session-data"
        /* Session */
      ), Tt.remove(
        "wallet-access-token"
        /* LegacySessionActive */
      ), Tt.remove(
        "wallet-authenticated"
        /* LegacyAuthenticated */
      );
    }
    static isExpired() {
      const e = Cn.getSameStoreSession();
      return e ? new Date(e.refresh_token_expiration_date).getTime() < Date.now() : !0;
    }
    static getSameStoreSession() {
      const e = Tt.get(
        "wallet-session-data"
        /* Session */
      );
      return e ? JSON.parse(e) : null;
    }
    static storeLegacySession(e) {
      Tt.set("wallet-authenticated", "authenticated", {
        expires: new Date(e.refresh_token_expiration_date)
      }), "access_token" in e && e.access_token && e.access_token_expiration_date && Tt.set("wallet-access-token", e.access_token, {
        expires: new Date(e.access_token_expiration_date)
      });
    }
    static expressCheckoutSessionConfig() {
      return Ly.MODE !== "test" ? {
        secure: !0,
        sameSite: "none"
      } : {};
    }
    static isJWTLogin() {
      return window.location.hash.includes("jwt_login");
    }
    static getJWTFromFragment() {
      const e = T0();
      if (e.startsWith("jwt_login="))
        return e.split("=")[1];
    }
    static removeJWTFromFragment() {
      const e = T0();
      if (!e)
        return;
      const n = e.startsWith("jwt_login=") ? "" : "#" + e, i = window.location.pathname + window.location.search + n;
      window.history && typeof window.history.replaceState == "function" && window.history.replaceState({}, "", i);
    }
  };
  M(Bi, "setDisableSession", () => {
    sessionStorage.setItem("sessionHasDisabled", "true");
  }), M(Bi, "removeDisableSession", () => {
    sessionStorage.removeItem("sessionHasDisabled");
  }), M(Bi, "isDisabled", () => (
    // Sessions are disabled when the user is logged in from the storefront with an email address other than wallet.
    !!sessionStorage.getItem("sessionHasDisabled")
  )), M(Bi, "getLoginType", () => Bi.isAuthenticated() ? Bi.isCrossStorePossible() ? "cross-store" : "same-store" : "not-logged");
  let Ce = Bi, Yr = class extends v0 {
    constructor(e) {
      super(e ?? ke.getWalletHost(), {
        sendFingerprint: ke.getConfig().sendFingerprint
      }, ke.getConfig().storeId);
    }
    async makeRequest(e, n, i, s, a) {
      await this.refreshTokenIfExpired(a);
      const u = Ce.getAccessToken(), d = a != null && a.public ? {
        ...s
      } : {
        ...s,
        Authorization: `Bearer ${u}`
      }, f = await super.makeRequest(e, n, i, d, a);
      return f.headers["x-send-snapshot"] && this.sendSnapshot(), f;
    }
    async refreshTokenIfExpired(e) {
      if (Ce.needsRefresh() && !(e != null && e.public)) {
        const n = Ce.getRefreshToken();
        if (!n || Ce.isExpired())
          throw new b0();
        const i = await super.makeRequest("POST", "/v1/auth/refresh", void 0, {
          Authorization: `Bearer ${n}`
        }, {
          sendVisitorComponents: !0
        });
        Ce.storeSession(i.data);
      }
    }
    async sendSnapshot() {
      try {
        const e = await br.getVisitorData();
        await this.makeRequest("POST", "/v1/fingerprint/snapshot", {
          components: JSON.parse(e.components)
        }, {}, {
          public: !1
        });
      } catch (e) {
        await this.logError("Failed to send fingerprint snapshot", e);
      }
    }
  };
  class jf {
    constructor(e = new Yr(), n = ke.getConfig()) {
      this.client = e, this.config = n;
    }
    registerLog(e, n) {
      return this.client.makeRequest("POST", "/v1/logger", {
        log: e,
        context: {
          ...n,
          store: {
            cartId: this.config.cartId,
            storeId: this.config.storeId
          },
          source: this.config.source
        }
      }, {}, {
        public: !0
      });
    }
  }
  const V4 = `
  height: 0;
  visibility: hidden;
  position: absolute;
  top: 0;
`, W4 = (t, e) => `
    <div style="${V4}">
        <iframe id="${e}" src="${t}" />
    </div>
`;
  let Mf = class {
    constructor(e, n) {
      this.iframeId = e, this.host = n;
    }
    postMessage(e, n = {}) {
      var i;
      const s = document.getElementById(this.iframeId);
      (i = s == null ? void 0 : s.contentWindow) == null || i.postMessage(JSON.stringify({
        message: e,
        data: n
      }), this.host);
    }
  };
  class Ff extends Error {
    constructor(e, n) {
      super(e), this.debuggingInfo = n, this.name = "TimeoutError";
    }
  }
  const cu = class ad {
    constructor(e, n, i) {
      M(this, "messageHandlers", []), M(this, "messageClient"), M(this, "attempts", []), M(this, "readyPayload"), M(this, "isIframeLoaded", !1), M(this, "handleMessage", (s) => {
        this.isValidOrigin(s.origin) && this.messageHandlers.forEach((a) => {
          a.handleIfShouldHandle(s);
        });
      }), this.iframeId = e, this.host = n, this.loggedUserEmail = i, this.messageClient = new Mf(e, n), this.messageHandlers = this.createMessageHandlers();
    }
    async start() {
      return await this.loadIframeAndWaitReady(), await this.continueFlow();
    }
    /**
     * Phase 1: Load iframe and wait for ready message
     * Returns the ready payload for cross store capability detection
     */
    async loadIframeAndWaitReady() {
      return this.isIframeLoaded && this.readyPayload ? this.readyPayload : new Promise((e, n) => {
        const i = (s) => {
          var a;
          if (this.isValidOrigin(s.origin) && ((a = s.data) == null ? void 0 : a.message) === this.getReadyMessageName()) {
            const u = s.data.data;
            this.readyPayload = u, this.isIframeLoaded = !0, window.removeEventListener("message", i), this.attempts.forEach(clearTimeout), e(u);
          }
        };
        window.addEventListener("message", i), this.attemptToLoadIframe(() => {
          window.removeEventListener("message", i), Ce.setCrossStoreImpossible(!0), n(new Ff("Timeout waiting for ready message", this.debuggingInfo()));
        });
      });
    }
    /**
     * Phase 2: Continue with authentication flow after iframe is loaded
     * Uses the existing message handlers for the complete flow
     */
    async continueFlow() {
      if (!document.getElementById(this.iframeId) || !this.readyPayload)
        throw new Error("Error continuing flow: Iframe not loaded or ready payload not available");
      return new Promise((e, n) => {
        const i = setTimeout(() => {
          n(new Ff("Timeout waiting for login to complete", this.debuggingInfo()));
        }, ad.CONTINUE_FLOW_TIMEOUT);
        return this.messageHandlers.forEach((s) => {
          s.onLoginFinished((a) => {
            clearTimeout(i), e(a);
          });
        }), this.handleReadyMessageForFlow(this.readyPayload, (s) => {
          clearTimeout(i), e(s);
        });
      });
    }
    attemptToLoadIframe(e) {
      this.attempts.length < ad.ATTEMPT_LIMIT ? (this.loadIframe(), this.attempts.push(setTimeout(() => {
        this.attemptToLoadIframe(e);
      }, ad.ATTEMPT_TIMEOUT))) : e();
    }
    loadIframe() {
      window.removeEventListener("message", this.handleMessage), window.addEventListener("message", this.handleMessage);
      const e = document.getElementById(this.iframeId);
      e && e.remove();
      const n = this.getIframeUrl(), i = new DOMParser().parseFromString(W4(n, this.iframeId), "text/html").body.firstElementChild;
      i && document.body.appendChild(i);
    }
    debuggingInfo() {
      return JSON.stringify(this.messageHandlers.reduce((e, n) => ({
        ...e,
        [n.name]: n.debuggingInfo()
      }), {}));
    }
    isValidOrigin(e) {
      return e === this.host;
    }
  };
  M(cu, "ATTEMPT_LIMIT", 3), M(cu, "ATTEMPT_TIMEOUT", 5e3), M(cu, "CONTINUE_FLOW_TIMEOUT", 5e3);
  let O0 = cu, Uo = class {
    constructor(e) {
      M(this, "debugInfo", {
        called: !1,
        error: ""
      }), M(this, "iframeFlowDone", () => ({
        isLogged: !1
      })), M(this, "handleIfShouldHandle", (n) => {
        try {
          const i = n.data;
          this.shouldHandle(i.message) && (this.debugInfo.called = !0, this.handleMessage(i.data, this.iframeFlowDone, i.error));
        } catch (i) {
          this.debugInfo.error = JSON.stringify(i, Object.getOwnPropertyNames(i));
        }
      }), M(this, "onLoginFinished", (n) => {
        this.iframeFlowDone = n;
      }), this.messageClient = e;
    }
    debuggingInfo() {
      return this.debugInfo;
    }
  };
  class G4 extends Uo {
    constructor() {
      super(...arguments), M(this, "name", "ClearAuthDataMessageHandler"), M(this, "handleMessage", (e, n, i) => {
        n({
          isLogged: !1,
          shouldLogout: Ce.isAuthenticated(),
          expiredSession: !1,
          cause: (e == null ? void 0 : e.cause) ?? i ?? "unexpected error",
          context: e == null ? void 0 : e.context
        });
      }), M(this, "shouldHandle", (e) => e === "NUVEM_CLEAR_AUTH_DATA");
    }
  }
  class q4 extends Uo {
    constructor() {
      super(...arguments), M(this, "name", "LoggedUserHandler"), M(this, "handleMessage", (e, n) => {
        const {
          user: i,
          storeId: s,
          sessionExpirationDate: a
        } = e;
        return Ce.storeSession({
          refresh_token_expiration_date: a
        }), Ce.removeDisableSession(), i && s && (new jf().registerLog("Found old cross store iframe session"), n({
          isLogged: !0,
          storeId: s,
          user: i
        })), n({
          isLogged: !1,
          shouldLogout: !1,
          expiredSession: !1
        });
      }), M(this, "shouldHandle", (e) => e === "NUVEM_LOGGED_USER");
    }
  }
  class Y4 extends Uo {
    constructor(e) {
      super(e), M(this, "name", "NoSessionMessageHandler"), M(this, "handleMessage", (n, i) => {
        this.messageClient.postMessage("NUVEM_SYNC_DONE"), Ce.setDisableSession(), i({
          isLogged: !1,
          shouldLogout: !1,
          expiredSession: !1,
          crossStoreImpossible: !1,
          cause: n.cause,
          context: n.context
        });
      }), M(this, "shouldHandle", (n) => n === "NUVEM_NO_SESSION"), this.messageClient = e;
    }
  }
  const _0 = class DE extends O0 {
    constructor(e, n) {
      super(DE.iframeID, e, n);
    }
    createMessageHandlers() {
      return [new q4(this.messageClient), new G4(this.messageClient), new Y4(this.messageClient)];
    }
    getIframeUrl() {
      return `${this.host}/authdata/v2.html`;
    }
    getReadyMessageName() {
      return "NUVEM_AUTH_DATA_READY";
    }
    async handleReadyMessageForFlow(e, n) {
      this.messageClient.postMessage("NUVEM_SYNC_DONE"), Ce.setCrossStoreImpossible(e.isCrossStoreImpossible), e.isCrossStoreImpossible ? n({
        isLogged: !1,
        shouldLogout: !1,
        expiredSession: !1,
        crossStoreImpossible: !0
      }) : this.messageClient.postMessage("NUVEM_LOGGED_USER", {
        email: this.loggedUserEmail,
        authenticated: Ce.isAuthenticated(),
        storeId: ke.getConfig().storeId,
        ...await this.getVisitorData()
      });
    }
    async getVisitorData() {
      if (!ke.getConfig().sendFingerprint)
        return {};
      try {
        return {
          visitorData: JSON.stringify(await br.getVisitorData()),
          deviceId: br.getDeviceId()
        };
      } catch (e) {
        return {
          visitorDataError: e.message
        };
      }
    }
  };
  M(_0, "iframeID", "walletAuthProxyIframe");
  let R0 = _0;
  class K4 {
    constructor(e = new Yr(window.location.origin)) {
      this.client = e;
    }
    async getSignedDomain() {
      return (await this.client.makeRequest("GET", "/store/signed_payload/", void 0, void 0, {
        public: !0
      })).data.signed_payload;
    }
  }
  class Z4 extends Uo {
    constructor(e) {
      super(e), M(this, "name", "ExpressCheckoutCheckSessionMessageHandler"), M(this, "handleMessage", async (n, i) => {
        try {
          const s = await new K4().getSignedDomain();
          this.messageClient.postMessage("EXPRESS_CHECKOUT_SESSION", {
            signedDomain: s
          });
        } catch (s) {
          i({
            isLogged: !1,
            shouldLogout: !1,
            expiredSession: !1,
            cause: "Error trying to send signed domain",
            context: {
              error: JSON.stringify(s, Object.getOwnPropertyNames(s))
            }
          });
        }
      }), M(this, "shouldHandle", (n) => n === "EXPRESS_CHECKOUT_HAS_SESSION"), this.messageClient = e;
    }
  }
  class X4 extends Uo {
    constructor(e) {
      super(e), M(this, "name", "ExpressCheckoutNoSessionMessageHandler"), M(this, "handleMessage", (n, i) => {
        i({
          isLogged: !1,
          shouldLogout: !1,
          expiredSession: !1,
          crossStoreImpossible: !1,
          cause: n.cause,
          context: n.context
        });
      }), M(this, "shouldHandle", (n) => n === "EXPRESS_CHECKOUT_NO_SESSION"), this.messageClient = e;
    }
  }
  class L0 {
    constructor(e) {
      M(this, "client"), M(this, "debuggingInfo", () => "SameStoreFlow"), M(this, "loginWithPersistedSession", async () => {
        try {
          const {
            data: n
          } = await this.client.makeRequest("GET", "/v1/auth/user");
          return this.isLoggedWithDifferentEmail(n.user) ? (Ce.setDisableSession(), {
            isLogged: !1,
            shouldLogout: !1,
            expiredSession: !1,
            cause: "EMAIL_MISMATCH",
            context: {
              userEmail: this.loggedUserEmail,
              payloadEmail: n.user.email
            }
          }) : (Ce.removeDisableSession(), {
            isLogged: !0,
            user: n.user
          });
        } catch (n) {
          return {
            isLogged: !1,
            shouldLogout: !1,
            expiredSession: n.name === b0.Name,
            cause: JSON.stringify(n, Object.getOwnPropertyNames(n))
          };
        }
      }), this.loggedUserEmail = e, this.client = new Yr();
    }
    start() {
      return Ce.isLegacyAuthenticated() ? (Ce.clearSession(), Promise.resolve({
        isLogged: !1,
        shouldLogout: !1,
        expiredSession: !1,
        cause: "Legacy session"
      })) : Ce.isAuthenticatedWithSameStoreSession() ? this.loginWithPersistedSession() : Promise.resolve({
        isLogged: !1,
        shouldLogout: !1,
        expiredSession: !1
      });
    }
    isLoggedWithDifferentEmail(e) {
      var n;
      return !e || this.loggedUserEmail && e && e.email.toLocaleLowerCase() !== ((n = this.loggedUserEmail) == null ? void 0 : n.toLocaleLowerCase());
    }
  }
  class J4 extends Uo {
    constructor(e, n, i = new jf()) {
      super(e), M(this, "name", "ExpressCheckoutSessionMessageHandler"), M(this, "handleMessage", async (s, a) => {
        Ce.storeSession({
          access_token: s.accessToken,
          access_token_expiration_date: s.accessTokenExpirationDate,
          refresh_token: s.refreshToken,
          refresh_token_expiration_date: s.refreshTokenExpirationDate
        });
        const u = await new L0(this.loggedUserEmail).start();
        a(u), await this.logger.registerLog("Transferred session from Express Checkout", {
          isLogged: u.isLogged
        });
      }), M(this, "shouldHandle", (s) => s === "EXPRESS_CHECKOUT_SESSION"), this.messageClient = e, this.loggedUserEmail = n, this.logger = i;
    }
  }
  const A0 = class Pm extends O0 {
    constructor(e, n = null) {
      super(Pm.iframeID, Bo.getExpressCheckoutHostByCountry(e), n), this.country = e;
    }
    createMessageHandlers() {
      return [new Z4(this.messageClient), new J4(this.messageClient, this.loggedUserEmail), new X4(this.messageClient)];
    }
    getIframeUrl() {
      return `${this.host}/session-sync`;
    }
    getReadyMessageName() {
      return "EXPRESS_CHECKOUT_READY";
    }
    handleReadyMessageForFlow(e, n) {
      return Ce.setCrossStoreImpossible(e.isCrossStoreImpossible), e.isCrossStoreImpossible ? n({
        isLogged: !1,
        shouldLogout: !1,
        expiredSession: !1,
        crossStoreImpossible: !0
      }) : this.messageClient.postMessage("EXPRESS_CHECKOUT_CHECK_SESSION", {}), Promise.resolve();
    }
    remove() {
      var e;
      window.removeEventListener("message", this.handleMessage), (e = document.getElementById(Pm.iframeID)) == null || e.remove();
    }
  };
  M(A0, "iframeID", "walletExpressCheckoutIframe");
  let Q4 = A0;
  class eR {
    constructor() {
      M(this, "client"), this.client = new Yr();
    }
    async start() {
      var e, n, i, s;
      const a = Ce.getJWTFromFragment();
      if (!a)
        return Promise.resolve({
          isLogged: !1,
          cause: "Expected a JWT for login and was not found",
          shouldLogout: !1,
          expiredSession: !1
        });
      try {
        const {
          data: u
        } = await this.client.makeRequest("POST", "/v1/auth/jwt-login", {
          jwt: a,
          cart_id: (e = ke.getConfig().cartId) == null ? void 0 : e.toString(),
          cart_hash: (n = ke.getConfig().cartHash) == null ? void 0 : n.toString(),
          store_id: (i = ke.getConfig().storeId) == null ? void 0 : i.toString(),
          type: ke.getConfig().source
        }, {}, {
          public: !0
        }), {
          user: d,
          ...f
        } = u;
        return Ce.storeSession(f), Ce.setCrossStoreImpossible(!0), Ce.removeJWTFromFragment(), Promise.resolve({
          isLogged: !0,
          user: d
        });
      } catch (u) {
        return Promise.resolve({
          isLogged: !1,
          cause: "JWT for jwt login was invalid, error: " + JSON.stringify(((s = u.response) == null ? void 0 : s.data) ?? u.message),
          shouldLogout: !1,
          expiredSession: !1
        });
      }
    }
    debuggingInfo() {
      return "JWTLoginFlow";
    }
  }
  const k0 = (t) => t.isLogged || "cause" in t && t.cause === "EMAIL_MISMATCH";
  async function tR(t, e = {}) {
    new jf().registerLog("Error in AuthFlowV2", {
      error: JSON.stringify(t, Object.getOwnPropertyNames(t)),
      crossStoreImpossible: !Ce.isCrossStorePossible(),
      disableSession: Ce.isDisabled(),
      isAuthenticated: Ce.isAuthenticated(),
      isAuthenticatedWithSameStoreSession: Ce.isAuthenticatedWithSameStoreSession(),
      ...e
    });
  }
  async function nR(t) {
    if (!Ce.isCrossStorePossible())
      return {
        crossStoreImpossible: !0
      };
    if (Bo.isExpressCheckoutHost())
      return Ce.setCrossStoreImpossible(!0), {
        crossStoreImpossible: !0
      };
    try {
      const e = new R0(ke.getIframeHost(), t), n = await e.loadIframeAndWaitReady();
      return Ce.setCrossStoreImpossible(n.isCrossStoreImpossible), {
        crossStoreImpossible: n.isCrossStoreImpossible,
        crossStoreFlow: n.isCrossStoreImpossible ? void 0 : e
      };
    } catch {
      return Ce.setCrossStoreImpossible(!0), {
        crossStoreImpossible: !0
      };
    }
  }
  async function rR({
    loggedUserEmail: t,
    country: e = "BR",
    useExpressCheckout: n = !0
  }) {
    try {
      let i, s;
      if (Ce.isJWTLogin()) {
        const d = await new eR().start();
        if (d.isLogged)
          return d;
        "cause" in d && (s = d.cause);
      }
      const {
        crossStoreImpossible: a,
        crossStoreFlow: u
      } = await nR(t);
      if (i = await new L0(t).start(), k0(i) || a)
        return {
          ...i,
          log: s
        };
      if (n) {
        const d = new Q4(e, t);
        if (i = await d.start(), d.remove(), k0(i) || "crossStoreImpossible" in i && i.crossStoreImpossible)
          return {
            ...i,
            log: s
          };
      }
      return i = await u.continueFlow(), {
        ...i,
        log: s
      };
    } catch (i) {
      throw tR(i), i;
    }
  }
  const $o = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
    __proto__: null,
    Client: Yr,
    MessageClient: Mf,
    SessionUtils: Ce,
    TimeoutError: Ff,
    start: rR
  }, Symbol.toStringTag, { value: "Module" })), iR = {
    logoNuvem: {
      paths: [{
        shape: "M141.32,0h-.09S141.18,0,141.15,0c-20.74.03-40.5,8.18-55.25,22.52-7.55-3.2-15.68-4.86-24.08-4.86C27.73,17.66,0,45.39,0,79.47s27.73,61.81,61.81,61.81c8.27,0,16.45-1.69,24.02-4.87,14.32,13.93,33.85,22.53,55.36,22.53,43.82,0,79.47-35.65,79.47-79.47S185.08.07,141.32,0ZM141.19,141.28c-34.08,0-61.81-27.73-61.81-61.81h-17.66c0,15.59,4.53,30.13,12.31,42.41-3.96,1.14-8.07,1.74-12.22,1.74-24.34,0-44.15-19.81-44.15-44.15s19.81-44.15,44.15-44.15c9.64,0,18.8,3.05,26.48,8.82,11.23,8.43,17.67,21.31,17.67,35.33h17.66c0-18.49-8.01-35.56-22.08-47.34,11.05-9.27,25.06-14.46,39.69-14.47,34.06.02,61.76,27.74,61.76,61.81s-27.73,61.81-61.81,61.81ZM324.85,55.35c2.25,4.03,3.38,8.69,3.38,13.98v45.51h-17.03v-41.48c0-3.12-.61-5.81-1.82-8.06-1.21-2.25-2.91-3.99-5.07-5.2-2.17-1.21-4.64-1.82-7.41-1.82s-5.25.61-7.41,1.82c-2.17,1.21-3.86,2.95-5.07,5.2-1.22,2.26-1.82,4.94-1.82,8.06v41.48h-17.16V44.1h16.12v8.7c1.64-2.92,3.92-5.24,6.83-6.95,3.77-2.21,8.17-3.32,13.2-3.32s9.82,1.13,13.85,3.38c4.03,2.26,7.17,5.4,9.43,9.43ZM385.98,44.1h17.03v42.91c0,5.81-1.32,10.92-3.97,15.34-2.65,4.42-6.29,7.87-10.92,10.34-4.64,2.47-10.12,3.71-16.45,3.71s-11.73-1.24-16.45-3.71c-4.73-2.47-8.41-5.92-11.05-10.34-2.65-4.42-3.97-9.54-3.97-15.34v-42.91h17.16v42.39c0,2.86.61,5.35,1.82,7.48,1.21,2.13,2.9,3.79,5.07,5.01,2.17,1.21,4.64,1.82,7.41,1.82s5.37-.61,7.54-1.82c2.17-1.21,3.84-2.88,5.01-5.01,1.17-2.12,1.76-4.62,1.76-7.48v-42.39ZM479.54,44.1l-27.83,70.74h-15.08l-27.83-70.74h18.59l16.72,46.17,16.83-46.17h18.59ZM539.97,52.81c-2.95-3.21-6.52-5.72-10.73-7.54-4.21-1.82-9.08-2.73-14.63-2.73-6.68,0-12.66,1.6-17.94,4.81-5.29,3.21-9.49,7.56-12.61,13.07-3.12,5.51-4.68,11.81-4.68,18.92s1.52,13.09,4.55,18.72c3.03,5.64,7.3,10.1,12.81,13.39,5.5,3.3,11.9,4.94,19.18,4.94,4.77,0,9.19-.74,13.26-2.21,4.07-1.47,7.58-3.51,10.53-6.11,2.95-2.6,5.11-5.59,6.5-8.97l-13.78-6.76c-1.56,2.78-3.71,4.99-6.44,6.63-2.73,1.65-6.05,2.47-9.95,2.47s-7.35-.91-10.34-2.73c-2.99-1.82-5.25-4.4-6.76-7.74-.91-2.01-1.48-4.2-1.72-6.57h50.94c.35-1.04.58-2.19.71-3.45.13-1.26.2-2.54.2-3.84,0-4.77-.78-9.21-2.34-13.33-1.56-4.12-3.82-7.78-6.76-10.99ZM505.13,59.31c2.77-1.82,5.94-2.73,9.49-2.73s6.91.91,9.56,2.73c2.64,1.82,4.55,4.29,5.72,7.41.53,1.42.85,2.95.95,4.55h-33.27c.29-1.49.7-2.88,1.24-4.16,1.43-3.38,3.53-5.98,6.31-7.8ZM660.63,55.35c2.25,4.03,3.38,8.69,3.38,13.98v45.51h-17.03v-41.48c0-3.12-.56-5.81-1.69-8.06-1.13-2.25-2.71-3.99-4.75-5.2-2.04-1.21-4.44-1.82-7.22-1.82s-5.07.61-7.15,1.82c-2.08,1.21-3.69,2.95-4.81,5.2-1.13,2.26-1.69,4.94-1.69,8.06v41.48h-17.03v-41.48c0-3.12-.56-5.81-1.69-8.06-1.13-2.25-2.71-3.99-4.75-5.2-2.04-1.21-4.44-1.82-7.22-1.82s-5.07.61-7.15,1.82c-2.08,1.21-3.69,2.95-4.81,5.2-1.13,2.26-1.69,4.94-1.69,8.06v41.48h-17.16V44.1h16.12v8.89c1.44-2.8,3.43-5.03,5.98-6.68,3.9-2.51,8.49-3.77,13.78-3.77,5.81,0,10.92,1.52,15.34,4.55,2.79,1.91,4.95,4.21,6.5,6.88,1.89-2.98,4.23-5.39,7.02-7.21,4.33-2.82,9.32-4.23,14.95-4.23,5.03,0,9.51,1.13,13.46,3.38,3.94,2.26,7.04,5.4,9.3,9.43Z"
      }],
      width: "101",
      height: "19",
      viewBoxWidth: "664",
      viewBoxHeight: "158",
      size: {
        default: "19",
        small: "16",
        medium: "22"
      }
    },
    logoNube: {
      paths: [{
        shape: "M15.9929 1H15.9829C15.9829 1 15.9765 1 15.9729 1C13.6257 1.00365 11.3896 1.92499 9.72064 3.54967C8.8665 3.1866 7.94587 2.99959 6.99514 2.99959C3.13751 2.99959 0 6.13949 0 10C0 13.8605 3.13751 16.9995 6.99424 16.9995C7.93039 16.9995 8.85649 16.8088 9.71243 16.4476C11.3331 18.0248 13.5436 19 15.9774 19C20.9362 19 24.9706 14.9625 24.9706 10C24.9706 5.03751 20.9444 1.0073 15.9929 1ZM15.9774 16.9995C12.1207 16.9995 8.9832 13.8596 8.9832 10H6.98509C6.98509 11.7652 7.49737 13.4117 8.37795 14.8028C7.93039 14.9315 7.46456 14.9999 6.99424 14.9999C4.23956 14.9999 1.99809 12.7576 1.99809 10C1.99809 7.24236 4.23866 5.00009 6.99424 5.00009C8.08534 5.00009 9.12176 5.34494 9.99135 5.99897C11.262 6.9541 11.9904 8.41274 11.9904 10H13.9884C13.9884 7.90555 13.0824 5.97254 11.4908 4.63795C12.7415 3.58798 14.3266 3.00142 15.982 2.99959C19.8369 3.00233 22.9716 6.14129 22.9716 9.9991C22.9716 13.8569 19.8341 16.9995 15.9774 16.9995Z"
      }, {
        shape: "M30.7302 15.0211H32.6409V10.7682C32.6409 9.38346 33.3987 8.50982 34.5352 8.50982C35.7047 8.50982 36.3306 9.26808 36.3306 10.5209V15.0211H38.2414V10.1582C38.2414 8.04824 37.0883 6.74601 35.1117 6.74601C33.9752 6.74601 33.1516 7.24052 32.6409 8.01527V6.94382H30.7302V15.0211Z"
      }, {
        shape: "M43.1306 15.2189C45.3705 15.2189 46.7212 13.8672 46.7212 11.5429V6.94382H44.8106V11.4275C44.8106 12.6968 44.1848 13.4551 43.1306 13.4551C42.0765 13.4551 41.4502 12.6968 41.4502 11.4275V6.94382H39.5396V11.5429C39.5396 13.8672 40.8904 15.2189 43.1306 15.2189Z"
      }, {
        shape: "M48.1766 15.0211H50.0711V13.9166C50.664 14.7573 51.6851 15.2189 52.8052 15.2189C55.029 15.2189 56.742 13.3562 56.742 10.9824C56.742 8.55925 55.029 6.74601 52.8052 6.74601C51.6851 6.74601 50.664 7.25703 50.0711 8.0977V3.48213H48.1766V15.0211ZM54.8314 10.9824C54.8314 12.3671 53.7772 13.488 52.41 13.488C51.0427 13.488 49.9886 12.3671 49.9886 10.9824C49.9886 9.59777 51.0427 8.47682 52.41 8.47682C53.7772 8.47682 54.8314 9.59777 54.8314 10.9824Z"
      }, {
        shape: "M65.0741 13.1254L63.5093 12.3836C63.048 13.0924 62.5046 13.6034 61.4505 13.6034C60.2479 13.6034 59.2103 12.7298 59.1278 11.5594H65.3378C65.3543 11.3286 65.3542 11.1308 65.3542 10.9824C65.3542 8.55925 63.6904 6.74601 61.335 6.74601C59.0126 6.74601 57.2336 8.55925 57.2336 10.9824C57.2336 13.4716 58.9796 15.2189 61.434 15.2189C63.147 15.2189 64.3988 14.3947 65.0741 13.1254ZM63.4598 10.1747H59.1443C59.2763 9.25161 60.1654 8.31201 61.302 8.31201C62.4716 8.31201 63.3281 9.10322 63.4598 10.1747Z"
      }],
      width: "66",
      height: "19",
      viewBoxWidth: "66",
      viewBoxHeight: "19",
      size: {
        default: "19",
        small: "16",
        medium: "22"
      }
    },
    close: {
      paths: [{
        shape: "M12.8075 4.45207L12.1925 3.74707L8 7.37707L3.8075 3.74707L3.1925 4.45207L7.2875 7.99957L3.1925 11.5471L3.8075 12.2521L8 8.62207L12.1925 12.2521L12.8075 11.5471L8.7125 7.99957L12.8075 4.45207Z"
      }],
      width: "16",
      height: "16",
      viewBoxWidth: "16",
      viewBoxHeight: "16"
    },
    quickAccessIcon: {
      paths: [{
        shape: "M9.613 2.474 6.387 8.12a.35.35 0 0 0 .298.525h1.837c.384 0 .695.311.695.694v2.334a.35.35 0 0 0 .641.192L13.032 7.1a.344.344 0 0 0-.286-.536h-1.814a.7.7 0 0 1-.7-.7V2.63a.344.344 0 0 0-.619-.157Z"
      }, {
        shape: "M5.104 4.731h-2.8a.437.437 0 1 1 0-.875h2.8a.437.437 0 1 1 0 .875Z"
      }, {
        shape: "M4.404 7.49h-2.8a.437.437 0 1 1 0-.875h2.8a.438.438 0 0 1 0 .875Z"
      }, {
        shape: "M5.104 10.856h-2.8a.437.437 0 1 1 0-.875h2.8a.437.437 0 1 1 0 .875Z"
      }],
      width: "14",
      height: "14",
      viewBoxHeight: "14",
      viewBoxWidth: "14"
    },
    person: {
      paths: [{
        shape: "M6.99993 6.99999C8.2891 6.99999 9.33327 5.95583 9.33327 4.66666C9.33327 3.37749 8.2891 2.33333 6.99993 2.33333C5.71077 2.33333 4.6666 3.37749 4.6666 4.66666C4.6666 5.95583 5.71077 6.99999 6.99993 6.99999ZM6.99993 8.16666C5.44243 8.16666 2.33327 8.94833 2.33327 10.5V11.0833C2.33327 11.4042 2.59577 11.6667 2.9166 11.6667H11.0833C11.4041 11.6667 11.6666 11.4042 11.6666 11.0833V10.5C11.6666 8.94833 8.55743 8.16666 6.99993 8.16666Z"
      }],
      width: "14",
      height: "14",
      viewBoxHeight: "14",
      viewBoxWidth: "14"
    }
  };
  var Hf = { iconSize: "wallet-lib-core_dkrzo20", minSize: { default: "wallet-lib-core_dkrzo23", small: "wallet-lib-core_dkrzo24", medium: "wallet-lib-core_dkrzo25" }, maxSize: { default: "wallet-lib-core_dkrzo26", small: "wallet-lib-core_dkrzo27", medium: "wallet-lib-core_dkrzo28" } };
  const oR = ({
    rects: t
  }) => t ? /* @__PURE__ */ O.jsx(O.Fragment, {
    children: t.map((e) => /* @__PURE__ */ O.jsx("rect", {
      width: e.width,
      height: e.height,
      rx: e.rx,
      fill: e.fill,
      stroke: e.stroke,
      strokeWidth: e.strokeWidth,
      transform: e.transform,
      x: e.x,
      y: e.y
    }, e.rx))
  }) : null, sR = ({
    paths: t
  }) => /* @__PURE__ */ O.jsxs(O.Fragment, {
    children: [t.map((e) => /* @__PURE__ */ O.jsx("path", {
      d: e.shape,
      fillRule: e.fillRule,
      clipRule: e.clipRule,
      strokeWidth: e.strokeWidth,
      stroke: e.stroke,
      strokeLinecap: e.strokeLineCap,
      strokeLinejoin: e.strokeLineJoin,
      fill: e.fill && gf.palette[e.fill]
    }, e.shape.slice(0, 10))), " "]
  }), na = ({
    name: t,
    className: e = "",
    iconColor: n = "white",
    size: i = "default",
    alt: s,
    minSize: a,
    maxSize: u,
    customSize: d,
    ...f
  }) => {
    var p;
    const m = iR[t], v = My("fill", n), y = d ?? ((p = m.size) == null ? void 0 : p[i]) ?? m.height;
    return /* @__PURE__ */ O.jsxs("svg", {
      width: "100%",
      height: y,
      viewBox: `0 0 ${m.viewBoxWidth} ${m.viewBoxHeight}`,
      className: Gr(Iy, Hf.iconSize, {
        [Hf.minSize[a]]: !!a
      }, {
        [Hf.maxSize[u]]: !!u
      }, e),
      style: v,
      "data-testid": f["data-testid"],
      fill: m.fill ?? "currentColor",
      "aria-label": s,
      "aria-hidden": !s,
      children: [/* @__PURE__ */ O.jsx(oR, {
        rects: m.rects
      }), /* @__PURE__ */ O.jsx(sR, {
        paths: m.paths
      })]
    });
  }, P0 = ({
    color: t = "white",
    size: e = "default"
  }) => {
    const {
      t: n
    } = or();
    return /* @__PURE__ */ O.jsx(na, {
      size: e,
      name: n("general.walletLogo"),
      iconColor: t,
      "data-testid": "svgLogo",
      alt: n("general.walletLogoAlt")
    });
  };
  var aR = { circularSpinner: "wallet-lib-core_y8sstu1" };
  const lR = () => /* @__PURE__ */ O.jsx("span", {
    className: aR.circularSpinner
  });
  var uR = { fullWidth: "wallet-lib-core_1hgah2tf", responsive: "wallet-lib-core_1hgah2tg" }, cR = { rounded: "wallet-lib-core_1hgah2th" }, dR = "wallet-lib-core_1hgah2ti", I0 = { primary: "wallet-lib-core_1hgah2t3 wallet-lib-core_1hgah2t2 wallet-lib-core_1hgah2t0", primaryPartial: "wallet-lib-core_1hgah2t4 wallet-lib-core_1hgah2t2 wallet-lib-core_1hgah2t0", primaryTheme: "wallet-lib-core_1hgah2t5 wallet-lib-core_1hgah2t0", secondary: "wallet-lib-core_1hgah2t6 wallet-lib-core_1hgah2t0", icon: "wallet-lib-core_1hgah2t7 wallet-lib-core_1hgah2t0", unStyled: "wallet-lib-core_1hgah2t8", container: "wallet-lib-core_1hgah2t9 wallet-lib-core_1hgah2t0", childrenLoading: "wallet-lib-core_1hgah2ta", link: "wallet-lib-core_1hgah2tb wallet-lib-core_1hgah2t1 wallet-lib-core_1hgah2t0", linkNoUnderline: "wallet-lib-core_1hgah2tc wallet-lib-core_1hgah2t1 wallet-lib-core_1hgah2t0", linkNeutral: "wallet-lib-core_1hgah2td wallet-lib-core_1hgah2t1 wallet-lib-core_1hgah2t0", invisible: "wallet-lib-core_1hgah2te" };
  const fR = ["Enter"], Ui = ({
    children: t,
    type: e = "primary",
    loading: n = !1,
    className: i = "",
    width: s,
    customHeight: a,
    id: u,
    shape: d,
    tabIndex: f = 0,
    ...p
  }) => {
    const m = (E) => {
      !n && p.onClick && p.onClick(E);
    }, v = (E) => {
      fR.includes(E.key) && m();
    }, y = {
      "btn btn-primary": ["primaryTheme", "primaryPartial"].includes(e)
    };
    return /* @__PURE__ */ O.jsxs("div", {
      id: u,
      role: "button",
      tabIndex: f,
      className: Gr(I0[e], i, y, s && uR[s], d && cR[d], n && dR),
      style: {
        height: a
      },
      "data-testid": p["data-testid"],
      onClick: m,
      onKeyDown: v,
      "aria-label": p["aria-label"],
      children: [n && /* @__PURE__ */ O.jsx(lR, {}), /* @__PURE__ */ O.jsx("span", {
        className: Gr({
          [I0.childrenLoading]: n
        }),
        children: t
      })]
    });
  }, hR = ["new_linkedman", "material", "bahia"], pR = ["cubo"];
  function mR({
    onClick: t,
    loading: e = !1,
    customHeight: n,
    user: i,
    theme: s,
    ...a
  }) {
    const {
      t: u
    } = or(), d = gR(i, s);
    return /* @__PURE__ */ O.jsx(Ui, {
      onClick: t,
      "data-testid": a["data-testid"],
      type: "primaryPartial",
      width: "fullWidth",
      loading: e,
      customHeight: n,
      children: /* @__PURE__ */ O.jsxs(ou, {
        alignItems: "center",
        children: [/* @__PURE__ */ O.jsx(Qs, {
          color: "white",
          size: "medium",
          weight: "bold",
          font: "wallet",
          children: u(d)
        }), /* @__PURE__ */ O.jsx(pf, {
          size: "xSmall"
        }), /* @__PURE__ */ O.jsx(P0, {
          color: "white",
          size: "small"
        })]
      })
    });
  }
  function gR(t, e) {
    return !t || e && pR.includes(e) ? "general.buyWith" : !t.hasSavedCards || e && hR.includes(e) ? "general.quickBuyWith" : "general.oneClickBuyWith";
  }
  const zo = {
    CORE_CHECKOUT: "core-checkout",
    FORCE_LOGIN: "force-login",
    INVISIBLE_OPT_IN: "invisible-opt-in",
    STOREFRONT_LOGIN: "storefront-login"
  }, ra = class rr {
    constructor(e, n) {
      M(this, "inputManual", !0), M(this, "registerEventPersisted", (i) => this.api.registerEventPersisted({
        input_manual: this.inputManual,
        ...this.eventDataForRequest(),
        ...i,
        type: zo.CORE_CHECKOUT
      })), M(this, "registerCustomerLogin", (i, s) => this.api.registerEvent({
        ...this.eventDataForRequest(),
        type: i.source,
        success: !0,
        error: null,
        email: s.email,
        wallet_customer_id: s.id,
        channel: "email"
      }, rr.events.CUSTOMER_LOGIN)), M(this, "eventDataForRequest", () => ({
        store_id: rr.getCurrentEventData(this.config).storeId,
        cart_id: rr.getCurrentEventData(this.config).cartId,
        cart_hash: rr.getCurrentEventData(this.config).cartHash,
        source: "default",
        timestamp: (/* @__PURE__ */ new Date()).toISOString(),
        country: this.config.country,
        session_id: rr.getCurrentEventData(this.config).tiendanubeSessionId,
        consumer_id: rr.getCurrentEventData(this.config).tiendanubeConsumerId
      })), this.api = e, this.config = n;
    }
    registerCustomIdentification(e, n) {
      return this.api.registerEvent({
        type: e.source,
        ...this.eventDataForRequest(),
        ...n
      }, rr.events.CUSTOMER_IDENTIFICATION);
    }
    registerOTPReceived(e, n) {
      return this.api.registerEvent({
        ...this.eventDataForRequest(),
        input_manual: this.inputManual,
        ...n,
        type: e.source
      }, rr.events.OTP_RECEIVED);
    }
    registerOTPDismissed() {
      return this.api.registerEvent(this.eventDataForRequest(), rr.events.OTP_DISMISSED);
    }
    registerOTPClosedImmediately() {
      return this.api.registerEvent(this.eventDataForRequest(), rr.events.OTP_CLOSED_IMMEDIATELY);
    }
  };
  M(ra, "events", {
    AB_TEST: "wallet_ab_test",
    APP_STORE_OPENED: "wallet_app_store_opened",
    APP_STORE_SHOWN: "wallet_app_store_shown",
    CUSTOMER_IDENTIFICATION: "wallet_customer_identification",
    OTP_CLOSED_IMMEDIATELY: "wallet_otp_closed_immediately",
    OTP_DISMISSED: "wallet_otp_dismissed",
    OTP_RECEIVED: "wallet_otp_received",
    CUSTOMER_LOGIN: "wallet_customer_login"
  }), M(ra, "logsEvents", {
    INVISIBLE_OPTIN_RENDERED: "wallet_invisible_optin_rendered",
    INVISIBLE_OPTIN_CLICKED: "wallet_invisible_optin_clicked",
    INVISIBLE_OPTIN_OTP_SEND: "wallet_invisible_optin_otp_send",
    INVISIBLE_OPTIN_LOGIN: "wallet_invisible_optin_login",
    INVISIBLE_OPTIN_LEGAL_SHOWN: "wallet_invisible_optin_legal_show"
  }), M(ra, "getCurrentEventData", (t) => ({
    cartHash: t.cartHash,
    storeId: Number(t.storeId),
    cartId: t.cartId ? Number(t.cartId) : void 0,
    source: "default",
    tiendanubeSessionId: t.tiendanubeSessionId,
    tiendanubeConsumerId: t.tiendanubeConsumerId
  })), M(ra, "getLoginEventData", (t) => ({
    storeId: t.storeId,
    cartId: t.cartId,
    cartHash: t.cartHash,
    type: t.source,
    source: "default",
    tiendanubeSessionId: t.tiendanubeSessionId,
    tiendanubeConsumerId: t.tiendanubeConsumerId
  }));
  let du = ra;
  class Bf {
    constructor(e, n) {
      M(this, "authCommonData", () => {
        const i = this.config.storeId, s = this.config.cartId;
        return {
          country: this.config.country,
          storeName: this.config.storeName,
          productsInfoUrl: `${ke.getNuvemshopHost()}/${i}/orders/${s}`,
          returnUrl: this.config.returnUrl,
          storeLogo: this.config.storeLogo,
          storeUrl: this.config.storeUrl,
          ...du.getCurrentEventData(this.config)
        };
      }), this.client = e, this.config = n;
    }
    commonHeaders() {
      return {
        "Accept-Language": this.config.language
      };
    }
    async registerEvent(e, n) {
      await this.client.makeRequest("POST", "/v1/events", {
        event: n,
        storeId: e.store_id,
        eventData: e
      }, {}, {
        public: !0
      });
    }
    async initialize(e, n, i, s = {}) {
      const {
        data: a
      } = await this.client.makeRequest("POST", "/v2/auth/initialize", {
        email: n,
        channel: e,
        type: i,
        ...this.authCommonData()
      }, {
        ...this.commonHeaders(),
        ...s
      }, {
        public: !0
      });
      return a ?? {};
    }
    async sendOTP(e, n, i, s, a = {}) {
      const {
        data: u
      } = await this.client.makeRequest("POST", `/v2/auth/send-otp?channel=${e}`, {
        email: n,
        phone: s,
        type: i,
        ...this.authCommonData()
      }, {
        ...this.commonHeaders(),
        ...a
      }, {
        public: !0
      });
      return u ?? {};
    }
    async login(e, n, i, s) {
      const {
        data: a
      } = await this.client.makeRequest("POST", "/v2/auth/login", this.getLoginData(e, n, i, s), this.commonHeaders(), {
        public: !0,
        sendVisitorComponents: !0
      });
      return a;
    }
    async getExperimentVariant(e) {
      const {
        data: n
      } = await this.client.makeRequest("POST", `/v1/carts/${this.config.cartId}/generate-variant`, {
        test_name: e
      }, {}, {
        public: !0
      });
      return n.variant;
    }
    async validateEmail(e) {
      await this.client.makeRequest("POST", "/v1/auth/validateEmail", {
        otp: e
      });
    }
    async registerEventPersisted(e) {
      await this.client.makeRequest("POST", "/v2/events/persisted", {
        eventData: e
      });
    }
    async getUserProfile(e) {
      if (e) {
        const {
          data: i
        } = await this.client.makeRequest("GET", `/v2/auth/user?email=${encodeURIComponent(e)}`);
        return i;
      }
      const {
        data: n
      } = await this.client.makeRequest("GET", "/v2/auth/user");
      return n;
    }
    async logout(e) {
      const n = {
        externalCartId: this.config.cartId,
        externalCartHash: this.config.cartHash,
        email: e,
        tiendanubeSessionId: this.config.tiendanubeSessionId,
        tiendanubeConsumerId: this.config.tiendanubeConsumerId
      };
      await this.client.makeRequest("POST", "/v2/auth/logout", n);
    }
    async refreshToken() {
      const {
        data: e
      } = await this.client.makeRequest("POST", "/v2/auth/refresh", void 0, void 0, {
        sendVisitorComponents: !0
      });
      return e;
    }
    async verifyUserExist(e) {
      const {
        data: n
      } = await this.client.makeRequest("POST", "/v2/users/registered", {
        email: e
      }, {}, {
        public: !0
      });
      return n;
    }
    getLoginData(e, n, i, s) {
      return {
        email: n,
        otp: e,
        customer_data: !0,
        channel: i,
        type: s,
        country: this.config.country,
        ...du.getCurrentEventData(this.config)
      };
    }
    async initSessionTransfer() {
      const e = Ce.getRefreshToken(), {
        data: n
      } = await this.client.makeRequest("POST", "/v1/auth/init-session-transfer", {
        refresh_token: e
      });
      return n.exchange_token;
    }
    async completeSessionTransfer(e) {
      const {
        data: n
      } = await this.client.makeRequest("POST", "/v1/auth/complete-session-transfer", {
        exchange_token: e
      }, {}, {
        public: !0,
        sendVisitorComponents: !0
      });
      return n;
    }
  }
  let Kr = class extends Error {
    constructor(e, n, i) {
      super(e), M(this, "asString", () => `${this.message} 
${this.error.message} 
${this.context}`), this.error = n, this.context = i;
    }
  }, Vo = class {
  };
  M(Vo, "round", (t) => Math.round(t * 100) / 100), M(Vo, "toArray", (t) => Array.from(Array(t).keys()));
  class Uf {
  }
  M(Uf, "secondsToMilliseconds", (t) => t * 1e3), M(Uf, "secondsBetweenDates", (t, e) => Math.abs((t.getTime() - e.getTime()) / 1e3));
  const $f = class {
    constructor(e) {
      M(this, "DEFAULT_STEP_SECONDS", 1), M(this, "config"), M(this, "interval", null), M(this, "start", () => {
        this.reachedZero() ? this.config.onTimerFinished() : this.interval = setInterval(() => {
          this.advanceTime(), this.reachedZero() && (this.config.onTimerFinished(), this.stop()), this.config.step && this.config.step(this.config.minutes, this.config.seconds);
        }, Uf.secondsToMilliseconds(this.config.stepTime));
      }), M(this, "stop", () => {
        this.interval && clearInterval(this.interval);
      }), M(this, "current", () => ({
        seconds: this.config.seconds,
        minutes: this.config.minutes
      })), M(this, "reachedZero", () => this.config.minutes === 0 && Vo.round(this.config.seconds) === 0), M(this, "advanceTime", () => {
        this.config.seconds -= this.config.stepTime, this.config.seconds === 0 && this.config.minutes > 0 && (this.config.minutes -= 1, this.config.seconds = 59);
      }), this.config = {
        ...e,
        minutes: e.minutes || 0,
        stepTime: e.stepTime || this.DEFAULT_STEP_SECONDS
      };
    }
  };
  M($f, "startWith", (t) => {
    const e = new $f(t);
    return e.start(), e;
  });
  let fu = $f;
  class vR {
    constructor() {
      M(this, "TIMEOUT_SECONDS", 20), M(this, "resourceMap", {}), M(this, "messageClient", new Mf(R0.iframeID, ke.getIframeHost())), M(this, "request", (e, n) => this.resourceMap[e](n)), M(this, "postAndGetMessage", async (e, n) => new Promise((i, s) => {
        const a = fu.startWith({
          seconds: this.TIMEOUT_SECONDS,
          onTimerFinished: () => {
            s(new Error("IframeClient timeout"));
          }
        });
        window.addEventListener("message", (u) => {
          if (u.origin !== ke.getIframeHost())
            return;
          const {
            message: d,
            data: f,
            error: p
          } = u.data;
          d === e && (a.stop(), p ? s(new Error(p)) : i(f));
        });
        try {
          this.messageClient.postMessage(e, n);
        } catch (u) {
          throw new Kr("Trying to access unavailable iframe", u);
        }
      })), M(this, "logout", (e) => this.postAndGetMessage("NUVEM_LOGOUT", e)), M(this, "login", (e) => this.postAndGetMessage("NUVEM_LOGIN", e)), M(this, "validateEmail", (e) => this.postAndGetMessage("NUVEM_REQUEST", {
        resource: "validateEmail",
        body: e
      })), M(this, "initSessionTransfer", () => this.postAndGetMessage("NUVEM_REQUEST", {
        resource: "initSessionTransfer"
      })), this.resourceMap = {
        "/logout": this.logout,
        "/login": this.login,
        "/validateEmail": this.validateEmail,
        "/initSessionTransfer": this.initSessionTransfer
      };
    }
  }
  class yR extends Bf {
    constructor(e, n) {
      super(e, n), M(this, "iframeClient", new vR());
    }
    async login(e, n, i, s) {
      return this.iframeClient.request("/login", this.getLoginData(e, n, i, s));
    }
    async validateEmail(e) {
      return this.iframeClient.request("/validateEmail", {
        otp: e
      });
    }
    async logout() {
      return this.iframeClient.request("/logout");
    }
    async initSessionTransfer() {
      return (await this.iframeClient.request("/initSessionTransfer")).exchange_token;
    }
  }
  class zf {
    static buildApi(e) {
      return Ce.isCrossStorePossible() ? new yR(new Yr(), e) : new Bf(new Yr(), e);
    }
  }
  class wR {
    constructor() {
      M(this, "eventService"), M(this, "config", ke.getConfig()), M(this, "registerCustomIdentification", (n) => this.eventService.registerCustomIdentification(this.config, n)), M(this, "registerOTPReceived", () => this.eventService.registerOTPReceived(this.config)), M(this, "registerCustomerLogin", (n) => this.eventService.registerCustomerLogin(this.config, n));
      const e = zf.buildApi(this.config);
      this.eventService = new du(e, this.config);
    }
  }
  const SR = new RegExp(/^\w+([+\\.-]\w+)*@\w+([\\.-]\w+)*(\.\w{2,3})+$/), ER = (t) => t.charAt(0).toUpperCase() + t.slice(1), N0 = (t) => SR.test(t), D0 = (t, e) => e.slice(-t), Vf = (t) => (t.match(/(\d+)/g) || [""])[0], j0 = class jE extends Error {
    constructor() {
      super("Access code validation is already in progress"), this.name = jE.Name;
    }
  };
  M(j0, "Name", "AccessCodeValidationInProgress");
  let Wf = j0;
  const hu = class Ja {
    constructor(e, n) {
      M(this, "refreshUserRegisteredResult", async (i) => {
        var s;
        const a = i ?? ((s = Ja.getUserRegisteredResultFromStorage()) == null ? void 0 : s.email), u = a ? await this.api.verifyUserExist(a) : {
          registered: !1,
          country: this.config.country
        };
        return Ja.setUserRegisteredResult(u), u;
      }), M(this, "isRegistered", async (i) => {
        const s = await this.getUserRegisteredResult(i);
        return !!(s != null && s.registered);
      }), M(this, "isRegisteredWithConsent", async (i) => {
        const s = await this.getUserRegisteredResult(i);
        return !!(s != null && s.registered && s != null && s.with_consent);
      }), M(this, "getUserRegisteredResult", async (i) => Ja.getUserRegisteredResultFromStorage() ?? this.refreshUserRegisteredResult(i)), this.api = e, this.config = n;
    }
    static getUserRegisteredResultFromStorage() {
      const e = sessionStorage.getItem(Ja.USER_REGISTERED_RESULT_KEY);
      return e ? JSON.parse(e) : null;
    }
  };
  M(hu, "USER_REGISTERED_RESULT_KEY", "userRegisteredResult"), M(hu, "setUserRegisteredResult", (t) => {
    sessionStorage.setItem(hu.USER_REGISTERED_RESULT_KEY, JSON.stringify(t));
  });
  let M0 = hu;
  const F0 = class ME {
    constructor(e, n, i) {
      M(this, "loginType", zo.CORE_CHECKOUT), M(this, "user", null), M(this, "accessCodeValidationIsInProgress", !1), M(this, "getUserAuthDataWithOtpCode", async (s, a, u) => {
        if (this.accessCodeValidationIsInProgress)
          throw new Wf();
        this.accessCodeValidationIsInProgress = !0;
        let d;
        try {
          d = await this.validateAccessCode(s, a, u);
        } catch (m) {
          throw this.accessCodeValidationIsInProgress = !1, m;
        }
        this.accessCodeValidationIsInProgress = !1;
        const {
          user: f,
          ...p
        } = d;
        if (!f)
          throw new Kr("Invalid otp", null, p);
        return ME.loginResponseToSessionData({
          user: f,
          ...p
        });
      }), M(this, "validateEmailWithOtpCode", async (s, a) => {
        if (this.accessCodeValidationIsInProgress)
          throw new Wf();
        this.accessCodeValidationIsInProgress = !0;
        try {
          await this.validateEmail(s, a);
        } catch (u) {
          throw this.accessCodeValidationIsInProgress = !1, u;
        }
        this.accessCodeValidationIsInProgress = !1;
      }), M(this, "login", ({
        user: s,
        ...a
      }) => {
        this.user = s, this.onLogin(), a.accessToken ? Ce.storeSession({
          access_token: a.accessToken,
          refresh_token: a.refreshToken,
          refresh_token_expiration_date: a.refreshTokenExpirationDate.toISOString(),
          access_token_expiration_date: a.accessTokenExpirationDate.toISOString()
        }) : Ce.storeSession({
          refresh_token_expiration_date: a.refreshTokenExpirationDate.toISOString()
        });
      }), M(this, "isUserLogged", () => (this.user !== null || Ce.isAuthenticated()) && !Ce.isDisabled()), M(this, "getUserWithCookie", async (s) => this.api.getUserProfile(s)), M(this, "logout", async (s) => {
        try {
          await this.api.logout(s), this.clearUserSession();
        } catch (a) {
          throw new Kr("ERROR_AT_LOGOUT", a);
        }
      }), M(this, "clearUserSession", () => {
        this.user = null, Ce.clearSession(), Ce.removeDisableSession();
      }), M(this, "setLoginType", (s) => {
        this.loginType = s;
      }), M(this, "getLoginType", () => this.loginType), M(this, "isInvisibleOptInLogin", () => this.getLoginType() === zo.INVISIBLE_OPT_IN && this.isUserLogged()), M(this, "isConsentedRecurringUserLogin", () => this.getLoginType() === zo.CORE_CHECKOUT || this.getLoginType() === zo.FORCE_LOGIN || this.getLoginType() === zo.STOREFRONT_LOGIN), M(this, "loginPersisted", (s, a) => {
        this.user = s, a && this.dispatchEventsLoginPersisted(s), this.onLogin();
      }), M(this, "dispatchEventsLoginPersisted", async (s) => {
        try {
          await this.eventService.registerEventPersisted({
            email: s.email,
            user_id: s.id,
            wallet_login_persisted: Ce.getSessionType()
          });
        } catch (a) {
          throw new Kr("ERROR_AT_DISPATCH_EVENTS_LOGIN_PERSISTED", a);
        }
      }), M(this, "validateAccessCode", async (s, a, u) => (this.registerOTPReceived(a), this.api.login(s, a, u, this.getLoginType()))), M(this, "validateEmail", async (s, a) => (this.registerOTPReceived(a), this.api.validateEmail(s))), M(this, "registerOTPReceived", (s) => {
        this.isConsentedRecurringUserLogin() && this.eventService.registerOTPReceived(this.config, {
          email: s
        });
      }), this.api = e, this.eventService = n, this.config = i;
    }
    getUser() {
      return this.user;
    }
    onLogin() {
      var e, n, i;
      M0.setUserRegisteredResult({
        registered: !0,
        with_consent: !0,
        email: (e = this.user) == null ? void 0 : e.email,
        country: this.config.country,
        completed: !!((n = this.user) != null && n.address_completed_at),
        has_passkeys: (i = this.user) == null ? void 0 : i.has_passkeys
      });
    }
  };
  M(F0, "loginResponseToSessionData", (t) => ({
    user: t.user,
    accessToken: t.access_token,
    refreshToken: t.refresh_token,
    accessTokenExpirationDate: new Date(t.access_token_expiration_date),
    refreshTokenExpirationDate: new Date(t.refresh_token_expiration_date)
  }));
  let xR = F0;
  var pu = {}, H0;
  function bR() {
    if (H0)
      return pu;
    H0 = 1;
    var t = Zb;
    return pu.createRoot = t.createRoot, pu.hydrateRoot = t.hydrateRoot, pu;
  }
  var CR = bR();
  const TR = {}, B0 = N.createContext(TR), OR = (t, e) => /* @__PURE__ */ O.jsx(B0.Provider, {
    value: e || {},
    children: t
  }), _R = (t, e, n) => {
    const i = document.getElementById(e);
    if (!i)
      throw new Kr("Error while rendering React component: root element not found", {
        rootId: e
      });
    const s = CR.createRoot(i);
    return s.render(OR(t, n)), s;
  };
  var RR = { container: "wallet-lib-core_18daksv0" };
  function LR({
    id: t,
    onClose: e,
    header: n,
    children: i,
    onMount: s
  }) {
    return N.useEffect(() => {
      s();
    }, [s]), /* @__PURE__ */ O.jsxs(PO, {
      id: t,
      open: !0,
      onDismiss: e,
      className: RR.container,
      initialFocusRef: !1,
      children: [/* @__PURE__ */ O.jsx(Py, {
        size: "slarge",
        children: /* @__PURE__ */ O.jsx(Fi, {
          size: "slarge",
          children: n
        })
      }), /* @__PURE__ */ O.jsx(Fi, {
        size: "xLarge",
        children: /* @__PURE__ */ O.jsx(yf, {})
      }), /* @__PURE__ */ O.jsx(No, {
        children: i
      })]
    });
  }
  const Gf = class FE {
    static focus() {
      const e = document.getElementById("otp_code_input-0");
      if (!e)
        return;
      const n = (i) => {
        setTimeout(() => {
          var s;
          (s = i.target) == null || s.scrollIntoView({
            behavior: "smooth",
            block: "center"
          });
        }, FE.KEYBOARD_DELAY);
      };
      e.addEventListener("focus", n), e.focus();
    }
  };
  M(Gf, "KEYBOARD_DELAY", 300), M(Gf, "COUNT", 4);
  let U0 = Gf;
  function qf() {
    return {
      count: U0.COUNT
    };
  }
  const Yf = N.createContext({});
  function $0({
    children: t,
    flow: e,
    data: n
  }) {
    const {
      count: i
    } = qf(), [s, a] = N.useState(Vo.toArray(i).map(() => "")), u = sessionStorage.getItem("otpState"), [d, f] = N.useState(u ? JSON.parse(u) : {
      currentChannel: e === "alwaysEmail" || e === "firstEmail" || !(n != null && n.telephone) ? "email" : "sms",
      resendState: "resend",
      whatsappAvailable: (n == null ? void 0 : n.whatsappAvailable) ?? !1
    }), p = (v) => {
      if (Array.isArray(v))
        a(v);
      else {
        const y = D0(i, Vf(v)).split("");
        a(y);
      }
    }, m = (v) => {
      f((y) => ({
        ...y,
        ...v
      })), sessionStorage.setItem("otpState", JSON.stringify(v));
    };
    return /* @__PURE__ */ O.jsx(Yf.Provider, {
      value: gt.useMemo(() => ({
        otpInputValue: s,
        onChangeOtpInputValue: p,
        currentState: d,
        updateState: m
      }), [s, p, d, m]),
      children: t
    });
  }
  const z0 = () => N.useContext(Yf), Kf = () => {
    const {
      currentState: t,
      updateState: e
    } = N.useContext(Yf);
    return {
      ...t,
      updateState: e
    };
  };
  function AR() {
    return N.useContext(B0);
  }
  const kR = {
    VALIDATE_EMAIL: "validateEmail",
    LOGIN: "login"
  }, PR = (t) => t.key === "Backspace";
  var IR = "wallet-lib-core_1oeujdp3", mu = "wallet-lib-core_1oeujdp9", NR = "wallet-lib-core_1oeujdpe", DR = { default: "wallet-lib-core_1oeujdpf", bottomSheet: "wallet-lib-core_1oeujdpg" }, jR = "wallet-lib-core_1oeujdph", V0 = "wallet-lib-core_1oeujdpi", MR = "wallet-lib-core_1oeujdpo", FR = "wallet-lib-core_1oeujdp6", HR = "wallet-lib-core_1oeujdp7", BR = "wallet-lib-core_1oeujdpt", UR = { square: "wallet-lib-core_1oeujdp5" }, $R = "wallet-lib-core_1oeujdp1", Zf = "wallet-lib-core_1oeujdpb", zR = "wallet-lib-core_1oeujdp4", W0 = { baseStyles: "wallet-lib-core_j0outm0", otpInput: "wallet-lib-core_j0outm1" };
  function VR({
    innerRef: t,
    onChange: e,
    onPaste: n,
    maxLength: i,
    value: s,
    onKeyDown: a,
    id: u,
    ...d
  }) {
    return /* @__PURE__ */ O.jsx("input", {
      id: u,
      ref: t,
      "data-testid": d["data-testid"],
      className: `${W0.otpInput} ${W0.baseStyles} ${UR.square}`,
      maxLength: i,
      onChange: e,
      onPaste: n,
      value: s,
      onKeyDown: a,
      autoComplete: "one-time-code",
      type: "text",
      autoCorrect: "off",
      inputMode: "numeric"
    });
  }
  function WR({
    onChangeValue: t,
    onPaste: e,
    inputNumber: n,
    value: i,
    innerRef: s,
    nextOTPInputRef: a,
    previousOTPInputRef: u,
    id: d
  }) {
    const {
      count: f
    } = qf(), p = (y) => y.length === f ? Vf(y) : D0(1, Vf(y)), m = (y) => {
      const {
        value: E
      } = y.target;
      if (!E)
        t(E);
      else {
        const S = p(E);
        S && (t(S), a != null && a.current && a.current.focus());
      }
    }, v = (y) => {
      PR(y) && u != null && u.current && !i && u.current.focus();
    };
    return /* @__PURE__ */ O.jsx(VR, {
      innerRef: s,
      id: d,
      "data-testid": `input${n}`,
      maxLength: 6,
      onChange: m,
      onPaste: e,
      value: i,
      onKeyDown: v
    }, n);
  }
  const GR = ({
    onOTPCompleted: t,
    clearError: e
  }) => {
    const {
      otpInputValue: n,
      onChangeOtpInputValue: i
    } = z0(), {
      count: s
    } = qf(), a = Vo.toArray(s).map(() => N.createRef());
    N.useEffect(() => {
      const f = n.join("");
      f.length === s ? t(f) : e();
    }, [n]);
    const u = (f, p) => {
      if (f.length > 1)
        i(f);
      else {
        const m = [...n];
        m[p] = f, i(m);
      }
    }, d = (f) => {
      const p = f.clipboardData.getData("text");
      i(p), f.preventDefault();
    };
    return /* @__PURE__ */ O.jsx(O.Fragment, {
      children: Vo.toArray(s).map((f) => /* @__PURE__ */ O.jsx(WR, {
        id: `otp_code_input-${f}`,
        innerRef: a[f],
        inputNumber: f,
        onChangeValue: (p) => u(p, f),
        onPaste: d,
        value: n[f],
        nextOTPInputRef: a[f + 1],
        previousOTPInputRef: a[f - 1]
      }, f))
    });
  };
  var qR = "var(--wallet-lib-core_rf6xsr0)", G0 = { marginTop: "wallet-lib-core_rf6xsr1", marginTopMobile: "wallet-lib-core_rf6xsr2" };
  const Xf = ({
    only: t,
    size: e = "small",
    children: n
  }) => /* @__PURE__ */ O.jsx("div", {
    className: t === "mobile" ? G0.marginTopMobile : G0.marginTop,
    style: Ny({
      [qR]: gf.spacing[e]
    }),
    children: n
  }), Jf = {
    LONG_RESEND_WAIT_SECONDS: 30,
    CODE_SENT_WAIT_SECONDS: 3
  }, ia = ({
    children: t,
    currentState: e,
    desiredState: n
  }) => e === n ? t : null, YR = ({
    alwaysEmail: t,
    onResend: e
  }) => {
    const {
      t: n
    } = or(), {
      currentChannel: i,
      resendState: s,
      updateState: a,
      whatsappAvailable: u
    } = Kf(), d = N.useMemo(() => {
      const S = sessionStorage.getItem("wallet-resend-timer"), x = S ? parseInt(S, 10) : 0, C = Date.now(), L = Math.max(0, Math.floor((x - C) / 1e3));
      return L > 0 ? L : -1;
    }, []), [f, p] = N.useState(d > 0 ? "timer" : s), [m, v] = N.useState(d), y = (S) => {
      p("message");
      const x = Date.now() + Jf.LONG_RESEND_WAIT_SECONDS * 1e3;
      sessionStorage.setItem("wallet-resend-timer", x.toString()), a({
        currentChannel: S,
        resendState: t ? "resendViaEmail" : "resendViaEmailAndSMS",
        whatsappAvailable: u
      }), e(S);
    }, E = () => n(i === "email" ? !t && u ? "otp.resendViaWhatsApp" : t ? "otp.resendEmailOnly" : "otp.resendViaSms" : "otp.resend");
    return N.useEffect(() => {
      if (f === "message" && fu.startWith({
        seconds: Jf.CODE_SENT_WAIT_SECONDS,
        onTimerFinished: () => p("timer")
      }), f === "timer") {
        const S = d > 0 ? d : Jf.LONG_RESEND_WAIT_SECONDS;
        v(S), fu.startWith({
          seconds: S,
          onTimerFinished: () => {
            p(t ? "resendViaEmail" : "resendViaEmailAndSMS");
          }
        });
      }
    }, [f]), N.useEffect(() => {
      const S = setTimeout(() => {
        const x = m - 1;
        v(x);
        const C = Date.now() + x * 1e3;
        sessionStorage.setItem("wallet-resend-timer", C.toString());
      }, 1e3);
      return m <= 0 && (clearTimeout(S), sessionStorage.removeItem("wallet-resend-timer")), () => clearTimeout(S);
    }, [m]), /* @__PURE__ */ O.jsxs(O.Fragment, {
      children: [/* @__PURE__ */ O.jsx(ia, {
        currentState: f,
        desiredState: "timer",
        children: /* @__PURE__ */ O.jsx(No, {
          children: /* @__PURE__ */ O.jsxs(Qs, {
            type: "small",
            color: "nimbusNeutralTextHigh",
            children: [n("otp.resendTimer"), " 00:", String(m).padStart(2, "0")]
          })
        })
      }), /* @__PURE__ */ O.jsx(ia, {
        currentState: f,
        desiredState: "message",
        children: /* @__PURE__ */ O.jsx(No, {
          children: /* @__PURE__ */ O.jsx(Qs, {
            type: "small",
            color: "nimbusNeutralTextHigh",
            children: n("otp.codeResent")
          })
        })
      }), /* @__PURE__ */ O.jsx(ia, {
        currentState: f,
        desiredState: "resend",
        children: /* @__PURE__ */ O.jsx(Xf, {
          only: "mobile",
          children: /* @__PURE__ */ O.jsx(No, {
            children: /* @__PURE__ */ O.jsx(Ui, {
              type: "link",
              "data-testid": "resendViaEmail",
              onClick: () => y(i === "sms" || t ? "email" : "sms"),
              className: `${mu} ${Zf}`,
              children: E()
            })
          })
        })
      }), /* @__PURE__ */ O.jsx(ia, {
        currentState: f,
        desiredState: "resendViaEmail",
        children: /* @__PURE__ */ O.jsx(Xf, {
          only: "mobile",
          children: /* @__PURE__ */ O.jsx(ou, {
            children: /* @__PURE__ */ O.jsx(Ui, {
              type: "link",
              "data-testid": "resendViaEmail",
              onClick: () => y("email"),
              className: `${mu} ${Zf}`,
              children: n(t ? "otp.resendEmailOnly" : "otp.resendViaEmailAndSMS")
            })
          })
        })
      }), /* @__PURE__ */ O.jsx(ia, {
        currentState: f,
        desiredState: "resendViaEmailAndSMS",
        children: /* @__PURE__ */ O.jsx(Xf, {
          only: "mobile",
          children: /* @__PURE__ */ O.jsxs(ou, {
            children: [/* @__PURE__ */ O.jsx(Ui, {
              type: "link",
              "data-testid": "resendViaEmail",
              onClick: () => y("email"),
              className: mu,
              children: n("otp.viaEmail")
            }), /* @__PURE__ */ O.jsx(Fi, {
              children: "ou"
            }), /* @__PURE__ */ O.jsx(Ui, {
              type: "link",
              "data-testid": "resendViaSMS",
              onClick: () => y("sms"),
              className: `${mu} ${Zf}`,
              children: n(u ? "otp.viaWhatsApp" : "otp.viaSMS")
            })]
          })
        })
      })]
    });
  };
  function KR() {
    const {
      t
    } = or();
    return /* @__PURE__ */ O.jsx("div", {
      id: "errorCodeConfirmationLabel",
      className: `error ${IR}`,
      children: /* @__PURE__ */ O.jsx("div", {
        className: zR,
        children: /* @__PURE__ */ O.jsx("span", {
          children: t("otp.invalidCode")
        })
      })
    });
  }
  function q0({
    data: t,
    flowConfig: e,
    flow: n
  }) {
    const [i, s] = N.useState(!1), [a, u] = N.useState(!1), d = AR(), {
      otpInputValue: f,
      currentState: {
        currentChannel: p
      }
    } = z0(), m = async () => {
      var y, E, S, x, C, L, k;
      try {
        if (i)
          return;
        if (s(!0), e.operation === kR.VALIDATE_EMAIL)
          await ((y = d == null ? void 0 : d.loginService) == null ? void 0 : y.validateEmailWithOtpCode(f.join(""), t.email)), (S = e.onLogin) == null || S.call(e, (E = d == null ? void 0 : d.loginService) == null ? void 0 : E.getUser());
        else {
          const I = await ((x = d == null ? void 0 : d.loginService) == null ? void 0 : x.getUserAuthDataWithOtpCode(f.join(""), t.email, p));
          (C = d == null ? void 0 : d.loginService) == null || C.login(I), (L = e.onLogin) == null || L.call(e, I.user);
        }
      } catch (I) {
        if (s(!1), (k = e.onError) == null || k.call(e, I), I instanceof Wf)
          return;
        u(!0);
      }
    }, v = (y) => {
      var E;
      (E = d == null ? void 0 : d.api) == null || E.sendOTP(y, t.email, t.loginType);
    };
    return /* @__PURE__ */ O.jsxs(O.Fragment, {
      children: [/* @__PURE__ */ O.jsx(No, {
        children: /* @__PURE__ */ O.jsxs(Py, {
          size: "xLarge",
          children: [/* @__PURE__ */ O.jsx(ou, {
            gap: "small",
            children: /* @__PURE__ */ O.jsx(GR, {
              onOTPCompleted: m,
              clearError: () => u(!1)
            })
          }), a && /* @__PURE__ */ O.jsx(KR, {})]
        })
      }), /* @__PURE__ */ O.jsx(mf, {
        size: "xLarge",
        children: /* @__PURE__ */ O.jsx(YR, {
          alwaysEmail: n === "alwaysEmail" || !t.telephone,
          onResend: v
        })
      })]
    });
  }
  function ZR({
    children: t
  }) {
    return /* @__PURE__ */ O.jsx("span", {
      className: KO.centered,
      children: t
    });
  }
  const Y0 = {
    sms: "SMS",
    email: "e-mail"
  };
  function K0({
    descriptionLabel: t,
    whatsappAvailable: e
  }) {
    const {
      t: n
    } = or(), {
      currentChannel: i,
      whatsappAvailable: s
    } = Kf(), a = i === "sms" ? e || s ? n("otp.title", {
      channel: "WhatsApp"
    }) : n("otp.title", {
      channel: Y0.sms
    }) : n("otp.title", {
      channel: Y0.email
    });
    return /* @__PURE__ */ O.jsxs(ZR, {
      children: [/* @__PURE__ */ O.jsx("h4", {
        id: "OTPPreTitleContainer",
        className: BR,
        children: /* @__PURE__ */ O.jsx("span", {
          id: "OTPPreTitle"
        })
      }), /* @__PURE__ */ O.jsx("div", {
        className: FR,
        role: "heading",
        "aria-label": a,
        children: /* @__PURE__ */ O.jsx("span", {
          children: a
        })
      }), /* @__PURE__ */ O.jsx("div", {
        className: $R,
        children: /* @__PURE__ */ O.jsx("span", {
          className: HR,
          children: t ?? n("otp.subtitle")
        })
      })]
    });
  }
  const XR = ({
    color: t = "theme"
  }) => /* @__PURE__ */ O.jsxs("span", {
    className: `${UO.quickAccessBadge}`,
    children: [/* @__PURE__ */ O.jsx(na, {
      name: "quickAccessIcon",
      iconColor: t,
      "data-testid": "TestId__QuickAccessIcon"
    }), /* @__PURE__ */ O.jsx(Qs, {
      color: t,
      children: kt.t("otp.quickAccess")
    })]
  });
  function Z0() {
    return /* @__PURE__ */ O.jsxs("div", {
      className: MR,
      children: [/* @__PURE__ */ O.jsx(XR, {
        color: "nimbusNeutralTextLow"
      }), /* @__PURE__ */ O.jsx(P0, {
        color: "nimbusNeutralTextLow",
        size: "small"
      })]
    });
  }
  function JR() {
    return /* @__PURE__ */ O.jsxs(O.Fragment, {
      children: [/* @__PURE__ */ O.jsx(yf, {}), /* @__PURE__ */ O.jsx(su, {
        size: "xLarge"
      }), /* @__PURE__ */ O.jsx(Fi, {
        size: "xLarge",
        children: /* @__PURE__ */ O.jsx(Z0, {})
      }), /* @__PURE__ */ O.jsx(mf, {
        size: "xxLarge"
      })]
    });
  }
  var Qf = { frame: "wallet-lib-core_mttnyu0", spacing: { small: "wallet-lib-core_mttnyu1", medium: "wallet-lib-core_mttnyu2" }, border: "wallet-lib-core_mttnyu3" };
  function X0({
    children: t,
    spacing: e = "small",
    withBorder: n = !1
  }) {
    return /* @__PURE__ */ O.jsx("div", {
      className: Gr(Qf.frame, Qf.spacing[e], {
        [Qf.border]: n
      }),
      children: t
    });
  }
  function QR({
    type: t,
    onClose: e,
    closeLabel: n
  }) {
    const {
      t: i
    } = or();
    return n ? /* @__PURE__ */ O.jsx(Ui, {
      type: "linkNoUnderline",
      id: "modalCloseButton",
      "aria-label": (n == null ? void 0 : n.trim()) || i("general.close"),
      onClick: e,
      tabIndex: t === "bottomSheet" ? -1 : void 0,
      children: n
    }) : /* @__PURE__ */ O.jsxs(Ui, {
      type: "icon",
      id: "modalCloseButton",
      "aria-label": i("general.close"),
      onClick: e,
      tabIndex: t === "bottomSheet" ? -1 : void 0,
      children: [t === "bottomSheet" && /* @__PURE__ */ O.jsx(X0, {
        children: /* @__PURE__ */ O.jsx(na, {
          name: "close",
          customSize: 16,
          iconColor: "nimbusNeutralInteractivePressed"
        })
      }), t === "default" && /* @__PURE__ */ O.jsx(na, {
        name: "close",
        iconColor: "nimbusNeutralTextDisabled"
      })]
    });
  }
  function J0({
    onClose: t,
    data: e,
    flow: n,
    type: i,
    closeLabel: s
  }) {
    const {
      currentChannel: a
    } = Kf();
    return /* @__PURE__ */ O.jsxs("h5", {
      className: NR,
      "data-testid": "wallet-modal-header",
      children: [i === "bottomSheet" && /* @__PURE__ */ O.jsx(pf, {
        size: "sMedium"
      }), /* @__PURE__ */ O.jsx(pf, {
        size: "medium",
        children: /* @__PURE__ */ O.jsx("div", {
          id: "OTPChannelIconContainer",
          children: /* @__PURE__ */ O.jsx(X0, {
            withBorder: !0,
            spacing: "medium",
            children: /* @__PURE__ */ O.jsx(na, {
              name: "person",
              "data-testid": "person-icon",
              iconColor: "nimbusNeutralTextHigh"
            })
          })
        })
      }), /* @__PURE__ */ O.jsxs("div", {
        className: DR[i],
        children: [/* @__PURE__ */ O.jsx("div", {
          className: [Dy, jy, jR, a === "email" ? V0 : ""].filter(Boolean).join(" "),
          children: e.email
        }), /* @__PURE__ */ O.jsx("div", {
          className: [Dy, jy, "text-left", V0].join(" "),
          children: n !== "alwaysEmail" && a === "sms" && !!e.telephone && e.telephone
        })]
      }), /* @__PURE__ */ O.jsx(QR, {
        type: i,
        onClose: t,
        closeLabel: s
      })]
    });
  }
  function eL({
    onClose: t,
    data: e,
    flowConfig: n,
    flow: i,
    ...s
  }) {
    return /* @__PURE__ */ O.jsx($0, {
      flow: i,
      data: e,
      children: /* @__PURE__ */ O.jsx(LR, {
        id: "bottomSheetAppWallet",
        onClose: t,
        onMount: () => {
          var a;
          s.onMount(), (a = n.focusedInput) == null || a.blur();
        },
        header: /* @__PURE__ */ O.jsx(J0, {
          onClose: t,
          data: e,
          flow: i,
          type: "bottomSheet",
          closeLabel: n.closeLabel
        }),
        children: /* @__PURE__ */ O.jsxs("div", {
          children: [/* @__PURE__ */ O.jsxs(Fi, {
            size: "xLarge",
            children: [/* @__PURE__ */ O.jsx(su, {
              size: "xLarge",
              children: /* @__PURE__ */ O.jsx(K0, {
                descriptionLabel: n.descriptionLabel,
                whatsappAvailable: e.whatsappAvailable
              })
            }), /* @__PURE__ */ O.jsx(q0, {
              data: e,
              flowConfig: n,
              flow: i
            })]
          }), /* @__PURE__ */ O.jsx(JR, {})]
        })
      })
    });
  }
  var eh = { fadeIn: "wallet-lib-core_9ciqhz4", fadeInShort: "wallet-lib-core_9ciqhz5" }, th = { backdrop: "wallet-lib-core_1l8sk3p0", positionStyles: { full: "wallet-lib-core_1l8sk3p1", top: "wallet-lib-core_1l8sk3p2" }, gradient: "wallet-lib-core_1l8sk3p3" };
  const tL = 500;
  function nL({
    animated: t,
    onClick: e,
    onAnimationFinished: n,
    position: i = "full",
    gradientBackground: s = !1,
    animationDuration: a = "default"
  }) {
    return N.useEffect(() => {
      t ? setTimeout(() => {
        n == null || n();
      }, tL) : n == null || n();
    }, [t, n]), /* @__PURE__ */ O.jsx("div", {
      "data-testid": "backdrop",
      className: Gr(th.backdrop, {
        [eh.fadeIn]: t && a === "default"
      }, {
        [eh.fadeInShort]: t && a === "short"
      }, th.positionStyles[i], {
        [th.gradient]: s
      }),
      tabIndex: -1,
      role: "button",
      onClick: e,
      onKeyDown: void 0,
      "aria-label": "backdrop"
    });
  }
  var gu = { modal: "wallet-lib-core_17qc9kw0", container: "wallet-lib-core_17qc9kw1", modalSize: { small: "wallet-lib-core_17qc9kw3", fitContent: "wallet-lib-core_17qc9kw4" }, modalDialog: "wallet-lib-core_17qc9kw5" };
  const rL = 500, iL = ({
    size: t = "small",
    children: e,
    isVisible: n = !1,
    id: i,
    onClose: s,
    onMount: a,
    onModalShown: u,
    animated: d = !1,
    type: f = "default",
    fadeInDuration: p = rL,
    ariaLabel: m = ""
  }) => {
    const [v, y] = N.useState(!d);
    if (N.useEffect(() => {
      v && (a == null || a());
    }, [a, v]), !n)
      return null;
    const E = (x) => {
      x.key === "Escape" && s();
    }, S = () => {
      y(!0), d ? setTimeout(() => {
        u == null || u();
      }, p) : u == null || u();
    };
    return /* @__PURE__ */ O.jsxs("div", {
      id: i,
      className: `${gu.modal} show ${gu.container}`,
      "data-testid": "wallet-modal",
      onKeyDown: E,
      role: "button",
      tabIndex: 0,
      children: [/* @__PURE__ */ O.jsx(nL, {
        animated: d,
        onClick: s,
        onAnimationFinished: S
      }), v && /* @__PURE__ */ O.jsx("div", {
        className: Gr("modal-dialog", {
          [gu.modalDialog]: f === "default"
        }, gu.modalSize[t], {
          [eh.fadeIn]: d
        }),
        role: "dialog",
        "aria-label": m,
        children: e
      })]
    });
  };
  function oL() {
    return /* @__PURE__ */ O.jsxs(Fi, {
      size: "xSmall",
      children: [/* @__PURE__ */ O.jsx(yf, {}), /* @__PURE__ */ O.jsxs(su, {
        size: "slarge",
        children: [/* @__PURE__ */ O.jsx(Z0, {}), /* @__PURE__ */ O.jsx(mf, {
          size: "small"
        })]
      })]
    });
  }
  function sL({
    onClose: t,
    data: e,
    flowConfig: n,
    flow: i,
    animated: s = !C0(),
    ...a
  }) {
    const u = () => {
      a.onMount(), s || d();
    }, d = () => {
      var f;
      z4() ? U0.focus() : (f = n.focusedInput) == null || f.blur();
    };
    return /* @__PURE__ */ O.jsx($0, {
      flow: i,
      data: e,
      children: /* @__PURE__ */ O.jsx(iL, {
        id: "modalAppWallet",
        onClose: t,
        isVisible: !0,
        size: "fitContent",
        onModalShown: d,
        animated: s,
        onMount: u,
        fadeInDuration: n.fadeInDuration,
        ariaLabel: "otp-modal",
        children: /* @__PURE__ */ O.jsxs("div", {
          children: [/* @__PURE__ */ O.jsx(J0, {
            onClose: t,
            data: e,
            flow: i,
            type: "default",
            closeLabel: n.closeLabel
          }), /* @__PURE__ */ O.jsx(su, {
            size: "xLarge",
            children: /* @__PURE__ */ O.jsx(K0, {
              descriptionLabel: n.descriptionLabel,
              whatsappAvailable: e.whatsappAvailable
            })
          }), /* @__PURE__ */ O.jsx(q0, {
            data: e,
            flowConfig: n,
            flow: i
          }), /* @__PURE__ */ O.jsx(oL, {})]
        })
      })
    });
  }
  function aL({
    flowConfig: t,
    animated: e = !C0(),
    onMount: n,
    ...i
  }) {
    return Df() ? /* @__PURE__ */ O.jsx(eL, {
      flowConfig: t,
      animated: e,
      onMount: n,
      ...i
    }) : /* @__PURE__ */ O.jsx(sL, {
      flowConfig: t,
      animated: e,
      onMount: n,
      ...i
    });
  }
  function nh(t) {
    var e;
    t == null || t.unmount(), (e = document.getElementById("otp-modal-root")) == null || e.remove();
  }
  function lL(t, e, n) {
    return new Promise((i) => {
      const s = document.getElementById("otp-modal-root") ?? document.createElement("div");
      s.id = "otp-modal-root", document.body.appendChild(s);
      let a = null;
      const u = (p) => {
        var m, v;
        (m = n.onLogin) == null || m.call(n, p), (v = n.reOpener) == null || v.close(), nh(a);
      }, d = () => {
        var p;
        (p = n.reOpener) == null || p.open(), nh(a);
      }, f = () => {
        nh(a);
      };
      a = _R(/* @__PURE__ */ O.jsx(aL, {
        data: t,
        flow: n.flow,
        onClose: d,
        onMount: i,
        onBackupLogin: f,
        flowConfig: {
          ...n,
          onLogin: u
        },
        animated: n.animated
      }), s.id, e);
    });
  }
  class Q0 {
    constructor() {
      M(this, "api"), M(this, "initSessionTransfer", async () => {
        const e = await this.api.initSessionTransfer(), n = br.getDeviceId(), {
          visitorId: i,
          components: s
        } = await br.getVisitorData();
        return {
          exchangeToken: e,
          deviceId: n,
          visitorId: i,
          components: s
        };
      }), M(this, "completeSessionTransfer", async (e, n) => {
        const i = await this.api.completeSessionTransfer(e);
        Ce.storeSession(i), n != null && n.deviceId && n != null && n.visitorId && n != null && n.components && br.setCustomVisitor(n.deviceId, n.visitorId, n.components);
      }), this.api = zf.buildApi(ke.getConfig());
    }
  }
  const e1 = class HE {
    constructor(e) {
      M(this, "props"), M(this, "onLoginCallback", null), M(this, "onErrorCallback", null), M(this, "startLoginFlow", async ({
        userRegisteredResult: u
      }) => {
        const d = this.getDefaultOtpFlow(), f = d === "alwaysEmail" || d === "firstEmail" || !u.formatted_phone ? "email" : "sms";
        let p;
        this.wasOTPAlreadySentFor(u.email) || (p = await this.props.api.initialize(f, u.email, this.props.loginService.getLoginType()), this.setOTPasSentFor(u.email)), await this.openModal(this.getLoginData(u, p), "login");
      }), M(this, "startEmailValidationFlow", async ({
        userRegisteredResult: u
      }) => {
        this.wasOTPAlreadySentFor(u.email) || (this.props.api.sendOTP("email", u.email, this.props.loginService.getLoginType()), this.setOTPasSentFor(u.email)), await this.openModal(this.getLoginData(u), "validateEmail");
      }), M(this, "onLogin", (u) => {
        this.onLoginCallback = u;
      }), M(this, "onError", (u) => {
        this.onErrorCallback = u;
      }), M(this, "openModal", async (u, d) => {
        await lL(u, this.props, this.getFlowConfigFor(d));
      }), M(this, "getFlowConfigFor", (u) => ({
        onLogin: this.onLoginCallback ?? (() => {
        }),
        onError: this.onErrorCallback ?? (() => {
        }),
        reOpener: this.modalConfig.reOpener,
        fadeInDuration: this.modalConfig.fadeInDuration,
        flow: this.getDefaultOtpFlow(),
        animated: this.modalConfig.animated,
        operation: u,
        focusedInput: this.modalConfig.focusedInput,
        closeLabel: this.modalConfig.closeLabel,
        descriptionLabel: this.modalConfig.descriptionLabel
      })), M(this, "getDefaultOtpFlow", () => this.modalConfig.flow === "emailOnly" || this.props.config.country === "AR" || this.props.config.country === "MX" ? "alwaysEmail" : Df() ? "firstSMS" : "firstEmail"), M(this, "getLoginData", (u, d) => {
        const f = this.props.loginService.getLoginType();
        return {
          email: u.email ?? "",
          firstName: ER(u.first_name ?? ""),
          country: u.country,
          telephone: "formatted_phone" in u && u.formatted_phone ? u.formatted_phone : "",
          hasPasskeys: u.has_passkeys ?? !1,
          loginType: this.props.config.source ?? f,
          whatsappAvailable: (d == null ? void 0 : d.whatsapp_provider) ?? !1
        };
      }), M(this, "wasOTPAlreadySentFor", (u) => Tt.get("otp-sent-for") === u), M(this, "setOTPasSentFor", (u) => {
        Tt.set("otp-sent-for", u, {
          expires: new Date(Date.now() + HE.OTP_DURATION_IN_SECONDS * 1e3)
        });
      }), this.modalConfig = e;
      const n = ke.getConfig(), i = zf.buildApi(n), s = new du(i, n), a = new xR(i, s, n);
      a.setLoginType(n.source), this.props = {
        config: n,
        eventService: s,
        loginService: a,
        api: i,
        expressCheckoutService: new Bo(),
        sessionService: new Q0()
      }, kt.changeLanguage(n.language);
    }
  };
  M(e1, "OTP_DURATION_IN_SECONDS", 150);
  let uL = e1;
  const t1 = class BE {
    constructor(e) {
      M(this, "MS_TO_CLEAR_EMAIL", 3e5), M(this, "subscribers"), M(this, "previousEmail", null), M(this, "lastUserEmail", null), M(this, "timer", null), M(this, "userService"), M(this, "attachTo", (i) => {
        i.addEventListener("input", this.handleInputChange), i.addEventListener("change", this.handleChange);
      }), M(this, "start", async (i) => {
        i && N0(i) && await this.handleEmailPrefilled(i);
      }), M(this, "handleInputChange", (i) => {
        var s;
        const a = i.target.value;
        this.subscribers.onInput.forEach((u) => {
          u(a);
        }), this.isNewEmail(a) && ((s = this.timer) == null || s.stop(), this.timer = fu.startWith({
          seconds: BE.SECONDS_TO_VALIDATE_EMAIL,
          stepTime: 0.2,
          onTimerFinished: () => {
            this.callSubscribers(a).catch((u) => {
              throw new Kr("Error while handling email input change event", u);
            });
          }
        }));
      }), M(this, "handleChange", (i) => {
        var s;
        const a = i.target.value;
        this.isNewEmail(a) && ((s = this.timer) == null || s.stop(), this.callSubscribers(a).catch((u) => {
          throw new Kr("Error while handling email change event", u);
        }));
      }), M(this, "addTimeoutToClearEmail", () => setTimeout(() => {
        this.previousEmail = null, this.lastUserEmail = null;
      }, this.MS_TO_CLEAR_EMAIL)), M(this, "callSubscribers", async (i) => {
        this.previousEmail = i;
        const s = await this.userService.refreshUserRegisteredResult(i);
        await this.userService.isRegisteredWithConsent() ? await this.handleEmailInputEvent("userWithConsent", s) : await this.userService.isRegistered() ? await this.handleEmailInputEvent("userWithoutConsent", s) : await this.handleEmailInputEvent("nonExistingUser", {
          ...s,
          email: i
        }), this.addTimeoutToClearEmail();
      }), M(this, "handleEmailInputEvent", async (i, s) => {
        await Promise.all(this.subscribers[i].map(async (a) => {
          try {
            await a(s, this.lastUserEmail !== s.email);
          } catch (u) {
            throw new Kr("Error while calling subscribers for email input event", u);
          }
        })), this.lastUserEmail = s.email;
      }), M(this, "handleEmailPrefilled", async (i) => {
        const s = await this.userService.refreshUserRegisteredResult(i);
        await Promise.all(this.subscribers.emailPrefilled.map((a) => a(s, !0)));
      }), M(this, "isNewEmail", (i) => N0(i) && this.previousEmail !== i);
      const n = ke.getConfig();
      this.userService = new M0(e ?? new Bf(new Yr(), n), n), this.subscribers = {
        userWithConsent: [],
        userWithoutConsent: [],
        nonExistingUser: [],
        emailPrefilled: [],
        onInput: []
      };
    }
    subscribeTo(e, n) {
      e === "onInput" ? this.subscribers.onInput.push(n) : this.subscribers[e].push(n);
    }
  };
  M(t1, "SECONDS_TO_VALIDATE_EMAIL", 0.4);
  let cL = t1;
  class oa {
    static createOTPModal(e) {
      return new uL(e ?? {});
    }
    static createEventReporter() {
      return new wR();
    }
    static createEmailInputHandler(e) {
      return new cL(e);
    }
    static createExpressCheckoutService() {
      return new Bo();
    }
    static createSessionService() {
      return new Q0();
    }
  }
  /*! js-cookie v3.0.5 | MIT */
  function vu(t) {
    for (var e = 1; e < arguments.length; e++) {
      var n = arguments[e];
      for (var i in n)
        t[i] = n[i];
    }
    return t;
  }
  var dL = {
    read: function(t) {
      return t[0] === '"' && (t = t.slice(1, -1)), t.replace(/(%[\dA-F]{2})+/gi, decodeURIComponent);
    },
    write: function(t) {
      return encodeURIComponent(t).replace(
        /%(2[346BF]|3[AC-F]|40|5[BDE]|60|7[BCD])/g,
        decodeURIComponent
      );
    }
  };
  function rh(t, e) {
    function n(s, a, u) {
      if (!(typeof document > "u")) {
        u = vu({}, e, u), typeof u.expires == "number" && (u.expires = new Date(Date.now() + u.expires * 864e5)), u.expires && (u.expires = u.expires.toUTCString()), s = encodeURIComponent(s).replace(/%(2[346B]|5E|60|7C)/g, decodeURIComponent).replace(/[()]/g, escape);
        var d = "";
        for (var f in u)
          u[f] && (d += "; " + f, u[f] !== !0 && (d += "=" + u[f].split(";")[0]));
        return document.cookie = s + "=" + t.write(a, s) + d;
      }
    }
    function i(s) {
      if (!(typeof document > "u" || arguments.length && !s)) {
        for (var a = document.cookie ? document.cookie.split("; ") : [], u = {}, d = 0; d < a.length; d++) {
          var f = a[d].split("="), p = f.slice(1).join("=");
          try {
            var m = decodeURIComponent(f[0]);
            if (u[m] = t.read(p, m), s === m)
              break;
          } catch {
          }
        }
        return s ? u[s] : u;
      }
    }
    return Object.create(
      {
        set: n,
        get: i,
        remove: function(s, a) {
          n(
            s,
            "",
            vu({}, a, {
              expires: -1
            })
          );
        },
        withAttributes: function(s) {
          return rh(this.converter, vu({}, this.attributes, s));
        },
        withConverter: function(s) {
          return rh(vu({}, this.converter, s), this.attributes);
        }
      },
      {
        attributes: { value: Object.freeze(e) },
        converter: { value: Object.freeze(t) }
      }
    );
  }
  var n1 = rh(dL, { path: "/" });
  const Wu = class Wu {
  };
  Wu.getCookie = (e) => n1.get(e), Wu.setCookie = (e, n, i) => {
    n1.set(e, n, {
      expires: i.expires
    });
  };
  let Cr = Wu;
  const he = class he {
  };
  he.EXPERIMENTS = {
    BUY_NOW: "wallet-buy-now"
  }, he.AB_CONTROL_VARIANT = "a", he.AB_TREATMENT_VARIANT = "b", he.getStoreId = () => {
    var e;
    return (e = he.getStorefrontObject().storeId) == null ? void 0 : e.toString();
  }, he.getCountry = () => he.getStorefrontObject().country, he.getTemplate = () => he.getStorefrontObject().template, he.getLanguage = () => he.getStorefrontObject().lang.replace("_", "-"), he.getStorefrontCartId = () => {
    var e;
    return ((e = he.getStorefrontObject().cartId) == null ? void 0 : e.toString()) ?? "";
  }, he.getCartId = () => {
    var e;
    return ((e = he.getStorefrontObject().cartId) == null ? void 0 : e.toString()) ?? he.cartId ?? null;
  }, he.getCartHash = () => he.cartHash, he.isCheckoutEnabled = () => he.checkoutEnabled, he.getSessionData = () => {
    var s, a;
    const n = (s = Cr.getCookie("tn_tracksession")) == null ? void 0 : s.split("~")[1], i = (a = Cr.getCookie("tn_track")) == null ? void 0 : a.split("~")[1];
    return {
      sessionId: n,
      customerId: i
    };
  }, he.getStoreName = () => window.LS.store.name, he.getStoreUrl = () => `https://${window.LS.store.url}`, he.isPageCart = () => window.LS.template === "cart", he.isModalCartEnabled = () => !!document.querySelector('[data-store="cart-form"]'), he.getThemeCode = () => window.LS.theme.code, he.getCartItems = () => window.LS.cart.items, he.getCartData = () => ({
    ...window.LS.cart,
    ...window.LS.data.cart
  }), he.getCurrency = () => window.LS.currency, he.getCustomerId = () => window.LS.customer ? window.LS.customer.toString() : void 0, he.getExperimentVariantByTag = (e) => {
    var n, i;
    return ((n = he.getStorefrontObject().abStorefrontCartExperiments) == null ? void 0 : n[e]) ?? ((i = he.abStorefrontCartExperiments) == null ? void 0 : i[e]);
  }, he.isWalletExperimentTreatmentVariant = () => {
    var e, n;
    return (((e = he.getStorefrontObject().abStorefrontCartExperiments) == null ? void 0 : e["ab-storefront_cart-stratified-wallet"]) ?? ((n = he.abStorefrontCartExperiments) == null ? void 0 : n["ab-storefront_cart-stratified-wallet"]) ?? !1) === he.AB_TREATMENT_VARIANT;
  }, he.hasZipcode = () => {
    var e;
    return !!((e = document.querySelector(".js-shipping-calculator-current-zip")) != null && e.textContent);
  }, he.getZipcode = () => {
    var e;
    return ((e = document.querySelector(".js-shipping-calculator-current-zip")) == null ? void 0 : e.textContent) ?? void 0;
  }, he.hasCartMinimumValue = () => he.getStorefrontObject().hasCartMinimumValue, he.updateZipcodeAndLoadShippingOptions = (e, n) => {
    window.LS.calculateShippingAjax(
      e,
      n("#cart-shipping-container").data("shipping-url"),
      n("#cart-shipping-container").closest(
        ".js-shipping-calculator-container"
      )
    ), document.querySelectorAll(".js-shipping-calculator-current-zip").forEach((i) => {
      i.textContent = e;
    }), document.querySelectorAll(".js-shipping-input").forEach((i) => {
      i.setAttribute("value", e);
    });
  }, he.hasShippingCalculator = () => !!document.querySelector('[data-store="shipping-calculator"]'), he.setInitialData = (e) => {
    var n;
    he.cartId = (n = e.cartId) == null ? void 0 : n.toString(), he.abStorefrontCartExperiments = e.abStorefrontCartExperiments, he.cartHash = e.token, he.checkoutEnabled = e.checkoutEnabled;
  }, he.getStorefrontObject = () => ({
    storeId: window.LS.store.id,
    cartId: window.LS.cart.id,
    lang: window.LS.lang,
    country: window.LS.country,
    abStorefrontCartExperiments: window.LS.abStorefrontCartExperiments,
    // ab tests are loaded at the moment script runs
    template: window.LS.template,
    hasCartMinimumValue: window.LS.hasCartMinimumValue
  }), he.getLoginInputEmail = () => {
    var e;
    return ((e = $('#login-form input[name="email"]').val()) == null ? void 0 : e.toString()) ?? "";
  }, he.getLoginInput = () => document.querySelector('#login-form input[name="email"]');
  let ne = he;
  const fL = {
    emailPanel: {
      header: {
        text: "Acesso rápido"
      }
    },
    loginPanel: {
      logo: {
        height: "18",
        width: "76"
      },
      header: {
        text: "Acesso rápido e seguro"
      },
      button: {
        text: "Iniciar sessão"
      }
    },
    buyNowPanel: {
      buyNowButton: {
        text: "Comprar agora"
      },
      goCartButton: {
        text: "Vá para o carrinho"
      },
      addedProduct: {
        text: "Você já adicionou este produto."
      },
      addToCart: {
        text: "Adicionar ao carrinho"
      }
    },
    expressCheckout: {
      goButton: {
        text: "Compra em 1 clique com"
      },
      or: {
        text: "OU"
      }
    }
  }, hL = {
    emailPanel: {
      header: {
        text: "Acceso rápido"
      }
    },
    loginPanel: {
      logo: {
        height: "17",
        width: "66"
      },
      header: {
        text: "Acceso rápido y seguro"
      },
      button: {
        text: "Iniciar sesión"
      }
    },
    buyNowPanel: {
      buyNowButton: {
        text: "Comprar ahora"
      },
      goCartButton: {
        text: "Ir al carrito"
      },
      addedProduct: {
        text: "Ya agregaste este producto."
      },
      addToCart: {
        text: "Agregar al carrito"
      }
    },
    expressCheckout: {
      goButton: {
        text: "Comprá en 1 clic con"
      },
      or: {
        text: "O"
      }
    }
  }, pL = {
    emailPanel: {
      header: {
        text: "Acceso rápido"
      }
    },
    loginPanel: {
      logo: {
        height: "17",
        width: "66"
      },
      header: {
        text: "Acceso rápido y seguro"
      },
      button: {
        text: "Iniciar sesión"
      }
    },
    buyNowPanel: {
      buyNowButton: {
        text: "Comprar ahora"
      },
      goCartButton: {
        text: "Ir al carrito"
      },
      addedProduct: {
        text: "Ya agregaste este producto."
      },
      addToCart: {
        text: "Agregar al carrito"
      }
    },
    expressCheckout: {
      goButton: {
        text: "Compra en 1 clic con"
      },
      or: {
        text: "O"
      }
    }
  }, mL = {
    emailPanel: {
      header: {
        text: "Acceso rápido"
      }
    },
    loginPanel: {
      logo: {
        height: "17",
        width: "66"
      },
      header: {
        text: "Acceso rápido y seguro"
      },
      button: {
        text: "Iniciar sesión"
      }
    },
    buyNowPanel: {
      buyNowButton: {
        text: "Comprar ahora"
      },
      goCartButton: {
        text: "Ir al carrito"
      },
      addedProduct: {
        text: "Ya agregaste este producto."
      },
      addToCart: {
        text: "Agregar al carrito"
      }
    },
    expressCheckout: {
      goButton: {
        text: "Compra en 1 clic con"
      },
      or: {
        text: "O"
      }
    }
  }, gL = {
    emailPanel: {
      header: {
        text: "Quick access"
      }
    },
    loginPanel: {
      logo: {
        height: "17",
        width: "66"
      },
      header: {
        text: "Quick and secure access"
      },
      button: {
        text: "Login"
      }
    },
    buyNowPanel: {
      buyNowButton: {
        text: "Buy now"
      },
      goCartButton: {
        text: "Go cart"
      },
      addedProduct: {
        text: "You have already added this product."
      },
      addToCart: {
        text: "Add to cart"
      }
    },
    expressCheckout: {
      goButton: {
        text: "Buy on 1 click with"
      },
      or: {
        text: "OR"
      }
    }
  }, vL = "translation", yL = {
    "pt-BR": {
      translation: {
        ...fL,
        ...ea["pt-BR"].translation
      }
    },
    "es-AR": {
      translation: {
        ...hL,
        ...ea["es-AR"].translation
      }
    },
    "es-MX": {
      translation: {
        ...pL,
        ...ea["es-MX"].translation
      }
    },
    "en-US": {
      translation: gL
    },
    es: {
      translation: {
        ...mL,
        ...ea.es.translation
      }
    }
  };
  kt.use(tg).init({
    resources: yL,
    lng: ne.getLanguage(),
    fallbackLng: "pt-BR",
    defaultNS: vL,
    ns: "translation",
    interpolation: {
      escapeValue: !1
    },
    returnNull: !1
  });
  class wL extends Error {
    constructor() {
      super(), this.message = "Error Iframe not found", this.name = "WALLET_IFRAME_NOT_FOUND";
    }
  }
  var SL = { WALLET_API_URL: "https://api-wallet.tiendanube.com", WALLET_BR_API_HOST: "https://api.nuvem.com.br", WALLET_LATAM_API_HOST: "https://api.nube.com", NODE_ENV: "production", WALLET_IFRAME_URL: "https://nuvempay.nuvemshop.com.br", WALLET_LIB_AUTH_URL: "https://wallet.tiendanube.com/auth.js", LATEST_COMMIT_HASH: "2a7dc915ddb83314d33e954845a64049f00be454", BR_EXPRESS_CHECKOUT_HOST: "https://nuvem.com.br", LATAM_EXPRESS_CHECKOUT_HOST: "https://nube.com" };
  const fa = class fa {
    static postMessage(e, n) {
      var s;
      const i = document.getElementById(this.iframeId);
      if (!i)
        throw new wL();
      (s = i == null ? void 0 : i.contentWindow) == null || s.postMessage(
        JSON.stringify({ message: e, data: n }),
        this.host
      );
    }
  };
  fa.host = SL.WALLET_IFRAME_URL, fa.iframeId = "walletAuthProxyIframe", fa.EVENTS = {
    NUVEM_REQUEST: "NUVEM_REQUEST"
  };
  let Wo = fa;
  var EL = { WALLET_API_URL: "https://api-wallet.tiendanube.com", WALLET_BR_API_HOST: "https://api.nuvem.com.br", WALLET_LATAM_API_HOST: "https://api.nube.com", NODE_ENV: "production", WALLET_IFRAME_URL: "https://nuvempay.nuvemshop.com.br", WALLET_LIB_AUTH_URL: "https://wallet.tiendanube.com/auth.js", LATEST_COMMIT_HASH: "2a7dc915ddb83314d33e954845a64049f00be454", BR_EXPRESS_CHECKOUT_HOST: "https://nuvem.com.br", LATAM_EXPRESS_CHECKOUT_HOST: "https://nube.com" };
  const Gu = class Gu {
  };
  Gu.onMessage = (e, n, i) => {
    window.addEventListener(
      "message",
      (s) => {
        const a = s.data;
        a.error ? i == null || i(a.error) : a.message === e && s.origin === EL.WALLET_IFRAME_URL && n(a.data);
      }
    );
  }, Gu.removeEvent = (e, n) => {
    window.removeEventListener(e, n);
  };
  let ih = Gu;
  class xL {
    get(e, n) {
      return new Promise((i, s) => {
        const a = setTimeout(() => {
          s(new Error(`Timeout request with message:${e}`));
        }, 6e3), u = (f) => {
          clearTimeout(a), i(f);
        }, d = (f) => {
          clearTimeout(a), s(new Error(f));
        };
        ih.onMessage(e, u, d), Wo.postMessage(e, n);
      });
    }
  }
  class r1 {
    constructor(e) {
      this.commonHeaders = {
        "Accept-Language": ne.getLanguage(),
        "x-store-id": ne.getStoreId()
      }, this.post = (n, i, s = {}, a) => this.authClient.makeRequest(
        "POST",
        n,
        i,
        {
          ...this.commonHeaders,
          ...s
        },
        a
      ), this.put = (n, i) => this.authClient.makeRequest("PUT", n, i, this.commonHeaders), this.get = async (n, i) => this.authClient.makeRequest(
        "GET",
        n,
        void 0,
        this.commonHeaders,
        i
      ), this.authClient = new $o.Client(e);
    }
  }
  const oh = (t) => t == null ? t : Array.isArray(t) ? t.map((e) => oh(e)) : typeof t == "object" ? Object.keys(t).reduce(
    (e, n) => {
      const i = t[n], s = n.replace(
        /_([a-z])/g,
        (a, u) => u.toUpperCase()
      );
      return {
        ...e,
        [s]: typeof i == "object" ? oh(i) : i
      };
    },
    {}
  ) : t, i1 = (t) => t.charAt(0).toUpperCase() + t.slice(1), $i = "v1";
  class bL {
    constructor() {
      this.registerEvent = async (e, n) => {
        await this.client.post(
          `/${$i}/events`,
          {
            event: n,
            eventData: e
          },
          {},
          {
            public: !0
          }
        );
      }, this.registerLog = async (e, n) => {
        await this.client.post(
          `/${$i}/logger`,
          {
            log: `[WALLET_STORE_FRONT] ${e}`,
            context: {
              ...n,
              store: {
                storeId: ne.getStoreId(),
                cartId: ne.getCartId()
              }
            }
          },
          {},
          {
            public: !0
          }
        );
      }, this.getStoreFeatures = async (e) => (await this.client.get(
        `/v1/stores/features?externalStoreId=${e.externalStoreId}`,
        { public: !0 }
      )).data, this.autocompleteCart = async ({
        data: e,
        params: n
      }) => {
        if (this.isCrossStore())
          return this.iframeClient.get(
            Wo.EVENTS.NUVEM_REQUEST,
            { resource: "autocompleteCart", body: oh({ data: e, params: n }) }
          );
        const i = new URLSearchParams({
          external_store_id: n.external_store_id,
          external_cart_id: n.external_cart_id
        }), s = `/${$i}/carts/ready-for-payment?${i.toString()}`;
        return (await this.client.put(s, e)).data;
      }, this.exchangeToken = async () => this.isCrossStore() ? this.iframeClient.get(
        Wo.EVENTS.NUVEM_REQUEST,
        {
          resource: "exchangeToken",
          body: {
            audience: "stores-api",
            grant_type: "urn:ietf:params:oauth:grant-type:token-exchange",
            subject_token_type: "urn:ietf:params:oauth:token-type:access_token"
          }
        }
      ) : (await this.client.post(`/${$i}/auth/exchange`, {
        audience: "stores-api",
        grant_type: "urn:ietf:params:oauth:grant-type:token-exchange",
        subject_token_type: "urn:ietf:params:oauth:token-type:access_token"
      })).data, this.getExperimentVariant = async (e) => {
        const n = await this.client.post(
          `/${$i}/carts/${ne.getCartId()}/generate-variant`,
          {
            test_name: e
          },
          {},
          {
            public: !0
          }
        );
        return n.status === 204 && e === "ab-storefront_cart-stratified-lazy-ec" ? ne.AB_TREATMENT_VARIANT : n.data.variant ?? ne.AB_CONTROL_VARIANT;
      }, this.doesStorefrontUserEmailMatch = async (e) => this.isCrossStore() ? this.iframeClient.get(
        Wo.EVENTS.NUVEM_REQUEST,
        {
          resource: "doesStorefrontUserEmailMatch",
          body: e
        }
      ) : (await this.client.get(
        `/${$i}/stores/email-match?externalStoreId=${e.externalStoreId}&externalUserId=${e.externalUserId}`
      )).data, this.getStorePaymentInfo = async (e) => (await this.client.get(
        `/${$i}/stores/${e}/payment-info`,
        { public: !0 }
      )).data, this.isCrossStore = () => !$o.SessionUtils.isAuthenticatedWithSameStoreSession(), this.client = new r1(), this.iframeClient = new xL();
    }
  }
  var CL = { WALLET_API_URL: "https://api-wallet.tiendanube.com", WALLET_BR_API_HOST: "https://api.nuvem.com.br", WALLET_LATAM_API_HOST: "https://api.nube.com", NODE_ENV: "production", WALLET_IFRAME_URL: "https://nuvempay.nuvemshop.com.br", WALLET_LIB_AUTH_URL: "https://wallet.tiendanube.com/auth.js", LATEST_COMMIT_HASH: "2a7dc915ddb83314d33e954845a64049f00be454", BR_EXPRESS_CHECKOUT_HOST: "https://nuvem.com.br", LATAM_EXPRESS_CHECKOUT_HOST: "https://nube.com" };
  const qu = class qu {
    constructor(e, n) {
      this.walletApi = e, this.cacheService = n, this.sessionData = null, this.getLoginType = () => this.isUserLogged() ? $o.SessionUtils.isCrossStorePossible() ? "cross-store" : "same-store" : "not-logged", this.doesStorefrontUserEmailMatch = async () => {
        const i = `${ne.getStoreId()}-storefrontUserEmailMatch`, s = this.cacheService.get(i);
        if (s)
          return s.match;
        const a = await this.walletApi.doesStorefrontUserEmailMatch({
          externalUserId: ne.getCustomerId(),
          externalStoreId: ne.getStoreId()
        });
        return this.cacheService.set(
          i,
          a,
          60 * 60 * 24
        ), a.match;
      };
    }
    async loadSession() {
      this.sessionData = { status: "notLogged" };
      const e = await $o.start(
        qu.getConfigWalletAuth()
      );
      if (e.isLogged) {
        if (ne.getCustomerId() && !await this.doesStorefrontUserEmailMatch()) {
          this.sessionData = {
            status: "notLogged"
          };
          return;
        }
        this.sessionData = {
          status: "logged",
          user: e.user
        };
      }
    }
    getSessionData() {
      return this.sessionData;
    }
    isUserLogged() {
      var e;
      return ((e = this.sessionData) == null ? void 0 : e.status) === "logged";
    }
    getEmailUserLogged() {
      var n;
      if (!this.isUserLogged())
        return null;
      const e = this.sessionData;
      return ((n = e == null ? void 0 : e.user) == null ? void 0 : n.email) ?? null;
    }
  };
  qu.getConfigWalletAuth = () => ({
    loggedUserEmail: null,
    iframeHost: CL.WALLET_IFRAME_URL,
    version: "v2",
    country: ne.getCountry()
  });
  let sh = qu;
  class TL extends Error {
    constructor(e, n) {
      super(), this.message = "Error occurred trying to register event", this.name = "WALLET_REGISTER_EVENT", this.customTag = { name: "wallet_register_event", data: e }, this.stack = n.stack, this.cause = n.cause;
    }
  }
  class OL {
    constructor(e, n) {
      this.event = {
        WALLET_CART_IDENTIFICATION: "wallet_cart_identification",
        WALLET_CART_ZIPCODE: "wallet_cart_zipcode",
        WALLET_ONCLICK_BUY_NOW: "wallet_onclick_buy_now"
      }, this.eventDataForRequest = (i) => ({
        cart_id: i,
        timestamp: (/* @__PURE__ */ new Date()).toISOString(),
        store_id: ne.getStoreId()
      }), this.api = e, this.errorHandlerService = n;
    }
    async registerEventWalletCartIdentificationOrFail(e) {
      const n = {
        ...this.eventDataForRequest(e),
        login_persisted_channel: $o.SessionUtils.isAuthenticatedWithSameStoreSession() ? "same" : "cross"
      };
      await this.registerEvent(
        n,
        this.event.WALLET_CART_IDENTIFICATION,
        { failOnError: !0 }
      );
    }
    async registerEventWalletCartZipcode(e, n) {
      const i = {
        ...this.eventDataForRequest(e),
        type: n
      };
      await this.registerEvent(i, this.event.WALLET_CART_ZIPCODE);
    }
    async registerEventWalletOnClickBuyNow(e) {
      const { sessionId: n, customerId: i } = ne.getSessionData(), s = {
        ...this.eventDataForRequest(e),
        session_id: n,
        customer_id: i
      };
      await this.registerEvent(s, this.event.WALLET_ONCLICK_BUY_NOW);
    }
    async registerEvent(e, n, i = { failOnError: !1 }) {
      try {
        await this.api.registerEvent(e, n);
      } catch (s) {
        const a = new TL(
          n,
          s
        );
        if (i.failOnError)
          throw a;
        this.errorHandlerService.reportException(a);
      }
    }
  }
  class Tr {
    constructor(e) {
      this.appProps = e;
    }
  }
  function ah(t, e) {
    return function(i) {
      class s extends i {
        constructor(...u) {
          super(...u);
          const { storefrontHandler: d } = this.appProps;
          this.loggedConditionSatisfied() && t(d, this.handleEventCalled.bind(this));
        }
        loggedConditionSatisfied() {
          return !(e != null && e.userLogged) || this.appProps.sessionService.isUserLogged();
        }
        async handleEventCalled(u, d) {
          try {
            await this.handle(u, d);
          } catch (f) {
            this.appProps.errorHandler.reportException(f);
          }
        }
      }
      return s;
    };
  }
  function yu(t) {
    return ah(
      (e, n) => {
        e.subscribeToCartExists(n);
      },
      t
    );
  }
  function lh(t, e) {
    return ah(
      (n, i) => {
        n.subscribeToInit(t, i);
      },
      e
    );
  }
  function o1(t, e) {
    return ah(
      (n, i) => {
        t.forEach((s) => {
          n.subscribeToInternalEvent(s, i);
        });
      },
      e
    );
  }
  class wu {
    constructor(e = new r1(window.location.origin)) {
      this.client = e;
    }
    async loginWithWallet(e) {
      const n = new FormData();
      n.append("token", e), await this.client.post(
        "/account/login_with_wallet/",
        n,
        {
          "Content-Type": "multipart/form-data",
          Accept: "text/html"
        },
        {
          public: !0
        }
      );
    }
    async getCartSession() {
      return (await this.client.get("/session/", {
        public: !0
      })).data;
    }
    async getCheckoutUrl({
      localizedPath: e,
      shippingMethod: n,
      afterCalculation: i,
      zipcode: s,
      itemQuantities: a
    }) {
      const u = new FormData();
      a && Object.keys(a).forEach((p) => {
        u.append(`quantity[${p}]`, a[p]);
      }), u.append("go_to_checkout", "1"), u.append("option", n), u.append("zipcode", s), u.append("after_calculation", i);
      const d = await this.client.post(
        e,
        u,
        {
          "Content-Type": "multipart/form-data"
        },
        {
          public: !0
        }
      );
      return d.headers.location || d.request.responseURL;
    }
    async getVariantByExperiment(e, n) {
      var d, f, p;
      const i = `experiment_${e}_${ne.getStoreId()}`, s = localStorage.getItem(i);
      if (s)
        return s;
      let a;
      n ? a = `/experiments/${e}/group?customer_email=${n}` : a = `/experiments/${e}/group`;
      const u = await this.client.get(a, {
        public: !0
      });
      return (d = u == null ? void 0 : u.data) != null && d.group_name ? (localStorage.setItem(i, u.data.group_name), (f = u.data) == null ? void 0 : f.group_name) : (p = u.data) == null ? void 0 : p.group_name;
    }
  }
  var uh, s1 = Ld;
  uh = s1.createRoot, s1.hydrateRoot;
  var Kt = function() {
    return Kt = Object.assign || function(e) {
      for (var n, i = 1, s = arguments.length; i < s; i++) {
        n = arguments[i];
        for (var a in n)
          Object.prototype.hasOwnProperty.call(n, a) && (e[a] = n[a]);
      }
      return e;
    }, Kt.apply(this, arguments);
  };
  function zi(t, e, n) {
    if (n || arguments.length === 2)
      for (var i = 0, s = e.length, a; i < s; i++)
        (a || !(i in e)) && (a || (a = Array.prototype.slice.call(e, 0, i)), a[i] = e[i]);
    return t.concat(a || Array.prototype.slice.call(e));
  }
  function _L(t) {
    var e = /* @__PURE__ */ Object.create(null);
    return function(n) {
      return e[n] === void 0 && (e[n] = t(n)), e[n];
    };
  }
  var RL = /^((children|dangerouslySetInnerHTML|key|ref|autoFocus|defaultValue|defaultChecked|innerHTML|suppressContentEditableWarning|suppressHydrationWarning|valueLink|abbr|accept|acceptCharset|accessKey|action|allow|allowUserMedia|allowPaymentRequest|allowFullScreen|allowTransparency|alt|async|autoComplete|autoPlay|capture|cellPadding|cellSpacing|challenge|charSet|checked|cite|classID|className|cols|colSpan|content|contentEditable|contextMenu|controls|controlsList|coords|crossOrigin|data|dateTime|decoding|default|defer|dir|disabled|disablePictureInPicture|download|draggable|encType|enterKeyHint|form|formAction|formEncType|formMethod|formNoValidate|formTarget|frameBorder|headers|height|hidden|high|href|hrefLang|htmlFor|httpEquiv|id|inputMode|integrity|is|keyParams|keyType|kind|label|lang|list|loading|loop|low|marginHeight|marginWidth|max|maxLength|media|mediaGroup|method|min|minLength|multiple|muted|name|nonce|noValidate|open|optimum|pattern|placeholder|playsInline|poster|preload|profile|radioGroup|readOnly|referrerPolicy|rel|required|reversed|role|rows|rowSpan|sandbox|scope|scoped|scrolling|seamless|selected|shape|size|sizes|slot|span|spellCheck|src|srcDoc|srcLang|srcSet|start|step|style|summary|tabIndex|target|title|translate|type|useMap|value|width|wmode|wrap|about|datatype|inlist|prefix|property|resource|typeof|vocab|autoCapitalize|autoCorrect|autoSave|color|incremental|fallback|inert|itemProp|itemScope|itemType|itemID|itemRef|on|option|results|security|unselectable|accentHeight|accumulate|additive|alignmentBaseline|allowReorder|alphabetic|amplitude|arabicForm|ascent|attributeName|attributeType|autoReverse|azimuth|baseFrequency|baselineShift|baseProfile|bbox|begin|bias|by|calcMode|capHeight|clip|clipPathUnits|clipPath|clipRule|colorInterpolation|colorInterpolationFilters|colorProfile|colorRendering|contentScriptType|contentStyleType|cursor|cx|cy|d|decelerate|descent|diffuseConstant|direction|display|divisor|dominantBaseline|dur|dx|dy|edgeMode|elevation|enableBackground|end|exponent|externalResourcesRequired|fill|fillOpacity|fillRule|filter|filterRes|filterUnits|floodColor|floodOpacity|focusable|fontFamily|fontSize|fontSizeAdjust|fontStretch|fontStyle|fontVariant|fontWeight|format|from|fr|fx|fy|g1|g2|glyphName|glyphOrientationHorizontal|glyphOrientationVertical|glyphRef|gradientTransform|gradientUnits|hanging|horizAdvX|horizOriginX|ideographic|imageRendering|in|in2|intercept|k|k1|k2|k3|k4|kernelMatrix|kernelUnitLength|kerning|keyPoints|keySplines|keyTimes|lengthAdjust|letterSpacing|lightingColor|limitingConeAngle|local|markerEnd|markerMid|markerStart|markerHeight|markerUnits|markerWidth|mask|maskContentUnits|maskUnits|mathematical|mode|numOctaves|offset|opacity|operator|order|orient|orientation|origin|overflow|overlinePosition|overlineThickness|panose1|paintOrder|pathLength|patternContentUnits|patternTransform|patternUnits|pointerEvents|points|pointsAtX|pointsAtY|pointsAtZ|preserveAlpha|preserveAspectRatio|primitiveUnits|r|radius|refX|refY|renderingIntent|repeatCount|repeatDur|requiredExtensions|requiredFeatures|restart|result|rotate|rx|ry|scale|seed|shapeRendering|slope|spacing|specularConstant|specularExponent|speed|spreadMethod|startOffset|stdDeviation|stemh|stemv|stitchTiles|stopColor|stopOpacity|strikethroughPosition|strikethroughThickness|string|stroke|strokeDasharray|strokeDashoffset|strokeLinecap|strokeLinejoin|strokeMiterlimit|strokeOpacity|strokeWidth|surfaceScale|systemLanguage|tableValues|targetX|targetY|textAnchor|textDecoration|textRendering|textLength|to|transform|u1|u2|underlinePosition|underlineThickness|unicode|unicodeBidi|unicodeRange|unitsPerEm|vAlphabetic|vHanging|vIdeographic|vMathematical|values|vectorEffect|version|vertAdvY|vertOriginX|vertOriginY|viewBox|viewTarget|visibility|widths|wordSpacing|writingMode|x|xHeight|x1|x2|xChannelSelector|xlinkActuate|xlinkArcrole|xlinkHref|xlinkRole|xlinkShow|xlinkTitle|xlinkType|xmlBase|xmlns|xmlnsXlink|xmlLang|xmlSpace|y|y1|y2|yChannelSelector|z|zoomAndPan|for|class|autofocus)|(([Dd][Aa][Tt][Aa]|[Aa][Rr][Ii][Aa]|x)-.*))$/, LL = /* @__PURE__ */ _L(
    function(t) {
      return RL.test(t) || t.charCodeAt(0) === 111 && t.charCodeAt(1) === 110 && t.charCodeAt(2) < 91;
    }
    /* Z+1 */
  ), ot = "-ms-", sa = "-moz-", Ze = "-webkit-", a1 = "comm", Su = "rule", ch = "decl", AL = "@import", l1 = "@keyframes", kL = "@layer", u1 = Math.abs, dh = String.fromCharCode, fh = Object.assign;
  function PL(t, e) {
    return jt(t, 0) ^ 45 ? (((e << 2 ^ jt(t, 0)) << 2 ^ jt(t, 1)) << 2 ^ jt(t, 2)) << 2 ^ jt(t, 3) : 0;
  }
  function c1(t) {
    return t.trim();
  }
  function Or(t, e) {
    return (t = e.exec(t)) ? t[0] : t;
  }
  function Le(t, e, n) {
    return t.replace(e, n);
  }
  function Eu(t, e, n) {
    return t.indexOf(e, n);
  }
  function jt(t, e) {
    return t.charCodeAt(e) | 0;
  }
  function Go(t, e, n) {
    return t.slice(e, n);
  }
  function ur(t) {
    return t.length;
  }
  function d1(t) {
    return t.length;
  }
  function aa(t, e) {
    return e.push(t), t;
  }
  function IL(t, e) {
    return t.map(e).join("");
  }
  function f1(t, e) {
    return t.filter(function(n) {
      return !Or(n, e);
    });
  }
  var xu = 1, qo = 1, h1 = 0, _n = 0, Ot = 0, Yo = "";
  function bu(t, e, n, i, s, a, u, d) {
    return { value: t, root: e, parent: n, type: i, props: s, children: a, line: xu, column: qo, length: u, return: "", siblings: d };
  }
  function Zr(t, e) {
    return fh(bu("", null, null, "", null, null, 0, t.siblings), t, { length: -t.length }, e);
  }
  function Ko(t) {
    for (; t.root; )
      t = Zr(t.root, { children: [t] });
    aa(t, t.siblings);
  }
  function NL() {
    return Ot;
  }
  function DL() {
    return Ot = _n > 0 ? jt(Yo, --_n) : 0, qo--, Ot === 10 && (qo = 1, xu--), Ot;
  }
  function Gn() {
    return Ot = _n < h1 ? jt(Yo, _n++) : 0, qo++, Ot === 10 && (qo = 1, xu++), Ot;
  }
  function Vi() {
    return jt(Yo, _n);
  }
  function Cu() {
    return _n;
  }
  function Tu(t, e) {
    return Go(Yo, t, e);
  }
  function hh(t) {
    switch (t) {
      case 0:
      case 9:
      case 10:
      case 13:
      case 32:
        return 5;
      case 33:
      case 43:
      case 44:
      case 47:
      case 62:
      case 64:
      case 126:
      case 59:
      case 123:
      case 125:
        return 4;
      case 58:
        return 3;
      case 34:
      case 39:
      case 40:
      case 91:
        return 2;
      case 41:
      case 93:
        return 1;
    }
    return 0;
  }
  function jL(t) {
    return xu = qo = 1, h1 = ur(Yo = t), _n = 0, [];
  }
  function ML(t) {
    return Yo = "", t;
  }
  function ph(t) {
    return c1(Tu(_n - 1, mh(t === 91 ? t + 2 : t === 40 ? t + 1 : t)));
  }
  function FL(t) {
    for (; (Ot = Vi()) && Ot < 33; )
      Gn();
    return hh(t) > 2 || hh(Ot) > 3 ? "" : " ";
  }
  function HL(t, e) {
    for (; --e && Gn() && !(Ot < 48 || Ot > 102 || Ot > 57 && Ot < 65 || Ot > 70 && Ot < 97); )
      ;
    return Tu(t, Cu() + (e < 6 && Vi() == 32 && Gn() == 32));
  }
  function mh(t) {
    for (; Gn(); )
      switch (Ot) {
        case t:
          return _n;
        case 34:
        case 39:
          t !== 34 && t !== 39 && mh(Ot);
          break;
        case 40:
          t === 41 && mh(t);
          break;
        case 92:
          Gn();
          break;
      }
    return _n;
  }
  function BL(t, e) {
    for (; Gn() && t + Ot !== 57; )
      if (t + Ot === 84 && Vi() === 47)
        break;
    return "/*" + Tu(e, _n - 1) + "*" + dh(t === 47 ? t : Gn());
  }
  function UL(t) {
    for (; !hh(Vi()); )
      Gn();
    return Tu(t, _n);
  }
  function $L(t) {
    return ML(Ou("", null, null, null, [""], t = jL(t), 0, [0], t));
  }
  function Ou(t, e, n, i, s, a, u, d, f) {
    for (var p = 0, m = 0, v = u, y = 0, E = 0, S = 0, x = 1, C = 1, L = 1, k = 0, I = "", B = s, V = a, P = i, R = I; C; )
      switch (S = k, k = Gn()) {
        case 40:
          if (S != 108 && jt(R, v - 1) == 58) {
            Eu(R += Le(ph(k), "&", "&\f"), "&\f", u1(p ? d[p - 1] : 0)) != -1 && (L = -1);
            break;
          }
        case 34:
        case 39:
        case 91:
          R += ph(k);
          break;
        case 9:
        case 10:
        case 13:
        case 32:
          R += FL(S);
          break;
        case 92:
          R += HL(Cu() - 1, 7);
          continue;
        case 47:
          switch (Vi()) {
            case 42:
            case 47:
              aa(zL(BL(Gn(), Cu()), e, n, f), f);
              break;
            default:
              R += "/";
          }
          break;
        case 123 * x:
          d[p++] = ur(R) * L;
        case 125 * x:
        case 59:
        case 0:
          switch (k) {
            case 0:
            case 125:
              C = 0;
            case 59 + m:
              L == -1 && (R = Le(R, /\f/g, "")), E > 0 && ur(R) - v && aa(E > 32 ? m1(R + ";", i, n, v - 1, f) : m1(Le(R, " ", "") + ";", i, n, v - 2, f), f);
              break;
            case 59:
              R += ";";
            default:
              if (aa(P = p1(R, e, n, p, m, s, d, I, B = [], V = [], v, a), a), k === 123)
                if (m === 0)
                  Ou(R, e, P, P, B, a, v, d, V);
                else
                  switch (y === 99 && jt(R, 3) === 110 ? 100 : y) {
                    case 100:
                    case 108:
                    case 109:
                    case 115:
                      Ou(t, P, P, i && aa(p1(t, P, P, 0, 0, s, d, I, s, B = [], v, V), V), s, V, v, d, i ? B : V);
                      break;
                    default:
                      Ou(R, P, P, P, [""], V, 0, d, V);
                  }
          }
          p = m = E = 0, x = L = 1, I = R = "", v = u;
          break;
        case 58:
          v = 1 + ur(R), E = S;
        default:
          if (x < 1) {
            if (k == 123)
              --x;
            else if (k == 125 && x++ == 0 && DL() == 125)
              continue;
          }
          switch (R += dh(k), k * x) {
            case 38:
              L = m > 0 ? 1 : (R += "\f", -1);
              break;
            case 44:
              d[p++] = (ur(R) - 1) * L, L = 1;
              break;
            case 64:
              Vi() === 45 && (R += ph(Gn())), y = Vi(), m = v = ur(I = R += UL(Cu())), k++;
              break;
            case 45:
              S === 45 && ur(R) == 2 && (x = 0);
          }
      }
    return a;
  }
  function p1(t, e, n, i, s, a, u, d, f, p, m, v) {
    for (var y = s - 1, E = s === 0 ? a : [""], S = d1(E), x = 0, C = 0, L = 0; x < i; ++x)
      for (var k = 0, I = Go(t, y + 1, y = u1(C = u[x])), B = t; k < S; ++k)
        (B = c1(C > 0 ? E[k] + " " + I : Le(I, /&\f/g, E[k]))) && (f[L++] = B);
    return bu(t, e, n, s === 0 ? Su : d, f, p, m, v);
  }
  function zL(t, e, n, i) {
    return bu(t, e, n, a1, dh(NL()), Go(t, 2, -2), 0, i);
  }
  function m1(t, e, n, i, s) {
    return bu(t, e, n, ch, Go(t, 0, i), Go(t, i + 1, -1), i, s);
  }
  function g1(t, e, n) {
    switch (PL(t, e)) {
      case 5103:
        return Ze + "print-" + t + t;
      case 5737:
      case 4201:
      case 3177:
      case 3433:
      case 1641:
      case 4457:
      case 2921:
      case 5572:
      case 6356:
      case 5844:
      case 3191:
      case 6645:
      case 3005:
      case 6391:
      case 5879:
      case 5623:
      case 6135:
      case 4599:
      case 4855:
      case 4215:
      case 6389:
      case 5109:
      case 5365:
      case 5621:
      case 3829:
        return Ze + t + t;
      case 4789:
        return sa + t + t;
      case 5349:
      case 4246:
      case 4810:
      case 6968:
      case 2756:
        return Ze + t + sa + t + ot + t + t;
      case 5936:
        switch (jt(t, e + 11)) {
          case 114:
            return Ze + t + ot + Le(t, /[svh]\w+-[tblr]{2}/, "tb") + t;
          case 108:
            return Ze + t + ot + Le(t, /[svh]\w+-[tblr]{2}/, "tb-rl") + t;
          case 45:
            return Ze + t + ot + Le(t, /[svh]\w+-[tblr]{2}/, "lr") + t;
        }
      case 6828:
      case 4268:
      case 2903:
        return Ze + t + ot + t + t;
      case 6165:
        return Ze + t + ot + "flex-" + t + t;
      case 5187:
        return Ze + t + Le(t, /(\w+).+(:[^]+)/, Ze + "box-$1$2" + ot + "flex-$1$2") + t;
      case 5443:
        return Ze + t + ot + "flex-item-" + Le(t, /flex-|-self/g, "") + (Or(t, /flex-|baseline/) ? "" : ot + "grid-row-" + Le(t, /flex-|-self/g, "")) + t;
      case 4675:
        return Ze + t + ot + "flex-line-pack" + Le(t, /align-content|flex-|-self/g, "") + t;
      case 5548:
        return Ze + t + ot + Le(t, "shrink", "negative") + t;
      case 5292:
        return Ze + t + ot + Le(t, "basis", "preferred-size") + t;
      case 6060:
        return Ze + "box-" + Le(t, "-grow", "") + Ze + t + ot + Le(t, "grow", "positive") + t;
      case 4554:
        return Ze + Le(t, /([^-])(transform)/g, "$1" + Ze + "$2") + t;
      case 6187:
        return Le(Le(Le(t, /(zoom-|grab)/, Ze + "$1"), /(image-set)/, Ze + "$1"), t, "") + t;
      case 5495:
      case 3959:
        return Le(t, /(image-set\([^]*)/, Ze + "$1$`$1");
      case 4968:
        return Le(Le(t, /(.+:)(flex-)?(.*)/, Ze + "box-pack:$3" + ot + "flex-pack:$3"), /s.+-b[^;]+/, "justify") + Ze + t + t;
      case 4200:
        if (!Or(t, /flex-|baseline/))
          return ot + "grid-column-align" + Go(t, e) + t;
        break;
      case 2592:
      case 3360:
        return ot + Le(t, "template-", "") + t;
      case 4384:
      case 3616:
        return n && n.some(function(i, s) {
          return e = s, Or(i.props, /grid-\w+-end/);
        }) ? ~Eu(t + (n = n[e].value), "span", 0) ? t : ot + Le(t, "-start", "") + t + ot + "grid-row-span:" + (~Eu(n, "span", 0) ? Or(n, /\d+/) : +Or(n, /\d+/) - +Or(t, /\d+/)) + ";" : ot + Le(t, "-start", "") + t;
      case 4896:
      case 4128:
        return n && n.some(function(i) {
          return Or(i.props, /grid-\w+-start/);
        }) ? t : ot + Le(Le(t, "-end", "-span"), "span ", "") + t;
      case 4095:
      case 3583:
      case 4068:
      case 2532:
        return Le(t, /(.+)-inline(.+)/, Ze + "$1$2") + t;
      case 8116:
      case 7059:
      case 5753:
      case 5535:
      case 5445:
      case 5701:
      case 4933:
      case 4677:
      case 5533:
      case 5789:
      case 5021:
      case 4765:
        if (ur(t) - 1 - e > 6)
          switch (jt(t, e + 1)) {
            case 109:
              if (jt(t, e + 4) !== 45)
                break;
            case 102:
              return Le(t, /(.+:)(.+)-([^]+)/, "$1" + Ze + "$2-$3$1" + sa + (jt(t, e + 3) == 108 ? "$3" : "$2-$3")) + t;
            case 115:
              return ~Eu(t, "stretch", 0) ? g1(Le(t, "stretch", "fill-available"), e, n) + t : t;
          }
        break;
      case 5152:
      case 5920:
        return Le(t, /(.+?):(\d+)(\s*\/\s*(span)?\s*(\d+))?(.*)/, function(i, s, a, u, d, f, p) {
          return ot + s + ":" + a + p + (u ? ot + s + "-span:" + (d ? f : +f - +a) + p : "") + t;
        });
      case 4949:
        if (jt(t, e + 6) === 121)
          return Le(t, ":", ":" + Ze) + t;
        break;
      case 6444:
        switch (jt(t, jt(t, 14) === 45 ? 18 : 11)) {
          case 120:
            return Le(t, /(.+:)([^;\s!]+)(;|(\s+)?!.+)?/, "$1" + Ze + (jt(t, 14) === 45 ? "inline-" : "") + "box$3$1" + Ze + "$2$3$1" + ot + "$2box$3") + t;
          case 100:
            return Le(t, ":", ":" + ot) + t;
        }
        break;
      case 5719:
      case 2647:
      case 2135:
      case 3927:
      case 2391:
        return Le(t, "scroll-", "scroll-snap-") + t;
    }
    return t;
  }
  function _u(t, e) {
    for (var n = "", i = 0; i < t.length; i++)
      n += e(t[i], i, t, e) || "";
    return n;
  }
  function VL(t, e, n, i) {
    switch (t.type) {
      case kL:
        if (t.children.length)
          break;
      case AL:
      case ch:
        return t.return = t.return || t.value;
      case a1:
        return "";
      case l1:
        return t.return = t.value + "{" + _u(t.children, i) + "}";
      case Su:
        if (!ur(t.value = t.props.join(",")))
          return "";
    }
    return ur(n = _u(t.children, i)) ? t.return = t.value + "{" + n + "}" : "";
  }
  function WL(t) {
    var e = d1(t);
    return function(n, i, s, a) {
      for (var u = "", d = 0; d < e; d++)
        u += t[d](n, i, s, a) || "";
      return u;
    };
  }
  function GL(t) {
    return function(e) {
      e.root || (e = e.return) && t(e);
    };
  }
  function qL(t, e, n, i) {
    if (t.length > -1 && !t.return)
      switch (t.type) {
        case ch:
          t.return = g1(t.value, t.length, n);
          return;
        case l1:
          return _u([Zr(t, { value: Le(t.value, "@", "@" + Ze) })], i);
        case Su:
          if (t.length)
            return IL(n = t.props, function(s) {
              switch (Or(s, i = /(::plac\w+|:read-\w+)/)) {
                case ":read-only":
                case ":read-write":
                  Ko(Zr(t, { props: [Le(s, /:(read-\w+)/, ":" + sa + "$1")] })), Ko(Zr(t, { props: [s] })), fh(t, { props: f1(n, i) });
                  break;
                case "::placeholder":
                  Ko(Zr(t, { props: [Le(s, /:(plac\w+)/, ":" + Ze + "input-$1")] })), Ko(Zr(t, { props: [Le(s, /:(plac\w+)/, ":" + sa + "$1")] })), Ko(Zr(t, { props: [Le(s, /:(plac\w+)/, ot + "input-$1")] })), Ko(Zr(t, { props: [s] })), fh(t, { props: f1(n, i) });
                  break;
              }
              return "";
            });
      }
  }
  var YL = {
    animationIterationCount: 1,
    borderImageOutset: 1,
    borderImageSlice: 1,
    borderImageWidth: 1,
    boxFlex: 1,
    boxFlexGroup: 1,
    boxOrdinalGroup: 1,
    columnCount: 1,
    columns: 1,
    flex: 1,
    flexGrow: 1,
    flexPositive: 1,
    flexShrink: 1,
    flexNegative: 1,
    flexOrder: 1,
    gridRow: 1,
    gridRowEnd: 1,
    gridRowSpan: 1,
    gridRowStart: 1,
    gridColumn: 1,
    gridColumnEnd: 1,
    gridColumnSpan: 1,
    gridColumnStart: 1,
    msGridRow: 1,
    msGridRowSpan: 1,
    msGridColumn: 1,
    msGridColumnSpan: 1,
    fontWeight: 1,
    lineHeight: 1,
    opacity: 1,
    order: 1,
    orphans: 1,
    tabSize: 1,
    widows: 1,
    zIndex: 1,
    zoom: 1,
    WebkitLineClamp: 1,
    // SVG-related properties
    fillOpacity: 1,
    floodOpacity: 1,
    stopOpacity: 1,
    strokeDasharray: 1,
    strokeDashoffset: 1,
    strokeMiterlimit: 1,
    strokeOpacity: 1,
    strokeWidth: 1
  }, He = { WALLET_API_URL: "https://api-wallet.tiendanube.com", WALLET_BR_API_HOST: "https://api.nuvem.com.br", WALLET_LATAM_API_HOST: "https://api.nube.com", NODE_ENV: "production", WALLET_IFRAME_URL: "https://nuvempay.nuvemshop.com.br", WALLET_LIB_AUTH_URL: "https://wallet.tiendanube.com/auth.js", LATEST_COMMIT_HASH: "2a7dc915ddb83314d33e954845a64049f00be454", BR_EXPRESS_CHECKOUT_HOST: "https://nuvem.com.br", LATAM_EXPRESS_CHECKOUT_HOST: "https://nube.com" }, Wi = typeof process < "u" && He !== void 0 && (He.REACT_APP_SC_ATTR || He.SC_ATTR) || "data-styled", v1 = "active", y1 = "data-styled-version", Ru = "6.1.8", gh = `/*!sc*/
`, vh = typeof window < "u" && "HTMLElement" in window, KL = !!(typeof SC_DISABLE_SPEEDY == "boolean" ? SC_DISABLE_SPEEDY : typeof process < "u" && He !== void 0 && He.REACT_APP_SC_DISABLE_SPEEDY !== void 0 && He.REACT_APP_SC_DISABLE_SPEEDY !== "" ? He.REACT_APP_SC_DISABLE_SPEEDY !== "false" && He.REACT_APP_SC_DISABLE_SPEEDY : typeof process < "u" && He !== void 0 && He.SC_DISABLE_SPEEDY !== void 0 && He.SC_DISABLE_SPEEDY !== "" ? He.SC_DISABLE_SPEEDY !== "false" && He.SC_DISABLE_SPEEDY : He.NODE_ENV !== "production"), w1 = /invalid hook call/i, Lu = /* @__PURE__ */ new Set(), ZL = function(t, e) {
    if (He.NODE_ENV !== "production") {
      var n = e ? ' with the id of "'.concat(e, '"') : "", i = "The component ".concat(t).concat(n, ` has been created dynamically.
`) + `You may see this warning because you've called styled inside another component.
To resolve this only create new StyledComponents outside of any render method and function component.`, s = console.error;
      try {
        var a = !0;
        console.error = function(u) {
          for (var d = [], f = 1; f < arguments.length; f++)
            d[f - 1] = arguments[f];
          w1.test(u) ? (a = !1, Lu.delete(i)) : s.apply(void 0, zi([u], d, !1));
        }, N.useRef(), a && !Lu.has(i) && (console.warn(i), Lu.add(i));
      } catch (u) {
        w1.test(u.message) && Lu.delete(i);
      } finally {
        console.error = s;
      }
    }
  }, Au = Object.freeze([]), Zo = Object.freeze({});
  function XL(t, e, n) {
    return n === void 0 && (n = Zo), t.theme !== n.theme && t.theme || e || n.theme;
  }
  var yh = /* @__PURE__ */ new Set(["a", "abbr", "address", "area", "article", "aside", "audio", "b", "base", "bdi", "bdo", "big", "blockquote", "body", "br", "button", "canvas", "caption", "cite", "code", "col", "colgroup", "data", "datalist", "dd", "del", "details", "dfn", "dialog", "div", "dl", "dt", "em", "embed", "fieldset", "figcaption", "figure", "footer", "form", "h1", "h2", "h3", "h4", "h5", "h6", "header", "hgroup", "hr", "html", "i", "iframe", "img", "input", "ins", "kbd", "keygen", "label", "legend", "li", "link", "main", "map", "mark", "menu", "menuitem", "meta", "meter", "nav", "noscript", "object", "ol", "optgroup", "option", "output", "p", "param", "picture", "pre", "progress", "q", "rp", "rt", "ruby", "s", "samp", "script", "section", "select", "small", "source", "span", "strong", "style", "sub", "summary", "sup", "table", "tbody", "td", "textarea", "tfoot", "th", "thead", "time", "tr", "track", "u", "ul", "use", "var", "video", "wbr", "circle", "clipPath", "defs", "ellipse", "foreignObject", "g", "image", "line", "linearGradient", "marker", "mask", "path", "pattern", "polygon", "polyline", "radialGradient", "rect", "stop", "svg", "text", "tspan"]), JL = /[!"#$%&'()*+,./:;<=>?@[\\\]^`{|}~-]+/g, QL = /(^-|-$)/g;
  function S1(t) {
    return t.replace(JL, "-").replace(QL, "");
  }
  var e3 = /(a)(d)/gi, ku = 52, E1 = function(t) {
    return String.fromCharCode(t + (t > 25 ? 39 : 97));
  };
  function wh(t) {
    var e, n = "";
    for (e = Math.abs(t); e > ku; e = e / ku | 0)
      n = E1(e % ku) + n;
    return (E1(e % ku) + n).replace(e3, "$1-$2");
  }
  var Sh, x1 = 5381, Gi = function(t, e) {
    for (var n = e.length; n; )
      t = 33 * t ^ e.charCodeAt(--n);
    return t;
  }, b1 = function(t) {
    return Gi(x1, t);
  };
  function C1(t) {
    return wh(b1(t) >>> 0);
  }
  function T1(t) {
    return He.NODE_ENV !== "production" && typeof t == "string" && t || t.displayName || t.name || "Component";
  }
  function Eh(t) {
    return typeof t == "string" && (He.NODE_ENV === "production" || t.charAt(0) === t.charAt(0).toLowerCase());
  }
  var O1 = typeof Symbol == "function" && Symbol.for, _1 = O1 ? Symbol.for("react.memo") : 60115, t3 = O1 ? Symbol.for("react.forward_ref") : 60112, n3 = { childContextTypes: !0, contextType: !0, contextTypes: !0, defaultProps: !0, displayName: !0, getDefaultProps: !0, getDerivedStateFromError: !0, getDerivedStateFromProps: !0, mixins: !0, propTypes: !0, type: !0 }, r3 = { name: !0, length: !0, prototype: !0, caller: !0, callee: !0, arguments: !0, arity: !0 }, R1 = { $$typeof: !0, compare: !0, defaultProps: !0, displayName: !0, propTypes: !0, type: !0 }, i3 = ((Sh = {})[t3] = { $$typeof: !0, render: !0, defaultProps: !0, displayName: !0, propTypes: !0 }, Sh[_1] = R1, Sh);
  function L1(t) {
    return ("type" in (e = t) && e.type.$$typeof) === _1 ? R1 : "$$typeof" in t ? i3[t.$$typeof] : n3;
    var e;
  }
  var o3 = Object.defineProperty, s3 = Object.getOwnPropertyNames, A1 = Object.getOwnPropertySymbols, a3 = Object.getOwnPropertyDescriptor, l3 = Object.getPrototypeOf, k1 = Object.prototype;
  function P1(t, e, n) {
    if (typeof e != "string") {
      if (k1) {
        var i = l3(e);
        i && i !== k1 && P1(t, i, n);
      }
      var s = s3(e);
      A1 && (s = s.concat(A1(e)));
      for (var a = L1(t), u = L1(e), d = 0; d < s.length; ++d) {
        var f = s[d];
        if (!(f in r3 || n && n[f] || u && f in u || a && f in a)) {
          var p = a3(e, f);
          try {
            o3(t, f, p);
          } catch {
          }
        }
      }
    }
    return t;
  }
  function qi(t) {
    return typeof t == "function";
  }
  function xh(t) {
    return typeof t == "object" && "styledComponentId" in t;
  }
  function Yi(t, e) {
    return t && e ? "".concat(t, " ").concat(e) : t || e || "";
  }
  function bh(t, e) {
    if (t.length === 0)
      return "";
    for (var n = t[0], i = 1; i < t.length; i++)
      n += e ? e + t[i] : t[i];
    return n;
  }
  function Xo(t) {
    return t !== null && typeof t == "object" && t.constructor.name === Object.name && !("props" in t && t.$$typeof);
  }
  function Ch(t, e, n) {
    if (n === void 0 && (n = !1), !n && !Xo(t) && !Array.isArray(t))
      return e;
    if (Array.isArray(e))
      for (var i = 0; i < e.length; i++)
        t[i] = Ch(t[i], e[i]);
    else if (Xo(e))
      for (var i in e)
        t[i] = Ch(t[i], e[i]);
    return t;
  }
  function Th(t, e) {
    Object.defineProperty(t, "toString", { value: e });
  }
  var u3 = He.NODE_ENV !== "production" ? { 1: `Cannot create styled-component for component: %s.

`, 2: `Can't collect styles once you've consumed a \`ServerStyleSheet\`'s styles! \`ServerStyleSheet\` is a one off instance for each server-side render cycle.

- Are you trying to reuse it across renders?
- Are you accidentally calling collectStyles twice?

`, 3: `Streaming SSR is only supported in a Node.js environment; Please do not try to call this method in the browser.

`, 4: `The \`StyleSheetManager\` expects a valid target or sheet prop!

- Does this error occur on the client and is your target falsy?
- Does this error occur on the server and is the sheet falsy?

`, 5: `The clone method cannot be used on the client!

- Are you running in a client-like environment on the server?
- Are you trying to run SSR on the client?

`, 6: `Trying to insert a new style tag, but the given Node is unmounted!

- Are you using a custom target that isn't mounted?
- Does your document not have a valid head element?
- Have you accidentally removed a style tag manually?

`, 7: 'ThemeProvider: Please return an object from your "theme" prop function, e.g.\n\n```js\ntheme={() => ({})}\n```\n\n', 8: `ThemeProvider: Please make your "theme" prop an object.

`, 9: "Missing document `<head>`\n\n", 10: `Cannot find a StyleSheet instance. Usually this happens if there are multiple copies of styled-components loaded at once. Check out this issue for how to troubleshoot and fix the common cases where this situation can happen: https://github.com/styled-components/styled-components/issues/1941#issuecomment-417862021

`, 11: `_This error was replaced with a dev-time warning, it will be deleted for v4 final._ [createGlobalStyle] received children which will not be rendered. Please use the component without passing children elements.

`, 12: "It seems you are interpolating a keyframe declaration (%s) into an untagged string. This was supported in styled-components v3, but is not longer supported in v4 as keyframes are now injected on-demand. Please wrap your string in the css\\`\\` helper which ensures the styles are injected correctly. See https://www.styled-components.com/docs/api#css\n\n", 13: `%s is not a styled component and cannot be referred to via component selector. See https://www.styled-components.com/docs/advanced#referring-to-other-components for more details.

`, 14: `ThemeProvider: "theme" prop is required.

`, 15: "A stylis plugin has been supplied that is not named. We need a name for each plugin to be able to prevent styling collisions between different stylis configurations within the same app. Before you pass your plugin to `<StyleSheetManager stylisPlugins={[]}>`, please make sure each plugin is uniquely-named, e.g.\n\n```js\nObject.defineProperty(importedPlugin, 'name', { value: 'some-unique-name' });\n```\n\n", 16: `Reached the limit of how many styled components may be created at group %s.
You may only create up to 1,073,741,824 components. If you're creating components dynamically,
as for instance in your render method then you may be running into this limitation.

`, 17: `CSSStyleSheet could not be found on HTMLStyleElement.
Has styled-components' style tag been unmounted or altered by another script?
`, 18: "ThemeProvider: Please make sure your useTheme hook is within a `<ThemeProvider>`" } : {};
  function c3() {
    for (var t = [], e = 0; e < arguments.length; e++)
      t[e] = arguments[e];
    for (var n = t[0], i = [], s = 1, a = t.length; s < a; s += 1)
      i.push(t[s]);
    return i.forEach(function(u) {
      n = n.replace(/%[a-z]/, u);
    }), n;
  }
  function _r(t) {
    for (var e = [], n = 1; n < arguments.length; n++)
      e[n - 1] = arguments[n];
    return He.NODE_ENV === "production" ? new Error("An error occurred. See https://github.com/styled-components/styled-components/blob/main/packages/styled-components/src/utils/errors.md#".concat(t, " for more information.").concat(e.length > 0 ? " Args: ".concat(e.join(", ")) : "")) : new Error(c3.apply(void 0, zi([u3[t]], e, !1)).trim());
  }
  var d3 = function() {
    function t(e) {
      this.groupSizes = new Uint32Array(512), this.length = 512, this.tag = e;
    }
    return t.prototype.indexOfGroup = function(e) {
      for (var n = 0, i = 0; i < e; i++)
        n += this.groupSizes[i];
      return n;
    }, t.prototype.insertRules = function(e, n) {
      if (e >= this.groupSizes.length) {
        for (var i = this.groupSizes, s = i.length, a = s; e >= a; )
          if ((a <<= 1) < 0)
            throw _r(16, "".concat(e));
        this.groupSizes = new Uint32Array(a), this.groupSizes.set(i), this.length = a;
        for (var u = s; u < a; u++)
          this.groupSizes[u] = 0;
      }
      for (var d = this.indexOfGroup(e + 1), f = (u = 0, n.length); u < f; u++)
        this.tag.insertRule(d, n[u]) && (this.groupSizes[e]++, d++);
    }, t.prototype.clearGroup = function(e) {
      if (e < this.length) {
        var n = this.groupSizes[e], i = this.indexOfGroup(e), s = i + n;
        this.groupSizes[e] = 0;
        for (var a = i; a < s; a++)
          this.tag.deleteRule(i);
      }
    }, t.prototype.getGroup = function(e) {
      var n = "";
      if (e >= this.length || this.groupSizes[e] === 0)
        return n;
      for (var i = this.groupSizes[e], s = this.indexOfGroup(e), a = s + i, u = s; u < a; u++)
        n += "".concat(this.tag.getRule(u)).concat(gh);
      return n;
    }, t;
  }(), Pu = /* @__PURE__ */ new Map(), Iu = /* @__PURE__ */ new Map(), Nu = 1, Du = function(t) {
    if (Pu.has(t))
      return Pu.get(t);
    for (; Iu.has(Nu); )
      Nu++;
    var e = Nu++;
    if (He.NODE_ENV !== "production" && ((0 | e) < 0 || e > 1073741824))
      throw _r(16, "".concat(e));
    return Pu.set(t, e), Iu.set(e, t), e;
  }, f3 = function(t, e) {
    Nu = e + 1, Pu.set(t, e), Iu.set(e, t);
  }, h3 = "style[".concat(Wi, "][").concat(y1, '="').concat(Ru, '"]'), p3 = new RegExp("^".concat(Wi, '\\.g(\\d+)\\[id="([\\w\\d-]+)"\\].*?"([^"]*)')), m3 = function(t, e, n) {
    for (var i, s = n.split(","), a = 0, u = s.length; a < u; a++)
      (i = s[a]) && t.registerName(e, i);
  }, g3 = function(t, e) {
    for (var n, i = ((n = e.textContent) !== null && n !== void 0 ? n : "").split(gh), s = [], a = 0, u = i.length; a < u; a++) {
      var d = i[a].trim();
      if (d) {
        var f = d.match(p3);
        if (f) {
          var p = 0 | parseInt(f[1], 10), m = f[2];
          p !== 0 && (f3(m, p), m3(t, m, f[3]), t.getTag().insertRules(p, s)), s.length = 0;
        } else
          s.push(d);
      }
    }
  };
  function v3() {
    return typeof __webpack_nonce__ < "u" ? __webpack_nonce__ : null;
  }
  var I1 = function(t) {
    var e = document.head, n = t || e, i = document.createElement("style"), s = function(d) {
      var f = Array.from(d.querySelectorAll("style[".concat(Wi, "]")));
      return f[f.length - 1];
    }(n), a = s !== void 0 ? s.nextSibling : null;
    i.setAttribute(Wi, v1), i.setAttribute(y1, Ru);
    var u = v3();
    return u && i.setAttribute("nonce", u), n.insertBefore(i, a), i;
  }, y3 = function() {
    function t(e) {
      this.element = I1(e), this.element.appendChild(document.createTextNode("")), this.sheet = function(n) {
        if (n.sheet)
          return n.sheet;
        for (var i = document.styleSheets, s = 0, a = i.length; s < a; s++) {
          var u = i[s];
          if (u.ownerNode === n)
            return u;
        }
        throw _r(17);
      }(this.element), this.length = 0;
    }
    return t.prototype.insertRule = function(e, n) {
      try {
        return this.sheet.insertRule(n, e), this.length++, !0;
      } catch {
        return !1;
      }
    }, t.prototype.deleteRule = function(e) {
      this.sheet.deleteRule(e), this.length--;
    }, t.prototype.getRule = function(e) {
      var n = this.sheet.cssRules[e];
      return n && n.cssText ? n.cssText : "";
    }, t;
  }(), w3 = function() {
    function t(e) {
      this.element = I1(e), this.nodes = this.element.childNodes, this.length = 0;
    }
    return t.prototype.insertRule = function(e, n) {
      if (e <= this.length && e >= 0) {
        var i = document.createTextNode(n);
        return this.element.insertBefore(i, this.nodes[e] || null), this.length++, !0;
      }
      return !1;
    }, t.prototype.deleteRule = function(e) {
      this.element.removeChild(this.nodes[e]), this.length--;
    }, t.prototype.getRule = function(e) {
      return e < this.length ? this.nodes[e].textContent : "";
    }, t;
  }(), S3 = function() {
    function t(e) {
      this.rules = [], this.length = 0;
    }
    return t.prototype.insertRule = function(e, n) {
      return e <= this.length && (this.rules.splice(e, 0, n), this.length++, !0);
    }, t.prototype.deleteRule = function(e) {
      this.rules.splice(e, 1), this.length--;
    }, t.prototype.getRule = function(e) {
      return e < this.length ? this.rules[e] : "";
    }, t;
  }(), N1 = vh, E3 = { isServer: !vh, useCSSOMInjection: !KL }, D1 = function() {
    function t(e, n, i) {
      e === void 0 && (e = Zo), n === void 0 && (n = {});
      var s = this;
      this.options = Kt(Kt({}, E3), e), this.gs = n, this.names = new Map(i), this.server = !!e.isServer, !this.server && vh && N1 && (N1 = !1, function(a) {
        for (var u = document.querySelectorAll(h3), d = 0, f = u.length; d < f; d++) {
          var p = u[d];
          p && p.getAttribute(Wi) !== v1 && (g3(a, p), p.parentNode && p.parentNode.removeChild(p));
        }
      }(this)), Th(this, function() {
        return function(a) {
          for (var u = a.getTag(), d = u.length, f = "", p = function(v) {
            var y = function(L) {
              return Iu.get(L);
            }(v);
            if (y === void 0)
              return "continue";
            var E = a.names.get(y), S = u.getGroup(v);
            if (E === void 0 || S.length === 0)
              return "continue";
            var x = "".concat(Wi, ".g").concat(v, '[id="').concat(y, '"]'), C = "";
            E !== void 0 && E.forEach(function(L) {
              L.length > 0 && (C += "".concat(L, ","));
            }), f += "".concat(S).concat(x, '{content:"').concat(C, '"}').concat(gh);
          }, m = 0; m < d; m++)
            p(m);
          return f;
        }(s);
      });
    }
    return t.registerId = function(e) {
      return Du(e);
    }, t.prototype.reconstructWithOptions = function(e, n) {
      return n === void 0 && (n = !0), new t(Kt(Kt({}, this.options), e), this.gs, n && this.names || void 0);
    }, t.prototype.allocateGSInstance = function(e) {
      return this.gs[e] = (this.gs[e] || 0) + 1;
    }, t.prototype.getTag = function() {
      return this.tag || (this.tag = (e = function(n) {
        var i = n.useCSSOMInjection, s = n.target;
        return n.isServer ? new S3(s) : i ? new y3(s) : new w3(s);
      }(this.options), new d3(e)));
      var e;
    }, t.prototype.hasNameForId = function(e, n) {
      return this.names.has(e) && this.names.get(e).has(n);
    }, t.prototype.registerName = function(e, n) {
      if (Du(e), this.names.has(e))
        this.names.get(e).add(n);
      else {
        var i = /* @__PURE__ */ new Set();
        i.add(n), this.names.set(e, i);
      }
    }, t.prototype.insertRules = function(e, n, i) {
      this.registerName(e, n), this.getTag().insertRules(Du(e), i);
    }, t.prototype.clearNames = function(e) {
      this.names.has(e) && this.names.get(e).clear();
    }, t.prototype.clearRules = function(e) {
      this.getTag().clearGroup(Du(e)), this.clearNames(e);
    }, t.prototype.clearTag = function() {
      this.tag = void 0;
    }, t;
  }(), x3 = /&/g, b3 = /^\s*\/\/.*$/gm;
  function j1(t, e) {
    return t.map(function(n) {
      return n.type === "rule" && (n.value = "".concat(e, " ").concat(n.value), n.value = n.value.replaceAll(",", ",".concat(e, " ")), n.props = n.props.map(function(i) {
        return "".concat(e, " ").concat(i);
      })), Array.isArray(n.children) && n.type !== "@keyframes" && (n.children = j1(n.children, e)), n;
    });
  }
  function C3(t) {
    var e, n, i, s = t === void 0 ? Zo : t, a = s.options, u = a === void 0 ? Zo : a, d = s.plugins, f = d === void 0 ? Au : d, p = function(y, E, S) {
      return S.startsWith(n) && S.endsWith(n) && S.replaceAll(n, "").length > 0 ? ".".concat(e) : y;
    }, m = f.slice();
    m.push(function(y) {
      y.type === Su && y.value.includes("&") && (y.props[0] = y.props[0].replace(x3, n).replace(i, p));
    }), u.prefix && m.push(qL), m.push(VL);
    var v = function(y, E, S, x) {
      E === void 0 && (E = ""), S === void 0 && (S = ""), x === void 0 && (x = "&"), e = x, n = E, i = new RegExp("\\".concat(n, "\\b"), "g");
      var C = y.replace(b3, ""), L = $L(S || E ? "".concat(S, " ").concat(E, " { ").concat(C, " }") : C);
      u.namespace && (L = j1(L, u.namespace));
      var k = [];
      return _u(L, WL(m.concat(GL(function(I) {
        return k.push(I);
      })))), k;
    };
    return v.hash = f.length ? f.reduce(function(y, E) {
      return E.name || _r(15), Gi(y, E.name);
    }, x1).toString() : "", v;
  }
  var T3 = new D1(), Oh = C3(), M1 = gt.createContext({ shouldForwardProp: void 0, styleSheet: T3, stylis: Oh });
  M1.Consumer, gt.createContext(void 0);
  function F1() {
    return N.useContext(M1);
  }
  var _h = function() {
    function t(e, n) {
      var i = this;
      this.inject = function(s, a) {
        a === void 0 && (a = Oh);
        var u = i.name + a.hash;
        s.hasNameForId(i.id, u) || s.insertRules(i.id, u, a(i.rules, u, "@keyframes"));
      }, this.name = e, this.id = "sc-keyframes-".concat(e), this.rules = n, Th(this, function() {
        throw _r(12, String(i.name));
      });
    }
    return t.prototype.getName = function(e) {
      return e === void 0 && (e = Oh), this.name + e.hash;
    }, t;
  }(), O3 = function(t) {
    return t >= "A" && t <= "Z";
  };
  function H1(t) {
    for (var e = "", n = 0; n < t.length; n++) {
      var i = t[n];
      if (n === 1 && i === "-" && t[0] === "-")
        return t;
      O3(i) ? e += "-" + i.toLowerCase() : e += i;
    }
    return e.startsWith("ms-") ? "-" + e : e;
  }
  var B1 = function(t) {
    return t == null || t === !1 || t === "";
  }, U1 = function(t) {
    var e, n, i = [];
    for (var s in t) {
      var a = t[s];
      t.hasOwnProperty(s) && !B1(a) && (Array.isArray(a) && a.isCss || qi(a) ? i.push("".concat(H1(s), ":"), a, ";") : Xo(a) ? i.push.apply(i, zi(zi(["".concat(s, " {")], U1(a), !1), ["}"], !1)) : i.push("".concat(H1(s), ": ").concat((e = s, (n = a) == null || typeof n == "boolean" || n === "" ? "" : typeof n != "number" || n === 0 || e in YL || e.startsWith("--") ? String(n).trim() : "".concat(n, "px")), ";")));
    }
    return i;
  };
  function Ki(t, e, n, i) {
    if (B1(t))
      return [];
    if (xh(t))
      return [".".concat(t.styledComponentId)];
    if (qi(t)) {
      if (!qi(a = t) || a.prototype && a.prototype.isReactComponent || !e)
        return [t];
      var s = t(e);
      return He.NODE_ENV === "production" || typeof s != "object" || Array.isArray(s) || s instanceof _h || Xo(s) || s === null || console.error("".concat(T1(t), " is not a styled component and cannot be referred to via component selector. See https://www.styled-components.com/docs/advanced#referring-to-other-components for more details.")), Ki(s, e, n, i);
    }
    var a;
    return t instanceof _h ? n ? (t.inject(n, i), [t.getName(i)]) : [t] : Xo(t) ? U1(t) : Array.isArray(t) ? Array.prototype.concat.apply(Au, t.map(function(u) {
      return Ki(u, e, n, i);
    })) : [t.toString()];
  }
  function _3(t) {
    for (var e = 0; e < t.length; e += 1) {
      var n = t[e];
      if (qi(n) && !xh(n))
        return !1;
    }
    return !0;
  }
  var R3 = b1(Ru), L3 = function() {
    function t(e, n, i) {
      this.rules = e, this.staticRulesId = "", this.isStatic = He.NODE_ENV === "production" && (i === void 0 || i.isStatic) && _3(e), this.componentId = n, this.baseHash = Gi(R3, n), this.baseStyle = i, D1.registerId(n);
    }
    return t.prototype.generateAndInjectStyles = function(e, n, i) {
      var s = this.baseStyle ? this.baseStyle.generateAndInjectStyles(e, n, i) : "";
      if (this.isStatic && !i.hash)
        if (this.staticRulesId && n.hasNameForId(this.componentId, this.staticRulesId))
          s = Yi(s, this.staticRulesId);
        else {
          var a = bh(Ki(this.rules, e, n, i)), u = wh(Gi(this.baseHash, a) >>> 0);
          if (!n.hasNameForId(this.componentId, u)) {
            var d = i(a, ".".concat(u), void 0, this.componentId);
            n.insertRules(this.componentId, u, d);
          }
          s = Yi(s, u), this.staticRulesId = u;
        }
      else {
        for (var f = Gi(this.baseHash, i.hash), p = "", m = 0; m < this.rules.length; m++) {
          var v = this.rules[m];
          if (typeof v == "string")
            p += v, He.NODE_ENV !== "production" && (f = Gi(f, v));
          else if (v) {
            var y = bh(Ki(v, e, n, i));
            f = Gi(f, y + m), p += y;
          }
        }
        if (p) {
          var E = wh(f >>> 0);
          n.hasNameForId(this.componentId, E) || n.insertRules(this.componentId, E, i(p, ".".concat(E), void 0, this.componentId)), s = Yi(s, E);
        }
      }
      return s;
    }, t;
  }(), ju = gt.createContext(void 0);
  ju.Consumer;
  function A3(t) {
    var e = gt.useContext(ju), n = N.useMemo(function() {
      return function(i, s) {
        if (!i)
          throw _r(14);
        if (qi(i)) {
          var a = i(s);
          if (He.NODE_ENV !== "production" && (a === null || Array.isArray(a) || typeof a != "object"))
            throw _r(7);
          return a;
        }
        if (Array.isArray(i) || typeof i != "object")
          throw _r(8);
        return s ? Kt(Kt({}, s), i) : i;
      }(t.theme, e);
    }, [t.theme, e]);
    return t.children ? gt.createElement(ju.Provider, { value: n }, t.children) : null;
  }
  var Rh = {}, $1 = /* @__PURE__ */ new Set();
  function k3(t, e, n) {
    var i = xh(t), s = t, a = !Eh(t), u = e.attrs, d = u === void 0 ? Au : u, f = e.componentId, p = f === void 0 ? function(B, V) {
      var P = typeof B != "string" ? "sc" : S1(B);
      Rh[P] = (Rh[P] || 0) + 1;
      var R = "".concat(P, "-").concat(C1(Ru + P + Rh[P]));
      return V ? "".concat(V, "-").concat(R) : R;
    }(e.displayName, e.parentComponentId) : f, m = e.displayName, v = m === void 0 ? function(B) {
      return Eh(B) ? "styled.".concat(B) : "Styled(".concat(T1(B), ")");
    }(t) : m, y = e.displayName && e.componentId ? "".concat(S1(e.displayName), "-").concat(e.componentId) : e.componentId || p, E = i && s.attrs ? s.attrs.concat(d).filter(Boolean) : d, S = e.shouldForwardProp;
    if (i && s.shouldForwardProp) {
      var x = s.shouldForwardProp;
      if (e.shouldForwardProp) {
        var C = e.shouldForwardProp;
        S = function(B, V) {
          return x(B, V) && C(B, V);
        };
      } else
        S = x;
    }
    var L = new L3(n, y, i ? s.componentStyle : void 0);
    function k(B, V) {
      return function(P, R, j) {
        var G = P.attrs, ee = P.componentStyle, W = P.defaultProps, re = P.foldedComponentIds, we = P.styledComponentId, ye = P.target, be = gt.useContext(ju), Be = F1(), ge = P.shouldForwardProp || Be.shouldForwardProp;
        He.NODE_ENV !== "production" && N.useDebugValue(we);
        var q = XL(R, be, W) || Zo, Q = function(Oe, _e, Pe) {
          for (var Ae, st = Kt(Kt({}, _e), { className: void 0, theme: Pe }), ti = 0; ti < Oe.length; ti += 1) {
            var Rn = qi(Ae = Oe[ti]) ? Ae(st) : Ae;
            for (var xt in Rn)
              st[xt] = xt === "className" ? Yi(st[xt], Rn[xt]) : xt === "style" ? Kt(Kt({}, st[xt]), Rn[xt]) : Rn[xt];
          }
          return _e.className && (st.className = Yi(st.className, _e.className)), st;
        }(G, R, q), T = Q.as || ye, U = {};
        for (var X in Q)
          Q[X] === void 0 || X[0] === "$" || X === "as" || X === "theme" && Q.theme === q || (X === "forwardedAs" ? U.as = Q.forwardedAs : ge && !ge(X, T) || (U[X] = Q[X], ge || He.NODE_ENV !== "development" || LL(X) || $1.has(X) || !yh.has(T) || ($1.add(X), console.warn('styled-components: it looks like an unknown prop "'.concat(X, '" is being sent through to the DOM, which will likely trigger a React console error. If you would like automatic filtering of unknown props, you can opt-into that behavior via `<StyleSheetManager shouldForwardProp={...}>` (connect an API like `@emotion/is-prop-valid`) or consider using transient props (`$` prefix for automatic filtering.)')))));
        var Se = function(Oe, _e) {
          var Pe = F1(), Ae = Oe.generateAndInjectStyles(_e, Pe.styleSheet, Pe.stylis);
          return He.NODE_ENV !== "production" && N.useDebugValue(Ae), Ae;
        }(ee, Q);
        He.NODE_ENV !== "production" && P.warnTooManyClasses && P.warnTooManyClasses(Se);
        var de = Yi(re, we);
        return Se && (de += " " + Se), Q.className && (de += " " + Q.className), U[Eh(T) && !yh.has(T) ? "class" : "className"] = de, U.ref = j, N.createElement(T, U);
      }(I, B, V);
    }
    k.displayName = v;
    var I = gt.forwardRef(k);
    return I.attrs = E, I.componentStyle = L, I.displayName = v, I.shouldForwardProp = S, I.foldedComponentIds = i ? Yi(s.foldedComponentIds, s.styledComponentId) : "", I.styledComponentId = y, I.target = i ? s.target : t, Object.defineProperty(I, "defaultProps", { get: function() {
      return this._foldedDefaultProps;
    }, set: function(B) {
      this._foldedDefaultProps = i ? function(V) {
        for (var P = [], R = 1; R < arguments.length; R++)
          P[R - 1] = arguments[R];
        for (var j = 0, G = P; j < G.length; j++)
          Ch(V, G[j], !0);
        return V;
      }({}, s.defaultProps, B) : B;
    } }), He.NODE_ENV !== "production" && (ZL(v, y), I.warnTooManyClasses = /* @__PURE__ */ function(B, V) {
      var P = {}, R = !1;
      return function(j) {
        if (!R && (P[j] = !0, Object.keys(P).length >= 200)) {
          var G = V ? ' with the id of "'.concat(V, '"') : "";
          console.warn("Over ".concat(200, " classes were generated for component ").concat(B).concat(G, `.
`) + `Consider using the attrs method, together with a style object for frequently changed styles.
Example:
  const Component = styled.div.attrs(props => ({
    style: {
      background: props.background,
    },
  }))\`width: 100%;\`

  <Component />`), R = !0, P = {};
        }
      };
    }(v, y)), Th(I, function() {
      return ".".concat(I.styledComponentId);
    }), a && P1(I, t, { attrs: !0, componentStyle: !0, displayName: !0, foldedComponentIds: !0, shouldForwardProp: !0, styledComponentId: !0, target: !0 }), I;
  }
  function z1(t, e) {
    for (var n = [t[0]], i = 0, s = e.length; i < s; i += 1)
      n.push(e[i], t[i + 1]);
    return n;
  }
  var V1 = function(t) {
    return Object.assign(t, { isCss: !0 });
  };
  function W1(t) {
    for (var e = [], n = 1; n < arguments.length; n++)
      e[n - 1] = arguments[n];
    if (qi(t) || Xo(t))
      return V1(Ki(z1(Au, zi([t], e, !0))));
    var i = t;
    return e.length === 0 && i.length === 1 && typeof i[0] == "string" ? Ki(i) : V1(Ki(z1(i, e)));
  }
  function Lh(t, e, n) {
    if (n === void 0 && (n = Zo), !e)
      throw _r(1, e);
    var i = function(s) {
      for (var a = [], u = 1; u < arguments.length; u++)
        a[u - 1] = arguments[u];
      return t(e, n, W1.apply(void 0, zi([s], a, !1)));
    };
    return i.attrs = function(s) {
      return Lh(t, e, Kt(Kt({}, n), { attrs: Array.prototype.concat(n.attrs, s).filter(Boolean) }));
    }, i.withConfig = function(s) {
      return Lh(t, e, Kt(Kt({}, n), s));
    }, i;
  }
  var G1 = function(t) {
    return Lh(k3, t);
  }, tt = G1;
  yh.forEach(function(t) {
    tt[t] = G1(t);
  });
  function P3(t) {
    for (var e = [], n = 1; n < arguments.length; n++)
      e[n - 1] = arguments[n];
    He.NODE_ENV !== "production" && typeof navigator < "u" && navigator.product === "ReactNative" && console.warn("`keyframes` cannot be used on ReactNative, only on the web. To do animation in ReactNative please use Animated.");
    var i = bh(W1.apply(void 0, zi([t], e, !1))), s = C1(i);
    return new _h(s, i);
  }
  He.NODE_ENV !== "production" && typeof navigator < "u" && navigator.product === "ReactNative" && console.warn(`It looks like you've imported 'styled-components' on React Native.
Perhaps you're looking to import 'styled-components/native'?
Read more about this at https://www.styled-components.com/docs/basics#react-native`);
  var Mu = "__sc-".concat(Wi, "__");
  He.NODE_ENV !== "production" && He.NODE_ENV !== "test" && typeof window < "u" && (window[Mu] || (window[Mu] = 0), window[Mu] === 1 && console.warn(`It looks like there are several instances of 'styled-components' initialized in this application. This may cause dynamic styles to not render properly, errors during the rehydration process, a missing theme prop, and makes your application bigger without good reason.

See https://s-c.sh/2BAXzed for more info.`), window[Mu] += 1);
  const q1 = {
    fontWeight: {
      book: 300,
      medium: 500,
      semibold: 600
    },
    pallete: {
      nimbusPrimaryInteractive: "#0050C3",
      nimbusPrimaryInteractiveHover: "#00409C",
      nimbusPrimaryInteractivePressed: "#003889",
      nimbusNeutralBackground: "#FFFFFF"
    },
    background: {
      neutral: "#FFF"
    },
    lineHeights: {
      small: "16px"
    },
    fontSize: {
      large: "24px",
      xMedium: "16px",
      medium: "14px",
      xSmall: "12px",
      small: "10px"
    },
    spacing: {
      small: "8px",
      xSmall: "12px",
      xMedium: "16px"
    },
    fontFamily: '-apple-system, system-ui, BlinkMacSystemFont, "Segoe UI", Roboto, sans-serif'
  }, Y1 = (t) => /* @__PURE__ */ O.jsx(A3, { theme: q1, children: t }), Ah = (t, e) => {
    const n = document.getElementById(e);
    uh(n).render(Y1(t));
  }, I3 = (t, e) => {
    e.render(Y1(t));
  }, kh = (t, e = "currentcolor") => `color-mix(in srgb, ${e} ${t}%, transparent)`, N3 = tt.div`
  background-color: ${({ theme: t }) => t.background.neutral};
  border: 1px solid ${kh(8)};
  border-radius: 8px;
  margin-top: 3px;
  max-width: 360px;

  display: flex;
  flex-direction: column;
  margin-bottom: 24px;
  position: absolute;
  width: 100%;
  text-align: left;
  z-index: 1000;

  &:before {
    content: '';
    width: 0px;
    height: 0px;
    position: absolute;
    border-left: 6px solid transparent;
    border-right: 6px solid transparent;
    border-bottom: 6px solid ${kh(8)};
    border-bottom-color: inherit;
    bottom: 100%;
    left: 18px;
    filter: none;
  }

  &:after {
    content: '';
    width: 0px;
    height: 0px;
    position: absolute;
    border-left: 6px solid transparent;
    border-right: 6px solid transparent;
    border-bottom: 6px solid ${({ theme: t }) => t.background.neutral};
    bottom: 99%;
    left: 18px;
  }
`, D3 = tt.div`
  display: flex;
  flex-direction: column;
  align-items: center;
  border-bottom: 1px solid ${kh(8)};
`, j3 = tt.div`
  display: flex;
  align-items: center;
  flex-direction: row;
  width: 100%;
`, M3 = tt.button`
  padding: 0;
  margin-left: auto;
  border: none;
  cursor: pointer;
  background: none;
`, F3 = tt.div`
  display: flex;
  align-items: center;
`, H3 = tt.div`
  display: flex;
  flex-direction: column;
  min-width: 0;
  max-width: 100%;
`, K1 = tt.div`
  white-space: nowrap;
  overflow: hidden;
  text-overflow: ellipsis;
  max-width: 100%;
`, B3 = tt.button`
  display: flex;
  position: relative;
  justify-content: center;
  align-items: center;
  cursor: pointer;
  transition: background 0.35s cubic-bezier(0.19, 1, 0.22, 1);
  padding: 16px;
  width: 100%;
  min-height: 48px;
  color: ${({ theme: t }) => t.pallete.nimbusNeutralBackground};
  background-color: ${({ theme: t }) => t.pallete.nimbusPrimaryInteractive};
  border: none;
  border-radius: 6px;
  font-size: 14px;
  font-weight: ${({ theme: t }) => t.fontWeight.medium};
  font-family: ${({ theme: t }) => t.fontFamily};

  &:hover,
  &:focus {
    background-color: ${({ theme: t }) => t.pallete.nimbusPrimaryInteractiveHover};
  }
  &:active {
    background-color: ${({ theme: t }) => t.pallete.nimbusPrimaryInteractivePressed};
  }

  &:disabled {
    cursor: not-allowed;
    opacity: 0.7;
  }
`, U3 = tt.div`
  display: flex;
  justify-content: center;
  align-items: center;
  height: 100%;
  padding: 8px;
  background: #f6f6f6;
  border-radius: 100%;
  border: 1px solid #e7e7e7;
`, Z1 = tt.path`
  fill: ${({ fill: t }) => t};
`, Ph = tt.svg`
  width: ${({ width: t }) => t};
  height: ${({ height: t }) => t};
`;
  tt(Ph)`
  position: absolute;
`;
  const $3 = {
    logoNuvem: {
      height: "13",
      width: "56",
      viewBoxMinX: "0",
      viewBoxMinY: "0",
      viewBoxWidth: "56",
      viewBoxHeight: "13",
      path: "M11.5591 0H11.5519C11.5519 0 11.5473 0 11.5447 0C9.84817 0.00263531 8.23206 0.668052 7.02575 1.84143C6.40842 1.57921 5.74301 1.44415 5.05585 1.44415C2.26769 1.44415 0 3.71184 0 6.5C0 9.28816 2.26769 11.5552 5.05519 11.5552C5.73181 11.5552 6.40118 11.4175 7.01982 11.1566C8.19121 12.2957 9.78887 13 11.5479 13C15.132 13 18.0479 10.084 18.0479 6.5C18.0479 2.91597 15.1379 0.00527063 11.5591 0ZM11.5479 11.5552C8.76044 11.5552 6.49275 9.2875 6.49275 6.5H5.0486C5.0486 7.77483 5.41886 8.96402 6.05529 9.96873C5.73181 10.0616 5.39515 10.111 5.05519 10.111C3.06421 10.111 1.44415 8.49164 1.44415 6.5C1.44415 4.50836 3.06355 2.88896 5.05519 2.88896C5.84381 2.88896 6.5929 3.138 7.22142 3.61038C8.13983 4.30017 8.66623 5.35364 8.66623 6.5H10.1104C10.1104 4.98733 9.45551 3.59127 8.30519 2.62741C9.2091 1.8691 10.3548 1.44547 11.5512 1.44415C14.3374 1.44613 16.6031 3.71316 16.6031 6.49934C16.6031 9.28553 14.3354 11.5552 11.5479 11.5552Z M23.3743 10.0794H22V4.27376H23.3743V5.04393C23.7413 4.48722 24.3342 4.13146 25.1512 4.13146C26.5729 4.13146 27.4024 5.06765 27.4024 6.58361V10.0787H26.0281V6.84451C26.0281 5.94389 25.5781 5.39904 24.7368 5.39904C23.8954 5.39904 23.3743 6.0269 23.3743 7.02239V10.0794Z M28.3702 7.57912V4.27378H29.7445V7.49611C29.7445 8.40858 30.1945 8.95343 30.9528 8.95343C31.7111 8.95343 32.1611 8.40858 32.1611 7.49611V4.27378H33.5354V7.57912C33.5354 9.24925 32.5637 10.221 30.9528 10.221C29.342 10.221 28.3702 9.24925 28.3702 7.57912Z M33.9261 4.27378H35.3828L36.935 8.30185L38.499 4.27378H39.9201L37.5273 10.0794H36.319L33.9261 4.27378Z M45.6407 7.17657C45.6407 5.43529 44.4443 4.13212 42.7504 4.13212C41.0566 4.13212 39.8002 5.43529 39.8002 7.17657C39.8002 8.91785 41.0559 10.221 42.8216 10.221C44.0536 10.221 44.9542 9.62873 45.4398 8.71625L44.3145 8.18326C43.9831 8.69253 43.5918 9.06016 42.8335 9.06016C41.9684 9.06016 41.222 8.4323 41.1627 7.59097H45.6295C45.6414 7.42495 45.6407 7.28264 45.6407 7.17657ZM41.1745 6.59614C41.2694 5.9327 41.9091 5.2574 42.7267 5.2574C43.5443 5.2574 44.184 5.82597 44.2789 6.59614H41.1745Z M47.7213 10.0794H46.347V4.27376H47.7213V5.04393C48.0415 4.48722 48.5864 4.13146 49.3796 4.13146C50.2209 4.13146 50.8251 4.534 51.1446 5.2093C51.4529 4.65259 52.1164 4.13146 53.0756 4.13146C54.4144 4.13146 55.1845 5.05579 55.1845 6.51246V10.0787H53.8102V6.77336C53.8102 5.92017 53.4195 5.38718 52.6968 5.38718C51.9741 5.38718 51.4648 5.99133 51.4529 6.93938V10.0787H50.0786V6.82079C50.0786 5.92017 49.6879 5.38718 48.9652 5.38718C48.2069 5.38718 47.7213 6.00319 47.7213 6.99868V10.0794Z"
    },
    logoNube: {
      height: "13",
      width: "48",
      viewBoxMinX: "0",
      viewBoxMinY: "0",
      viewBoxWidth: "48",
      viewBoxHeight: "13",
      path: "M11.5504 0H11.5432C11.5432 0 11.5386 0 11.5359 0C9.84074 0.00263531 8.22588 0.66805 7.02045 1.84142C6.40359 1.57921 5.73869 1.44415 5.05204 1.44415C2.26598 1.44415 0 3.71185 0 6.5C0 9.28818 2.26598 11.5552 5.05139 11.5552C5.7275 11.5552 6.39635 11.4175 7.01454 11.1566C8.18506 12.2957 9.78153 13 11.5393 13C15.1206 13 18.0344 10.084 18.0344 6.5C18.0344 2.91598 15.1265 0.00527064 11.5504 0ZM11.5393 11.5552C8.75388 11.5552 6.48786 9.28752 6.48786 6.5H5.04479C5.04479 7.77485 5.41477 8.96402 6.05074 9.96873C5.7275 10.0616 5.39107 10.1111 5.05139 10.1111C3.06191 10.1111 1.44306 8.4916 1.44306 6.5C1.44306 4.50837 3.06126 2.88895 5.05139 2.88895C5.83941 2.88895 6.58794 3.13801 7.21597 3.61037C8.13371 4.30019 8.65969 5.35364 8.65969 6.5H10.1028C10.1028 4.98734 9.4484 3.59128 8.29894 2.62741C9.20218 1.86909 10.347 1.44547 11.5425 1.44415C14.3266 1.44613 16.5906 3.71315 16.5906 6.49935C16.5906 9.28551 14.3246 11.5552 11.5393 11.5552Z M21.9937 10.1264H23.3737V7.05477C23.3737 6.05474 23.921 5.42378 24.7418 5.42378C25.5864 5.42378 26.0385 5.9714 26.0385 6.87622V10.1264H27.4184V6.61427C27.4184 5.09041 26.5857 4.14991 25.1581 4.14991C24.3373 4.14991 23.7425 4.50706 23.3737 5.0666V4.29278H21.9937V10.1264Z M30.9496 10.2692C32.5672 10.2692 33.5428 9.29298 33.5428 7.6143V4.29277H32.1629V7.53096C32.1629 8.44772 31.7108 8.99535 30.9496 8.99535C30.1882 8.99535 29.7359 8.44772 29.7359 7.53096V4.29277H28.3561V7.6143C28.3561 9.29298 29.3316 10.2692 30.9496 10.2692Z M34.594 10.1264H35.9622V9.32867C36.3904 9.93583 37.1279 10.2692 37.9369 10.2692C39.5429 10.2692 40.78 8.92391 40.78 7.20954C40.78 5.45946 39.5429 4.14991 37.9369 4.14991C37.1279 4.14991 36.3904 4.51897 35.9622 5.12612V1.79265H34.594V10.1264ZM39.4001 7.20954C39.4001 8.20956 38.6389 9.01914 37.6514 9.01914C36.6639 9.01914 35.9026 8.20956 35.9026 7.20954C35.9026 6.20951 36.6639 5.39993 37.6514 5.39993C38.6389 5.39993 39.4001 6.20951 39.4001 7.20954Z M46.7977 8.75725L45.6675 8.22153C45.3344 8.73347 44.9419 9.10247 44.1806 9.10247C43.312 9.10247 42.5626 8.47151 42.503 7.62626H46.988C46.9999 7.4596 47 7.31672 47 7.20954C47 5.45947 45.7983 4.14991 44.0972 4.14991C42.4199 4.14991 41.1351 5.45947 41.1351 7.20954C41.1351 9.00724 42.3961 10.2692 44.1687 10.2692C45.4059 10.2692 46.3099 9.67395 46.7977 8.75725ZM45.6317 6.62616H42.515C42.6103 5.95951 43.2524 5.28091 44.0734 5.28091C44.9181 5.28091 45.5367 5.85235 45.6317 6.62616Z"
    }
  }, z3 = {
    AR: "logoNube",
    BR: "logoNuvem",
    MX: "logoNube"
  }, X1 = ({ fill: t, width: e, height: n }) => {
    const i = z3[ne.getCountry()], s = $3[i || "logoNuvem"], { viewBoxMinX: a, viewBoxMinY: u, viewBoxWidth: d, viewBoxHeight: f, path: p } = s, m = s.width, v = s.height;
    return /* @__PURE__ */ O.jsx(
      Ph,
      {
        xmlns: "http://www.w3.org/2000/svg",
        width: e ?? m,
        height: n ?? v,
        viewBox: `${a} ${u} ${d} ${f}`,
        fill: t ?? "currentColor",
        children: /* @__PURE__ */ O.jsx(Z1, { d: p, fill: t })
      }
    );
  }, la = tt.span`
  font-size: ${({ theme: t, size: e = "medium" }) => t.fontSize[e]};
  font-weight: ${({ weight: t = "medium", theme: e }) => e.fontWeight[t]};
  font-family: ${({ theme: t }) => t.fontFamily};
`, rn = tt.div`
  margin: ${({ mt: t = 0, mr: e = 0, ml: n = 0, mb: i = 0 }) => `${t}px ${e}px ${i}px ${n}px`};
`, V3 = ({
    width: t = 24,
    height: e = 24
  }) => /* @__PURE__ */ O.jsxs(
    "svg",
    {
      width: t,
      height: e,
      viewBox: "0 0 14 14",
      fill: "none",
      xmlns: "http://www.w3.org/2000/svg",
      "data-testid": "person-icon",
      "aria-hidden": "true",
      children: [
        /* @__PURE__ */ O.jsx("g", { clipPath: "url(#clip0_2305_8309)", children: /* @__PURE__ */ O.jsx(
          "path",
          {
            d: "M6.99993 6.99999C8.2891 6.99999 9.33327 5.95583 9.33327 4.66666C9.33327 3.37749 8.2891 2.33333 6.99993 2.33333C5.71077 2.33333 4.6666 3.37749 4.6666 4.66666C4.6666 5.95583 5.71077 6.99999 6.99993 6.99999ZM6.99993 8.16666C5.44243 8.16666 2.33327 8.94833 2.33327 10.5V11.0833C2.33327 11.4042 2.59577 11.6667 2.9166 11.6667H11.0833C11.4041 11.6667 11.6666 11.4042 11.6666 11.0833V10.5C11.6666 8.94833 8.55743 8.16666 6.99993 8.16666Z",
            fill: "#5E6163"
          }
        ) }),
        /* @__PURE__ */ O.jsx("defs", { children: /* @__PURE__ */ O.jsx("clipPath", { id: "clip0_2305_8309", children: /* @__PURE__ */ O.jsx("rect", { width: "14", height: "14", fill: "white" }) }) })
      ]
    }
  ), J1 = ({ fill: t = "currentColor" }) => /* @__PURE__ */ O.jsx(
    "svg",
    {
      width: "16",
      height: "16",
      viewBox: "0 0 16 16",
      fill: t,
      xmlns: "http://www.w3.org/2000/svg",
      children: /* @__PURE__ */ O.jsx(
        "path",
        {
          d: "M12.8075 4.45207L12.1925 3.74707L8 7.37707L3.8075 3.74707L3.1925 4.45207L7.2875 7.99957L3.1925 11.5471L3.8075 12.2521L8 8.62207L12.1925 12.2521L12.8075 11.5471L8.7125 7.99957L12.8075 4.45207Z",
          fill: t
        }
      )
    }
  );
  J1.defaultProps = {
    fill: "currentColor"
  };
  const W3 = P3`
  0% { transform: rotate(0deg); }
  100% { transform: rotate(360deg); }
`, Ih = tt.span`
  position: ${({ absolute: t }) => t ?? "absolute"};
  display: inline-block;
  width: ${({ size: t }) => t ?? "16px"};
  height: ${({ size: t }) => t ?? "16px"};
  border: 3px solid ${({ theme: t }) => t.pallete.nimbusNeutralBackground};
  border-bottom-color: transparent;
  border-radius: 50%;
  box-sizing: border-box;
  animation: ${W3} 1s linear infinite;
`, G3 = ({ user: t, onLogin: e }) => {
    const { t: n } = or(), [i, s] = N.useState(!0), [a, u] = N.useState(!1), d = (p) => {
      p.preventDefault(), s(!1);
    }, f = async () => {
      if (!a) {
        u(!0);
        try {
          await e();
        } finally {
          u(!1);
        }
      }
    };
    return /* @__PURE__ */ O.jsx(O.Fragment, { children: i && /* @__PURE__ */ O.jsxs(N3, { children: [
      /* @__PURE__ */ O.jsxs(D3, { children: [
        /* @__PURE__ */ O.jsx(rn, { mt: 12 }),
        /* @__PURE__ */ O.jsxs(j3, { children: [
          /* @__PURE__ */ O.jsx(rn, { ml: 16 }),
          /* @__PURE__ */ O.jsx(
            X1,
            {
              height: n("loginPanel.logo.height"),
              width: n("loginPanel.logo.width"),
              fill: q1.pallete.nimbusPrimaryInteractive
            }
          ),
          /* @__PURE__ */ O.jsx(rn, { mr: 8 }),
          /* @__PURE__ */ O.jsx(la, { weight: "book", size: "xSmall", children: n("loginPanel.header.text") }),
          /* @__PURE__ */ O.jsx(
            M3,
            {
              "data-testid": "close-login-button",
              onClick: d,
              children: /* @__PURE__ */ O.jsx(J1, {})
            }
          ),
          /* @__PURE__ */ O.jsx(rn, { mr: 16 })
        ] }),
        /* @__PURE__ */ O.jsx(rn, { mb: 12 })
      ] }),
      /* @__PURE__ */ O.jsxs(rn, { mr: 16, ml: 16, mb: 16, mt: 12, children: [
        /* @__PURE__ */ O.jsxs(F3, { children: [
          /* @__PURE__ */ O.jsx(U3, { children: /* @__PURE__ */ O.jsx(V3, { width: 14, height: 14 }) }),
          /* @__PURE__ */ O.jsx(rn, { mr: 8 }),
          /* @__PURE__ */ O.jsxs(H3, { children: [
            /* @__PURE__ */ O.jsx(K1, { children: /* @__PURE__ */ O.jsxs(la, { weight: "medium", size: "xSmall", children: [
              i1(t.first_name),
              " ",
              i1(t.last_name)
            ] }) }),
            /* @__PURE__ */ O.jsx(rn, { mb: 2 }),
            /* @__PURE__ */ O.jsx(K1, { children: /* @__PURE__ */ O.jsx(la, { weight: "book", size: "xSmall", children: t.email }) })
          ] })
        ] }),
        /* @__PURE__ */ O.jsx(rn, { mb: 24 }),
        /* @__PURE__ */ O.jsx(
          B3,
          {
            role: "button",
            onClick: f,
            disabled: a,
            children: a ? /* @__PURE__ */ O.jsx(Ih, {}) : n("loginPanel.button.text")
          }
        )
      ] })
    ] }) });
  };
  class q3 {
    constructor() {
      this.rootId = "wallet-login-panel", this.root = null, this.onLoginCallback = null;
    }
    setUser(e) {
      this.user = e;
    }
    hide() {
      var e;
      (e = this.root) == null || e.unmount();
    }
    show() {
      this.root = this.buildRoot(), I3(
        /* @__PURE__ */ O.jsx(G3, { onLogin: this.onLoginCallback, user: this.user }),
        this.root
      );
    }
    onLogin(e) {
      this.onLoginCallback = e;
    }
    buildRoot() {
      var n, i;
      const e = document.getElementById(this.rootId) ?? document.createElement("div");
      return e.id = this.rootId, (i = (n = document.querySelector('#login-form input[name="email"]')) == null ? void 0 : n.parentNode) == null || i.append(e), uh(e);
    }
  }
  class Y3 {
    constructor() {
      this.client = new $o.Client();
    }
    async verifyUserExist(e) {
      const { data: n } = await this.client.makeRequest(
        "POST",
        "/v1/users/registered/storefront",
        {
          email: e,
          store_id: Number(ne.getStoreId())
        },
        {},
        { public: !0 }
      );
      return n;
    }
  }
  var K3 = { chrome: "Google Chrome", brave: "Brave", crios: "Google Chrome", edge: "Microsoft Edge", edg: "Microsoft Edge", edgios: "Microsoft Edge", fennec: "Mozilla Firefox", jsdom: "JsDOM", mozilla: "Mozilla Firefox", fxios: "Mozilla Firefox", msie: "Microsoft Internet Explorer", opera: "Opera", opios: "Opera", opr: "Opera", opt: "Opera", rv: "Microsoft Internet Explorer", safari: "Safari", samsungbrowser: "Samsung Browser", electron: "Electron" }, Z3 = { android: "Android", androidTablet: "Android Tablet", cros: "Chrome OS", fennec: "Android Tablet", ipad: "IPad", ipod: "IPod", iphone: "IPhone", jsdom: "JsDOM", linux: "Linux", mac: "Macintosh", tablet: "Android Tablet", win: "Windows", "windows phone": "Windows Phone", xbox: "Microsoft Xbox" }, X3 = (t, e = -1) => {
    let n = new RegExp(`^-?\\d+(?:.\\d{0,${e}})?`), i = Number(t).toString().match(n);
    return i ? i[0] : null;
  }, J3 = { toFixed: X3 }, Q3 = "4.1.0", Q1 = () => typeof window < "u" ? window.navigator : null, eA = class {
    constructor(t) {
      PE(this, "userAgent");
      var e;
      this.userAgent = t || ((e = Q1()) == null ? void 0 : e.userAgent) || null;
    }
    static get VERSION() {
      return Q3;
    }
    parseUserAgent(t) {
      var V;
      let e = {}, n = t || this.userAgent || "", i = n.toLowerCase().replace(/\s\s+/g, " "), s = /(edge)\/([\w.]+)/.exec(i) || /(edg)[/]([\w.]+)/.exec(i) || /(opr)[/]([\w.]+)/.exec(i) || /(opt)[/]([\w.]+)/.exec(i) || /(fxios)[/]([\w.]+)/.exec(i) || /(edgios)[/]([\w.]+)/.exec(i) || /(jsdom)[/]([\w.]+)/.exec(i) || /(samsungbrowser)[/]([\w.]+)/.exec(i) || /(electron)[/]([\w.]+)/.exec(i) || /(chrome)[/]([\w.]+)/.exec(i) || /(crios)[/]([\w.]+)/.exec(i) || /(opios)[/]([\w.]+)/.exec(i) || /(version)(applewebkit)[/]([\w.]+).*(safari)[/]([\w.]+)/.exec(i) || /(webkit)[/]([\w.]+).*(version)[/]([\w.]+).*(safari)[/]([\w.]+)/.exec(i) || /(applewebkit)[/]([\w.]+).*(safari)[/]([\w.]+)/.exec(i) || /(webkit)[/]([\w.]+)/.exec(i) || /(opera)(?:.*version|)[/]([\w.]+)/.exec(i) || /(msie) ([\w.]+)/.exec(i) || /(fennec)[/]([\w.]+)/.exec(i) || i.indexOf("trident") >= 0 && /(rv)(?::| )([\w.]+)/.exec(i) || i.indexOf("compatible") < 0 && /(mozilla)(?:.*? rv:([\w.]+)|)/.exec(i) || [], a = /(ipad)/.exec(i) || /(ipod)/.exec(i) || /(iphone)/.exec(i) || /(jsdom)/.exec(i) || /(windows phone)/.exec(i) || /(xbox)/.exec(i) || /(win)/.exec(i) || /(tablet)/.exec(i) || /(android)/.test(i) && /(mobile)/.test(i) === !1 && ["androidTablet"] || /(android)/.exec(i) || /(mac)/.exec(i) || /(linux)/.exec(i) || /(cros)/.exec(i) || [], u = s[5] || s[3] || s[1] || null, d = a[0] || null, f = s[4] || s[2] || null, p = Q1();
      u === "chrome" && typeof ((V = p == null ? void 0 : p.brave) == null ? void 0 : V.isBrave) == "function" && (u = "brave"), u && (e[u] = !0), d && (e[d] = !0);
      let m = !!(e.tablet || e.android || e.androidTablet), v = !!(e.ipad || e.tablet || e.androidTablet), y = !!(e.android || e.androidTablet || e.tablet || e.ipad || e.ipod || e.iphone || e["windows phone"]), E = !!(e.cros || e.mac || e.linux || e.win), S = !!(e.brave || e.chrome || e.crios || e.opr || e.safari || e.edg || e.electron), x = !!(e.msie || e.rv), C = !!(e.chrome || e.crios), L = !!(e.fxios || e.fennec || e.mozilla), k = !!e.safari, I = !!(e.opera || e.opios || e.opr || e.opt), B = !!(e.edg || e.edge || e.edgios);
      return { name: K3[u] ?? null, platform: Z3[d] ?? null, userAgent: n, version: f, shortVersion: f ? J3.toFixed(parseFloat(f), 2) : null, isAndroid: m, isTablet: v, isMobile: y, isDesktop: E, isWebkit: S, isIE: x, isChrome: C, isFireFox: L, isSafari: k, isOpera: I, isEdge: B };
    }
    getBrowserInfo() {
      let t = this.parseUserAgent();
      return { name: t.name, platform: t.platform, userAgent: t.userAgent, version: t.version, shortVersion: t.shortVersion };
    }
  };
  function ua(t) {
    window.location.href = t;
  }
  const tA = () => {
    const e = new eA(window.navigator.userAgent).parseUserAgent();
    return `${e.name ?? "Unknown"} - ${e.isMobile ? "Mobile" : "Desktop"} - ${e.shortVersion ?? "Unknown Version"} - ${e.platform}`;
  }, ew = (t, e) => !t || !e ? null : `${t} ${e}`, tw = (t) => t.split(" ").map((e) => e.length <= 2 ? e : `${e[0]}${"*".repeat(e.length - 2)}${e[e.length - 1]}`).join(" ");
  var nA = { BASE_URL: "/", MODE: "production", DEV: !1, PROD: !0, SSR: !1 }, rA = Object.defineProperty, iA = Object.getOwnPropertyDescriptor, oA = (t, e, n, i) => {
    for (var s = i > 1 ? void 0 : i ? iA(e, n) : e, a = t.length - 1, u; a >= 0; a--)
      (u = t[a]) && (s = (i ? u(e, n, s) : u(s)) || s);
    return i && s && rA(e, n, s), s;
  };
  let Nh = class extends Tr {
    constructor(t) {
      super(t), this.storesApi = new wu(), this.loginPanel = new q3(), this.userApi = new Y3(), this.sessionData = this.appProps.sessionService.getSessionData(), this.eventReporter = oa.createEventReporter(), this.otpModal = oa.createOTPModal({
        reOpener: {
          // We don't want to open the login panel again after the user closes the OTP modal
          // So we return null and don't call the open method
          open: () => null,
          close: this.loginPanel.hide.bind(this.loginPanel)
        },
        flow: "emailOnly",
        fadeInDuration: nA.VITE_ENV === "test" ? 0 : 500,
        focusedInput: ne.getLoginInput()
      }), this.otpModal.onLogin(this.onLogin.bind(this)), this.otpModal.onError(this.onError.bind(this)), this.emailInputHandler = oa.createEmailInputHandler(
        this.userApi
      );
    }
    async handle() {
      this.attachEmailInputHandler(), this.sessionData.status === "logged" && await this.handleLoggedUser();
    }
    attachEmailInputHandler() {
      this.emailInputHandler.attachTo(
        document.querySelector("#login-form")
      ), this.emailInputHandler.subscribeTo(
        "userWithConsent",
        this.onOpenLoginModal.bind(this)
      ), this.emailInputHandler.subscribeTo(
        "nonExistingUser",
        this.loginPanel.hide.bind(this.loginPanel)
      ), this.emailInputHandler.subscribeTo(
        "onInput",
        this.loginPanel.hide.bind(this.loginPanel)
      );
    }
    async onOpenLoginModal(t) {
      try {
        await this.otpModal.startLoginFlow({
          userRegisteredResult: {
            ...t,
            email: ne.getLoginInputEmail()
          }
        });
      } catch (e) {
        this.onError(e);
      }
    }
    async onLogin() {
      try {
        const { token: t } = await this.appProps.api.exchangeToken();
        await this.storesApi.loginWithWallet(t), ua("/account");
      } catch (t) {
        this.onError(t);
      }
    }
    onError(t) {
      this.appProps.errorHandler.reportError("Error on login", {
        error: JSON.stringify(t, Object.getOwnPropertyNames(t))
      });
    }
    async handleLoggedUser() {
      const t = await this.userApi.verifyUserExist(
        this.sessionData.user.email
      );
      if (!t.registered)
        return;
      let { user: e } = this.sessionData;
      e.email_confirmed_at ? this.loginPanel.onLogin(this.onLoggedUserLogin.bind(this)) : (e = {
        ...e,
        email: e.email,
        first_name: tw(e.first_name),
        last_name: tw(e.last_name)
      }, this.loginPanel.onLogin(this.onEmailValidationFlow.bind(this, t))), this.loginPanel.setUser(e), this.eventReporter.registerCustomIdentification(), this.loginPanel.show();
    }
    async onEmailValidationFlow(t) {
      this.otpModal.onLogin(this.onEmailValidationLogin.bind(this)), this.loginPanel.onLogin(this.onEmailValidationFlow.bind(this, t));
      const { user: e } = this.sessionData;
      await this.otpModal.startEmailValidationFlow({
        userRegisteredResult: e
      }), this.eventReporter.registerOTPReceived();
    }
    async onEmailValidationLogin() {
      await this.onLogin(), this.eventReporter.registerCustomerLogin(
        this.sessionData.user
      );
    }
    async onLoggedUserLogin() {
      await this.onLogin(), this.eventReporter.registerOTPReceived(), this.eventReporter.registerCustomerLogin(
        this.sessionData.user
      );
    }
  };
  Nh = oA([
    lh("account.login")
  ], Nh);
  const sA = Nh;
  var aA = Object.defineProperty, lA = Object.getOwnPropertyDescriptor, uA = (t, e, n, i) => {
    for (var s = i > 1 ? void 0 : i ? lA(e, n) : e, a = t.length - 1, u; a >= 0; a--)
      (u = t[a]) && (s = (i ? u(e, n, s) : u(s)) || s);
    return i && s && aA(e, n, s), s;
  };
  let ca = class extends Tr {
    async handle() {
      await this.reportEventWalletCartIdentification();
    }
    async reportEventWalletCartIdentification() {
      try {
        const t = ne.getCartId();
        ca.hasEventBeenSent(
          t,
          "WALLET_CART_IDENTIFICATION"
        ) || (await this.appProps.eventService.registerEventWalletCartIdentificationOrFail(
          t
        ), ca.saveEventSent(
          t,
          "WALLET_CART_IDENTIFICATION"
        ));
      } catch (t) {
        this.appProps.errorHandler.reportException(t);
      }
    }
    static hasEventBeenSent(t, e) {
      const n = window.localStorage.getItem(e);
      return n && n === t;
    }
    static saveEventSent(t, e) {
      window.localStorage.setItem(e, t);
    }
  };
  ca = uA([
    yu({ userLogged: !0 })
  ], ca);
  const cA = ca, dA = tt.div.attrs({
    role: "separator"
  })`
  &&& {
    margin-bottom: ${({ marginBottom: t, theme: e }) => t ?? e.spacing.xMedium};
    margin-top: ${({ marginTop: t, theme: e }) => t ?? e.spacing.xMedium};
    width: ${({ width: t }) => t ?? "100%"};
  }
`, fA = ({
    height: t = "24",
    width: e = "24",
    fill: n = "currentColor"
  }) => /* @__PURE__ */ O.jsxs(
    Ph,
    {
      xmlns: "http://www.w3.org/2000/svg",
      width: e,
      height: t,
      fill: n,
      children: [
        /* @__PURE__ */ O.jsx("rect", { width: "24", height: "24", rx: "12", fill: "#0059D5" }),
        /* @__PURE__ */ O.jsx(
          Z1,
          {
            fillRule: "evenodd",
            clipRule: "evenodd",
            d: "M9.74956 9C9.74956 8.40326 9.98661 7.83097 10.4086 7.40901C10.8305 6.98705 11.4028 6.75 11.9996 6.75C12.5963 6.75 13.1686 6.98705 13.5905 7.40901C14.0125 7.83097 14.2496 8.40326 14.2496 9C14.2496 9.59674 14.0125 10.169 13.5905 10.591C13.1686 11.0129 12.5963 11.25 11.9996 11.25C11.4028 11.25 10.8305 11.0129 10.4086 10.591C9.98661 10.169 9.74956 9.59674 9.74956 9ZM7.87506 16.0525C7.89192 14.9697 8.33388 13.937 9.10554 13.1773C9.8772 12.4176 10.9167 11.9917 11.9996 11.9917C13.0825 11.9917 14.1219 12.4176 14.8936 13.1773C15.6652 13.937 16.1072 14.9697 16.1241 16.0525C16.1254 16.1254 16.1054 16.1971 16.0666 16.2588C16.0278 16.3205 15.9718 16.3696 15.9056 16.4C14.6801 16.9619 13.3476 17.2518 11.9996 17.25C10.6066 17.25 9.28306 16.946 8.09356 16.4C8.0273 16.3696 7.97135 16.3205 7.93254 16.2588C7.89373 16.1971 7.87376 16.1254 7.87506 16.0525Z",
            fill: "#fff"
          }
        )
      ]
    }
  ), hA = tt.div`
  display: flex;
  flex-direction: column;
  align-items: flex-start;
  align-self: stretch;
  padding: ${({ padding: t }) => t};
  background: transparent;
  margin: ${({ margin: t }) => t};
`, pA = tt.div`
  display: flex;
  align-items: center;
  margin-bottom: 2px;
`, mA = tt.div`
  display: flex;
  align-items: center;
`, nw = ({
    email: t,
    margin: e = "0px",
    padding: n = "0px",
    showDivider: i = !0,
    ...s
  }) => {
    const { t: a } = or();
    return /* @__PURE__ */ O.jsxs(hA, { "data-testid": s["data-testid"], margin: e, padding: n, children: [
      /* @__PURE__ */ O.jsxs(pA, { children: [
        /* @__PURE__ */ O.jsx(la, { weight: "medium", size: "small", children: a("emailPanel.header.text") }),
        /* @__PURE__ */ O.jsx(rn, { mr: 4 }),
        /* @__PURE__ */ O.jsx(X1, {})
      ] }),
      /* @__PURE__ */ O.jsx(rn, { mt: 4, mb: 4 }),
      /* @__PURE__ */ O.jsxs(mA, { children: [
        /* @__PURE__ */ O.jsx(fA, {}),
        /* @__PURE__ */ O.jsx(rn, { mr: 8 }),
        /* @__PURE__ */ O.jsx(la, { size: "xSmall", weight: "medium", children: t })
      ] }),
      i && /* @__PURE__ */ O.jsx(dA, { className: "divider" })
    ] });
  };
  nw.defaultProps = {
    email: void 0
  };
  const Dh = ({ margin: t, padding: e, email: n, showDivider: i, ...s }, a) => {
    Ah(
      /* @__PURE__ */ O.jsx(
        nw,
        {
          "data-testid": s["data-testid"],
          margin: t,
          padding: e,
          email: n,
          showDivider: i
        }
      ),
      a
    );
  }, Ee = {
    IDEA: "idea",
    TREND: "trend",
    AMAZONAS: "amazonas",
    RIO: "rio",
    CALI: "cali",
    LIMA: "lima",
    CUBO: "cubo",
    BAIRES: "baires",
    RECIFE: "recife",
    MORELIA: "morelia",
    UYUNI: "uyuni",
    TOLUCA: "toluca",
    GUADALAJARA: "guadalajara",
    STYLE: "style",
    LUXURY: "luxury",
    ZEN: "zen",
    BAHIA: "bahia",
    MATERIAL: "material",
    BRASILIA: "brasilia",
    NEW_LINKEDMAN: "new_linkedman",
    ATLANTICO: "atlantico",
    FLEX: "flex"
  };
  class jh {
    constructor() {
      this.themeCustomSelectorsList = [
        Ee.ATLANTICO,
        Ee.STYLE
      ];
    }
    createOrGetContainerEmailPanel() {
      const e = document.getElementById(this.getContainerId());
      if (e)
        return e;
      const n = document.createElement("div");
      return n.setAttribute("id", this.getContainerId()), n;
    }
    hasThemeWithCustomSelectors() {
      return this.themeCustomSelectorsList.includes(ne.getThemeCode());
    }
    appendEmailPanelContainer() {
      this.hasThemeWithCustomSelectors() ? ne.getThemeCode() === Ee.STYLE ? this.appendEmailPanelContainerForStyleTheme() : this.appendEmailPanelContainerForAtlanticoTheme() : this.appendEmailPanelContainerForCommonThemes();
    }
  }
  class gA extends jh {
    constructor() {
      super(...arguments), this.SELECTOR_CONTAINER_BUTTONS_MODAL_TEMPLATE = "#modal-cart .js-ajax-cart-submit, form#ajax-cart-details.js-ajax-cart-panel .js-ajax-cart-submit", this.themeStyleConditionsList = [
        Ee.AMAZONAS,
        Ee.CUBO,
        Ee.ATLANTICO
      ], this.SELECTORS_HEADER_MODAL = [
        '[data-store="cart-form"] > .modal-header, .modal-right-header',
        ".js-modal-close.js-fullscreen-modal-close.modal-header",
        // see stores 188770, 1249495
        ".component_drawer_header"
        // see store 4522458
      ];
    }
    render(e) {
      if (this.isModalHoverTemplate())
        return;
      this.appendEmailPanelContainer();
      const { margin: n, padding: i } = this.getStyles();
      Dh(
        {
          "data-testid": "email-panel-modal-cart",
          margin: n,
          padding: i,
          email: e
        },
        this.getContainerId()
      );
    }
    appendEmailPanelContainerForCommonThemes() {
      const e = this.createOrGetContainerEmailPanel(), n = this.SELECTORS_HEADER_MODAL.map(
        (s) => document.querySelector(s)
      ).find((s) => s !== null), i = n.nextElementSibling;
      i != null && i.classList.contains("js-toggle-cart") ? i == null || i.after(e) : n == null || n.after(e);
    }
    appendEmailPanelContainerForAtlanticoTheme() {
      const e = this.createOrGetContainerEmailPanel(), n = document.querySelector(".cart-body");
      n.insertBefore(
        e,
        n.firstChild
      );
    }
    appendEmailPanelContainerForStyleTheme() {
      this.appendEmailPanelContainerForCommonThemes();
    }
    hasThemeWithConditions() {
      return this.themeStyleConditionsList.includes(ne.getThemeCode());
    }
    getStyleThemesWithConditions() {
      return ne.getThemeCode() === Ee.ATLANTICO ? {
        margin: "8px 0px 24px 0px",
        padding: "0px 20px 0px 20px"
      } : {
        margin: "0px",
        padding: "0px"
      };
    }
    getStyles() {
      return this.hasThemeWithConditions() ? this.getStyleThemesWithConditions() : {
        margin: "8px 0px 0px 0px",
        padding: "2px 15px 2px 15px"
      };
    }
    isModalHoverTemplate() {
      const e = document.querySelector(
        this.SELECTOR_CONTAINER_BUTTONS_MODAL_TEMPLATE
      );
      return ne.getThemeCode() === Ee.CUBO && !e;
    }
    getContainerId() {
      return "emailPanelCart";
    }
  }
  class vA extends jh {
    render(e) {
      this.appendEmailPanelContainer();
      const { margin: n } = this.getStyles();
      Dh(
        {
          "data-testid": "email-panel-page-cart",
          margin: n,
          email: e
        },
        this.getContainerId()
      );
    }
    appendEmailPanelContainerForAtlanticoTheme() {
      var i;
      const e = this.createOrGetContainerEmailPanel(), n = (i = document.querySelector(".page-header")) == null ? void 0 : i.firstElementChild;
      n == null || n.append(e);
    }
    appendEmailPanelContainerForStyleTheme() {
      this.appendEmailPanelContainerForCommonThemes();
    }
    appendEmailPanelContainerForCommonThemes() {
      const e = this.createOrGetContainerEmailPanel(), n = document.querySelector('[data-store="cart-form"]');
      n == null || n.insertBefore(e, n.firstChild);
    }
    getStyles() {
      return ne.getThemeCode() === Ee.ATLANTICO ? {
        margin: "16px 0px 0px 0px",
        padding: "0px"
      } : {
        margin: "0px 0px 24px 0px",
        padding: "0px"
      };
    }
    getContainerId() {
      return "emailPanelCart";
    }
  }
  var yA = Object.defineProperty, wA = Object.getOwnPropertyDescriptor, SA = (t, e, n, i) => {
    for (var s = i > 1 ? void 0 : i ? wA(e, n) : e, a = t.length - 1, u; a >= 0; a--)
      (u = t[a]) && (s = (i ? u(e, n, s) : u(s)) || s);
    return i && s && yA(e, n, s), s;
  };
  let Mh = class extends Tr {
    constructor() {
      super(...arguments), this.modalTemplateEmailPanelRenderer = new gA(), this.pageTemplateEmailPanelRenderer = new vA();
    }
    handle() {
      const { email: t } = this.appProps.sessionService.getSessionData().user;
      ne.isPageCart() ? this.addToPageCart(t) : ne.isModalCartEnabled() && this.addToModalCart(t);
    }
    addToModalCart(t) {
      this.modalTemplateEmailPanelRenderer.render(t);
    }
    addToPageCart(t) {
      this.pageTemplateEmailPanelRenderer.render(t);
    }
  };
  Mh = SA([
    yu({ userLogged: !0 })
  ], Mh);
  const EA = Mh, Jh = class Jh {
  };
  Jh.getMainAddressByCountry = (e, n) => {
    const i = e.filter(
      (s) => s.country === n
    );
    return i.find((s) => s.main) ?? i[0] ?? null;
  };
  let Fh = Jh;
  var xA = Object.defineProperty, bA = Object.getOwnPropertyDescriptor, CA = (t, e, n, i) => {
    for (var s = i > 1 ? void 0 : i ? bA(e, n) : e, a = t.length - 1, u; a >= 0; a--)
      (u = t[a]) && (s = (i ? u(e, n, s) : u(s)) || s);
    return i && s && xA(e, n, s), s;
  };
  let Hh = class extends Tr {
    async handle() {
      try {
        const t = ne.hasShippingCalculator();
        if (!ne.hasZipcode() && t) {
          const n = Fh.getMainAddressByCountry(
            this.appProps.sessionService.getSessionData().user.address,
            ne.getCountry()
          );
          n && await this.autocompleteZipcode(n);
        }
      } catch (t) {
        this.appProps.errorHandler.reportException(
          t,
          "Error trying to autocomplete zipcode"
        );
      } finally {
        await this.appProps.storefrontHandler.publishInternalEvent(
          "WALLET_ZIPCODE_FILLER_FINISHED"
        );
      }
    }
    async autocompleteZipcode(t) {
      ne.updateZipcodeAndLoadShippingOptions(
        t.zipcode,
        this.appProps.jquery
      ), await this.appProps.eventService.registerEventWalletCartZipcode(
        ne.getCartId(),
        "autocompleted"
      );
    }
  };
  Hh = CA([
    yu({ userLogged: !0 })
  ], Hh);
  const TA = Hh;
  class OA {
    constructor(e, n, i) {
      this.user = e, this.mainAddress = n, this.externalCartId = i;
    }
    buildRequestData() {
      const e = {
        first_name: this.mainAddress.first_name,
        last_name: this.mainAddress.last_name,
        address: this.mainAddress.address,
        number: this.mainAddress.number,
        floor: this.mainAddress.floor,
        locality: this.mainAddress.locality,
        city: this.mainAddress.city,
        state: this.mainAddress.state,
        zipcode: this.mainAddress.zipcode,
        country: this.mainAddress.country,
        phone: this.getContactPhone(),
        between_streets: this.mainAddress.between_streets,
        reference: this.mainAddress.reference
      };
      return {
        data: {
          shipping_address: e,
          billing_address: {
            ...e,
            identification_number: this.user.identification_number
          },
          contact: {
            email: this.user.email,
            name: ew(this.user.first_name, this.user.last_name) ?? ew(
              this.mainAddress.first_name,
              this.mainAddress.last_name
            ),
            phone: this.getContactPhone()
          }
        },
        params: {
          external_store_id: ne.getStoreId(),
          external_cart_id: this.externalCartId
        }
      };
    }
    getContactPhone() {
      return this.mainAddress.phone ?? this.user.phone;
    }
  }
  var _A = Object.defineProperty, RA = Object.getOwnPropertyDescriptor, LA = (t, e, n, i) => {
    for (var s = i > 1 ? void 0 : i ? RA(e, n) : e, a = t.length - 1, u; a >= 0; a--)
      (u = t[a]) && (s = (i ? u(e, n, s) : u(s)) || s);
    return i && s && _A(e, n, s), s;
  };
  let Mt = class extends Tr {
    async handle() {
      try {
        const { user: t } = this.appProps.sessionService.getSessionData(), e = ne.getCartId();
        if (!e)
          return;
        const n = ne.hasShippingCalculator(), i = ne.hasZipcode(), s = await this.appProps.storeFeaturesService.storeHas("checkoutRedirect"), a = Mt.isCartEligibleForAutocomplete(e);
        if (n && i && s && a) {
          const u = t.address.find(
            (d) => d.zipcode === ne.getZipcode()
          );
          u && await this.autocompleteCart(t, u, e);
        }
      } catch (t) {
        this.reportError(t);
      }
    }
    async autocompleteCart(t, e, n) {
      var a;
      const i = new OA(
        t,
        e,
        n
      ).buildRequestData(), { id: s } = await new wu().getCartSession();
      if (!s) {
        await this.appProps.api.registerLog(
          "Autocomplete skipped. No Cart in session",
          {
            storefrontCartId: n,
            windowCartId: ne.getStorefrontCartId(),
            windowCartPresent: !!ne.getStorefrontCartId()
          }
        );
        return;
      }
      await this.appProps.api.registerLog("Trying to autocomplete cart", {
        storefrontCartId: n,
        sessionCartId: s,
        mismatch: s.toString() !== n.toString()
      }), i.params.external_cart_id = s ?? n, await this.appProps.api.autocompleteCart(i), Mt.setCartHasBeenAutocompleted(
        i.params.external_cart_id
      ), await this.appProps.api.registerLog("Cart autocompleted successfully", {
        email: i.data.contact.email,
        zipcode: (a = i.data.shipping_address) == null ? void 0 : a.zipcode,
        cartId: n,
        hasCartAutocompleteSucceeded: Mt.hasCartAutocompleteSucceeded(
          i.params.external_cart_id
        )
      }), this.initTimeToRedirectToNext();
    }
    reportError(t) {
      this.appProps.errorHandler.reportException(
        t,
        "Error trying to autocomplete cart"
      ), Mt.setCartAutocompleteFailed();
    }
    static hasCartAutocompleteSucceeded(t) {
      return Cr.getCookie(
        Mt.AUTOCOMPLETED_CART_COOKIE
      ) === t;
    }
    static hasCartAutocompleteFailed(t) {
      return Cr.getCookie(
        Mt.CART_AUTOCOMPLETE_FAILED_COOKIE
      ) === t;
    }
    static isCartEligibleForAutocomplete(t) {
      const e = Mt.hasCartAutocompleteSucceeded(t), n = Mt.hasCartAutocompleteFailed(t);
      return !e && !n;
    }
    static setCartHasBeenAutocompleted(t) {
      Cr.setCookie(
        Mt.AUTOCOMPLETED_CART_COOKIE,
        t,
        {
          expires: new Date(
            Date.now() + Mt.AUTOCOMPLETED_CART_COOKIE_EXPIRATION
          )
        }
      );
    }
    static setCartAutocompleteFailed() {
      Cr.setCookie(
        Mt.CART_AUTOCOMPLETE_FAILED_COOKIE,
        ne.getCartId() ?? "",
        {
          expires: new Date(
            Date.now() + Mt.AUTOCOMPLETED_CART_COOKIE_EXPIRATION
          )
        }
      );
    }
    initTimeToRedirectToNext() {
      document.getElementsByName("go_to_checkout").forEach((e) => {
        e.addEventListener("click", async () => {
          await this.appProps.api.registerLog("Redirect to next");
        });
      });
    }
  };
  Mt.AUTOCOMPLETED_CART_COOKIE_EXPIRATION = 100 * 365 * 24 * 60 * 60 * 1e3, Mt.AUTOCOMPLETED_CART_COOKIE = "wallet-autocompleted-cart", Mt.CART_AUTOCOMPLETE_FAILED_COOKIE = "wallet-cart-autocomplete-failed", Mt = LA([
    o1(["WALLET_ZIPCODE_FILLER_FINISHED"], { userLogged: !0 })
  ], Mt);
  const AA = Mt, rw = (t, e, n) => {
    let i = t.parentElement;
    for (; i; ) {
      const s = i.tagName.toLowerCase();
      if (s === e.toLowerCase() && i.classList.contains(n))
        return i;
      if (["body", "html"].includes(s))
        break;
      i = i.parentElement;
    }
    return null;
  }, yt = {
    MARGIN_TOP_0: "margin-top:0px;",
    MARGIN_TOP_8: "margin-top:8px;",
    MARGIN_TOP_12: "margin-top:12px;",
    MARGIN_TOP_16: "margin-top:16px;",
    MARGIN_TOP_20_LR_0: "margin-top:20px; margin-left:0px; margin-right:0px;",
    MARGIN_TOP_24: "margin-top:24px;",
    MARGIN_TOP_NEG_8: "margin-top:-8px;",
    MARGIN_TOP_NEG_16: "margin-top:-16px;",
    MARGIN_TOP_12_LEFT_0: "margin-top:12px; margin-left: 0px;"
  }, _t = {
    EMPTY: [],
    COL_12: ["col-12"],
    COL_12_PR_0: ["col-12", "pr-0"],
    COL_12_MD_9: ["col-12", "col-md-9"],
    MB_3_FULL_WIDTH: ["mb-3", "full-width-container"],
    MATERIAL_RESPONSIVE: ["col-xs-12", "col-sm-12", "col-md-9", "col-lg-9"],
    ROW: ["row"],
    SPAN_12: ["span12"]
  }, Pt = {
    FORM_ROW: "form-row",
    ROW: "row",
    ROW_FLUID: "row-fluid",
    MB_2: "mb-2",
    MB_3: "mb-3",
    MB_4: "mb-4",
    JS_PRODUCT_FORM: "js-product-form",
    JS_PRODUCT_BUY_CONTAINER: "js-product-buy-container",
    PRODUCT_BUY_CONTAINER: "product-buy-container"
  }, Fu = {
    BAIRES: "margin-left:0px; margin-bottom:0px;",
    UYUNI: "margin-left:8px; margin-bottom:16px;",
    FLEX: "margin-top:-8px;",
    STYLE: "margin-left:0px; margin-bottom:24px;"
  }, wt = (t, e, n, i) => ({
    style: t,
    ...e !== void 0 && { classes: [...e] },
    ...n && { parentClass: n },
    ...i && { emailStyle: i }
  }), kA = /* @__PURE__ */ new Map([
    // Themes with mb-3 and full-width-container classes
    [
      Ee.IDEA,
      wt(
        yt.MARGIN_TOP_8,
        _t.MB_3_FULL_WIDTH
      )
    ],
    [
      Ee.TREND,
      wt(
        yt.MARGIN_TOP_8,
        _t.MB_3_FULL_WIDTH
      )
    ],
    // Themes with form-row parent and col-12 base
    [
      Ee.AMAZONAS,
      wt(
        yt.MARGIN_TOP_NEG_8,
        _t.COL_12_PR_0,
        Pt.FORM_ROW
      )
    ],
    [
      Ee.RIO,
      wt(
        yt.MARGIN_TOP_NEG_16,
        _t.COL_12,
        Pt.MB_2
      )
    ],
    [
      Ee.CALI,
      wt(
        yt.MARGIN_TOP_8,
        _t.COL_12,
        Pt.FORM_ROW
      )
    ],
    [
      Ee.LIMA,
      wt(
        yt.MARGIN_TOP_NEG_8,
        _t.COL_12,
        Pt.FORM_ROW
      )
    ],
    [
      Ee.CUBO,
      wt(
        yt.MARGIN_TOP_8,
        _t.COL_12_MD_9,
        Pt.FORM_ROW
      )
    ],
    [
      Ee.FLEX,
      wt(
        yt.MARGIN_TOP_8,
        _t.COL_12,
        Pt.FORM_ROW,
        Fu.FLEX
      )
    ],
    // Themes with row parent and col-12 base
    [
      Ee.BAIRES,
      wt(
        yt.MARGIN_TOP_16,
        _t.COL_12,
        Pt.ROW,
        Fu.BAIRES
      )
    ],
    [
      Ee.RECIFE,
      wt(
        yt.MARGIN_TOP_12,
        _t.COL_12,
        Pt.ROW
      )
    ],
    [
      Ee.MORELIA,
      wt(
        yt.MARGIN_TOP_8,
        _t.COL_12,
        Pt.ROW
      )
    ],
    [
      Ee.UYUNI,
      wt(
        yt.MARGIN_TOP_0,
        _t.COL_12,
        Pt.ROW,
        Fu.UYUNI
      )
    ],
    [
      Ee.TOLUCA,
      wt(
        yt.MARGIN_TOP_16,
        _t.COL_12,
        Pt.ROW
      )
    ],
    [
      Ee.GUADALAJARA,
      wt(
        yt.MARGIN_TOP_8,
        _t.COL_12,
        Pt.ROW
      )
    ],
    // Themes with unique configurations
    [
      Ee.STYLE,
      wt(
        yt.MARGIN_TOP_0,
        _t.EMPTY,
        void 0,
        Fu.STYLE
      )
    ],
    [
      Ee.LUXURY,
      wt(
        yt.MARGIN_TOP_12_LEFT_0,
        _t.SPAN_12,
        Pt.ROW_FLUID
      )
    ],
    [
      Ee.ZEN,
      wt(
        yt.MARGIN_TOP_24,
        _t.EMPTY,
        Pt.PRODUCT_BUY_CONTAINER
      )
    ],
    [
      Ee.BAHIA,
      wt(
        yt.MARGIN_TOP_20_LR_0,
        _t.ROW,
        Pt.MB_3
      )
    ],
    [
      Ee.MATERIAL,
      wt(
        yt.MARGIN_TOP_0,
        _t.MATERIAL_RESPONSIVE,
        Pt.ROW
      )
    ],
    [
      Ee.BRASILIA,
      wt(
        yt.MARGIN_TOP_0,
        _t.EMPTY,
        Pt.JS_PRODUCT_FORM
      )
    ],
    [
      Ee.NEW_LINKEDMAN,
      wt(
        yt.MARGIN_TOP_8,
        void 0,
        Pt.JS_PRODUCT_BUY_CONTAINER
      )
    ],
    [
      Ee.ATLANTICO,
      wt(
        yt.MARGIN_TOP_8,
        void 0,
        Pt.MB_4
      )
    ]
  ]), Hu = (t) => kA.get(t) || null;
  class Bu extends jh {
    constructor() {
      super(), this.themeCode = ne.getThemeCode();
    }
    render(e) {
      if (Bu.shouldPreventShow())
        return;
      this.appendEmailPanelContainer();
      const { margin: n } = this.getStyles();
      Dh(
        {
          "data-testid": "email-panel-product-page",
          margin: n,
          email: e,
          showDivider: !1
        },
        this.getContainerId()
      );
    }
    appendEmailPanelContainerForAtlanticoTheme() {
      this.appendEmailPanelContainerForCommonThemes();
    }
    appendEmailPanelContainerForStyleTheme() {
      var i;
      const e = this.createOrGetContainerEmailPanel(), n = document.querySelector(
        '[data-store="product-buy-button"]'
      );
      n && ((i = n.parentNode) == null || i.insertBefore(
        e,
        n.nextSibling
      ), this.setContainerStyle(e));
    }
    appendEmailPanelContainerForCommonThemes() {
      var f;
      const e = this.createOrGetContainerEmailPanel(), n = document.querySelector(
        '[data-store="product-buy-button"]'
      );
      if (!n)
        return;
      const i = (f = Hu(
        this.themeCode
      )) == null ? void 0 : f.parentClass;
      if (!i)
        return;
      const s = this.themeCode === Ee.BRASILIA ? "form" : "div", a = rw(
        n,
        s,
        i
      );
      a == null || a.appendChild(e);
      const u = Hu(this.themeCode), d = u == null ? void 0 : u.classes;
      d && e.classList.add(...d), this.setContainerStyle(e);
    }
    setContainerStyle(e) {
      const n = Hu(this.themeCode), i = n == null ? void 0 : n.emailStyle;
      e.setAttribute(
        "style",
        i || "margin-left:0px;margin-bottom:16px;"
      );
    }
    getStyles() {
      return {
        margin: "16px 8px 0px 0px",
        padding: "0px"
      };
    }
    getContainerId() {
      return "emailPanelProduct";
    }
    static shouldPreventShow() {
      return Bu.isProductBuyButtonContactPresent();
    }
    static isProductBuyButtonContactPresent() {
      const e = document.querySelector(
        '[data-store="product-buy-button"]'
      );
      return (e == null ? void 0 : e.classList.contains("contact")) ?? !1;
    }
  }
  const PA = {
    clearStoreFeaturesCacheHash: "b1e3845bdb71c890fc0606c06652b4af6e2b5855"
  };
  class IA {
    static get(e) {
      return PA[e];
    }
  }
  class NA extends Error {
    constructor(e) {
      super(), this.message = "Failed to request store features", this.name = "WALLET_STORE_FEATURES", this.cause = e.cause || e.message, this.stack = e.stack;
    }
  }
  const cr = {
    BUY_NOW: "buyNow",
    CHECKOUT_REDIRECT: "checkoutRedirect",
    EXPRESS_CHECKOUT: "expressCheckout",
    EXPRESS_CHECKOUT_SESSION_SYNC: "expressCheckoutSessionSync",
    FACEBOOK_INTEGRATION: "facebookIntegration",
    TIKTOK_INTEGRATION: "tiktokIntegration"
  }, Jo = {
    PRODUCT_PAGE: "productPage",
    CART: "cart",
    NEXT: "next",
    REDIRECT: "redirect",
    EXECUTE: "execute",
    FACEBOOK: "unknown",
    TIKTOK: "unknown"
  }, Xr = class Xr {
    constructor(e, n, i) {
      this.sessionData = e, this.walletApi = n, this.cacheService = i, this.storeFeaturesCache = null, this.storeFeaturesPromise = null;
    }
    async storeHas(e) {
      const n = await this.getStoreFeatures();
      return Xr.isKnownFeature(e) ? Xr.hasExpectedValue(e, n) : Xr.hasAnyTruthyValue(e, n);
    }
    async getFeatureValue(e) {
      return (await this.getStoreFeatures())[e];
    }
    async getStoreFeatures() {
      if (this.storeFeaturesCache)
        return this.storeFeaturesCache.features;
      if (this.storeFeaturesPromise)
        return (await this.storeFeaturesPromise).features;
      this.storeFeaturesPromise = this.fetchStoreFeatures();
      const e = await this.storeFeaturesPromise;
      return this.storeFeaturesCache = e, this.storeFeaturesPromise = null, e.features;
    }
    async fetchStoreFeatures() {
      try {
        const e = `${ne.getStoreId()}-storeFeatures`, n = this.cacheService.get(e), i = IA.get(
          "clearStoreFeaturesCacheHash"
        );
        if (n && n.cacheHash === i)
          return n.data;
        const s = await this.walletApi.getStoreFeatures({
          externalStoreId: ne.getStoreId()
        });
        return this.cacheService.set(
          e,
          { data: s, cacheHash: i },
          60 * 60 * 2
        ), s;
      } catch (e) {
        throw new NA(e);
      }
    }
    static isKnownFeature(e) {
      return Xr.FEATURE_TO_VALUE_MAP[e] !== "unknown";
    }
    static hasExpectedValue(e, n) {
      return !!n[e] && n[e] === Xr.FEATURE_TO_VALUE_MAP[e];
    }
    static hasAnyTruthyValue(e, n) {
      return !!n[e];
    }
  };
  Xr.FEATURE_TO_VALUE_MAP = {
    [cr.BUY_NOW]: Jo.PRODUCT_PAGE,
    [cr.CHECKOUT_REDIRECT]: Jo.NEXT,
    [cr.EXPRESS_CHECKOUT]: Jo.REDIRECT,
    [cr.EXPRESS_CHECKOUT_SESSION_SYNC]: Jo.EXECUTE,
    [cr.FACEBOOK_INTEGRATION]: Jo.FACEBOOK,
    [cr.TIKTOK_INTEGRATION]: Jo.TIKTOK
  };
  let Bh = Xr;
  var DA = Object.defineProperty, jA = Object.getOwnPropertyDescriptor, MA = (t, e, n, i) => {
    for (var s = i > 1 ? void 0 : i ? jA(e, n) : e, a = t.length - 1, u; a >= 0; a--)
      (u = t[a]) && (s = (i ? u(e, n, s) : u(s)) || s);
    return i && s && DA(e, n, s), s;
  };
  let Uh = class extends Tr {
    constructor(t, e = new Bu()) {
      super(t), this.productPageTemplateEmailPanelRenderer = e;
    }
    async handle() {
      const { email: t } = this.appProps.sessionService.getSessionData().user;
      await this.addToProductPage(t);
    }
    async addToProductPage(t) {
      await this.appProps.storeFeaturesService.storeHas(
        cr.BUY_NOW
      ) && this.productPageTemplateEmailPanelRenderer.render(t);
    }
  };
  Uh = MA([
    lh("product", { userLogged: !0 })
  ], Uh);
  const FA = Uh;
  var HA = Object.defineProperty, BA = Object.getOwnPropertyDescriptor, UA = (t, e, n, i) => {
    for (var s = i > 1 ? void 0 : i ? BA(e, n) : e, a = t.length - 1, u; a >= 0; a--)
      (u = t[a]) && (s = (i ? u(e, n, s) : u(s)) || s);
    return i && s && HA(e, n, s), s;
  };
  let $h = class extends Tr {
    constructor(t, e) {
      super(t), this.zipcodeFiller = e;
    }
    async handle() {
      await this.appProps.storeFeaturesService.storeHas(
        cr.BUY_NOW
      ) && await this.zipcodeFiller.handle();
    }
  };
  $h = UA([
    lh("product", { userLogged: !0 })
  ], $h);
  const $A = $h, zA = tt.div`
  display: flex;
  flex-direction: column;
  margin-top: 8px;
`, iw = tt.button`
  display: flex;
  position: relative;
  justify-content: center;
  align-items: center;
  width: 100%;

  &:disabled {
    cursor: not-allowed;
    opacity: 0.7;
  }
`, VA = tt(iw)`
  margin-bottom: 8px;
  margin-top: 8px;
`, WA = tt(iw)`
  margin-bottom: 0;
`, ow = ({
    size: t = 24,
    color: e = "currentColor"
  }) => /* @__PURE__ */ O.jsxs(
    "svg",
    {
      width: t,
      height: t,
      viewBox: "0 -5 24 24",
      fill: "none",
      stroke: e,
      strokeWidth: "1.5",
      strokeLinecap: "round",
      strokeLinejoin: "round",
      children: [
        /* @__PURE__ */ O.jsx("path", { d: "M4 13l4 4L14 7" }),
        /* @__PURE__ */ O.jsx("path", { d: "M8 13l4 4L18 7" })
      ]
    }
  );
  ow.defaultProps = {
    color: "currentColor"
  };
  const GA = ({ buttonType: t, disable: e = !1, fontFamily: n, onBuyNow: i }, s) => {
    const { t: a } = or(), [u, d] = N.useState(!1), [f, p] = N.useState(e), m = ne.getThemeCode(), v = m === Ee.BAHIA, y = m === Ee.BRASILIA, E = m === Ee.CUBO, S = m === Ee.FLEX, x = u || f, C = () => v ? "btn-primary btn col-12 col-md-7" : S ? "btn btn-big btn-primary btn-add-to-cart" : "btn btn-primary btn-big btn-block", L = () => y ? "js-modal-open-private btn btn-primary btn-big btn-block" : "js-modal-open js-open-cart js-fullscreen-modal-open js-toggle-cart btn btn-primary btn-big btn-block";
    N.useImperativeHandle(s, () => ({
      setDisabled: (B) => p(B),
      isDisabled: () => x
    }));
    const k = async () => {
      if (!u) {
        d(!0);
        try {
          await i();
        } finally {
          d(!1);
        }
      }
    }, I = () => {
      E && ua("/comprar");
    };
    return t === "GoCart" ? /* @__PURE__ */ O.jsxs(zA, { className: "font-small", children: [
      /* @__PURE__ */ O.jsxs("span", { children: [
        /* @__PURE__ */ O.jsx(ow, { size: 24 }),
        " ",
        a("buyNowPanel.addedProduct.text")
      ] }),
      /* @__PURE__ */ O.jsx(
        VA,
        {
          "data-testid": "go-cart-panel-button",
          disabled: u,
          type: "button",
          style: { fontFamily: n },
          "data-toggle": "#modal-cart",
          "data-target": "#modal-cart",
          "data-modal-url": "modal-fullscreen-cart",
          className: L(),
          onClick: I,
          children: u ? /* @__PURE__ */ O.jsx(Ih, {}) : a("buyNowPanel.goCartButton.text")
        }
      )
    ] }) : /* @__PURE__ */ O.jsx(
      WA,
      {
        "data-testid": "buy-now-panel-button",
        onClick: k,
        disabled: x,
        type: "button",
        style: { fontFamily: n },
        className: C(),
        children: u ? /* @__PURE__ */ O.jsx(Ih, { size: "24px", absolute: "static" }) : a("buyNowPanel.buyNowButton.text")
      }
    );
  }, qA = N.forwardRef(GA), Me = class Me {
    constructor() {
      this.onBuyNowCallback = null, this.buyNowRef = N.createRef(), this.mutationObserver = null, this.themeCode = ne.getThemeCode();
    }
    show(e) {
      Me.shouldPreventShow() || (this.prepareUI(), this.renderBuyNowComponent(e), this.setupButtonStateWatcher());
    }
    remove() {
      this.cleanupObserver();
      const e = document.getElementById(Me.ROOT_ID);
      e == null || e.remove();
    }
    onBuyNow(e) {
      this.onBuyNowCallback = e;
    }
    static shouldPreventShow() {
      return Me.isAddProductBuyButtonContact() || Me.isAddProductBuyButtonNoStock();
    }
    prepareUI() {
      Me.isAddProductBuyButtonDisabled() || (Me.removeAddedToCartMessage(), this.changeAddToCartButton());
    }
    renderBuyNowComponent(e) {
      this.buildRoot(), this.buyNowRef = N.createRef(), Ah(
        /* @__PURE__ */ O.jsx(
          qA,
          {
            ref: this.buyNowRef,
            buttonType: e,
            onBuyNow: this.onBuyNowCallback,
            disable: Me.isAddProductBuyButtonDisabled(),
            fontFamily: Me.getAddProductBuyFontFamily()
          }
        ),
        Me.ROOT_ID
      );
    }
    buildRoot() {
      const e = this.getOrCreateRootContainer();
      Me.tryInsertBeforeEmailPanel(e) || this.insertInProductBuyContainer(e);
    }
    getOrCreateRootContainer() {
      const e = document.getElementById(Me.ROOT_ID);
      return e || this.createNewContainer();
    }
    createNewContainer() {
      const e = document.createElement("div");
      return e.id = Me.ROOT_ID, this.addClassesToContainerElement(e), this.addStyleToContainerElement(e), e;
    }
    static tryInsertBeforeEmailPanel(e) {
      const n = document.getElementById(Me.EMAIL_PANEL_ID);
      return n != null && n.parentNode ? (n.parentNode.insertBefore(e, n), !0) : !1;
    }
    insertInProductBuyContainer(e) {
      var i;
      const n = Me.getAddProductBuyButton();
      if (n)
        if (this.themeCode === Ee.STYLE)
          (i = n.parentNode) == null || i.insertBefore(
            e,
            n.nextSibling
          );
        else {
          const s = this.findProductBuyContainer(n);
          s == null || s.appendChild(e);
        }
    }
    addClassesToContainerElement(e) {
      const n = this.getContainerAttributesByTheme(), i = n == null ? void 0 : n.classes;
      i && e.classList.add(...i);
    }
    addStyleToContainerElement(e) {
      const n = this.getContainerAttributesByTheme(), i = n == null ? void 0 : n.style;
      i && e.setAttribute("style", i);
    }
    findProductBuyContainer(e) {
      var i;
      const n = (i = this.getContainerAttributesByTheme()) == null ? void 0 : i.parentClass;
      return rw(
        e,
        "div",
        n
      );
    }
    changeAddToCartButton() {
      const e = Me.getAddProductBuyButton();
      e && this.updateElementAppearance(e);
      const n = Me.getAddProductBuyPlaceHolder();
      n && this.updateElementAppearance(n);
    }
    updateElementAppearance(e) {
      const n = ox("buyNowPanel.addToCart.text");
      e instanceof HTMLInputElement ? e.setAttribute("value", n) : e.textContent = n, [
        Ee.IDEA,
        Ee.TREND,
        Ee.BRASILIA,
        Ee.CUBO
      ].includes(this.themeCode) || e.classList.replace("btn-primary", "btn-secondary");
    }
    static removeAddedToCartMessage() {
      const e = document.querySelector(
        Me.ADDED_TO_CART_MESSAGE_SELECTOR
      );
      e && Me.removeMessageElement(e);
    }
    static removeMessageElement(e) {
      const n = e.parentElement;
      n != null && n.classList.contains("col-12") ? n.remove() : e.remove();
    }
    setupButtonStateWatcher() {
      const e = Me.getAddProductBuyButton();
      e && (this.cleanupObserver(), this.createButtonObserver(e));
    }
    createButtonObserver(e) {
      this.mutationObserver = new MutationObserver((n) => {
        this.handleButtonMutations(n);
      }), this.mutationObserver.observe(e, {
        attributes: !0,
        attributeFilter: ["disabled", "style", "class"]
      });
    }
    handleButtonMutations(e) {
      e.forEach((n) => {
        if (Me.isRelevantAttributeChange(n)) {
          const i = n.target;
          this.updateBuyNowButtonState(i);
        }
      });
    }
    static isRelevantAttributeChange(e) {
      return e.type === "attributes" && (e.attributeName === "disabled" || e.attributeName === "style" || e.attributeName === "class");
    }
    updateBuyNowButtonState(e) {
      const n = !e.disabled && !Me.isElementHidden(e);
      this.setBuyNowButtonEnabled(n);
    }
    static isAddProductBuyButtonDisabled() {
      const e = Me.getAddProductBuyButton();
      return (e == null ? void 0 : e.disabled) ?? !1;
    }
    static isAddProductBuyButtonContact() {
      const e = Me.getAddProductBuyButton();
      return (e == null ? void 0 : e.classList.contains("contact")) ?? !1;
    }
    static isAddProductBuyButtonNoStock() {
      const e = Me.getAddProductBuyButton();
      return (e == null ? void 0 : e.classList.contains("nostock")) ?? !1;
    }
    static isElementHidden(e) {
      return e.style.display === "none" ? !0 : window.getComputedStyle(e).display === "none";
    }
    static getAddProductBuyButton() {
      return document.querySelector(
        Me.ADD_PRODUCT_BUTTON_SELECTOR
      );
    }
    static getAddProductBuyPlaceHolder() {
      return document.querySelector(
        Me.ADD_PRODUCT_PLACEHOLDER_SELECTOR
      );
    }
    static getAddProductBuyFontFamily() {
      const e = document.querySelector(
        Me.ADD_PRODUCT_BUTTON_SELECTOR
      );
      if (e) {
        const { fontFamily: n } = window.getComputedStyle(e);
        return n;
      }
      return "";
    }
    setBuyNowButtonEnabled(e) {
      var n, i;
      (i = (n = this.buyNowRef) == null ? void 0 : n.current) == null || i.setDisabled(!e);
    }
    cleanupObserver() {
      this.mutationObserver && (this.mutationObserver.disconnect(), this.mutationObserver = null);
    }
    getContainerAttributesByTheme() {
      return Hu(this.themeCode);
    }
  };
  Me.ROOT_ID = "wallet-buy-now-panel", Me.ADD_PRODUCT_BUTTON_SELECTOR = '[data-store="product-buy-button"]', Me.ADD_PRODUCT_PLACEHOLDER_SELECTOR = ".js-addtocart.js-addtocart-placeholder", Me.EMAIL_PANEL_ID = "emailPanelProduct", Me.ADDED_TO_CART_MESSAGE_SELECTOR = ".js-added-to-cart-product-message";
  let zh = Me;
  const Rr = class Rr {
    static addProductToCart(e) {
      return new Promise((n, i) => {
        const s = () => n(), a = () => i(new Error("An error occurred when adding product to cart"));
        window.LS.addToCartEnhanced(
          e,
          "",
          // unused param
          "",
          // unused param
          "",
          // unused param
          "true",
          // unused param
          s,
          a
        );
      });
    }
    static validateForm(e) {
      return e.checkValidity() ? !0 : (e.querySelector(":invalid") && e.reportValidity(), !1);
    }
  };
  Rr.buy = async () => {
    const e = await Rr.getProductForm();
    if (!Rr.validateForm(e[0]))
      throw new Error("Form validation failed - required fields missing");
    await Rr.addProductToCart(e), await Rr.goToCheckout(e);
  }, Rr.getProductForm = async () => (await window.useJquery())(
    document.querySelector("#wallet-buy-now-panel").closest(
      "form"
    )
  ), Rr.goToCheckout = async (e) => {
    const n = new FormData(e[0]), i = new wu(), s = n.get("add_to_cart"), a = n.get("quantity"), u = {
      [s]: a
    }, d = e.attr("action"), f = await i.getCheckoutUrl({
      localizedPath: d,
      zipcode: "",
      shippingMethod: "",
      afterCalculation: "",
      itemQuantities: u
    });
    ua(f);
  };
  let Vh = Rr;
  var YA = Object.defineProperty, KA = Object.getOwnPropertyDescriptor, ZA = (t, e, n, i) => {
    for (var s = i > 1 ? void 0 : i ? KA(e, n) : e, a = t.length - 1, u; a >= 0; a--)
      (u = t[a]) && (s = (i ? u(e, n, s) : u(s)) || s);
    return i && s && YA(e, n, s), s;
  };
  const XA = "cart.updated";
  let Uu = class extends Tr {
    constructor(t, e = new zh()) {
      super(t), this.buyNowPanel = e, this.isFirstCartUpdate = !0, this.isBuyNowInProgress = !1, this.handleCartUpdate = (n) => {
        var s;
        const i = ((s = n.detail) == null ? void 0 : s.products.length) ?? 0;
        this.isFirstCartUpdate = i === 0, this.isBuyNowInProgress || this.refreshBuyNowPanel(i);
      };
    }
    async handle() {
      await this.shouldShowBuyNowPanel() && (this.setupBuyNowPanel(), this.setupCartUpdateListener());
    }
    getIsBuyNowInProgress() {
      return this.isBuyNowInProgress;
    }
    async shouldShowBuyNowPanel() {
      const t = await this.appProps.storeFeaturesService.storeHas(
        cr.BUY_NOW
      ), e = ne.hasCartMinimumValue();
      return t && !e;
    }
    setupBuyNowPanel() {
      const t = Uu.getCartItemsCount();
      this.configureBuyNowCallback(), this.showAppropriatePanel(t);
    }
    configureBuyNowCallback() {
      this.buyNowPanel.onBuyNow(async () => {
        this.isBuyNowInProgress = !0;
        try {
          await Vh.buy(), await this.eventBuyNowButtonClick(), await this.logBuyNowButtonClick(), await new Promise((t) => setTimeout(t, 1e4));
        } catch (t) {
          (!(t instanceof Error) || !t.message.includes("Form validation failed")) && this.appProps.errorHandler.reportException(
            t,
            "Error during buy now"
          );
        } finally {
          this.isBuyNowInProgress = !1;
        }
      });
    }
    async logBuyNowButtonClick() {
      await this.appProps.api.registerLog("User clicked the buy now button", {
        email: this.appProps.sessionService.getEmailUserLogged()
      });
    }
    async eventBuyNowButtonClick() {
      const t = await this.appProps.storeApi.getCartSession();
      await this.appProps.eventService.registerEventWalletOnClickBuyNow(
        t.id
      );
    }
    showAppropriatePanel(t) {
      t === 0 ? this.buyNowPanel.show("BuyNow") : this.isFirstCartUpdate || this.buyNowPanel.show("GoCart");
    }
    setupCartUpdateListener() {
      window.addEventListener(
        XA,
        this.handleCartUpdate.bind(this)
      );
    }
    refreshBuyNowPanel(t) {
      this.buyNowPanel.remove(), this.showAppropriatePanel(t);
    }
    static getCartItemsCount() {
      return ne.getCartItems().length;
    }
  };
  Uu = ZA([
    o1(["WALLET_ZIPCODE_FILLER_FINISHED"], { userLogged: !0 })
  ], Uu);
  const JA = Uu, $u = "center", QA = tt.div`
  display: flex;
  flex-direction: column;
  justify-content: ${({ justifyContent: t }) => t ?? $u};
  align-items: ${({ alignItems: t }) => t ?? $u};
  width: 100%;
`;
  tt.div`
  display: flex;
  flex-direction: row;
  justify-content: ${({ justifyContent: t }) => t ?? $u};
  align-items: ${({ alignItems: t }) => t ?? $u};
  width: 100%;
`;
  function ek(t, e) {
    const n = N.useRef(null);
    N.useEffect(() => (n.current = new ResizeObserver(() => {
      e(`${t.offsetHeight}px`);
    }), n.current.observe(t), () => {
      var i;
      (i = n.current) == null || i.disconnect();
    }), [t, e]);
  }
  const tk = ({
    onExpressCheckout: t,
    startBuyButton: e,
    sessionData: n
  }) => {
    const [i, s] = N.useState(!1), [a, u] = N.useState(`${e.offsetHeight}px`);
    ek(e, (m) => {
      u(m);
    });
    const d = () => (n == null ? void 0 : n.status) === "logged" ? {
      id: n.user.email,
      hasSavedCards: n.user.has_saved_cards
    } : null, f = () => {
      var m;
      return (m = window.LS) == null ? void 0 : m.theme;
    }, p = async () => {
      if (!i) {
        s(!0);
        try {
          await t();
        } finally {
          s(!1);
        }
      }
    };
    return /* @__PURE__ */ O.jsxs(QA, { children: [
      /* @__PURE__ */ O.jsx(rn, { mt: 12 }),
      /* @__PURE__ */ O.jsx(ZO, {}),
      /* @__PURE__ */ O.jsx(rn, { mt: 12 }),
      /* @__PURE__ */ O.jsx(
        mR,
        {
          "data-testid": "express-checkout-panel-button",
          onClick: p,
          loading: i,
          customHeight: a,
          user: d(),
          theme: f()
        }
      ),
      /* @__PURE__ */ O.jsx(rn, { mb: 12 })
    ] });
  }, Rt = class Rt {
    constructor(e) {
      this.sessionService = e, this.onExpressCheckoutCallback = null, this.mutationObserver = null;
    }
    show() {
      Rt.getStartBuyButtons().length > 0 ? this.renderExpressCheckoutComponent() : this.waitForStartBuyButton();
    }
    onExpressCheckout(e) {
      this.onExpressCheckoutCallback = e;
    }
    destroy() {
      this.cleanupObserver(), Rt.getStartBuyButtons().forEach((n, i) => {
        const s = document.getElementById(
          `${Rt.ROOT_ID}-${i}`
        );
        s == null || s.remove();
      });
    }
    waitForStartBuyButton() {
      this.cleanupObserver();
      const e = document.querySelector(
        Rt.CART_FORM_SELECTOR
      );
      e && (this.mutationObserver = new MutationObserver(() => {
        Rt.getStartBuyButtons().length > 0 && (this.cleanupObserver(), this.renderExpressCheckoutComponent());
      }), this.mutationObserver.observe(e, {
        childList: !0,
        subtree: !0
      }));
    }
    cleanupObserver() {
      this.mutationObserver && (this.mutationObserver.disconnect(), this.mutationObserver = null);
    }
    renderExpressCheckoutComponent() {
      Rt.buildRoot(), Rt.adjustStartBuyButtonStyles(), Rt.getStartBuyButtons().forEach((n, i) => {
        Ah(
          /* @__PURE__ */ O.jsx(
            tk,
            {
              onExpressCheckout: this.onExpressCheckoutCallback,
              startBuyButton: n,
              sessionData: this.sessionService.getSessionData()
            }
          ),
          `${Rt.ROOT_ID}-${i}`
        );
      });
    }
    static buildRoot() {
      Rt.getStartBuyButtons().forEach((n, i) => {
        const s = Rt.getOrCreateRootContainer(i);
        n.after(s);
      });
    }
    static adjustStartBuyButtonStyles() {
      Rt.getStartBuyButtons().forEach((n) => {
        n.style.setProperty("margin-bottom", "0", "important"), n.style.setProperty("width", "100%", "important");
      });
    }
    static getStartBuyButtons() {
      return Array.from(
        document.querySelectorAll(Rt.START_BUY_BUTTON_SELECTOR)
      );
    }
    static getOrCreateRootContainer(e = 0) {
      const n = `${Rt.ROOT_ID}-${e}`, i = document.getElementById(n);
      return i || Rt.createNewContainer(n);
    }
    static createNewContainer(e) {
      const n = document.createElement("div");
      return n.id = e, n.style.width = "100%", n;
    }
  };
  Rt.ROOT_ID = "wallet-express-checkout-panel", Rt.START_BUY_BUTTON_SELECTOR = 'input[name="go_to_checkout"]', Rt.CART_FORM_SELECTOR = '[data-store="cart-form"]';
  let Wh = Rt;
  const et = class et {
    constructor(e, n, i, s) {
      this.storesApi = e, this.storefrontSessionService = n, this.errorHandler = i, this.storeFeaturesService = s, this.facebookAnalytics = new E0.FacebookAnalytics(), this.tiktokAnalytics = new E0.TikTokAnalytics(), this.goToExpressCheckout = async () => {
        try {
          const a = await this.getValidCheckoutUrl();
          if (!a)
            return;
          const u = await this.buildExpressCheckoutUrl(a);
          await this.sendInitiateCheckoutAnalyticsEvent(), ua(await this.appendGASessionToUrl(u));
        } catch (a) {
          this.errorHandler.reportException(
            a,
            "Error during express checkout process"
          );
        }
      }, this.getValidCheckoutUrl = async () => {
        const a = et.getCartForm();
        if (!a)
          return this.errorHandler.reportError("Cart form not found"), null;
        const u = et.extractFormData(a), d = await this.requestCheckoutUrl(u);
        return this.validateAndHandleCheckoutUrl(d);
      }, this.buildExpressCheckoutUrl = async (a) => {
        const u = this.extractHashFromUrl(a), d = oa.createExpressCheckoutService(), f = await this.getFragments(), p = et.determineCheckoutStep(a);
        return d.getRedirectUrl(p, f, u);
      };
    }
    static getCartForm() {
      return document.querySelector(et.CART_FORM_SELECTOR);
    }
    static extractFormData(e) {
      const { INPUT_SELECTORS: n } = et;
      return {
        afterCalculation: et.getInputValue(
          e,
          n.AFTER_CALCULATION
        ),
        zipcode: et.getInputValue(
          e,
          n.ZIPCODE
        ),
        shippingMethod: et.getInputValue(
          e,
          n.SHIPPING_METHOD
        ),
        quantities: et.extractQuantities(e),
        localizedPath: e.action
      };
    }
    static getInputValue(e, n) {
      const i = e.querySelector(n);
      return (i == null ? void 0 : i.value) || void 0;
    }
    static extractQuantities(e) {
      const n = e.querySelectorAll(
        et.INPUT_SELECTORS.QUANTITY_INPUTS
      ), i = {};
      return n.forEach((s) => {
        const a = s, u = et.extractItemIdFromName(
          a.name
        );
        u && a.value && (i[u] = a.value);
      }), i;
    }
    static extractItemIdFromName(e) {
      const i = /quantity\[([^\]]+)]/.exec(e);
      return i ? i[1] : null;
    }
    async requestCheckoutUrl(e) {
      return this.storesApi.getCheckoutUrl({
        localizedPath: e.localizedPath,
        shippingMethod: e.shippingMethod || "",
        afterCalculation: e.afterCalculation || "",
        zipcode: e.zipcode || "",
        itemQuantities: e.quantities
      });
    }
    validateAndHandleCheckoutUrl(e) {
      return et.isValidCheckoutUrl(e) ? e : (this.handleInvalidCheckoutUrl(e), null);
    }
    static isValidCheckoutUrl(e) {
      return e.includes(et.CHECKOUT_URL_KEYWORD);
    }
    handleInvalidCheckoutUrl(e) {
      this.errorHandler.reportError(
        "Checkout URL does not contain checkout keyword",
        { url: e }
      ), ua(e);
    }
    static determineCheckoutStep(e) {
      return e.includes(et.NEXT_URL_KEYWORD) ? "next" : "start";
    }
    async getFragments() {
      if (!this.isUserLoggedIn())
        return null;
      try {
        return await oa.createSessionService().initSessionTransfer();
      } catch (e) {
        return this.errorHandler.reportException(
          e,
          "Error getting exchange token"
        ), null;
      }
    }
    isUserLoggedIn() {
      return this.storefrontSessionService.isUserLogged();
    }
    async appendGASessionToUrl(e) {
      const n = new URL(e), i = await et.getGLParam(e);
      i ? n.searchParams.set("_gl", i) : this.appendGAClientAndGASessionToUrl(n);
      const s = new URL(window.location.href);
      return [
        "gclid",
        "utm_source",
        "utm_medium",
        "utm_campaign",
        "gad_campaignid",
        "gad_source",
        "gbraid"
      ].forEach((u) => {
        const d = s.searchParams.get(u);
        d && n.searchParams.set(u, d);
      }), n.toString();
    }
    appendGAClientAndGASessionToUrl(e) {
      const n = this.extractGAMeasurementIdFromDOM("nsGA4"), i = this.extractGAMeasurementIdFromDOM("nsGAW"), s = et.getSessionIdFromCookie(n), a = et.getSessionIdFromCookie(i), u = et.getClientIdFromCookie();
      s && u && (e.searchParams.set("ga4_sid", s), e.searchParams.set("ga4_cid", u)), a && u && (e.searchParams.set("gaw_sid", a), e.searchParams.set("gaw_cid", u));
    }
    static async getGLParam(e) {
      const n = document.getElementById("wallet-express-checkout-panel-0"), i = document.createElement("a");
      return i.href = e, i.style.display = "none", i.textContent = "link TO Express Checkout", n == null || n.appendChild(i), i.dispatchEvent(new MouseEvent("mousedown", { bubbles: !0 })), await new Promise((a) => setTimeout(a, 100)), new URL(i.href).searchParams.get("_gl");
    }
    static getClientIdFromCookie() {
      const e = document.cookie.split("; ").find((s) => s.startsWith("_ga="));
      if (!e)
        return null;
      const i = e.split("=")[1].split(".");
      return i.length >= 4 ? `${i[2]}.${i[3]}` : null;
    }
    static getSessionIdFromCookie(e) {
      if (!e)
        return null;
      const i = `_ga_${e.replace(/^(G-|AW-)/, "")}`, s = Cr.getCookie(i);
      if (!s)
        return null;
      if (s.startsWith("GS1.1.")) {
        const d = s.split(".");
        if (d.length >= 4)
          return d[2];
      }
      const u = /s(\d+)\$/.exec(s);
      return u != null && u[1] ? u[1] : null;
    }
    extractHashFromUrl(e) {
      try {
        const i = new URL(e).pathname.split("/"), s = i[i.length - 1];
        return et.isValidHash(s) ? s : void 0;
      } catch (n) {
        this.errorHandler.reportException(
          n,
          "Error parsing URL for hash extraction"
        );
        return;
      }
    }
    static isValidHash(e) {
      return !!(e && et.HASH_REGEX.test(e));
    }
    async sendInitiateCheckoutAnalyticsEvent() {
      try {
        const e = this.getInitiateCheckoutEventPayload(), n = await this.storeFeaturesService.getFeatureValue(
          "facebookIntegration"
        ), i = await this.storeFeaturesService.getFeatureValue("tiktokIntegration");
        this.facebookAnalytics.sendEvent("InitiateCheckout", e, {
          fbPixel: n
        }), this.tiktokAnalytics.sendEvent("InitiateCheckout", e, {
          tiktokPixel: i
        });
      } catch (e) {
        this.errorHandler.reportException(
          e,
          "Error sending initiate checkout analytics event"
        );
      }
    }
    getInitiateCheckoutEventPayload() {
      const e = ne.getCartData();
      return {
        currency: ne.getCurrency().code,
        discount: e.discount,
        shippingPrice: e.shipping,
        subtotal: e.subtotal,
        total: e.total,
        items: ne.getCartItems().map((n) => ({
          id: n.id,
          variantId: n.variant_id,
          brand: n.brand,
          name: n.name,
          quantity: n.quantity,
          categoriesTaxonomy: n.google_item_categories,
          price: n.unit_price
        }))
      };
    }
    extractGAMeasurementIdFromDOM(e) {
      try {
        const n = document.querySelectorAll(
          'script[src*="googletagmanager.com/gtag"]'
        ), s = Array.from(n).filter((a) => {
          const u = a.getAttribute("src");
          return u == null ? void 0 : u.includes(`l=${e}`);
        }).map((a) => a.getAttribute("src")).filter((a) => a !== null).map((a) => this.extractGAMeasurementId(a)).find((a) => a !== null);
        return s || null;
      } catch (n) {
        return this.errorHandler.reportException(
          n,
          "Error to find gtag script with dataLayerGA4 on DOM"
        ), null;
      }
    }
    extractGAMeasurementId(e) {
      try {
        const n = /[?&]id=((G-|AW-)[A-Z0-9]+)/i, i = e.replace(/&amp;/g, "&"), s = n.exec(i);
        return s ? s[1] : null;
      } catch (n) {
        return this.errorHandler.reportException(
          n,
          "Error to extract Measurement ID"
        ), null;
      }
    }
  };
  et.CART_FORM_SELECTOR = 'form[data-store="cart-form"]', et.INPUT_SELECTORS = {
    AFTER_CALCULATION: 'input[name="after_calculation"]',
    ZIPCODE: 'input[name="zipcode"]',
    SHIPPING_METHOD: "input.js-shipping-method:checked",
    QUANTITY_INPUTS: 'input.js-cart-quantity-input[name^="quantity["]'
  }, et.CHECKOUT_URL_KEYWORD = "checkout", et.NEXT_URL_KEYWORD = "next", et.HASH_REGEX = /^[a-f0-9]{40}$/i;
  let Gh = et;
  const Jr = class Jr {
    constructor(e, n, i) {
      this.cacheService = e, this.errorHandler = n, this.walletApi = i;
    }
    async shouldShowExpressCheckout() {
      const e = ne.getStoreId(), n = `${Jr.CACHE_KEY}-${e}`, i = this.cacheService.get(n);
      if (i !== null)
        return i;
      try {
        const s = await this.walletApi.getStorePaymentInfo(e), a = s.isNuvempagoActive && s.isCreditCardPaymentActive;
        return this.cacheService.set(
          n,
          a,
          Jr.CACHE_TTL_SECONDS
        ), a;
      } catch (s) {
        return this.errorHandler.reportException(
          s,
          "Failed to check Express Checkout visibility"
        ), !1;
      }
    }
  };
  Jr.CACHE_KEY = "express-checkout-visibility", Jr.CACHE_TTL_HOURS = 5, Jr.CACHE_TTL_SECONDS = Jr.CACHE_TTL_HOURS * 60 * 60;
  let qh = Jr;
  var nk = Object.defineProperty, rk = Object.getOwnPropertyDescriptor, ik = (t, e, n, i) => {
    for (var s = i > 1 ? void 0 : i ? rk(e, n) : e, a = t.length - 1, u; a >= 0; a--)
      (u = t[a]) && (s = (i ? u(e, n, s) : u(s)) || s);
    return i && s && nk(e, n, s), s;
  };
  let da = class extends Tr {
    constructor(t, e = new Wh(
      t.sessionService
    ), n = new Gh(
      t.storeApi,
      t.sessionService,
      t.errorHandler,
      t.storeFeaturesService
    ), i = new qh(
      t.cacheService,
      t.errorHandler,
      t.api
    )) {
      super(t), this.expressCheckoutPanel = e, this.expressCheckoutService = n, this.expressCheckoutVisibilityService = i;
    }
    async handle() {
      if (!await this.shouldShowExpressCheckoutPanel())
        return;
      if (await this.waitUntilCartOpenIfNeeded(), await this.getVariant() !== "b") {
        this.expressCheckoutPanel.destroy();
        return;
      }
      if (!await this.expressCheckoutVisibilityService.shouldShowExpressCheckout()) {
        this.expressCheckoutPanel.destroy();
        return;
      }
      this.configureCallback(), this.expressCheckoutPanel.show();
    }
    async shouldShowExpressCheckoutPanel() {
      const t = cr.EXPRESS_CHECKOUT;
      return this.appProps.storeFeaturesService.storeHas(t);
    }
    configureCallback() {
      this.expressCheckoutPanel.onExpressCheckout(async () => {
        try {
          await this.expressCheckoutService.goToExpressCheckout();
        } catch (t) {
          this.appProps.errorHandler.reportException(
            t,
            "Failed to go to express checkout"
          );
        }
      });
    }
    async getVariant() {
      const t = localStorage.getItem(
        `experiment-ab-storefront_cart-stratified-lazy-ec-${ne.getCartId()}`
      );
      return t || this.appProps.abtestUtils.getVariantForExperiment(
        "ab-storefront_cart-stratified-lazy-ec"
      );
    }
    async waitUntilCartOpenIfNeeded() {
      const t = [
        Ee.ZEN,
        Ee.NEW_LINKEDMAN,
        Ee.LUXURY,
        Ee.STYLE,
        Ee.ATLANTICO,
        Ee.BAHIA
      ];
      !ne.isPageCart() && !t.includes(ne.getThemeCode()) && await this.waitForUserToOpenCart();
    }
    async waitForUserToOpenCart() {
      return new Promise((t) => {
        const e = document.getElementById("modal-cart");
        if (!e) {
          this.appProps.errorHandler.reportError(
            "Express checkout handler: modal-cart element not found"
          ), t();
          return;
        }
        if (da.isModalVisible(e)) {
          t();
          return;
        }
        const n = new MutationObserver((i) => {
          i.forEach((s) => {
            if (s.type === "attributes") {
              const a = s.target;
              da.isModalVisible(a) && (n.disconnect(), t());
            }
          });
        });
        n.observe(e, {
          attributes: !0,
          attributeFilter: ["class", "style"]
        });
      });
    }
    static isModalVisible(t) {
      return t.classList.contains("modal-visible") || t.classList.contains("modal-show") || t.style.display === "flex";
    }
  };
  da = ik([
    yu({})
  ], da);
  const ok = da;
  class sk {
    constructor() {
      this.appProps = null, this.INIT_EVENT = "INIT", this.CART_EXISTS_EVENT = "CART_EXISTS", this.initialEventHandlers = {}, this.cartExistsEventHandlers = [], this.eventHandlers = {}, this.internalEventHandlers = {
        WALLET_ZIPCODE_FILLER_FINISHED: []
      }, this.receivedCartUpdatedEvent = !1, this.start = (e) => {
        this.appProps = e, this.createHandlers(e), this.handleCartExists(), this.publishInit(ne.getTemplate());
      }, this.subscribeToCartExists = (e) => {
        this.cartExistsEventHandlers.push(e);
      };
    }
    subscribeToInit(e, n) {
      this.initialEventHandlers[e] = [
        ...this.initialEventHandlers[e] || [],
        n
      ];
    }
    async publishInit(e, n) {
      return Promise.all(
        (this.initialEventHandlers[e] || []).map(
          (i) => i(this.INIT_EVENT, n)
        )
      );
    }
    async handleCartExists() {
      var n, i;
      return ne.isWalletExperimentTreatmentVariant() ? Promise.resolve() : ne.getCartId() ? (this.setLibCartInfo(), this.publishCartExists()) : (window.localStorage.setItem(
        "WALLET_USER_LOGGED_WHEN_CART_NOT_EXISTS",
        ((i = (n = this.appProps) == null ? void 0 : n.sessionService.isUserLogged()) == null ? void 0 : i.toString()) ?? "false"
      ), this.onCartCreationPublishCartExists());
    }
    subscribeToInternalEvent(e, n) {
      this.internalEventHandlers[e].push(n);
    }
    async publishInternalEvent(e, n) {
      return Promise.all(
        this.internalEventHandlers[e].map((i) => i(e, n))
      );
    }
    async publishCartExists() {
      return this.isBuyNowOperationInProgress() ? Promise.resolve() : Promise.all(
        this.cartExistsEventHandlers.map(
          (e) => e(this.CART_EXISTS_EVENT)
        )
      );
    }
    isBuyNowOperationInProgress() {
      var i;
      const n = (i = this.eventHandlers) == null ? void 0 : i.buyNowPanelHandler;
      return (n == null ? void 0 : n.getIsBuyNowInProgress()) ?? !1;
    }
    createHandlers(e) {
      const n = new TA(e);
      this.eventHandlers = {
        storefrontLoginHandler: new sA(e),
        cartIdentificationHandler: new cA(e),
        emailPanelHandler: new EA(e),
        emailPanelProductHandler: new FA(e),
        zipcodeFiller: n,
        zipcodeFillerProductPage: new $A(
          e,
          n
        ),
        buyNowHandler: new JA(e),
        autocompleteCartHandler: new AA(e),
        expressCheckoutHandler: new ok(e)
      };
    }
    async onCartCreationPublishCartExists() {
      return new Promise((e) => {
        window.addEventListener("cart.updated", (n) => {
          var i, s, a, u, d, f;
          (s = this.appProps) == null || s.api.registerLog("cart.updated Event fired", {
            cartId: (i = n.detail) == null ? void 0 : i.id,
            event: n.detail,
            windowLSCartId: ne.getStorefrontCartId()
          }), this.receivedCartUpdatedEvent || (this.receivedCartUpdatedEvent = !0, ne.setInitialData({
            cartId: (a = n.detail) == null ? void 0 : a.id,
            abStorefrontCartExperiments: (u = n.detail) == null ? void 0 : u.storefrontCartAbExperiments,
            token: ((d = n.detail) == null ? void 0 : d.token) ?? "",
            checkoutEnabled: ((f = n.detail) == null ? void 0 : f.checkoutEnabled) ?? !1
          }), this.setLibCartInfo(), e(this.publishCartExists()));
        });
      });
    }
    setLibCartInfo() {
      ke.setGeneralConfig({
        cartId: ne.getCartId(),
        cartHash: ne.getCartHash()
      });
    }
  }
  var Yh = { WALLET_API_URL: "https://api-wallet.tiendanube.com", WALLET_BR_API_HOST: "https://api.nuvem.com.br", WALLET_LATAM_API_HOST: "https://api.nube.com", NODE_ENV: "production", WALLET_IFRAME_URL: "https://nuvempay.nuvemshop.com.br", WALLET_LIB_AUTH_URL: "https://wallet.tiendanube.com/auth.js", LATEST_COMMIT_HASH: "2a7dc915ddb83314d33e954845a64049f00be454", BR_EXPRESS_CHECKOUT_HOST: "https://nuvem.com.br", LATAM_EXPRESS_CHECKOUT_HOST: "https://nube.com" };
  const Kh = () => (ne.getCountry() === "BR" ? Yh.WALLET_BR_API_HOST : Yh.WALLET_LATAM_API_HOST) || Yh.WALLET_API_URL;
  var ak = { WALLET_API_URL: "https://api-wallet.tiendanube.com", WALLET_BR_API_HOST: "https://api.nuvem.com.br", WALLET_LATAM_API_HOST: "https://api.nube.com", NODE_ENV: "production", WALLET_IFRAME_URL: "https://nuvempay.nuvemshop.com.br", WALLET_LIB_AUTH_URL: "https://wallet.tiendanube.com/auth.js", LATEST_COMMIT_HASH: "2a7dc915ddb83314d33e954845a64049f00be454", BR_EXPRESS_CHECKOUT_HOST: "https://nuvem.com.br", LATAM_EXPRESS_CHECKOUT_HOST: "https://nube.com" };
  const sw = "v1", Qr = class Qr {
    constructor(e) {
      this.sessionService = e;
    }
    static warn(e, n) {
      fetch(`${Kh()}/${sw}/logger`, {
        method: "POST",
        body: JSON.stringify({
          log: `[WALLET_STORE_FRONT] ${e}`,
          context: {
            ...Qr.commonContext(n)
          },
          type: "warn"
        }),
        headers: Qr.getCommonHeaders()
      });
    }
    reportError(e, n) {
      this.reportUserError(e, n);
    }
    reportException(e, n) {
      var i, s;
      if (e instanceof Gb) {
        const a = (s = (i = e.response) == null ? void 0 : i.data) == null ? void 0 : s.code;
        this.reportUserError(n ?? a ?? e.message, {
          error: JSON.stringify(e, Object.getOwnPropertyNames(e)),
          response: e.response
        });
      } else
        e instanceof Error ? this.reportUserError(n ?? e.message, {
          error: JSON.stringify(e, Object.getOwnPropertyNames(e))
        }) : this.reportUserError("unknown error", {
          error: JSON.stringify(e, Object.getOwnPropertyNames(e)),
          errorType: "constructor" in e ? e.constructor.name : "unknown type",
          name: "name" in e ? e.name : "unknown name",
          stack: "stack" in e ? e.stack : "unknown stack"
        });
    }
    reportUserError(e, n) {
      fetch(`${Kh()}/${sw}/logger/user-error`, {
        method: "POST",
        body: JSON.stringify({
          message: e,
          userData: {
            isLoggedIn: this.sessionService.isUserLogged(),
            loginType: this.sessionService.getLoginType(),
            email: this.sessionService.getEmailUserLogged() ?? ne.getLoginInputEmail()
          },
          ...Qr.commonContext(n)
        }),
        headers: Qr.getCommonHeaders()
      });
    }
  };
  Qr.commonContext = (e) => ({
    release: ak.LATEST_COMMIT_HASH,
    currentPage: window.LS.template,
    source: "storefront",
    browser: tA(),
    extraContext: {
      theme: ne.getThemeCode(),
      ...e
    }
  }), Qr.getCommonHeaders = () => {
    var e, n;
    return {
      "Accept-Language": ne.getLanguage(),
      "Content-Type": "application/json",
      "x-cart-id": ((e = ne.getCartId()) == null ? void 0 : e.toString()) ?? "",
      "x-store-id": ((n = ne.getStoreId()) == null ? void 0 : n.toString()) ?? ""
    };
  };
  let zu = Qr;
  const ei = class ei {
    set(e, n, i) {
      if (!this.localStorageIsAvailable())
        return;
      const s = Date.now() + i * 1e3, a = { value: n, expiresAt: s };
      localStorage.setItem(ei.withPrefix(e), JSON.stringify(a));
    }
    get(e) {
      if (!this.localStorageIsAvailable())
        return null;
      const n = localStorage.getItem(ei.withPrefix(e));
      if (!n)
        return null;
      const i = JSON.parse(n);
      return Date.now() > i.expiresAt ? (localStorage.removeItem(ei.withPrefix(e)), null) : i.value;
    }
    localStorageIsAvailable() {
      try {
        if (this.isAvailable !== void 0)
          return this.isAvailable;
        const e = "storageTest";
        localStorage.setItem(ei.withPrefix(e), "1"), localStorage.removeItem(e), this.isAvailable = !0;
      } catch (e) {
        zu.warn(
          "Local storage is not available so cache will not be used",
          { error: JSON.stringify(e, Object.getOwnPropertyNames(e)) }
        ), this.isAvailable = !1;
      }
      return this.isAvailable;
    }
    static withPrefix(e) {
      return `${ei.APP_PREFIX}${e}`;
    }
  };
  ei.APP_PREFIX = "wallet-";
  let Zh = ei;
  class lk {
    constructor(e) {
      this.walletApi = e;
    }
    async getVariantForExperiment(e) {
      const n = `experiment-${e}-${ne.getCartId()}`, i = localStorage.getItem(n);
      if (i)
        return Promise.resolve(i);
      try {
        const s = ne.getExperimentVariantByTag(e) ?? await this.assignVariant(e);
        return localStorage.setItem(n, s), s;
      } catch {
        return ne.AB_CONTROL_VARIANT;
      }
    }
    async assignVariant(e) {
      try {
        return await this.walletApi.getExperimentVariant(e);
      } catch {
        return ne.AB_CONTROL_VARIANT;
      }
    }
    static wasUserLoggedWhenCartCreated() {
      return window.localStorage.getItem("WALLET_USER_LOGGED_WHEN_CART_NOT_EXISTS") === "true" && !!ne.getCartId();
    }
  }
  class uk {
    constructor() {
      const e = new bL(), n = new Zh(), i = new wu(), s = new sh(e, n), a = new Bh(
        s,
        e,
        n
      ), u = new sk(), d = new zu(s), f = new OL(e, d), p = new lk(e);
      this.appProps = {
        api: e,
        sessionService: s,
        eventService: f,
        storefrontHandler: u,
        errorHandler: d,
        cacheService: n,
        storeFeaturesService: a,
        abtestUtils: p,
        storeApi: i
      };
    }
    async build() {
      return this.appProps.jquery = await window.useJquery(), this.appProps;
    }
  }
  var Vu = { WALLET_API_URL: "https://api-wallet.tiendanube.com", WALLET_BR_API_HOST: "https://api.nuvem.com.br", WALLET_LATAM_API_HOST: "https://api.nube.com", NODE_ENV: "production", WALLET_IFRAME_URL: "https://nuvempay.nuvemshop.com.br", WALLET_LIB_AUTH_URL: "https://wallet.tiendanube.com/auth.js", LATEST_COMMIT_HASH: "2a7dc915ddb83314d33e954845a64049f00be454", BR_EXPRESS_CHECKOUT_HOST: "https://nuvem.com.br", LATAM_EXPRESS_CHECKOUT_HOST: "https://nube.com" };
  class Xh {
    static async start() {
      await Xh.setLibConfig();
      const e = await new uk().build();
      try {
        await e.sessionService.loadSession(), e.storefrontHandler.start(e);
      } catch (n) {
        e.errorHandler.reportException(n);
      }
    }
    static async setLibConfig() {
      ke.setHostConfig({
        host: Kh(),
        iframeHost: Vu.WALLET_IFRAME_URL,
        nuvemshopHost: Vu.NUVEMSHOP_HOST,
        brExpressCheckoutHost: Vu.BR_EXPRESS_CHECKOUT_HOST,
        latamExpressCheckoutHost: Vu.LATAM_EXPRESS_CHECKOUT_HOST
      }), ke.setGeneralConfig({
        cartId: ne.getCartId(),
        cartHash: ne.getCartHash(),
        storeId: ne.getStoreId(),
        country: ne.getCountry(),
        language: ne.getLanguage(),
        tiendanubeSessionId: ne.getSessionData().sessionId,
        tiendanubeConsumerId: ne.getSessionData().customerId,
        storeName: ne.getStoreName(),
        storeLogo: "",
        storeUrl: ne.getStoreUrl(),
        returnUrl: "",
        source: "storefront-login",
        sendFingerprint: !0
      }), await ke.init();
    }
  }
  (async function() {
    await Xh.start();
  })();
})(JP);